NO762989L - - Google Patents
Info
- Publication number
- NO762989L NO762989L NO762989A NO762989A NO762989L NO 762989 L NO762989 L NO 762989L NO 762989 A NO762989 A NO 762989A NO 762989 A NO762989 A NO 762989A NO 762989 L NO762989 L NO 762989L
- Authority
- NO
- Norway
- Prior art keywords
- ether
- trifluoroethyl
- difluoromethyl
- chloro
- preparation
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 7
- OOBHQCBCEJUDAR-UHFFFAOYSA-N 1,1,2,2,3-pentafluoro-3-(1,2,2,3,3-pentafluoropropoxy)propane Chemical compound FC(F)C(F)(F)C(F)OC(F)C(F)(F)C(F)F OOBHQCBCEJUDAR-UHFFFAOYSA-N 0.000 claims description 4
- 238000005660 chlorination reaction Methods 0.000 claims description 3
- 238000006298 dechlorination reaction Methods 0.000 claims description 3
- 238000003682 fluorination reaction Methods 0.000 claims description 3
- 230000002829 reductive effect Effects 0.000 claims description 3
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims 3
- 108010081348 HRT1 protein Hairy Proteins 0.000 claims 3
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- FWADSYFPXFXNAX-UHFFFAOYSA-N 1-chloro-3-(3-chloro-1,1,2,3,3-pentafluoropropoxy)-1,1,2,3,3-pentafluoropropane Chemical compound ClC(C(F)C(F)(F)OC(C(C(Cl)(F)F)F)(F)F)(F)F FWADSYFPXFXNAX-UHFFFAOYSA-N 0.000 description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 206010002091 Anaesthesia Diseases 0.000 description 9
- 230000037005 anaesthesia Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 6
- 239000001569 carbon dioxide Substances 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000003444 anaesthetic effect Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- WZJQNLGQTOCWDS-UHFFFAOYSA-K cobalt(iii) fluoride Chemical compound F[Co](F)F WZJQNLGQTOCWDS-UHFFFAOYSA-K 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000003193 general anesthetic agent Substances 0.000 description 3
- BCQZXOMGPXTTIC-UHFFFAOYSA-N halothane Chemical compound FC(F)(F)C(Cl)Br BCQZXOMGPXTTIC-UHFFFAOYSA-N 0.000 description 3
- 229960003132 halothane Drugs 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 230000029058 respiratory gaseous exchange Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NZZHHOMCJICYCD-UHFFFAOYSA-N 1,1,1-trichloro-2-methoxyethane Chemical compound COCC(Cl)(Cl)Cl NZZHHOMCJICYCD-UHFFFAOYSA-N 0.000 description 2
- SWVAQDCBPXOVFY-UHFFFAOYSA-N 1-chloro-2-(difluoromethoxy)-1,1,2-trifluoroethane Chemical compound FC(F)OC(F)C(F)(F)Cl SWVAQDCBPXOVFY-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229910021583 Cobalt(III) fluoride Inorganic materials 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- -1 compound 2-chloro-1,2,2-trifluoroethyl-difluoromethyl ether Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- DLEGDLSLRSOURQ-UHFFFAOYSA-N fluroxene Chemical compound FC(F)(F)COC=C DLEGDLSLRSOURQ-UHFFFAOYSA-N 0.000 description 2
- 229950010045 fluroxene Drugs 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 231100001274 therapeutic index Toxicity 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- GWSDMVRYBFKVTB-UHFFFAOYSA-N 1,2-dichloro-1,1,2-trifluoro-2-methoxyethane Chemical compound COC(F)(Cl)C(F)(F)Cl GWSDMVRYBFKVTB-UHFFFAOYSA-N 0.000 description 1
- ODNBVEIAQAZNNM-UHFFFAOYSA-N 1-(6-chloroimidazo[1,2-b]pyridazin-3-yl)ethanone Chemical compound C1=CC(Cl)=NN2C(C(=O)C)=CN=C21 ODNBVEIAQAZNNM-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Inorganic materials F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 description 1
- LPTPWPQEMTWZMU-UHFFFAOYSA-N C(C(OC(C(C(F)(F)Cl)(F)Cl)(F)F)(F)F)(C(F)(F)Cl)(F)Cl Chemical compound C(C(OC(C(C(F)(F)Cl)(F)Cl)(F)F)(F)F)(C(F)(F)Cl)(F)Cl LPTPWPQEMTWZMU-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- PIWKPBJCKXDKJR-UHFFFAOYSA-N Isoflurane Chemical compound FC(F)OC(Cl)C(F)(F)F PIWKPBJCKXDKJR-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- IUJDSEJGGMCXSG-UHFFFAOYSA-N Thiopental Chemical compound CCCC(C)C1(CC)C(=O)NC(=S)NC1=O IUJDSEJGGMCXSG-UHFFFAOYSA-N 0.000 description 1
