NZ190820A - Stabilised radiographic scanning agents;water-soluble stannous gentisylate - Google Patents
Stabilised radiographic scanning agents;water-soluble stannous gentisylateInfo
- Publication number
- NZ190820A NZ190820A NZ190820A NZ19082079A NZ190820A NZ 190820 A NZ190820 A NZ 190820A NZ 190820 A NZ190820 A NZ 190820A NZ 19082079 A NZ19082079 A NZ 19082079A NZ 190820 A NZ190820 A NZ 190820A
- Authority
- NZ
- New Zealand
- Prior art keywords
- composition according
- gentisol
- stabilizer
- pertechnetate
- acid
- Prior art date
Links
- PUZSUVGRVHEUQO-UHFFFAOYSA-N gentisyl alcohol Chemical compound OCC1=CC(O)=CC=C1O PUZSUVGRVHEUQO-UHFFFAOYSA-N 0.000 claims description 81
- 239000000203 mixture Substances 0.000 claims description 62
- 239000003795 chemical substances by application Substances 0.000 claims description 59
- 150000003839 salts Chemical class 0.000 claims description 46
- 239000002253 acid Substances 0.000 claims description 42
- 239000003381 stabilizer Substances 0.000 claims description 39
- 239000003638 chemical reducing agent Substances 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 34
- 239000000243 solution Substances 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 22
- 150000002148 esters Chemical class 0.000 claims description 20
- 210000000056 organ Anatomy 0.000 claims description 20
- 229910052713 technetium Inorganic materials 0.000 claims description 18
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 claims description 18
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 16
- 235000011150 stannous chloride Nutrition 0.000 claims description 16
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 claims description 14
- 239000001119 stannous chloride Substances 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 13
- 159000000000 sodium salts Chemical group 0.000 claims description 8
- GKLVYJBZJHMRIY-OUBTZVSYSA-N Technetium-99 Chemical compound [99Tc] GKLVYJBZJHMRIY-OUBTZVSYSA-N 0.000 claims description 7
- 230000002285 radioactive effect Effects 0.000 claims description 7
- 229940056501 technetium 99m Drugs 0.000 claims description 7
- 229910052816 inorganic phosphate Inorganic materials 0.000 claims description 6
- 230000000087 stabilizing effect Effects 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 5
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical compound OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 4
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 claims description 3
- 229940109126 chromous chloride Drugs 0.000 claims description 3
- ACSIXWWBWUQEHA-UHFFFAOYSA-N clodronic acid Chemical compound OP(O)(=O)C(Cl)(Cl)P(O)(O)=O ACSIXWWBWUQEHA-UHFFFAOYSA-N 0.000 claims description 3
- 239000011790 ferrous sulphate Substances 0.000 claims description 3
- 235000003891 ferrous sulphate Nutrition 0.000 claims description 3
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims description 3
- 229910000359 iron(II) sulfate Inorganic materials 0.000 claims description 3
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 claims description 2
- 238000004108 freeze drying Methods 0.000 claims description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 claims description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 claims description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 claims description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims description 2
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- 210000000988 bone and bone Anatomy 0.000 description 19
- -1 carboxylate esters Chemical class 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 12
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 9
- 239000011591 potassium Substances 0.000 description 9
