NO134743B - - Google Patents
Download PDFInfo
- Publication number
- NO134743B NO134743B NO3374/71A NO337471A NO134743B NO 134743 B NO134743 B NO 134743B NO 3374/71 A NO3374/71 A NO 3374/71A NO 337471 A NO337471 A NO 337471A NO 134743 B NO134743 B NO 134743B
- Authority
- NO
- Norway
- Prior art keywords
- dimethyl
- chromen
- tetrahydropyrid
- mol
- amyl
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000001145 hydrido group Chemical group *[H] 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 94
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 88
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 70
- -1 2-octyl Chemical group 0.000 description 53
- 229910000033 sodium borohydride Inorganic materials 0.000 description 29
- 239000012279 sodium borohydride Substances 0.000 description 29
- 239000000243 solution Substances 0.000 description 26
- 239000000203 mixture Substances 0.000 description 24
- 238000010626 work up procedure Methods 0.000 description 23
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 238000004440 column chromatography Methods 0.000 description 11
- 239000003480 eluent Substances 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 150000002170 ethers Chemical class 0.000 description 7
- JEPYMPNKOCZCHI-UHFFFAOYSA-N 2-benzylpyridine hydrobromide Chemical class Br.C=1C=CC=NC=1CC1=CC=CC=C1 JEPYMPNKOCZCHI-UHFFFAOYSA-N 0.000 description 6
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 206010020772 Hypertension Diseases 0.000 description 4
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 235000009518 sodium iodide Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- OEPFQUBYNBPKEK-UHFFFAOYSA-N 2,2-dimethyl-7-octan-2-yl-4-pyridin-4-ylchromen-5-ol Chemical compound C=1C(C)(C)OC2=CC(C(C)CCCCCC)=CC(O)=C2C=1C1=CC=NC=C1 OEPFQUBYNBPKEK-UHFFFAOYSA-N 0.000 description 3
- RUHJZSZTSCSTCC-UHFFFAOYSA-N 2-(bromomethyl)naphthalene Chemical compound C1=CC=CC2=CC(CBr)=CC=C21 RUHJZSZTSCSTCC-UHFFFAOYSA-N 0.000 description 3
- SJPVZEOHRLQKQN-UHFFFAOYSA-N 2-benzylpyridine;hydrochloride Chemical class Cl.C=1C=CC=NC=1CC1=CC=CC=C1 SJPVZEOHRLQKQN-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000003276 anti-hypertensive effect Effects 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 210000003169 central nervous system Anatomy 0.000 description 3
- MCDZAXCSYDQTAB-UHFFFAOYSA-N chromenol Natural products CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C)Oc2ccc(O)cc2C=C1)C)C)C)C)C)C MCDZAXCSYDQTAB-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229960000956 coumarin Drugs 0.000 description 3
- 235000001671 coumarin Nutrition 0.000 description 3
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- JGFUFQSXEHUHTN-UHFFFAOYSA-N 4-(1-benzyl-3,6-dihydro-2h-pyridin-4-yl)-2,2,7-trimethylchromen-5-ol Chemical compound C=1C(C)(C)OC2=CC(C)=CC(O)=C2C=1C(CC1)=CCN1CC1=CC=CC=C1 JGFUFQSXEHUHTN-UHFFFAOYSA-N 0.000 description 2
- POHQHBMICXGBLN-UHFFFAOYSA-N 7-hexan-2-yl-2,2-dimethyl-4-pyridin-4-ylchromen-5-ol Chemical compound C=1C(C)(C)OC2=CC(C(C)CCCC)=CC(O)=C2C=1C1=CC=NC=C1 POHQHBMICXGBLN-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 150000004775 coumarins Chemical class 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- PCJNYGPKMQQCPX-UHFFFAOYSA-N ethyl 3-oxo-3-pyridin-4-ylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=NC=C1 PCJNYGPKMQQCPX-UHFFFAOYSA-N 0.000 description 2
- NBEMQPLNBYYUAZ-UHFFFAOYSA-N ethyl acetate;propan-2-one Chemical compound CC(C)=O.CCOC(C)=O NBEMQPLNBYYUAZ-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- ZORDDOAHFBBJHY-UHFFFAOYSA-N 2,2,7-trimethyl-4-pyridin-4-ylchromen-5-ol Chemical compound N1=CC=C(C=C1)C1=CC(OC=2C=C(C=C(C12)O)C)(C)C ZORDDOAHFBBJHY-UHFFFAOYSA-N 0.000 description 1
