NZ180109A - 2-(indolin-1-yl)-guanidine compounds and pharmaceutical compositions - Google Patents
2-(indolin-1-yl)-guanidine compounds and pharmaceutical compositionsInfo
- Publication number
- NZ180109A NZ180109A NZ180109A NZ18010976A NZ180109A NZ 180109 A NZ180109 A NZ 180109A NZ 180109 A NZ180109 A NZ 180109A NZ 18010976 A NZ18010976 A NZ 18010976A NZ 180109 A NZ180109 A NZ 180109A
- Authority
- NZ
- New Zealand
- Prior art keywords
- indolin
- pharmaceutical compositions
- guanidine compounds
- guanidine
- compounds
- Prior art date
Links
- BRSYLRPPQIAFQU-UHFFFAOYSA-N 2-(2,3-dihydroindol-1-yl)guanidine Chemical class C1=CC=C2N(NC(=N)N)CCC2=C1 BRSYLRPPQIAFQU-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Peptides Or Proteins (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH244075A CH613691A5 (en) | 1975-02-26 | 1975-02-26 | Process for the preparation of novel 1-indolinylguanidine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ180109A true NZ180109A (en) | 1978-06-20 |
Family
ID=4233860
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ180109A NZ180109A (en) | 1975-02-26 | 1976-02-24 | 2-(indolin-1-yl)-guanidine compounds and pharmaceutical compositions |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS51110562A (en:Method) |
| AT (1) | AT358062B (en:Method) |
| AU (1) | AU505134B2 (en:Method) |
| BE (1) | BE838903A (en:Method) |
| CA (1) | CA1071640A (en:Method) |
| CH (1) | CH613691A5 (en:Method) |
| DD (1) | DD123883A5 (en:Method) |
| DE (1) | DE2605981A1 (en:Method) |
| DK (1) | DK62676A (en:Method) |
| ES (1) | ES445477A1 (en:Method) |
| FI (1) | FI760385A7 (en:Method) |
| FR (1) | FR2302090A1 (en:Method) |
| GB (1) | GB1531611A (en:Method) |
| IE (1) | IE42644B1 (en:Method) |
| IL (1) | IL49097A (en:Method) |
| NL (1) | NL7601728A (en:Method) |
| NO (1) | NO760537L (en:Method) |
| NZ (1) | NZ180109A (en:Method) |
| PT (1) | PT64838B (en:Method) |
| SE (1) | SE411119B (en:Method) |
| SU (1) | SU655307A3 (en:Method) |
| YU (1) | YU47076A (en:Method) |
| ZA (1) | ZA761155B (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2737064A1 (de) * | 1976-08-27 | 1978-03-09 | Sandoz Ag | Indolin-1-ylguanidin-derivate, ihre verwendung und herstellung |
| JP4943715B2 (ja) * | 2006-02-27 | 2012-05-30 | 株式会社タダノ | 移動式クレーンのカウンタウエイト装置 |
-
1975
- 1975-02-26 CH CH244075A patent/CH613691A5/xx not_active IP Right Cessation
-
1976
- 1976-02-14 DE DE19762605981 patent/DE2605981A1/de not_active Ceased
- 1976-02-17 FI FI760385A patent/FI760385A7/fi not_active Application Discontinuation
- 1976-02-17 DK DK62676*#A patent/DK62676A/da not_active Application Discontinuation
- 1976-02-18 NO NO760537A patent/NO760537L/no unknown
- 1976-02-19 SE SE7602000A patent/SE411119B/xx unknown
- 1976-02-20 NL NL7601728A patent/NL7601728A/xx unknown
- 1976-02-23 GB GB7002/76A patent/GB1531611A/en not_active Expired
- 1976-02-24 ES ES445477A patent/ES445477A1/es not_active Expired
- 1976-02-24 IL IL49097A patent/IL49097A/xx unknown
- 1976-02-24 PT PT64838A patent/PT64838B/pt unknown
- 1976-02-24 NZ NZ180109A patent/NZ180109A/xx unknown
- 1976-02-24 DD DD191457A patent/DD123883A5/xx unknown
- 1976-02-24 FR FR7605036A patent/FR2302090A1/fr active Granted
- 1976-02-24 CA CA246,492A patent/CA1071640A/en not_active Expired
- 1976-02-24 BE BE164609A patent/BE838903A/xx unknown
- 1976-02-25 JP JP51019038A patent/JPS51110562A/ja active Pending
