NO121844B - - Google Patents
Download PDFInfo
- Publication number
- NO121844B NO121844B NO164729A NO16472966A NO121844B NO 121844 B NO121844 B NO 121844B NO 164729 A NO164729 A NO 164729A NO 16472966 A NO16472966 A NO 16472966A NO 121844 B NO121844 B NO 121844B
- Authority
- NO
- Norway
- Prior art keywords
- electrode
- plate
- shaft
- electrode body
- glass
- Prior art date
Links
- 239000011521 glass Substances 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 8
- 238000002844 melting Methods 0.000 claims description 5
- 230000004888 barrier function Effects 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 239000012809 cooling fluid Substances 0.000 claims 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 7
- 229910052750 molybdenum Inorganic materials 0.000 description 7
- 239000011733 molybdenum Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000002826 coolant Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000004020 conductor Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000006060 molten glass Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000110 cooling liquid Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000005485 electric heating Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000005304 optical glass Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/10—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only
- H03K4/26—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/48—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices
- H03K4/60—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor
- H03K4/62—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor using a semiconductor device operating as a switching device
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/48—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices
- H03K4/60—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor
- H03K4/62—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor using a semiconductor device operating as a switching device
- H03K4/64—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor using a semiconductor device operating as a switching device combined with means for generating the driving pulses
Landscapes
- Details Of Television Scanning (AREA)
- Dc-Dc Converters (AREA)
- Glass Melting And Manufacturing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6512106A NL6512106A (member.php) | 1965-09-17 | 1965-09-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121844B true NO121844B (member.php) | 1971-04-19 |
Family
ID=19794166
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164729A NO121844B (member.php) | 1965-09-17 | 1966-09-14 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3504224A (member.php) |
| JP (1) | JPS517965B1 (member.php) |
| AT (1) | AT267626B (member.php) |
| BE (1) | BE686951A (member.php) |
| BR (1) | BR6682818D0 (member.php) |
| CH (1) | CH461578A (member.php) |
| DK (1) | DK115479B (member.php) |
| ES (1) | ES331238A1 (member.php) |
| FI (1) | FI44137B (member.php) |
| FR (1) | FR1506384A (member.php) |
| GB (1) | GB1133528A (member.php) |
| NL (1) | NL6512106A (member.php) |
| NO (1) | NO121844B (member.php) |
| OA (1) | OA02137A (member.php) |
| SE (1) | SE321701B (member.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3654510A (en) * | 1969-11-14 | 1972-04-04 | Gen Electric | Direct drive vertical deflection system utilizing a storage capacitor and discharge tube in place of an output transformer |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL290577A (member.php) * | 1962-03-24 | |||
| NL302164A (member.php) * | 1962-12-19 |
-
1965
- 1965-09-17 NL NL6512106A patent/NL6512106A/xx unknown
-
1966
- 1966-09-09 OA OA52592A patent/OA02137A/xx unknown
- 1966-09-14 SE SE12364/66A patent/SE321701B/xx unknown
- 1966-09-14 CH CH1324866A patent/CH461578A/de unknown
- 1966-09-14 JP JP41060616A patent/JPS517965B1/ja active Pending
- 1966-09-14 AT AT867066A patent/AT267626B/de active
- 1966-09-14 NO NO164729A patent/NO121844B/no unknown
- 1966-09-14 FI FI2392/66A patent/FI44137B/fi active
- 1966-09-14 BR BR182818/66A patent/BR6682818D0/pt unknown
- 1966-09-14 DK DK475666AA patent/DK115479B/da unknown
- 1966-09-14 GB GB41103/66A patent/GB1133528A/en not_active Expired
- 1966-09-15 BE BE686951D patent/BE686951A/xx unknown
- 1966-09-15 US US579539A patent/US3504224A/en not_active Expired - Lifetime
- 1966-09-15 ES ES0331238A patent/ES331238A1/es not_active Expired
- 1966-09-16 FR FR76590A patent/FR1506384A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1462847A1 (de) | 1968-12-19 |
| DE1462847B2 (de) | 1972-07-27 |
| OA02137A (fr) | 1970-05-05 |
| CH461578A (de) | 1968-08-31 |
| ES331238A1 (es) | 1967-08-01 |
| NL6512106A (member.php) | 1967-03-20 |
| AT267626B (de) | 1969-01-10 |
| GB1133528A (en) | 1968-11-13 |
| SE321701B (member.php) | 1970-03-16 |
| FR1506384A (fr) | 1967-12-22 |
| DK115479B (da) | 1969-10-13 |
| BR6682818D0 (pt) | 1973-12-27 |
| US3504224A (en) | 1970-03-31 |
| BE686951A (member.php) | 1967-03-15 |
| JPS517965B1 (member.php) | 1976-03-12 |
| FI44137B (member.php) | 1971-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7530238B2 (en) | Heating apparatus with electrode for the conductive heating of melts | |
| NO850858L (no) | Elektrisk glassmelteovn | |
| JP2738423B2 (ja) | ガラス用電熱熔融炉 | |
| US1905534A (en) | Apparatus for and method of making glass | |
| GB2244368A (en) | A thermal shunt for a battery contained in a thermally-insulated container | |
| US11530152B2 (en) | Method for manufacturing glass article, and melting furnace | |
| US3967046A (en) | Apparatus and method for increasing furnace life in an electric furnace for thermoplastic materials | |
| NO163840B (no) | Elektrodekonstruksjon for et bad av smeltet metall. | |
| NO121844B (member.php) | ||
| US20070098036A1 (en) | Unit for conductively heatable melting | |
| GB2133126A (en) | Melting furnace | |
| US3388204A (en) | Glass furnace electrode | |
| JP3655308B2 (ja) | 電気的溶融装置 | |
| US3375314A (en) | Electrode for glass melting furnaces | |
| US1880540A (en) | Electrode for glass melting furnaces | |
| NO131829B (member.php) | ||
| US1933527A (en) | Electrically heated tank for glass | |
| US2397445A (en) | Electric resistance element and method of operating the same | |
| US3409725A (en) | Furnace electrode assembly | |
| US3391237A (en) | Electrical contact system for ceramic electrodes | |
| EP0096938B1 (en) | Electrodes for glass furnaces | |
| JP2007119299A (ja) | ガラス溶融用電極 | |
| JPH0826736A (ja) | ガラス電気熔融炉及びその熔融炉用の電極 | |
| AU2024254947A1 (en) | Electrode support for glass-making furnace | |
| US3740445A (en) | Electrode assemblies |