- 229910052700 potassium Inorganic materials 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 239000004615 ingredient Substances 0.000 description 7
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 6
- 235000011180 diphosphates Nutrition 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 229940048084 pyrophosphate Drugs 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 210000004872 soft tissue Anatomy 0.000 description 5
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 5
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 230000002452 interceptive effect Effects 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 150000004707 phenolate Chemical class 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 230000008685 targeting Effects 0.000 description 3
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 2
- RHWUIRMVPYNGIV-UHFFFAOYSA-N 1,3,4-triphosphonobutan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O RHWUIRMVPYNGIV-UHFFFAOYSA-N 0.000 description 2
- SXGRAKNNKBAFML-UHFFFAOYSA-N 1,3-diphosphonopropan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)CP(O)(O)=O SXGRAKNNKBAFML-UHFFFAOYSA-N 0.000 description 2
- LJHKZAQSNTWOLY-UHFFFAOYSA-N 1-[bis(1-phosphonopentyl)amino]pentylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)N(C(CCCC)P(O)(O)=O)C(CCCC)P(O)(O)=O LJHKZAQSNTWOLY-UHFFFAOYSA-N 0.000 description 2
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 2
- 229940072107 ascorbate Drugs 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000007469 bone scintigraphy Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- GBHRVZIGDIUCJB-UHFFFAOYSA-N hydrogenphosphite Chemical class OP([O-])[O-] GBHRVZIGDIUCJB-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical class OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000003608 radiolysis reaction Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000010405 reoxidation reaction Methods 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- ZWVMLYRJXORSEP-LURJTMIESA-N (2s)-hexane-1,2,6-triol Chemical compound OCCCC[C@H](O)CO ZWVMLYRJXORSEP-LURJTMIESA-N 0.000 description 1
- DFTADKFLALRADR-UHFFFAOYSA-N (3,3,4,4,5,5-hexafluoro-2-phosphonocyclopenten-1-yl)phosphonic acid Chemical compound OP(O)(=O)C1=C(P(O)(O)=O)C(F)(F)C(F)(F)C1(F)F DFTADKFLALRADR-UHFFFAOYSA-N 0.000 description 1
- HPACKUSWEBMYJE-UHFFFAOYSA-N 1,2,3,5,6,7,8-heptaphosphonooctan-4-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O HPACKUSWEBMYJE-UHFFFAOYSA-N 0.000 description 1
- XWFHTVUSIQXPJR-UHFFFAOYSA-N 1,2,3,5,6,7-hexaphosphonoheptan-4-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O XWFHTVUSIQXPJR-UHFFFAOYSA-N 0.000 description 1
- CCSPRGDNSSMNIH-UHFFFAOYSA-N 1,2,4,5,6-pentaphosphonohexan-3-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O CCSPRGDNSSMNIH-UHFFFAOYSA-N 0.000 description 1
- UWOPXOPPISBKGY-UHFFFAOYSA-N 1,2,4,5-tetraphosphonopentan-3-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O UWOPXOPPISBKGY-UHFFFAOYSA-N 0.000 description 1
- YVPHSTVRTGSOSK-UHFFFAOYSA-N 1,3,3-triphosphonopropylphosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)CC(P(O)(O)=O)P(O)(O)=O YVPHSTVRTGSOSK-UHFFFAOYSA-N 0.000 description 1
- JEZUNPWQNIOAAC-UHFFFAOYSA-N 1-[bis(1-phosphonoethyl)amino]ethylphosphonic acid Chemical compound OP(=O)(O)C(C)N(C(C)P(O)(O)=O)C(C)P(O)(O)=O JEZUNPWQNIOAAC-UHFFFAOYSA-N 0.000 description 1
- HFDKJNXFZSYGLU-UHFFFAOYSA-N 1-phosphonododecylphosphonic acid Chemical compound CCCCCCCCCCCC(P(O)(O)=O)P(O)(O)=O HFDKJNXFZSYGLU-UHFFFAOYSA-N 0.000 description 1
- CCBUTSCPNFSHKC-UHFFFAOYSA-N 1-phosphonohexadecylphosphonic acid Chemical compound CCCCCCCCCCCCCCCC(P(O)(O)=O)P(O)(O)=O CCBUTSCPNFSHKC-UHFFFAOYSA-N 0.000 description 1
- OZKFUXZUWPRXHB-UHFFFAOYSA-N 1-phosphonononylphosphonic acid Chemical compound CCCCCCCCC(P(O)(O)=O)P(O)(O)=O OZKFUXZUWPRXHB-UHFFFAOYSA-N 0.000 description 1
