NO121319B - - Google Patents
Download PDFInfo
- Publication number
- NO121319B NO121319B NO167815A NO16781567A NO121319B NO 121319 B NO121319 B NO 121319B NO 167815 A NO167815 A NO 167815A NO 16781567 A NO16781567 A NO 16781567A NO 121319 B NO121319 B NO 121319B
- Authority
- NO
- Norway
- Prior art keywords
- water
- solution
- salts
- parts
- prepared
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 claims description 17
- 241001124076 Aphididae Species 0.000 claims description 7
- 239000012458 free base Substances 0.000 claims description 6
- 241000607479 Yersinia pestis Species 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 241000238876 Acari Species 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000003053 toxin Substances 0.000 claims description 3
- 231100000765 toxin Toxicity 0.000 claims description 3
- 150000008043 acidic salts Chemical class 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 231100000167 toxic agent Toxicity 0.000 claims 1
- 239000003440 toxic substance Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 150000003839 salts Chemical class 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- -1 dimethylcarbamyl halide Chemical class 0.000 description 11
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 150000001447 alkali salts Chemical class 0.000 description 8
- DWLVWMUCHSLGSU-UHFFFAOYSA-M n,n-dimethylcarbamate Chemical compound CN(C)C([O-])=O DWLVWMUCHSLGSU-UHFFFAOYSA-M 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- FUIQBJHUESBZNU-UHFFFAOYSA-N 2-[(dimethylazaniumyl)methyl]phenolate Chemical compound CN(C)CC1=CC=CC=C1O FUIQBJHUESBZNU-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 230000002824 aphicidal effect Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- IGXXOUGMPVOZFH-UHFFFAOYSA-N 2-(diethylaminomethyl)phenol Chemical compound CCN(CC)CC1=CC=CC=C1O IGXXOUGMPVOZFH-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 231100000614 poison Toxicity 0.000 description 4
- 239000002574 poison Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- WVCOMNRALZFVRQ-UHFFFAOYSA-N 4-[(dimethylamino)methyl]-2-methyl-5-propan-2-ylphenol Chemical compound CN(C)CC1=CC(=C(C=C1C(C)C)O)C WVCOMNRALZFVRQ-UHFFFAOYSA-N 0.000 description 3
- 238000006683 Mannich reaction Methods 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 150000003891 oxalate salts Chemical class 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000002516 radical scavenger Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NFVPEIKDMMISQO-UHFFFAOYSA-N 4-[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC=C(O)C=C1 NFVPEIKDMMISQO-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- DWLVWMUCHSLGSU-UHFFFAOYSA-N dimethylcarbamic acid Chemical class CN(C)C(O)=O DWLVWMUCHSLGSU-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GKQHIYSTBXDYNQ-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+]1=CC=CC=C1 GKQHIYSTBXDYNQ-UHFFFAOYSA-M 0.000 description 1
- OQVRGGFRZFMQGP-UHFFFAOYSA-N 2,3-bis(diethylaminomethyl)phenol Chemical compound CCN(CC)CC1=CC=CC(O)=C1CN(CC)CC OQVRGGFRZFMQGP-UHFFFAOYSA-N 0.000 description 1
- HCKPQGBXPQNMKU-UHFFFAOYSA-N 2,3-bis[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC=CC(O)=C1CN(C)C HCKPQGBXPQNMKU-UHFFFAOYSA-N 0.000 description 1
- CDKBMGVNKAKAPA-UHFFFAOYSA-N 2-[(dimethylamino)methyl]phenol;hydrochloride Chemical compound Cl.CN(C)CC1=CC=CC=C1O CDKBMGVNKAKAPA-UHFFFAOYSA-N 0.000 description 1
- KIGPVLRLTICSAG-UHFFFAOYSA-N 2-methyl-4-(morpholin-4-ylmethyl)-5-propan-2-ylphenol Chemical compound CC(C)C1=CC(O)=C(C)C=C1CN1CCOCC1 KIGPVLRLTICSAG-UHFFFAOYSA-N 0.000 description 1
- FEHUHAVQGZZDMW-UHFFFAOYSA-N 5-methyl-4-piperidin-1-yl-2-propan-2-ylphenol Chemical compound C1=C(O)C(C(C)C)=CC(N2CCCCC2)=C1C FEHUHAVQGZZDMW-UHFFFAOYSA-N 0.000 description 1
