NO126316B - - Google Patents
Download PDFInfo
- Publication number
- NO126316B NO126316B NO03629/68A NO362968A NO126316B NO 126316 B NO126316 B NO 126316B NO 03629/68 A NO03629/68 A NO 03629/68A NO 362968 A NO362968 A NO 362968A NO 126316 B NO126316 B NO 126316B
- Authority
- NO
- Norway
- Prior art keywords
- acrolein
- catalysts
- catalyst
- compounds
- methylmercaptopropionaldehyde
- Prior art date
Links
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 29
- 239000003054 catalyst Substances 0.000 claims description 26
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- CLUWOWRTHNNBBU-UHFFFAOYSA-N 3-methylthiopropanal Chemical compound CSCCC=O CLUWOWRTHNNBBU-UHFFFAOYSA-N 0.000 claims description 8
- 229910052785 arsenic Inorganic materials 0.000 claims description 3
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000006701 autoxidation reaction Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- VYNGFCUGSYEOOZ-UHFFFAOYSA-N triphenylphosphine sulfide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=S)C1=CC=CC=C1 VYNGFCUGSYEOOZ-UHFFFAOYSA-N 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- MNZAKDODWSQONA-UHFFFAOYSA-N 1-dibutylphosphorylbutane Chemical compound CCCCP(=O)(CCCC)CCCC MNZAKDODWSQONA-UHFFFAOYSA-N 0.000 description 1
- FSTTVKGSJLFJAC-UHFFFAOYSA-N 1-diphenylphosphoryl-4-methylbenzene Chemical compound C1=CC(C)=CC=C1P(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 FSTTVKGSJLFJAC-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- PEGCITODQASXKH-UHFFFAOYSA-N [methyl(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(C)C1=CC=CC=C1 PEGCITODQASXKH-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- LEFPWWWXFFNJAA-UHFFFAOYSA-N dicyclohexylphosphorylcyclohexane Chemical compound C1CCCCC1P(C1CCCCC1)(=O)C1CCCCC1 LEFPWWWXFFNJAA-UHFFFAOYSA-N 0.000 description 1
- NTWZKDSMPFHONS-UHFFFAOYSA-N diethylphosphorylbenzene Chemical compound CCP(=O)(CC)C1=CC=CC=C1 NTWZKDSMPFHONS-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229940093920 gynecological arsenic compound Drugs 0.000 description 1
- 238000007172 homogeneous catalysis Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19671668139 DE1668139C3 (de) | 1967-10-13 | 1967-10-13 | Verfahren zur Herstellung von beta- Methylmercaptopropionaldehyd |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126316B true NO126316B (enExample) | 1973-01-22 |
Family
ID=5686080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO03629/68A NO126316B (enExample) | 1967-10-13 | 1968-09-13 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3574766A (enExample) |
| ES (1) | ES357862A1 (enExample) |
| FR (1) | FR1585366A (enExample) |
| NO (1) | NO126316B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954877A (en) * | 1967-10-12 | 1976-05-04 | Jefferson Chemical Co., Inc. | Hydroformylation of olefins |
| FR2314917A1 (fr) * | 1975-06-20 | 1977-01-14 | Rhone Poulenc Ind | Procede de fabrication de l'aldehyde beta-methylthiopropionique |
| FR2460925A1 (fr) * | 1979-07-10 | 1981-01-30 | Rhone Poulenc Ind | Procede de preparation directe d'aldehyde beta-methylthiopropionique |
| US5905171A (en) | 1995-06-22 | 1999-05-18 | Novus International, Inc. | Process for the preparation of 3-(methylthio)propanal |
| US5925794A (en) * | 1993-06-08 | 1999-07-20 | Novus International, Inc. | Process for the preparation of 3-(methylthio)propanal |
| US5637766A (en) * | 1993-06-08 | 1997-06-10 | Novus International, Inc. | Process for the preparation of 3-(methylthio) propanal |
| RU2149159C1 (ru) * | 1994-07-11 | 2000-05-20 | Новус Интернэшнл, Инк. | Способ непрерывного получения 3-(метилтио)-пропаналя (варианты) |
| US5663409A (en) * | 1995-06-07 | 1997-09-02 | Novus International, Inc. | Process for the preparation of 3-(methylthio) propanal and 2-hydroxy-4-(methylthio) butanenitrile |
| US5825369A (en) * | 1996-01-16 | 1998-10-20 | International Business Machines Corporation | Compression of simple geometric models using spanning trees |
| US6524674B1 (en) | 2000-02-24 | 2003-02-25 | Glass Unlimited Of High Point, Inc. | Glass panel with simulated metal strip |
| JP4203718B2 (ja) * | 2002-10-31 | 2009-01-07 | 東レ・ダウコーニング株式会社 | 含ケイ素ポリサルファイド系重合体の製造方法 |
-
1968
- 1968-09-05 ES ES357862A patent/ES357862A1/es not_active Expired
- 1968-09-13 NO NO03629/68A patent/NO126316B/no unknown
- 1968-10-03 US US764946A patent/US3574766A/en not_active Expired - Lifetime
- 1968-10-10 FR FR1585366D patent/FR1585366A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1585366A (enExample) | 1970-01-16 |
| ES357862A1 (es) | 1970-04-01 |
| US3574766A (en) | 1971-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3953362A (en) | Molybdenum salt catalysts and methods of preparing them | |
| NO126316B (enExample) | ||
| US5077046A (en) | Polyprenyl composition or compounds and process for the production thereof | |
| DE2540210C3 (de) | Verfahren zur Herstellung von Organozinntrihalogeniden | |
| US2516625A (en) | Derivatives of dihydropyridine | |
| US2779761A (en) | Process for preparing amine polysulfides | |
| US3836524A (en) | Preparation of esters of thiocarbamic acids | |
| US2471274A (en) | Nitroalkyl sulfites and process for preparing them | |
| US3043880A (en) | Process for preparing 1, 2-ethanedithiol | |
| Sosnovsky et al. | The peroxyester reaction | |
| US4886916A (en) | Process for preparing sulfone compounds | |
| US3662004A (en) | Process for producing hydroxyalkyl mercaptans | |
| US2521677A (en) | Production of beta-methylmercapto-propionaldehyde | |
| FOSTER et al. | Organomercury Chemistry. Decomposition of Alkenylmercury Compounds | |
| Veber et al. | Alkylation of ethyl bromomalonate by alkylcobaloximes | |
| US3637789A (en) | Process for the production of alkenyl thioesters | |
| US2451740A (en) | Process for the manufacture of an aldehyde | |
| US3299098A (en) | Phenoxathins and their preparation | |
| US2408519A (en) | Manufacture of 4-ketotetrahydrothiophenes | |
| US2872455A (en) | Process for the preparation of dithiacyclopentylaliphatic acids | |
| KR890005347B1 (ko) | 신규의 히드록시-티아-알켄의 제조방법 | |
| JP3855570B2 (ja) | 4−アセチルテトラヒドロピランの製法 | |
| US3205268A (en) | Preparation of unsymmetrical disulfides | |
| WO1997003954A1 (en) | Compositions containing pentaerythritol tetraesters and process for production thereof | |
| US2878265A (en) | Production of methylenedioxyphenyl derivatives |