NO122692B - - Google Patents
Download PDFInfo
- Publication number
- NO122692B NO122692B NO5138/69A NO513869A NO122692B NO 122692 B NO122692 B NO 122692B NO 5138/69 A NO5138/69 A NO 5138/69A NO 513869 A NO513869 A NO 513869A NO 122692 B NO122692 B NO 122692B
- Authority
- NO
- Norway
- Prior art keywords
- explosive
- nitrate
- mixture
- hydrazine
- weight
- Prior art date
Links
- 239000002360 explosive Substances 0.000 claims description 69
- 239000000203 mixture Substances 0.000 claims description 69
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 54
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 28
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 24
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 21
- RAESLDWEUUSRLO-UHFFFAOYSA-O aminoazanium;nitrate Chemical compound [NH3+]N.[O-][N+]([O-])=O RAESLDWEUUSRLO-UHFFFAOYSA-O 0.000 claims description 13
- 229910021529 ammonia Inorganic materials 0.000 claims description 13
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 11
- 230000001590 oxidative effect Effects 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 239000002562 thickening agent Substances 0.000 claims description 8
- 230000001603 reducing effect Effects 0.000 claims description 4
- 239000003975 dentin desensitizing agent Substances 0.000 claims description 2
- 150000002823 nitrates Chemical class 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 description 22
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 12
- 239000007788 liquid Substances 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000002245 particle Substances 0.000 description 9
- 229940090898 Desensitizer Drugs 0.000 description 7
- 229910002651 NO3 Inorganic materials 0.000 description 7
- 238000007710 freezing Methods 0.000 description 7
- 230000008014 freezing Effects 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229910001868 water Inorganic materials 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- UUZSPXJCBLJUQH-UHFFFAOYSA-O aminoazanium hydrazine nitrate Chemical compound [N+](=O)([O-])[O-].[NH3+]N.NN UUZSPXJCBLJUQH-UHFFFAOYSA-O 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- -1 ammonium cations Chemical class 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000446 fuel Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000001457 metallic cations Chemical class 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 3
- 239000004411 aluminium Substances 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 238000005474 detonation Methods 0.000 description 3
- 239000000295 fuel oil Substances 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XGSVQGOPJUAOQH-UHFFFAOYSA-N aluminum;2-methyl-1,3,5-trinitrobenzene Chemical compound [Al+3].CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O XGSVQGOPJUAOQH-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910001018 Cast iron Inorganic materials 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- AGUIVNYEYSCPNI-UHFFFAOYSA-N N-methyl-N-picrylnitramine Chemical group [O-][N+](=O)N(C)C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O AGUIVNYEYSCPNI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 229910001485 alkali metal perchlorate Inorganic materials 0.000 description 1
- PVTHIYCCXJJALA-UHFFFAOYSA-N aminoazanium;thiocyanate Chemical compound [NH3+]N.[S-]C#N PVTHIYCCXJJALA-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- ZXNIRGPMYQWIJS-UHFFFAOYSA-O azanium azane nitrate Chemical compound [N+](=O)([O-])[O-].[NH4+].N ZXNIRGPMYQWIJS-UHFFFAOYSA-O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- AFEBXVJYLNMAJB-UHFFFAOYSA-N hydrazine;nitric acid Chemical compound NN.O[N+]([O-])=O AFEBXVJYLNMAJB-UHFFFAOYSA-N 0.000 description 1
- HFPDJZULJLQGDN-UHFFFAOYSA-N hydrazine;perchloric acid Chemical compound [NH3+]N.[O-]Cl(=O)(=O)=O HFPDJZULJLQGDN-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B31/00—Compositions containing an inorganic nitrogen-oxygen salt
- C06B31/28—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate
- C06B31/32—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate with a nitrated organic compound
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B25/00—Compositions containing a nitrated organic compound
