NZ194269A - Preparation of 2,3-dichloro-4-(hydroxybenzoyl)-phenoxyacetic acid derivatives - Google Patents
Preparation of 2,3-dichloro-4-(hydroxybenzoyl)-phenoxyacetic acid derivativesInfo
- Publication number
- NZ194269A NZ194269A NZ194269A NZ19426980A NZ194269A NZ 194269 A NZ194269 A NZ 194269A NZ 194269 A NZ194269 A NZ 194269A NZ 19426980 A NZ19426980 A NZ 19426980A NZ 194269 A NZ194269 A NZ 194269A
- Authority
- NZ
- New Zealand
- Prior art keywords
- hydroxybenzoyl
- dichloro
- preparation
- acid derivatives
- phenoxyacetic acid
- Prior art date
Links
- DSYOCFBXKYFILI-UHFFFAOYSA-N 2-[2,3-dichloro-4-(2-hydroxybenzoyl)phenoxy]acetic acid Chemical class ClC1=C(Cl)C(OCC(=O)O)=CC=C1C(=O)C1=CC=CC=C1O DSYOCFBXKYFILI-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/059,823 US4220801A (en) | 1979-07-23 | 1979-07-23 | Process for making 4-aroyl-substituted phenoxyacetic acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ194269A true NZ194269A (en) | 1982-05-25 |
Family
ID=22025500
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ194269A NZ194269A (en) | 1979-07-23 | 1980-07-08 | Preparation of 2,3-dichloro-4-(hydroxybenzoyl)-phenoxyacetic acid derivatives |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4220801A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5620543A (cg-RX-API-DMAC10.html) |
| AU (1) | AU534570B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE884414A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1137997A (cg-RX-API-DMAC10.html) |
| CH (1) | CH644344A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE3027765A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES493563A0 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2461694A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2055817A (cg-RX-API-DMAC10.html) |
| GR (1) | GR69715B (cg-RX-API-DMAC10.html) |
| IT (1) | IT1132221B (cg-RX-API-DMAC10.html) |
| NL (1) | NL8004211A (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ194269A (cg-RX-API-DMAC10.html) |
| PH (1) | PH15325A (cg-RX-API-DMAC10.html) |
| SE (1) | SE434512B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA804134B (cg-RX-API-DMAC10.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR75464B (cg-RX-API-DMAC10.html) * | 1981-04-24 | 1984-07-20 | Ciba Geigy |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4069344A (en) * | 1972-05-10 | 1978-01-17 | Ciba-Geigy Corporation | Insecticidal substituted phenyl derivatives |
| JPS5195049A (en) * | 1975-02-12 | 1976-08-20 | * **********so*****no***tsu*****************************************ni*no | |
| US4058559A (en) * | 1975-09-24 | 1977-11-15 | Abbott Laboratories | 4-Aroyl-substituted phenoxy acetic acids |
-
1979
- 1979-07-23 US US06/059,823 patent/US4220801A/en not_active Expired - Lifetime
-
1980
- 1980-07-03 CA CA000355311A patent/CA1137997A/en not_active Expired
- 1980-07-08 NZ NZ194269A patent/NZ194269A/xx unknown
- 1980-07-08 GB GB8022301A patent/GB2055817A/en not_active Withdrawn
- 1980-07-09 PH PH24259A patent/PH15325A/en unknown
- 1980-07-09 ZA ZA00804134A patent/ZA804134B/xx unknown
- 1980-07-11 AU AU60344/80A patent/AU534570B2/en not_active Ceased
- 1980-07-16 SE SE8005205A patent/SE434512B/sv unknown
- 1980-07-19 GR GR62504A patent/GR69715B/el unknown
- 1980-07-21 ES ES493563A patent/ES493563A0/es active Granted
- 1980-07-22 BE BE0/201481A patent/BE884414A/fr not_active IP Right Cessation
