NO121319B - - Google Patents
Download PDFInfo
- Publication number
- NO121319B NO121319B NO167815A NO16781567A NO121319B NO 121319 B NO121319 B NO 121319B NO 167815 A NO167815 A NO 167815A NO 16781567 A NO16781567 A NO 16781567A NO 121319 B NO121319 B NO 121319B
- Authority
- NO
- Norway
- Prior art keywords
- water
- solution
- salts
- parts
- prepared
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 claims description 17
- 241001124076 Aphididae Species 0.000 claims description 7
- 239000012458 free base Substances 0.000 claims description 6
- 241000607479 Yersinia pestis Species 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 241000238876 Acari Species 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000003053 toxin Substances 0.000 claims description 3
- 231100000765 toxin Toxicity 0.000 claims description 3
- 150000008043 acidic salts Chemical class 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 231100000167 toxic agent Toxicity 0.000 claims 1
- 239000003440 toxic substance Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 150000003839 salts Chemical class 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- -1 dimethylcarbamyl halide Chemical class 0.000 description 11
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 150000001447 alkali salts Chemical class 0.000 description 8
- DWLVWMUCHSLGSU-UHFFFAOYSA-M n,n-dimethylcarbamate Chemical compound CN(C)C([O-])=O DWLVWMUCHSLGSU-UHFFFAOYSA-M 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- FUIQBJHUESBZNU-UHFFFAOYSA-N 2-[(dimethylazaniumyl)methyl]phenolate Chemical compound CN(C)CC1=CC=CC=C1O FUIQBJHUESBZNU-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 230000002824 aphicidal effect Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- IGXXOUGMPVOZFH-UHFFFAOYSA-N 2-(diethylaminomethyl)phenol Chemical compound CCN(CC)CC1=CC=CC=C1O IGXXOUGMPVOZFH-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 231100000614 poison Toxicity 0.000 description 4
- 239000002574 poison Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- WVCOMNRALZFVRQ-UHFFFAOYSA-N 4-[(dimethylamino)methyl]-2-methyl-5-propan-2-ylphenol Chemical compound CN(C)CC1=CC(=C(C=C1C(C)C)O)C WVCOMNRALZFVRQ-UHFFFAOYSA-N 0.000 description 3
- 238000006683 Mannich reaction Methods 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 150000003891 oxalate salts Chemical class 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000002516 radical scavenger Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NFVPEIKDMMISQO-UHFFFAOYSA-N 4-[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC=C(O)C=C1 NFVPEIKDMMISQO-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- DWLVWMUCHSLGSU-UHFFFAOYSA-N dimethylcarbamic acid Chemical class CN(C)C(O)=O DWLVWMUCHSLGSU-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GKQHIYSTBXDYNQ-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+]1=CC=CC=C1 GKQHIYSTBXDYNQ-UHFFFAOYSA-M 0.000 description 1
- OQVRGGFRZFMQGP-UHFFFAOYSA-N 2,3-bis(diethylaminomethyl)phenol Chemical compound CCN(CC)CC1=CC=CC(O)=C1CN(CC)CC OQVRGGFRZFMQGP-UHFFFAOYSA-N 0.000 description 1
- HCKPQGBXPQNMKU-UHFFFAOYSA-N 2,3-bis[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC=CC(O)=C1CN(C)C HCKPQGBXPQNMKU-UHFFFAOYSA-N 0.000 description 1
- CDKBMGVNKAKAPA-UHFFFAOYSA-N 2-[(dimethylamino)methyl]phenol;hydrochloride Chemical compound Cl.CN(C)CC1=CC=CC=C1O CDKBMGVNKAKAPA-UHFFFAOYSA-N 0.000 description 1
- KIGPVLRLTICSAG-UHFFFAOYSA-N 2-methyl-4-(morpholin-4-ylmethyl)-5-propan-2-ylphenol Chemical compound CC(C)C1=CC(O)=C(C)C=C1CN1CCOCC1 KIGPVLRLTICSAG-UHFFFAOYSA-N 0.000 description 1