- ROKLPPRTPHAGFK-UHFFFAOYSA-N 1-phosphonooctylphosphonic acid Chemical compound CCCCCCCC(P(O)(O)=O)P(O)(O)=O ROKLPPRTPHAGFK-UHFFFAOYSA-N 0.000 description 1
- GIXFALHDORQSOQ-UHFFFAOYSA-N 2,4,6,8-tetrahydroxy-1,3,5,7,2$l^{5},4$l^{5},6$l^{5},8$l^{5}-tetraoxatetraphosphocane 2,4,6,8-tetraoxide Chemical compound OP1(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)O1 GIXFALHDORQSOQ-UHFFFAOYSA-N 0.000 description 1
- VUITVRLCDCMTNK-UHFFFAOYSA-N 2-[bis(2-phosphonopropan-2-yl)amino]propan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)N(C(C)(C)P(O)(O)=O)C(C)(C)P(O)(O)=O VUITVRLCDCMTNK-UHFFFAOYSA-N 0.000 description 1
- HSVLGQVUNHEEGH-UHFFFAOYSA-N 2-phosphonopentan-2-ylphosphonic acid Chemical compound CCCC(C)(P(O)(O)=O)P(O)(O)=O HSVLGQVUNHEEGH-UHFFFAOYSA-N 0.000 description 1
- ROPQINLWRARCTM-UHFFFAOYSA-N 2-phosphonopropan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)P(O)(O)=O ROPQINLWRARCTM-UHFFFAOYSA-N 0.000 description 1
- RBJBFHZUIPIEJX-UHFFFAOYSA-N 5-phosphonononan-5-ylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)(P(O)(O)=O)CCCC RBJBFHZUIPIEJX-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- ZSIMTUICJBOSTH-UHFFFAOYSA-N C1(=CC=CC=C1)P(=O)(O)OP(=O)O.C Chemical compound C1(=CC=CC=C1)P(=O)(O)OP(=O)O.C ZSIMTUICJBOSTH-UHFFFAOYSA-N 0.000 description 1
- WEZACEWXLNNNIR-UHFFFAOYSA-N C1CCC(=C(C1)P(=O)(O)O)P(=O)(O)O Chemical compound C1CCC(=C(C1)P(=O)(O)O)P(=O)(O)O WEZACEWXLNNNIR-UHFFFAOYSA-N 0.000 description 1
- GUKVNKNOQUXYKM-UHFFFAOYSA-N CCCN.OP(=O)OP(O)=O Chemical class CCCN.OP(=O)OP(O)=O GUKVNKNOQUXYKM-UHFFFAOYSA-N 0.000 description 1
- 208000004434 Calcinosis Diseases 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HWZUDASOMGNLSM-UHFFFAOYSA-N O=P1OCOP(=O)O1 Chemical compound O=P1OCOP(=O)O1 HWZUDASOMGNLSM-UHFFFAOYSA-N 0.000 description 1
- 241000228127 Penicillium griseofulvum Species 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- FRCICXIVPRNPLM-UHFFFAOYSA-N [amino(phosphono)methyl]phosphonic acid Chemical compound OP(=O)(O)C(N)P(O)(O)=O FRCICXIVPRNPLM-UHFFFAOYSA-N 0.000 description 1
- VOCLSHIYPGYWJW-UHFFFAOYSA-N [dihydroxy(phosphono)methyl]phosphonic acid Chemical compound OP(=O)(O)C(O)(O)P(O)(O)=O VOCLSHIYPGYWJW-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 1
- XABJJJZIQNZSIM-UHFFFAOYSA-N azane;phenol Chemical class [NH4+].[O-]C1=CC=CC=C1 XABJJJZIQNZSIM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 230000002308 calcification Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229960002286 clodronic acid Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 229940039227 diagnostic agent Drugs 0.000 description 1
- 239000000032 diagnostic agent Substances 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229960005219 gentisic acid Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012216 imaging agent Substances 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000001455 metallic ions Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940102859 methylene diphosphonate Drugs 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical class NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012857 radioactive material Substances 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/025—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus inorganic Tc complexes or compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/04—Organic compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/12—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by a special physical form, e.g. emulsion, microcapsules, liposomes, characterized by a special physical form, e.g. emulsions, dispersions, microcapsules
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2123/00—Preparations for testing in vivo