- 1980-07-22 JP JP9945080A patent/JPS5620543A/ja active Pending
- 1980-07-22 DE DE19803027765 patent/DE3027765A1/de not_active Withdrawn
- 1980-07-22 FR FR8016152A patent/FR2461694A1/fr active Granted
- 1980-07-22 NL NL8004211A patent/NL8004211A/nl not_active Application Discontinuation
- 1980-07-22 IT IT23618/80A patent/IT1132221B/it active
- 1980-07-22 CH CH560080A patent/CH644344A5/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU6034480A (en) | 1981-01-29 |
| SE434512B (sv) | 1984-07-30 |
| CA1137997A (en) | 1982-12-21 |
| DE3027765A1 (de) | 1981-02-19 |
| JPS5620543A (en) | 1981-02-26 |
| GB2055817A (en) | 1981-03-11 |
| CH644344A5 (fr) | 1984-07-31 |
| BE884414A (fr) | 1981-01-22 |
| ES8106691A1 (es) | 1981-09-01 |
| FR2461694B1 (cg-RX-API-DMAC10.html) | 1983-04-01 |
| IT8023618A0 (it) | 1980-07-22 |
| ES493563A0 (es) | 1981-09-01 |
| AU534570B2 (en) | 1984-02-09 |
| NL8004211A (nl) | 1981-01-27 |
| FR2461694A1 (fr) | 1981-02-06 |
| GR69715B (cg-RX-API-DMAC10.html) | 1982-07-09 |
| ZA804134B (en) | 1981-07-29 |
| SE8005205L (sv) | 1981-01-24 |
| PH15325A (en) | 1982-11-24 |
| IT1132221B (it) | 1986-06-25 |
| US4220801A (en) | 1980-09-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU532217B2 (en) | Preparation of 4,1:,6:-tricholoro-4,1:,6: -trideoxy - galactosucrose | |
| IL51643A0 (en) | Novel 4,5-dichloroimidazole-2-carboxylic acid derivatives their preparation and their use as pesticides | |
| GB2034307B (en) | Preparation of 1,1-diesters | |
| NZ191462A (en) | Derivatives of 2 ,16 -bis-piperidino-3 -hydroxy-5 -androstane-3 -esters | |
| IL60546A (en) | Preparation of 2,6-dialkylcyclohexylamines | |
| ZA792773B (en) | Derivatives of 4,5-dihydro-4-oxofuran-2-carboxylic acid | |
| IL57591A0 (en) | The preparation of chlorostyryl-cyclopropane carboxylic acid derivatives | |
| AU532840B2 (en) | Preparation of 2:,6:-n-alkoxymethyl-2-chloro-acetanilides | |
| IL59760A (en) | Method for the preparation of 7-oxo-4-thia-1-aza-bicyclo(3,2,0)-heptane-2-carboxylic acid derivatives | |
| IL65568A0 (en) | Preparation of 4-amino-3,5,6-trichloropicolinic acid | |
| AU527930B2 (en) | 1,3,4-thiadiazole-2-carboxylic acid derivatives | |
| NZ194269A (en) | Preparation of 2,3-dichloro-4-(hydroxybenzoyl)-phenoxyacetic acid derivatives | |
| IL60440A0 (en) | Preparation of cyclopropane-carboxylic acid derivatives,new intermediate products used therein and their preparation | |
| GB2058775B (en) | Preparation of 2,5-diketogluconic acid | |
| DE2961465D1 (en) | Process for the preparation of 3,3-dimethyl-2-oxo-butanoic acid | |
| GB2012266B (en) | 1,5 - cyclohexadienecarbocylic acid derivatives | |
| DE3069461D1 (en) | 1,2,4-benzotriazinylaminophenoxyalkane carboxylic acid derivatives, processes for their preparation and their use as herbicides | |
| IL60633A (en) | Preparation of 1,1-dichloroalkenes | |
| IL60630A0 (en) | Preparation of 3-(2,2-dichlorovinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid derivatives | |
| AU515571B2 (en) | Preparation of cyclo-1,3,2-oxazaphosphoryl derivatives | |
| GB2093018B (en) | 6,8-difluoro-quinoline carboxylic acid derivatives | |
| IL56255A0 (en) | Substituted 1,4-cychlohexadiene carboxylic acid derivatives | |
| ZA793907B (en) | Salts of 2,3-dichloro-4-(4-hydroxybenzoyl)phenoxyacetic acid | |
| AU519340B2 (en) | Preparation of 2,5-diketogluconic acid | |
| GB2044768B (en) | Preparation of 1,1,1,4,4,4,-hexofluorobutyne |