- FEHUHAVQGZZDMW-UHFFFAOYSA-N 5-methyl-4-piperidin-1-yl-2-propan-2-ylphenol Chemical compound C1=C(O)C(C(C)C)=CC(N2CCCCC2)=C1C FEHUHAVQGZZDMW-UHFFFAOYSA-N 0.000 description 1
- 240000005020 Acaciella glauca Species 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005739 Bordeaux mixture Substances 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241001002197 Juglans mollis Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- MFSIEROJJKUHBQ-UHFFFAOYSA-N O.[Cl] Chemical compound O.[Cl] MFSIEROJJKUHBQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- BIWJNBZANLAXMG-YQELWRJZSA-N chloordaan Chemical compound ClC1=C(Cl)[C@@]2(Cl)C3CC(Cl)C(Cl)C3[C@]1(Cl)C2(Cl)Cl BIWJNBZANLAXMG-YQELWRJZSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000003499 redwood Nutrition 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 239000002435 venom Substances 0.000 description 1
- 231100000611 venom Toxicity 0.000 description 1
- 210000001048 venom Anatomy 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B10/00—Means for influencing, e.g. improving, the aerodynamic properties of projectiles or missiles; Arrangements on projectiles or missiles for stabilising, steering, range-reducing, range-increasing or fall-retarding
- F42B10/32—Range-reducing or range-increasing arrangements; Fall-retarding means
- F42B10/34—Tubular projectiles
Landscapes
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Toys (AREA)
- Powder Metallurgy (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
- Portable Nailing Machines And Staplers (AREA)
- Excavating Of Shafts Or Tunnels (AREA)
- Filling Or Discharging Of Gas Storage Vessels (AREA)
- Injection Moulding Of Plastics Or The Like (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0047391 | 1965-05-29 | ||
| DED0050224 | 1966-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121319B true NO121319B (enExample) | 1971-02-08 |
Family
ID=25972144
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162235A NO119168B (enExample) | 1965-05-29 | 1966-03-22 | |
| NO167815A NO121319B (enExample) | 1965-05-29 | 1967-04-20 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162235A NO119168B (enExample) | 1965-05-29 | 1966-03-22 |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US3442205A (enExample) |
| AT (1) | AT282412B (enExample) |
| BE (2) | BE681705A (enExample) |
| CH (2) | CH447885A (enExample) |
| DE (1) | DE1453827A1 (enExample) |
| FI (1) | FI44199C (enExample) |
| FR (2) | FR1470546A (enExample) |
| GB (2) | GB1143436A (enExample) |
| IL (1) | IL28076A (enExample) |
| LU (2) | LU50450A1 (enExample) |
| NL (2) | NL165287C (enExample) |
| NO (2) | NO119168B (enExample) |
| SE (2) | SE322442B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3485173A (en) * | 1968-02-06 | 1969-12-23 | Us Army | Variable centroid projectile |
| GB1590600A (en) * | 1976-10-30 | 1981-06-03 | Dynamit Nobel Ag | Bullet |
| CA1064321A (en) * | 1976-12-01 | 1979-10-16 | Maurice A. Laviolette | Tubular projectile |
| DE3064795D1 (en) * | 1979-03-10 | 1983-10-20 | Schirnecker Hans Ludwig | Projectile, e.g. for hunting, and method of manufacturing same |
| DE3243430C2 (de) * | 1982-11-24 | 1987-01-08 | Mauser-Werke Oberndorf Gmbh, 7238 Oberndorf | Geschoß mit einem rohrförmigen Körper |
| US4549487A (en) * | 1983-09-29 | 1985-10-29 | Pocal Industries, Inc. | Practice projectile with variable range |
| GB2192696B (en) * | 1986-07-15 | 1989-12-13 | Royal Ordnance Plc | Mortar projectiles |