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Epidemiology (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Optics & Photonics (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Physics & Mathematics (AREA)
- Public Health (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Inorganic Chemistry (AREA)
- Dispersion Chemistry (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Investigating Or Analysing Biological Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/920,082 US4232000A (en) | 1978-06-28 | 1978-06-28 | Radioactive scanning agents with stabilizer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ190820A true NZ190820A (en) | 1986-07-11 |
Family
ID=25443124
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ190820A NZ190820A (en) | 1978-06-28 | 1979-06-25 | Stabilised radiographic scanning agents;water-soluble stannous gentisylate |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4232000A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0006659B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5536796A (cg-RX-API-DMAC7.html) |
| AU (1) | AU521704B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1118683A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2962552D1 (cg-RX-API-DMAC7.html) |
| IE (1) | IE48766B1 (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ190820A (cg-RX-API-DMAC7.html) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4432963A (en) * | 1978-07-31 | 1984-02-21 | Mallinckrodt, Inc. | Radiographic scanning agent |
| US4515766A (en) * | 1980-06-23 | 1985-05-07 | The Massachusetts General Hospital | Labeled phosphonic acid compositions for investigations of in vivo deposits of calcium |
| JPS5750928A (en) * | 1980-09-13 | 1982-03-25 | Nippon Mejifuijitsukusu Kk | Diagnostic agent for scanning bone |
| DE78642T1 (de) * | 1981-10-30 | 1983-10-27 | Amersham International Plc, Amersham, Buckinghamshire | Radiopharmazeutische zubereitung auf grund von technetium-99m und reagenz zur herstellung derselben. |
| JPS5896031A (ja) * | 1981-12-03 | 1983-06-07 | Nippon Mejifuijitsukusu Kk | 放射性診断剤およびその製造用組成物 |
| ATE26071T1 (de) | 1982-06-10 | 1987-04-15 | Mallinckrodt Inc | Roentgen-sichtbarmachungsmittel. |
| US4707353A (en) * | 1982-12-08 | 1987-11-17 | Mallinckrodt, Inc. | Radiographic imaging agents |
| US4510125A (en) * | 1982-12-08 | 1985-04-09 | Mallinckrodt, Inc. | Process for making lyophilized radiographic imaging kit |
| US5175343A (en) * | 1985-01-14 | 1992-12-29 | Neorx Corporation | Metal radionuclide labeled proteins for diagnosis and therapy |
| US4897255A (en) * | 1985-01-14 | 1990-01-30 | Neorx Corporation | Metal radionuclide labeled proteins for diagnosis and therapy |
| US4853209A (en) * | 1987-05-18 | 1989-08-01 | The Dow Chemical Company | Bone marrow suppressing agents |
| US5355245A (en) * | 1988-02-12 | 1994-10-11 | Donnelly Corporation | Ultraviolet protected electrochemichromic rearview mirror |
| US5202451A (en) * | 1988-02-17 | 1993-04-13 | Neorx Corporation | Anchimeric radiometal chelating compounds |
| EP0430968B1 (en) * | 1988-05-02 | 1996-11-20 | PHANOS TECHNOLOGIES, Inc. | Compounds, compositions and method for binding bio-affecting substances to surface membranes of bio-particles |
| WO1991004057A1 (en) * | 1989-09-22 | 1991-04-04 | Neorx Corporation | Stable therapeutic radionuclide compositions and methods for preparation thereof |
| CA2113995C (en) * | 1991-08-29 | 2003-04-22 | Edward A. Deutsch | Use of gentisic acid or gentisyl alcohol for stabilising radiolabeled peptides and proteins |
| US6359119B1 (en) | 2000-05-24 | 2002-03-19 | Mallinckrodt Inc. | Formulation of Tc and Re carbonyl complexes using stannous ion as the reductant for pertechnetate and perrhenate |