- C06B25/34—Compositions containing a nitrated organic compound the compound being a nitrated acyclic, alicyclic or heterocyclic amine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Air Bags (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US78799768A | 1968-12-30 | 1968-12-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122692B true NO122692B (xx) | 1971-07-26 |
Family
ID=25143133
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO5138/69A NO122692B (xx) | 1968-12-30 | 1969-12-29 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3523047A (xx) |
| JP (1) | JPS491521B1 (xx) |
| BE (1) | BE743795A (xx) |
| CH (1) | CH555306A (xx) |
| FR (1) | FR2027374A1 (xx) |
| IL (1) | IL33590A (xx) |
| NL (1) | NL6919507A (xx) |
| NO (1) | NO122692B (xx) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4029747A (en) * | 1974-11-26 | 1977-06-14 | Molecular Energy Research Co., Inc. | Method of preparing inorganic monomeric and polymeric complexes and products so produced |
| GB2080279B (en) * | 1980-07-21 | 1984-02-15 | Ici Ltd | Emulsion type blasting agent containing hydrazine mononitrate |
| JPS57189720A (en) * | 1981-05-15 | 1982-11-22 | Mitsubishi Electric Corp | Electric discharge machining device |
| US4528049A (en) * | 1984-07-09 | 1985-07-09 | Udy Lex L | Seismic explosive composition |
| US5542704A (en) * | 1994-09-20 | 1996-08-06 | Oea, Inc. | Automotive inflatable safety system propellant with complexing agent |
| WO2020131099A1 (en) * | 2018-12-21 | 2020-06-25 | Aerojet Rocketdyne, Inc. | Reduced vapor-toxicity hydrazine composition |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2704706A (en) * | 1950-04-06 | 1955-03-22 | Olin Mathieson | Explosive composition |
| US3061489A (en) * | 1958-05-19 | 1962-10-30 | Commercial Solvents Corp | Stable propellants |
| US2978864A (en) * | 1958-05-19 | 1961-04-11 | Commercial Solvents Corp | Ammonium nitrate explosives |
| US3197348A (en) * | 1963-11-07 | 1965-07-27 | Skolnik Sol | Thixotropic propellant |
-
1968
- 1968-12-30 US US787997A patent/US3523047A/en not_active Expired - Lifetime
-
1969
- 1969-12-23 IL IL33590A patent/IL33590A/en unknown
- 1969-12-29 CH CH1932069A patent/CH555306A/xx not_active IP Right Cessation
- 1969-12-29 JP JP44105310A patent/JPS491521B1/ja active Pending
- 1969-12-29 NO NO5138/69A patent/NO122692B/no unknown
- 1969-12-29 BE BE743795D patent/BE743795A/xx unknown
- 1969-12-29 NL NL6919507A patent/NL6919507A/xx not_active Application Discontinuation
- 1969-12-30 FR FR6945423A patent/FR2027374A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| IL33590A (en) | 1976-03-31 |
| US3523047A (en) | 1970-08-04 |
| IL33590A0 (en) | 1970-03-22 |
| JPS491521B1 (xx) | 1974-01-14 |
| BE743795A (xx) | 1970-05-28 |
| CH555306A (de) | 1974-10-31 |
| NL6919507A (xx) | 1970-07-02 |
| DE1964537A1 (de) | 1970-12-17 |
| FR2027374A1 (xx) | 1970-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Fordham | High explosives and propellants | |
| US2929699A (en) | Explosive | |
| US3395056A (en) | Inorganic oxidizer salt-alcohol explosive slurry containing an alcohol thickening agent | |
| Oxley | The chemistry of explosives | |
| NO122692B (xx) | ||
| US1890112A (en) | Igniter charge for blasting caps | |
| Badgujar et al. | Thermal analysis and sensitivity studies on guanylurea dinitramide (GUDN or FOX-12) based melt cast explosive formulations | |
| US3111439A (en) | High explosive mixtures | |
| US3419443A (en) | Hydrazine containing explosive compositions | |
| US6214140B1 (en) | Development of new high energy blasting products using demilitarized ammonium picrate | |
| US3730789A (en) | Monopropellant composition including hydroxylamine perchlorate | |
| US9409830B1 (en) | Non-toxic primer mix | |
| Oxley | Explosives detection: potential problems | |
| JPS5813519B2 (ja) | 爆破組成物 | |
| US4874441A (en) | Explosive for warheads and solid rocket propellant | |
| Oxley | Non‐traditional explosives: Potential detection problems | |
| NO179972B (no) | Tennsatsmateriale, samt fremgangsmåte for fremstilling derav | |
| US2929698A (en) | Explosive | |
| US3580750A (en) | Tmetn-inorganic nitrate explosives blended with petroleum oil | |
| US2060522A (en) | Nitrosoguanidine as a priming ingredient | |
| US2425310A (en) | Explosive | |
| US1984846A (en) | Ignition composition | |
| US2829036A (en) | Fire damp proof explosive compositions | |
| US3356546A (en) | Safety blasting composition with a metal formate as a fuel | |
| EP4086238B1 (en) | Composition for forming an explosive comprising an emulsion of hydrogen peroxide and an oil type fuel |