| US5501155A (en) * | 1994-10-24 | 1996-03-26 | The United States Of America As Represented By The Secretary Of The Army | Hollow training round |
| CA2196977C (en) * | 1995-06-07 | 2000-08-22 | Jeffrey A. Brown | Aerodynamically stabilized projectile system for use against underwater objects |
| DE19917649C2 (de) | 1999-04-19 | 2001-10-31 | Nico Pyrotechnik | System aus einem Übungsgeschoß für eine automatische Schnellfeuerwaffe und einem Waffenrohr |
| EP1644690B1 (en) * | 2003-07-04 | 2009-08-05 | Industria Meccanica Zane' S.r.l. | Method of making inactive ballistic exercise elements and inactive ballistic element made by said method |
| ITVI20050010A1 (it) * | 2005-01-17 | 2006-07-18 | I M Z Spa | Metodo per la fabbricazione di un elemento balistico inerte per esercitazioni ed elemento balistico inerte fabbricato con tale metodo |
| USD813974S1 (en) | 2015-11-06 | 2018-03-27 | Vista Outdoor Operations Llc | Cartridge with an enhanced ball round |
| US10551154B2 (en) | 2017-01-20 | 2020-02-04 | Vista Outdoor Operations Llc | Rifle cartridge with improved bullet upset and separation |
| CA3065378A1 (en) * | 2017-05-30 | 2018-12-06 | Techventure Investments Pty Ltd | Single seal projectile |
| USD848569S1 (en) | 2018-01-20 | 2019-05-14 | Vista Outdoor Operations Llc | Rifle cartridge |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB185301033A (enExample) * | ||||
| US183009A (en) * | 1876-10-10 | Improvement in projectiles | ||
| GB189600989A (en) * | 1896-01-14 | 1896-11-14 | Jacques Luciani | Improvements in Projectiles. |
| GB190503921A (en) * | 1905-02-24 | 1905-11-23 | William Henry Harvey | Improvements in Armour-piercing Projectiles. |
| US1292388A (en) * | 1917-04-14 | 1919-01-21 | Bowers Arms And Munitions Company | Tubular projectile. |
| BE344530A (enExample) * | 1926-08-26 | |||
| GB393891A (en) * | 1933-01-14 | 1933-06-15 | Hirtenberger Patronen | Target practice projectile |
| US2324346A (en) * | 1941-09-05 | 1943-07-13 | Albree George Norman | Projectile for firearms |
| US2386054A (en) * | 1942-04-16 | 1945-10-02 | William N Mcgee | Projectile |
| US2433334A (en) * | 1944-01-11 | 1947-12-30 | Birkeland Leigh Forstner | Ammunition |
| US2996992A (en) * | 1944-09-26 | 1961-08-22 | Charles L Critchfield | Projectile |
| US3019733A (en) * | 1957-05-21 | 1962-02-06 | Harvey Machine Co Inc | Projectile construction |
| US3027840A (en) * | 1960-06-09 | 1962-04-03 | Paul V Hannas | Dummy ammunition cartridge |
-
1965
- 1965-05-29 DE DE19651453827 patent/DE1453827A1/de active Pending
-
1966
- 1966-02-14 LU LU50450A patent/LU50450A1/xx unknown
- 1966-03-02 FR FR51736A patent/FR1470546A/fr not_active Expired
- 1966-03-04 NL NL6602864.A patent/NL165287C/xx not_active IP Right Cessation
- 1966-03-22 NO NO162235A patent/NO119168B/no unknown
- 1966-04-01 SE SE4420/66A patent/SE322442B/xx unknown
- 1966-05-25 CH CH762366A patent/CH447885A/de unknown
- 1966-05-26 GB GB23750/66A patent/GB1143436A/en not_active Expired
- 1966-05-27 BE BE681705D patent/BE681705A/xx not_active IP Right Cessation
- 1966-06-02 US US554853A patent/US3442205A/en not_active Expired - Lifetime
-
1967
- 1967-04-20 NO NO167815A patent/NO121319B/no unknown
- 1967-04-21 FI FI671180A patent/FI44199C/fi active
- 1967-05-17 US US639089A patent/US3476049A/en not_active Expired - Lifetime
- 1967-05-24 LU LU53741D patent/LU53741A1/xx unknown
- 1967-05-25 CH CH736167A patent/CH473375A/de not_active IP Right Cessation
- 1967-05-30 IL IL28076A patent/IL28076A/en unknown