- 239000005844 Thymol Substances 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000001949 anaesthesia Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- LQIIRBFXBIGGAZ-UHFFFAOYSA-L calcium;sodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[Ca+2] LQIIRBFXBIGGAZ-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229950011148 cyclopropane Drugs 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- 229940096810 diethylhexyl sebacate Drugs 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- VJHINFRRDQUWOJ-UHFFFAOYSA-N dioctyl sebacate Chemical compound CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC VJHINFRRDQUWOJ-UHFFFAOYSA-N 0.000 description 1
- JPGQOUSTVILISH-UHFFFAOYSA-N enflurane Chemical compound FC(F)OC(F)(F)C(F)Cl JPGQOUSTVILISH-UHFFFAOYSA-N 0.000 description 1
- 229960000305 enflurane Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229960002725 isoflurane Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- RFKMCNOHBTXSMU-UHFFFAOYSA-N methoxyflurane Chemical compound COC(F)(F)C(Cl)Cl RFKMCNOHBTXSMU-UHFFFAOYSA-N 0.000 description 1
- 229960002455 methoxyflurane Drugs 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 229960001730 nitrous oxide Drugs 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 238000010943 off-gassing Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- RZXZIZDRFQFCTA-UHFFFAOYSA-N teflurane Chemical compound FC(Br)C(F)(F)F RZXZIZDRFQFCTA-UHFFFAOYSA-N 0.000 description 1
- 229950010846 teflurane Drugs 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 229960000790 thymol Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229960002415 trichloroethylene Drugs 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
Landscapes
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
NO762989A NO762989L (enrdf_load_stackoverflow) | 1974-12-06 | 1976-08-31 |
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB52834/74A GB1499818A (en) | 1974-12-06 | 1974-12-06 | Anaesthetic composition |
NO754118A NO754118L (enrdf_load_stackoverflow) | 1974-12-06 | 1975-12-05 | |
NO762989A NO762989L (enrdf_load_stackoverflow) | 1974-12-06 | 1976-08-31 |
Publications (1)
Publication Number | Publication Date |
---|---|
NO762989L true NO762989L (enrdf_load_stackoverflow) | 1976-06-09 |
Family
ID=27260279
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO762989A NO762989L (enrdf_load_stackoverflow) | 1974-12-06 | 1976-08-31 |
Country Status (1)
Country | Link |
---|---|
NO (1) | NO762989L (enrdf_load_stackoverflow) |
-
1976
- 1976-08-31 NO NO762989A patent/NO762989L/no unknown
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US3557294A (en) | Fluorinated ethers as inhalation convulsants | |
Whalen et al. | Inhaled anesthetics: an historical overview | |
US3659023A (en) | Method of inducing anesthesia with 2-bromo-1 1 2 3 3-pentafluoropropane | |
KR910006888B1 (ko) | 흡입용 마취제 | |
US3962460A (en) | Ether compounds as inhalant anesthetics | |
US3469011A (en) | 1,1,2-trifluoro-2-chloroethyl-difluoromethyl ether as an anesthetic agent | |
US3689571A (en) | Fluorinated ether | |
US5015781A (en) | Anesthetic compound and method of preparing | |
US4080389A (en) | Anaesthetic composition | |
NO762989L (enrdf_load_stackoverflow) | ||
US4109016A (en) | Anaesthetic composition | |
US3499089A (en) | Method of inducing anesthesia with 2-halo-1,1,1,3,3-pentafluoropropanes | |
US4104314A (en) | Ether compounds | |
US3097133A (en) | Anaesthetic 1: 1: 1: 3: 3: 3-hexafluoro-2-halopropane | |
US3666864A (en) | Compositions and methods for producing anesthesia | |
CA1060799A (en) | Anaesthetic compositions | |
US2951102A (en) | Chlorofluoromethylfluoroform | |
US3806602A (en) | Inhalant analgesic and anesthetic method and composition | |
US3764705A (en) | 1-bromo2,2,2-trifluoroethyl difluoromethyl ether as an inhalation anesthetic | |
KRANTZ JR | The rationale of the use of fluorinated hydrocarbons and ethers as volatile anesthetic agents | |
US3095354A (en) | Inhalation anesthetic: 2-bromo-1, 1, 2-trifluroethyl methyl ether | |
JP2726824B2 (ja) | カルボニルフロライド化合物の製造法 | |
US3989845A (en) | Anesthetic chlorocyclopropanes | |
US3749798A (en) | 1-chloro-1-hydroperfluorobutyl difluoromethyl ether as an inhalation anesthetic | |
US3480683A (en) | 2-bromo-1,1,2,3,3-pentafluoropropane |