- YHUDSHIRWOVVCV-UHFFFAOYSA-N 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-ol Chemical compound C=1C(C)(C)OC2=CC(C(C)C(C)CCCCC)=CC(O)=C2C=1C1=CC=NC=C1 YHUDSHIRWOVVCV-UHFFFAOYSA-N 0.000 description 1
- YHZCTZGJKHNVQY-UHFFFAOYSA-N 2-(diethylazaniumyl)propanoate Chemical compound CCN(CC)C(C)C(O)=O YHZCTZGJKHNVQY-UHFFFAOYSA-N 0.000 description 1
- MELCWEWUZODSIS-UHFFFAOYSA-N 2-[2-(diethylamino)ethoxy]-n,n-diethylethanamine Chemical compound CCN(CC)CCOCCN(CC)CC MELCWEWUZODSIS-UHFFFAOYSA-N 0.000 description 1
- NUPBLKRYNHUYKJ-UHFFFAOYSA-N 2-propylpyridin-1-ium;bromide Chemical class [Br-].CCCC1=CC=CC=[NH+]1 NUPBLKRYNHUYKJ-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- MEBNLBHILOYVPC-UHFFFAOYSA-N 3-bromo-2-ethylpyridine Chemical class CCC1=NC=CC=C1Br MEBNLBHILOYVPC-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- GJSVCUHWEJFFMO-UHFFFAOYSA-N 3-iodo-2-methylpyridine Chemical class CC1=NC=CC=C1I GJSVCUHWEJFFMO-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JOZMGUQZTOWLAS-UHFFFAOYSA-N 5-butylbenzene-1,3-diol Chemical compound CCCCC1=CC(O)=CC(O)=C1 JOZMGUQZTOWLAS-UHFFFAOYSA-N 0.000 description 1
- XECRVULUEJSGBY-UHFFFAOYSA-N 5-hexylbenzene-1,3-diol Chemical compound CCCCCCC1=CC(O)=CC(O)=C1 XECRVULUEJSGBY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical class COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- CLYUYIASUJTQNI-UHFFFAOYSA-N [Cl-].C1=CC=C2C(C[N+]3=CC=C(C=C3)C=3C4=C(O)C=C(C=C4OC(C)(C)C=3)C(C)CCCC)=CC=CC2=C1 Chemical compound [Cl-].C1=CC=C2C(C[N+]3=CC=C(C=C3)C=3C4=C(O)C=C(C=C4OC(C)(C)C=3)C(C)CCCC)=CC=CC2=C1 CLYUYIASUJTQNI-UHFFFAOYSA-N 0.000 description 1
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 229940124538 antidiuretic agent Drugs 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001562 benzopyrans Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000005792 cardiovascular activity Effects 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008227 sterile water for injection Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000005942 tetrahydropyridyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7221770A | 1970-09-14 | 1970-09-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO134743B true NO134743B (cg-RX-API-DMAC10.html) | 1976-08-30 |
| NO134743C NO134743C (cg-RX-API-DMAC10.html) | 1976-12-08 |
Family
ID=22106286
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3374/71A NO134743C (cg-RX-API-DMAC10.html) | 1970-09-14 | 1971-09-10 |
Country Status (14)
| Country | Link |
|---|---|
| AT (1) | AT308108B (cg-RX-API-DMAC10.html) |
| BE (1) | BE772492A (cg-RX-API-DMAC10.html) |
| CA (1) | CA965421A (cg-RX-API-DMAC10.html) |
| CH (1) | CH559209A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2145320A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK135994B (cg-RX-API-DMAC10.html) |
| ES (1) | ES394980A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2106490B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1360009A (cg-RX-API-DMAC10.html) |
| IE (1) | IE35636B1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7112521A (cg-RX-API-DMAC10.html) |
| NO (1) | NO134743C (cg-RX-API-DMAC10.html) |
| SE (1) | SE372943B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA716039B (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3960880A (en) * | 1974-03-26 | 1976-06-01 | Beecham Group Limited | Tetrahydropyrid-4-yl-chroman-5-ol derivatives |
| JPS4995978A (cg-RX-API-DMAC10.html) * | 1973-01-24 | 1974-09-11 | ||
| GB1417745A (en) * | 1973-07-07 | 1975-12-17 | Beecham Group Ltd | Chromene compounds |
-
1971
- 1971-09-09 ZA ZA716039A patent/ZA716039B/xx unknown