- 1967-05-31 GB GB25049/67A patent/GB1169079A/en not_active Expired
- 1967-05-31 AT AT507567A patent/AT282412B/de not_active IP Right Cessation
- 1967-05-31 FR FR108656A patent/FR92545E/fr not_active Expired
- 1967-05-31 SE SE7643/67*A patent/SE324122B/xx unknown
- 1967-05-31 BE BE699263D patent/BE699263A/xx unknown
- 1967-06-01 NL NLAANVRAGE6707638,A patent/NL168936C/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| DE1578103B2 (de) | 1976-02-26 |
| NL165287B (nl) | 1980-10-15 |
| NL6707638A (enExample) | 1967-12-04 |
| SE324122B (enExample) | 1970-05-19 |
| DE1578103A1 (de) | 1971-03-11 |
| FI44199C (fi) | 1971-09-10 |
| FI44199B (enExample) | 1971-06-01 |
| US3442205A (en) | 1969-05-06 |
| AT282412B (de) | 1970-06-25 |
| US3476049A (en) | 1969-11-04 |
| NL168936C (nl) | 1982-05-17 |
| NL165287C (nl) | 1981-03-16 |
| NO119168B (enExample) | 1970-03-31 |
| BE681705A (enExample) | 1966-10-31 |
| FR1470546A (fr) | 1967-02-24 |
| LU53741A1 (enExample) | 1967-07-24 |
| FR92545E (fr) | 1968-11-22 |
| NL6602864A (enExample) | 1966-11-30 |
| GB1143436A (en) | 1969-02-19 |
| CH447885A (de) | 1967-11-30 |
| CH473375A (de) | 1969-05-31 |
| SE322442B (enExample) | 1970-04-06 |
| BE699263A (enExample) | 1967-11-03 |
| DE1453827A1 (enExample) | 1969-10-23 |
| LU50450A1 (enExample) | 1966-04-14 |
| NL168936B (nl) | 1981-12-16 |
| IL28076A (en) | 1971-08-25 |
| GB1169079A (en) | 1969-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO121319B (enExample) | ||
| US2681879A (en) | Carbamic acid esters as well as pest combatting agents and a method of making the same | |
| US2503390A (en) | Alkyl mono-nitrophenyl thionobenzene-phosphonates and insecticidal compositions containing the same | |
| US2843519A (en) | Pesticidal compositions comprising dimethyl carbamates of dimethyl amino and hetero-substituted methyl phenols and method of using same | |
| US2687348A (en) | Herbicidal compositions | |
| US2679453A (en) | Method and composition for the control of undesired vegetation | |
| US3513240A (en) | Controlling beetles with 3,5-dimethyl-4-dimethylaminomethylphenyl - n - methylcarbamate | |
| US2553778A (en) | Parasiticidal compositions containing reaction products of mercapto acetic acid esters and perchloromethylmercaptan | |
| US3202573A (en) | Propargoxyphenyl nu-methylcarbamates and their use as pesticides | |
| US2582204A (en) | Tetraalkyl monothiopyrophosphate as an insecticide | |
| US2864741A (en) | Di (alkylmercapto) substituted vinyl, dialkyl phosphate and thiophosphate insecticides | |
| US3065066A (en) | Method of defoliating plants employing aminos | |
| US2192927A (en) | Insecticide | |
| US2898263A (en) | Pesticidal petroleum composition and use thereof | |
| US2696496A (en) | S-crotonyl alkylxanthates | |
| US2934420A (en) | Pesticidal and herbicidal compositions of matter | |
| US2728653A (en) | Tetrahydrofurfuryl ester of 4-chloro-2-methylphenoxyacetic acid | |
| US2774658A (en) | Herbicidal alkyl-amino-phosphonium halides | |
| US2703751A (en) | Herbicidal compositions | |
| US2992967A (en) | Insecticidal compositions comprising condensates of hexachlorocyclopentadiene with 1, 2-dichlorobutene-3 | |
| US2375095A (en) | Insecticides | |
| US3203855A (en) | Method for combating fungi with 2-(2, 2, 2-trichloro-1-hydroxyethylamino) pyridine | |
| US3116335A (en) | Organic sulfur-containing compounds | |
| US2745780A (en) | Acaricide composition containing 4. 4'-dichlorobenzilic acid esters | |
| US2766166A (en) | 2(dialkoxy-thionophosphonyl-thio)-1, 4-dithianes |