NO783631L - Fremgangsmaate til fremstilling av n,n-bis-(2-hydroksyalkyl)-aminometanfosfonsyre-dimetylester - Google Patents
Fremgangsmaate til fremstilling av n,n-bis-(2-hydroksyalkyl)-aminometanfosfonsyre-dimetylesterInfo
- Publication number
- NO783631L NO783631L NO783631A NO783631A NO783631L NO 783631 L NO783631 L NO 783631L NO 783631 A NO783631 A NO 783631A NO 783631 A NO783631 A NO 783631A NO 783631 L NO783631 L NO 783631L
- Authority
- NO
- Norway
- Prior art keywords
- mol
- acid
- bis
- reaction
- hydroxyalkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 17
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 238000002360 preparation method Methods 0.000 title claims abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 title abstract description 3
- 239000002253 acid Substances 0.000 title description 11
- 150000001875 compounds Chemical class 0.000 claims description 17
- CZHYKKAKFWLGJO-UHFFFAOYSA-N dimethyl phosphite Chemical compound COP([O-])OC CZHYKKAKFWLGJO-UHFFFAOYSA-N 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 150000002917 oxazolidines Chemical class 0.000 claims description 5
- -1 H-acid compound Chemical class 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000003063 flame retardant Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 2
- 229920003023 plastic Polymers 0.000 claims description 2
- 239000012467 final product Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 15
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 14
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 13
- 239000007788 liquid Substances 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000005187 foaming Methods 0.000 description 4
- 238000005809 transesterification reaction Methods 0.000 description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- MOFCYHDQWIZKMY-UHFFFAOYSA-N chloromethylphosphonic acid Chemical compound OP(O)(=O)CCl MOFCYHDQWIZKMY-UHFFFAOYSA-N 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 3
- 229940043276 diisopropanolamine Drugs 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- JYFHYPJRHGVZDY-UHFFFAOYSA-N Dibutyl phosphate Chemical compound CCCCOP(O)(=O)OCCCC JYFHYPJRHGVZDY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- QPILZZVXGUNELN-UHFFFAOYSA-M sodium;4-amino-5-hydroxynaphthalene-2,7-disulfonate;hydron Chemical class [Na+].OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S([O-])(=O)=O)=CC2=C1 QPILZZVXGUNELN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- UECJAKIAPOWTMX-UHFFFAOYSA-N (3-amino-1,5-dihydroxypentan-3-yl)phosphonic acid Chemical compound NC(CCO)(CCO)P(O)(O)=O UECJAKIAPOWTMX-UHFFFAOYSA-N 0.000 description 1
- SLJIKADEGHILDH-UHFFFAOYSA-N 1-[dimethoxyphosphorylmethyl(2-hydroxypropyl)amino]propan-2-ol Chemical compound COP(=O)(OC)CN(CC(C)O)CC(C)O SLJIKADEGHILDH-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- HZCDANOFLILNSA-UHFFFAOYSA-N Dimethyl hydrogen phosphite Chemical class COP(=O)OC HZCDANOFLILNSA-UHFFFAOYSA-N 0.000 description 1
- KKUKTXOBAWVSHC-UHFFFAOYSA-N Dimethylphosphate Chemical compound COP(O)(=O)OC KKUKTXOBAWVSHC-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000006261 foam material Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4006—Esters of acyclic acids which can have further substituents on alkyl
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
- C08K5/5333—Esters of phosphonic acids
- C08K5/5353—Esters of phosphonic acids containing also nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772750555 DE2750555A1 (de) | 1977-11-11 | 1977-11-11 | Verfahren zur herstellung von n,n-bis-(2-hydroxyalkyl)-aminomethanphosphonsaeure-dimethylester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO783631L true NO783631L (no) | 1979-05-14 |
Family
ID=6023567
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO783631A NO783631L (no) | 1977-11-11 | 1978-10-27 | Fremgangsmaate til fremstilling av n,n-bis-(2-hydroksyalkyl)-aminometanfosfonsyre-dimetylester |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4246206A (fi) |
| EP (1) | EP0001996B1 (fi) |
| JP (1) | JPS5476528A (fi) |
| AT (1) | AT366061B (fi) |
| BR (1) | BR7807412A (fi) |
| DE (2) | DE2750555A1 (fi) |
| DK (1) | DK501178A (fi) |
| FI (1) | FI783426A (fi) |
| IT (1) | IT1109333B (fi) |
| NO (1) | NO783631L (fi) |
| ZA (1) | ZA786341B (fi) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3903336A1 (de) * | 1989-02-04 | 1990-08-09 | Bayer Ag | Verwendung von c(pfeil abwaerts)3(pfeil abwaerts)- bis c(pfeil abwaerts)5(pfeil abwaerts)-polyfluoralkanen als treibgase |