| US6881396B2 (en) * | 2000-10-24 | 2005-04-19 | Diatide, Inc. | Stabilization of radiopharmaceutical compositions using hydrophilic 6-hydroxy-chromans |
| US6989138B2 (en) | 2000-10-24 | 2006-01-24 | Diatide, Inc. | Stabilization of radiopharmaceutical compositions using hydrophilic thioethers and hydrophilic 6-hydroxy chromans |
| US6902718B2 (en) * | 2000-10-24 | 2005-06-07 | Diatide, Inc. | Stabilization of radiopharmaceutical compositions using hydrophilic thioethers |
| US7018614B2 (en) | 2002-11-05 | 2006-03-28 | Eastern Isotopes, Inc. | Stabilization of radiopharmaceuticals labeled with 18-F |
| US20070269375A1 (en) * | 2003-07-24 | 2007-11-22 | Bracco Imaging S.P.A. | Stable Radiopharmaceutical Compositions and Methods for Preparation |
| JP4844471B2 (ja) | 2007-05-14 | 2011-12-28 | 株式会社ジェイテクト | 十字軸継手 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091088A (en) * | 1975-02-19 | 1978-05-23 | Australian Atomic Energy Commission | Phenolic amino-carboxylic acid complexes for forming radiopharmaceuticals |
| US4062933A (en) * | 1975-05-27 | 1977-12-13 | Mallinckrodt, Inc. | Colloidal compositions with protective agents suitable for radioactive labeling |
| DE2543349C2 (de) * | 1975-09-29 | 1984-05-10 | Henkel KGaA, 4000 Düsseldorf | Preaparate zur herstellung von99m technetium-radiagnostica |
| DE2543350C2 (de) * | 1975-09-29 | 1984-10-11 | Henkel KGaA, 4000 Düsseldorf | Präparate zur Herstellung von ↑9↑↑9↑↑m↑ Technetium-Radiodiagnostika |
| US4071613A (en) * | 1976-02-26 | 1978-01-31 | Abbott Laboratories | Stabilized alcohol solution of reducing salt formulations for use in preparing radioisotope labeled scanning agents: liver scanning technetium-99m colloid and method of preparation |
-
1978
- 1978-06-28 US US05/920,082 patent/US4232000A/en not_active Expired - Lifetime
-
1979
- 1979-06-18 DE DE7979200316T patent/DE2962552D1/de not_active Expired
- 1979-06-18 EP EP79200316A patent/EP0006659B1/en not_active Expired
- 1979-06-25 NZ NZ190820A patent/NZ190820A/en unknown
- 1979-06-27 AU AU48459/79A patent/AU521704B2/en not_active Expired
- 1979-06-27 CA CA000330719A patent/CA1118683A/en not_active Expired
- 1979-06-28 JP JP8198379A patent/JPS5536796A/ja active Granted
- 1979-08-08 IE IE1204/79A patent/IE48766B1/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CA1118683A (en) | 1982-02-23 |
| EP0006659B1 (en) | 1982-04-21 |
| AU4845979A (en) | 1980-01-03 |
| US4232000A (en) | 1980-11-04 |
| JPS636528B2 (cg-RX-API-DMAC7.html) | 1988-02-10 |
| JPS5536796A (en) | 1980-03-14 |
| EP0006659A1 (en) | 1980-01-09 |
| IE791204L (en) | 1979-12-28 |
| AU521704B2 (en) | 1982-04-22 |
| IE48766B1 (en) | 1985-05-15 |
| DE2962552D1 (en) | 1982-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4229427A (en) | Radioactive scanning agents with hydroquinone stabilizer | |
| EP0004684B1 (en) | Stabilized radiographic scanning agents and method for preparing them | |
| US4232000A (en) | Radioactive scanning agents with stabilizer | |
| US4247534A (en) | Radiographic scanning agent | |
| EP0096930B1 (en) | Stable radiographic imaging agents | |
| US3983227A (en) | Dry mixture containing diphosphonates and a stannous salt useful in the preparation of Tc99M containing bone scanning agents | |
| US4497744A (en) | Gentisic acid salts as radiographic scanning agent stabilizers | |
| IE43086B1 (en) | Stable radiographic scannin agents | |
| US4234562A (en) | Radiographic scanning | |
| EP0096931B1 (en) | Radiographic imaging agents | |
| US4432963A (en) | Radiographic scanning agent | |
| Fawzi | Radioactive scanning agents with stabilizer | |
| Gawzi | Stabilised radiographic scanning agents | |
| JPH0513930B2 (cg-RX-API-DMAC7.html) | ||
| Bevan | Radiographic scanning agent | |
| CA1157033A (en) | Radiographic scanning agent | |
| NZ209953A (en) | 99m technetatemethanehydroxydiphosphonate |