- 1976-02-25 IE IE371/76A patent/IE42644B1/en unknown
- 1976-02-25 YU YU00470/76A patent/YU47076A/xx unknown
- 1976-02-25 AT AT136476A patent/AT358062B/de not_active IP Right Cessation
- 1976-02-25 SU SU762324510A patent/SU655307A3/ru active
- 1976-02-26 ZA ZA761155A patent/ZA761155B/xx unknown
- 1976-02-26 AU AU11461/76A patent/AU505134B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2302090B1 (en:Method) | 1979-09-21 |
| IE42644L (en) | 1976-08-26 |
| JPS51110562A (en:Method) | 1976-09-30 |
| NL7601728A (nl) | 1976-08-30 |
| YU47076A (en) | 1982-02-28 |
| FI760385A7 (en:Method) | 1976-08-27 |
| AU505134B2 (en) | 1979-11-08 |
| DK62676A (da) | 1976-08-27 |
| ATA136476A (de) | 1980-01-15 |
| SE411119B (sv) | 1979-12-03 |
| NO760537L (en:Method) | 1976-08-27 |
| IE42644B1 (en) | 1980-09-24 |
| ZA761155B (en) | 1977-09-28 |
| SE7602000L (sv) | 1976-08-27 |
| GB1531611A (en) | 1978-11-08 |
| AU1146176A (en) | 1977-09-01 |
| AT358062B (de) | 1980-08-25 |
| PT64838B (fr) | 1977-09-06 |
| DD123883A5 (en:Method) | 1977-01-19 |
| FR2302090A1 (fr) | 1976-09-24 |
| ES445477A1 (es) | 1977-10-16 |
| IL49097A (en) | 1979-01-31 |
| CA1071640A (en) | 1980-02-12 |
| IL49097A0 (en) | 1976-04-30 |
| BE838903A (fr) | 1976-08-24 |
| CH613691A5 (en) | 1979-10-15 |
| PT64838A (pt) | 1976-03-01 |
| DE2605981A1 (de) | 1976-09-09 |
| SU655307A3 (ru) | 1979-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA7671B (en) | Pharmaceutical composition | |
| NZ182011A (en) | N- -haolethyl (or hydroxyethyl)-nortropine benzilates salts and pharmaceutical compositions | |
| NZ181726A (en) | Pyrrolidine derivatives and pharmaceutical compositions | |
| JPS5272829A (en) | Pharmaceutical composition | |
| NZ180529A (en) | Erythromyc-9-yl-amine derivatives and pharmaceutical compositions | |
| GB1524578A (en) | Aminobenzoamide compounds and pharmaceutical compositions containing them | |
| NZ181010A (en) | Heteroaryl compounds and pharmaceutical compositions | |
| NZ182665A (en) | Amine derivatives and pharmaceutical compositions | |
| ZA763917B (en) | Pharmaceutical compositions and compounds | |
| KE3219A (en) | Pharmaceutical compositions | |
| NZ181503A (en) | Substituted diphenyls-ulphides and pharmaceutical compositions | |
| AU507272B2 (en) | Pharmaceutical compositions and compounds | |
| PH13912A (en) | Substituted benzamide derivatives and pharmaceutical compositions thereof | |
| NZ182161A (en) | Alkoxy-pyridine-carobxamide derivatives and pharmaceutical compositions | |
| ZA766663B (en) | Novel heterocyclic compounds and pharmaceutical composition containing them | |
| NZ184808A (en) | Heterocyclic compounds and pharmaceutical compositions | |
| NZ181727A (en) | Pyrroline-2-one derivatives and pharmaceutical compositions | |
| NZ181401A (en) | 2-benzopyranone derivatives and pharmaceutical compositions | |
| JPS5285126A (en) | Novel phenetylamine derivatives* salts thereof and pharmaceutical composition | |
| NZ180109A (en) | 2-(indolin-1-yl)-guanidine compounds and pharmaceutical compositions | |
| NZ180863A (en) | 3,5-bisoxygenated 2-(w-halo-3-oxygenated-1-alkenyl)-cyclopentane-1-heptanoic acid derivatives and pharmaceutical compositions | |
| NZ181146A (en) | Benzocycloheptathiophene derivatives and pharmaceutical compositions | |
| ZA761880B (en) | New pharmaceutical compositions | |
| ZA767215B (en) | Pharmaceutical compositions | |
| IE42772L (en) | Pharmaceutical compositions |