| CN100447176C (zh) * | 2006-08-18 | 2008-12-31 | 中国科学院广州化学研究所 | 含磷环氧树脂固化剂及其制备方法和应用 |
| CN108047038A (zh) * | 2018-01-09 | 2018-05-18 | 浙江瑞通光电材料有限公司 | 一种乙酸2-羟基-3-氯-丙酯化合物的制备方法 |
| DE102018119835A1 (de) | 2018-08-15 | 2020-02-20 | Chemische Fabrik Budenheim Kg | Polymerzusammensetzung mit Phosphonatflammschutzmittel |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3076010A (en) * | 1960-03-25 | 1963-01-29 | Stauffer Chemical Co | Bis (hydroxyalkyl) amino alkyl phosphonic acid diesters |
| US3297796A (en) * | 1963-09-27 | 1967-01-10 | Dow Chemical Co | Hydroxyalkyl-aminomethyl phosphonates |
| US3746572A (en) * | 1971-02-23 | 1973-07-17 | Stauffer Chemical Co | Process for flame retarding fabrics |
| US3969437A (en) * | 1971-02-23 | 1976-07-13 | Stauffer Chemical Company | Cyclic phosphorus esters |
| DE2339393A1 (de) * | 1973-08-03 | 1975-03-27 | Bayer Ag | Verfahren zur herstellung von phosphorund stickstoff enthaltenden polyolen |
| DE2506442C2 (de) * | 1975-02-15 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von N,N-Bis(2-hydroxyalkyl)-aminomethanphosphonsäuredialkylestern |
-
1977
- 1977-11-11 DE DE19772750555 patent/DE2750555A1/de not_active Withdrawn
-
1978
- 1978-10-23 US US05/954,047 patent/US4246206A/en not_active Expired - Lifetime
- 1978-10-27 NO NO783631A patent/NO783631L/no unknown
- 1978-10-28 EP EP78101247A patent/EP0001996B1/de not_active Expired
- 1978-10-28 DE DE7878101247T patent/DE2860101D1/de not_active Expired
- 1978-11-09 IT IT51835/78A patent/IT1109333B/it active
- 1978-11-09 AT AT0801578A patent/AT366061B/de not_active IP Right Cessation
- 1978-11-09 FI FI783426A patent/FI783426A/fi unknown
- 1978-11-09 JP JP13739778A patent/JPS5476528A/ja active Granted
- 1978-11-10 DK DK501178A patent/DK501178A/da unknown
- 1978-11-10 ZA ZA00786341A patent/ZA786341B/xx unknown
- 1978-11-10 BR BR7807412A patent/BR7807412A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0001996B1 (de) | 1980-07-23 |
| JPS6145998B2 (fi) | 1986-10-11 |
| DE2860101D1 (en) | 1980-11-13 |
| EP0001996A1 (de) | 1979-05-30 |
| ZA786341B (en) | 1979-10-31 |
| US4246206A (en) | 1981-01-20 |
| IT1109333B (it) | 1985-12-16 |
| ATA801578A (de) | 1981-07-15 |
| IT7851835A0 (it) | 1978-11-09 |
| BR7807412A (pt) | 1979-07-24 |
| JPS5476528A (en) | 1979-06-19 |
| FI783426A (fi) | 1979-05-12 |
| AT366061B (de) | 1982-03-10 |
| DE2750555A1 (de) | 1979-05-17 |
| DK501178A (da) | 1979-05-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4327039A (en) | Process for the production of 3-amino-1-hydroxypropane-1,1-diphosphonic acid | |
| US2774786A (en) | Phosphono-ammonium surface active agents | |
| GB1436843A (en) | Preparation of n-phosphonomethyl-glycine | |
| CS204013B2 (en) | Herbicide means | |
| JP2020525510A (ja) | Ｄｏｐｏ誘導体の調製方法 | |
| NO783631L (no) | Fremgangsmaate til fremstilling av n,n-bis-(2-hydroksyalkyl)-aminometanfosfonsyre-dimetylester | |
| US4117227A (en) | Production of n-(substituted) morpholine | |
| US2830082A (en) | N-(hydroxyalkyl) taurine compounds and method of preparation | |
| AR045476A1 (es) | Proceso para la preparacion de n-fosfono-metilglicina y derivados de la misma | |
| US4332746A (en) | Diphosphonodicarboxylic acid esters | |
| US1945183A (en) | Manufacture of alkoxy derivatives of phosphorous acid chlorides | |
| CN101089005A (zh) | 一种环状膦酸酯类化合物的制备方法 | |
| US3968188A (en) | Process for preparing the pentaerythritol ester of phosphorohalidous acid | |
| US3453301A (en) | Tris-betahydroxyethyl phosphonomethylene ammonium compounds | |
| CS239903B2 (en) | Processing of aminomethyl phosphoric acid derivatives | |
| US2535173A (en) | 3-phosphonopropane-1, 1-dicarboxylic acid esters and method of preparation | |
| US3372209A (en) | Diphosphorus ester hydrocarbon diols | |
| US3639532A (en) | Esters and/or amides of acids of phosphorus containing a group having the formula roch2nhco- | |
| US4032601A (en) | Process for the production of sulfonamide phosphonates | |
| US4060571A (en) | Production of N,N-Bis-(2-hydroxyalkyl)-aminomethane phosphonic acid dialkyl esters | |
| US2668179A (en) | Linear dodecamethyltetraphosphoramide | |
| US3013046A (en) | Method for preparing a gasoline additive containing boron and phosphorus | |
| US3642959A (en) | Process for preparing alkyl aryl phosphates | |
| US5719281A (en) | Preparation of 1/3/5-Tris(2-Hydroxyalkyl) isocyanurates | |
| DE2017812C3 (de) | Verfahren zur Herstellung von organischen Phosphorverbindungen |