NO131072B - - Google Patents
Download PDFInfo
- Publication number
- NO131072B NO131072B NO00922/73A NO92273A NO131072B NO 131072 B NO131072 B NO 131072B NO 00922/73 A NO00922/73 A NO 00922/73A NO 92273 A NO92273 A NO 92273A NO 131072 B NO131072 B NO 131072B
- Authority
- NO
- Norway
- Prior art keywords
- composition
- cross
- liquid
- salt
- tetravalent titanium
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 69
- 239000002360 explosive Substances 0.000 claims description 45
- 239000000243 solution Substances 0.000 claims description 30
- 239000010936 titanium Substances 0.000 claims description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 27
- 229910052719 titanium Inorganic materials 0.000 claims description 26
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 17
- 239000007788 liquid Substances 0.000 claims description 16
- 239000002562 thickening agent Substances 0.000 claims description 15
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 14
- 239000003431 cross linking reagent Substances 0.000 claims description 13
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 12
- 239000000446 fuel Substances 0.000 claims description 12
- 230000001590 oxidative effect Effects 0.000 claims description 12
- 150000003609 titanium compounds Chemical class 0.000 claims description 12
- 239000007864 aqueous solution Substances 0.000 claims description 8
- 239000007791 liquid phase Substances 0.000 claims description 8
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 6
- -1 alkali metal chlorates Chemical class 0.000 claims description 5
- 150000003608 titanium Chemical class 0.000 claims description 5
- 239000004317 sodium nitrate Substances 0.000 claims description 4
- 235000010344 sodium nitrate Nutrition 0.000 claims description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 3
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical group Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 229910001963 alkali metal nitrate Inorganic materials 0.000 claims description 2
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 235000010288 sodium nitrite Nutrition 0.000 claims description 2
- 229960000819 sodium nitrite Drugs 0.000 claims 1
- 238000004132 cross linking Methods 0.000 description 29
- 239000004971 Cross linker Substances 0.000 description 22
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 21
- 239000002002 slurry Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 13
- 230000008719 thickening Effects 0.000 description 12
- 229920002907 Guar gum Polymers 0.000 description 10
- 239000000665 guar gum Substances 0.000 description 10
- 229960002154 guar gum Drugs 0.000 description 10
- 235000010417 guar gum Nutrition 0.000 description 10
- 239000000295 fuel oil Substances 0.000 description 9
- 239000000499 gel Substances 0.000 description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 7
- 238000004581 coalescence Methods 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 229910052782 aluminium Inorganic materials 0.000 description 6
- 235000013312 flour Nutrition 0.000 description 6
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 235000019698 starch Nutrition 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 4
- 238000005204 segregation Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 240000003183 Manihot esculenta Species 0.000 description 3
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 239000003575 carbonaceous material Substances 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000002386 leaching Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- OMDQUFIYNPYJFM-XKDAHURESA-N (2r,3r,4s,5r,6s)-2-(hydroxymethyl)-6-[[(2r,3s,4r,5s,6r)-4,5,6-trihydroxy-3-[(2s,3s,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O[C@H]2[C@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@H](O)[C@H](O)O1 OMDQUFIYNPYJFM-XKDAHURESA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- 229920000926 Galactomannan Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical class [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 229910010068 TiCl2 Inorganic materials 0.000 description 1