- 1971-09-09 GB GB4206671A patent/GB1360009A/en not_active Expired
- 1971-09-10 CA CA122,575A patent/CA965421A/en not_active Expired
- 1971-09-10 IE IE1154/71A patent/IE35636B1/xx unknown
- 1971-09-10 CH CH1332671A patent/CH559209A5/xx not_active IP Right Cessation
- 1971-09-10 SE SE7111539A patent/SE372943B/xx unknown
- 1971-09-10 DK DK446771AA patent/DK135994B/da unknown
- 1971-09-10 NL NL7112521A patent/NL7112521A/xx not_active Application Discontinuation
- 1971-09-10 NO NO3374/71A patent/NO134743C/no unknown
- 1971-09-10 ES ES394980A patent/ES394980A1/es not_active Expired
- 1971-09-10 FR FR7132675A patent/FR2106490B1/fr not_active Expired
- 1971-09-10 BE BE772492A patent/BE772492A/xx unknown
- 1971-09-10 DE DE19712145320 patent/DE2145320A1/de active Pending
- 1971-09-10 AT AT787271A patent/AT308108B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2106490B1 (cg-RX-API-DMAC10.html) | 1975-04-18 |
| DK135994B (da) | 1977-07-25 |
| DE2145320A1 (de) | 1972-03-16 |
| IE35636L (en) | 1972-03-14 |
| DK135994C (cg-RX-API-DMAC10.html) | 1977-12-27 |
| AU3336571A (en) | 1973-03-15 |
| ES394980A1 (es) | 1974-12-01 |
| CA965421A (en) | 1975-04-01 |
| ZA716039B (en) | 1972-07-26 |
| CH559209A5 (cg-RX-API-DMAC10.html) | 1975-02-28 |
| FR2106490A1 (cg-RX-API-DMAC10.html) | 1972-05-05 |
| BE772492A (fr) | 1972-03-10 |
| NL7112521A (cg-RX-API-DMAC10.html) | 1972-03-16 |
| NO134743C (cg-RX-API-DMAC10.html) | 1976-12-08 |
| SE372943B (cg-RX-API-DMAC10.html) | 1975-01-20 |
| IE35636B1 (en) | 1976-04-14 |
| AT308108B (de) | 1973-06-25 |
| GB1360009A (en) | 1974-07-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2739968A (en) | Substituted piperidines | |
| US2524855A (en) | Process for the manufacture of | |
| Moltzen et al. | . sigma. Ligands with Subnanomolar Affinity and Preference for the. sigma. 2 Binding Site. 2. Spiro-Joined Benzofuran, Isobenzofuran, and Benzopyran Piperidines | |
| DE102008022221A1 (de) | Inhibitoren der humanen Aldosteronsynthase CYP11B2 | |
| CZ172397A3 (en) | Novel benzimidazole derivatives with antihistaminic activity | |
| DE4414113A1 (de) | 3-Indolylpiperidine | |
| US2689853A (en) | Certain i | |
| EP0612730B1 (en) | O-aryl ethers of morphinans | |
| DD298921A5 (de) | Disubstituierte (chinolin-2-yl-methoxy)phenyl-essigsaeure derivate | |
| EP2664617A1 (en) | Method of making a 2,6-diaryl piperidine derivative | |
| DE69318920T2 (de) | Ellipticinderivate mit Antitumorwirkung | |
| US3060177A (en) | O-(aminoalkyl)oxime derivatives of heterocyclic aldehydes and ketones | |
| US4007191A (en) | 2-(Piperidinyl or tetrahydropyridinyl)-alkyl)-2,3-dihydro-3-hydroxy-1H-benz(DE)isoquinolin-1-ones | |
| NO134743B (cg-RX-API-DMAC10.html) | ||
| US3381013A (en) | Heterocyclicamino ethers of benzylphenols | |
| US2970149A (en) | Certain 1-[(2-pyridyl)-lower alkyl]-2-(tertamino-lower alkyl)-indan-1-ols, and acid addition salts | |
| US2695290A (en) | Derivatives of indole and method for the production thereof | |
| CA2499125C (en) | An improved process for the production of desloratadine | |
| NO151387B (no) | Innstillingsinnretning for en elektronisk digitalindikator | |
| NO144548B (no) | Elastisk mellomledd for akselkoblinger. | |
| Gray et al. | Bis-ammonium Salts. Unsymmetrical Derivatives of Some Isoquinolines and Related Heterocyclic Bases1 | |
| JPH0375542B2 (cg-RX-API-DMAC10.html) | ||
| US3316272A (en) | Heterocyclic derivatives of triphenyl-ethylenes, triphenylethanes and triphenylethanols | |
| US5663350A (en) | Process for the preparation of intermediates useful for the synthesis of histamine receptor antagonists | |
| US5438062A (en) | Benzo(5,6)cycloheptapyridines, compositions and methods of use |