- 229910010062 TiCl3 Inorganic materials 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000005885 boration reaction Methods 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000002925 chemical effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000005474 detonation Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000001455 metallic ions Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 239000004449 solid propellant Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- ZWYDDDAMNQQZHD-UHFFFAOYSA-L titanium(ii) chloride Chemical compound [Cl-].[Cl-].[Ti+2] ZWYDDDAMNQQZHD-UHFFFAOYSA-L 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- FEACDYATMHKJPE-JXHOJRNMSA-N xxxx-3 Chemical compound C1CC(C)CC(OC)C(O)C(C)\C=C(C)\C(OC(N)=O)C(OC)CC\C=C(C)\C(=O)NC2=CC(O)=C(O)C1=C2 FEACDYATMHKJPE-JXHOJRNMSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Colloid Chemistry (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23335772A | 1972-03-09 | 1972-03-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131072B true NO131072B (enExample) | 1974-12-23 |
| NO131072C NO131072C (enExample) | 1975-04-02 |
Family
ID=22876901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO922/73A NO131072C (enExample) | 1972-03-09 | 1973-03-07 |
Country Status (7)
| Country | Link |
|---|---|
| CA (1) | CA999441A (enExample) |
| DE (1) | DE2308680A1 (enExample) |
| FR (1) | FR2175188B1 (enExample) |
| GB (1) | GB1426381A (enExample) |
| IE (1) | IE37312B1 (enExample) |
| NO (1) | NO131072C (enExample) |
| ZA (1) | ZA731197B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4585495A (en) * | 1985-03-11 | 1986-04-29 | Du Pont Of Canada, Inc. | Stable nitrate/slurry explosives |
| RU2204544C2 (ru) * | 2000-05-10 | 2003-05-20 | Институт горного дела Уральского отделения РАН | Способ изготовления водосодержащих взрывчатых веществ |
| CN120081716B (zh) * | 2025-05-06 | 2025-08-01 | 青州市博奥炭黑有限责任公司 | 一种利用改性炭黑制备乳化炸药敏化剂的方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3622408A (en) * | 1967-11-15 | 1971-11-23 | Du Pont | Water-bearing explosives thickened with a partially hydrolyzed acrylamide polymer |
| US3645809A (en) * | 1969-12-09 | 1972-02-29 | Hercules Inc | Aqueous slurry explosives having improved oxidizer-fuel system and method of making |
-
1973
- 1973-02-20 GB GB826673A patent/GB1426381A/en not_active Expired
- 1973-02-20 ZA ZA731197A patent/ZA731197B/xx unknown
- 1973-02-21 CA CA164,242A patent/CA999441A/en not_active Expired
- 1973-02-21 IE IE274/73A patent/IE37312B1/xx unknown
- 1973-02-22 DE DE19732308680 patent/DE2308680A1/de not_active Ceased
- 1973-03-07 NO NO922/73A patent/NO131072C/no unknown
- 1973-03-08 FR FR7308334A patent/FR2175188B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NO131072C (enExample) | 1975-04-02 |
| CA999441A (en) | 1976-11-09 |
| IE37312B1 (en) | 1977-06-22 |
| DE2308680A1 (de) | 1973-09-20 |
| AU5258073A (en) | 1974-08-29 |
| ZA731197B (en) | 1973-11-28 |
| IE37312L (en) | 1973-09-09 |
| FR2175188B1 (enExample) | 1977-04-22 |
| GB1426381A (en) | 1976-02-25 |
| FR2175188A1 (enExample) | 1973-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1155664A (en) | Slurry explosive composition | |
| CA2842822F (en) | IMPROVED EXPLOSIVE COMPOSITION CONTAINING HYDROGEN PEROXIDE AND A SENSITIZING AGENT | |
| CA1087396A (en) | Aqueous blasting composition | |
| EP0028908B1 (en) | Emulsion explosive composition | |
| US20200002241A1 (en) | Improved explosive composition | |
| NO125443B (enExample) | ||
| CN114206811A (zh) | 具有改进的睡眠时间的基于过氧化氢的爆炸物 | |
| KR850001665B1 (ko) | 농조화된 연속수성상을 갖는 함수 폭약의 안정화방법 | |
| NO131072B (enExample) | ||
| US5490887A (en) | Low density watergel explosive composition | |
| CA1069312A (en) | Blasting composition containing calcium nitrate and sulfur | |
| US3524777A (en) | Slurry explosive containing an improved thickening agent | |
| US3734864A (en) | Aqueous gel for slurry explosives composition and method of preparing said gel | |
| US4364782A (en) | Permissible slurry explosive | |
| AU2016217971B2 (en) | Water-based explosive suspension | |
| US4198253A (en) | Explosive compositions containing sulphonated guar gum derivatives | |
| CA1197688A (en) | Perchlorate slurry explosive | |
| US4221616A (en) | Hydrophobic explosive composition and method of making | |
| CA2363212C (en) | Blasting method for reducing nitrogen oxide fumes | |
| USRE28848E (en) | Blasting slurry compositions containing calcium nitrate and method of preparation | |
| CA2095260C (en) | Low density watergel explosive composition | |
| US3869320A (en) | Explosive composition containing biopolymeric material, method of preparing and using | |
| CA1090139A (en) | Explosive compositions | |
| EP0547278A1 (en) | Explosive watergels based on protonized vinyl basic polymers | |
| JPH0393690A (ja) | 油中水滴型エマルジョン爆薬 |