- 240000005020 Acaciella glauca Species 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005739 Bordeaux mixture Substances 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241001002197 Juglans mollis Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- MFSIEROJJKUHBQ-UHFFFAOYSA-N O.[Cl] Chemical compound O.[Cl] MFSIEROJJKUHBQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- BIWJNBZANLAXMG-YQELWRJZSA-N chloordaan Chemical compound ClC1=C(Cl)[C@@]2(Cl)C3CC(Cl)C(Cl)C3[C@]1(Cl)C2(Cl)Cl BIWJNBZANLAXMG-YQELWRJZSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000003499 redwood Nutrition 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 239000002435 venom Substances 0.000 description 1
- 231100000611 venom Toxicity 0.000 description 1
- 210000001048 venom Anatomy 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B10/00—Means for influencing, e.g. improving, the aerodynamic properties of projectiles or missiles; Arrangements on projectiles or missiles for stabilising, steering, range-reducing, range-increasing or fall-retarding
- F42B10/32—Range-reducing or range-increasing arrangements; Fall-retarding means
- F42B10/34—Tubular projectiles
Landscapes
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Toys (AREA)
- Portable Nailing Machines And Staplers (AREA)
- Filling Or Discharging Of Gas Storage Vessels (AREA)
- Injection Moulding Of Plastics Or The Like (AREA)
- Excavating Of Shafts Or Tunnels (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Powder Metallurgy (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0047391 | 1965-05-29 | ||
| DED0050224 | 1966-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121319B true NO121319B (OSRAM) | 1971-02-08 |
Family
ID=25972144
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162235A NO119168B (OSRAM) | 1965-05-29 | 1966-03-22 | |
| NO167815A NO121319B (OSRAM) | 1965-05-29 | 1967-04-20 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162235A NO119168B (OSRAM) | 1965-05-29 | 1966-03-22 |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US3442205A (OSRAM) |
| AT (1) | AT282412B (OSRAM) |
| BE (2) | BE681705A (OSRAM) |
| CH (2) | CH447885A (OSRAM) |
| DE (1) | DE1453827A1 (OSRAM) |
| FI (1) | FI44199C (OSRAM) |
| FR (2) | FR1470546A (OSRAM) |
| GB (2) | GB1143436A (OSRAM) |
| IL (1) | IL28076A (OSRAM) |
| LU (2) | LU50450A1 (OSRAM) |
| NL (2) | NL165287C (OSRAM) |
| NO (2) | NO119168B (OSRAM) |
| SE (2) | SE322442B (OSRAM) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3485173A (en) * | 1968-02-06 | 1969-12-23 | Us Army | Variable centroid projectile |
| GB1590600A (en) * | 1976-10-30 | 1981-06-03 | Dynamit Nobel Ag | Bullet |
| CA1064321A (en) * | 1976-12-01 | 1979-10-16 | Maurice A. Laviolette | Tubular projectile |
| EP0015574B1 (de) * | 1979-03-10 | 1983-09-14 | Hans-Ludwig Schirneker | Geschoss, beispielsweise für Jagdzwecke, und Verfahren zu seiner Herstellung |
| DE3243430C2 (de) * | 1982-11-24 | 1987-01-08 | Mauser-Werke Oberndorf Gmbh, 7238 Oberndorf | Geschoß mit einem rohrförmigen Körper |
| US4549487A (en) * | 1983-09-29 | 1985-10-29 | Pocal Industries, Inc. | Practice projectile with variable range |
| GB2192696B (en) * | 1986-07-15 | 1989-12-13 | Royal Ordnance Plc | Mortar projectiles |
| US5501155A (en) * | 1994-10-24 | 1996-03-26 | The United States Of America As Represented By The Secretary Of The Army | Hollow training round |
| JP3065669B2 (ja) * | 1995-06-07 | 2000-07-17 | レイセオン・カンパニー | 水中の目標に対して使用するための航学力学的に安定した弾丸システム |
| DE19917649C2 (de) | 1999-04-19 | 2001-10-31 | Nico Pyrotechnik | System aus einem Übungsgeschoß für eine automatische Schnellfeuerwaffe und einem Waffenrohr |
| EP1644690B1 (en) * | 2003-07-04 | 2009-08-05 | Industria Meccanica Zane' S.r.l. | Method of making inactive ballistic exercise elements and inactive ballistic element made by said method |
| ITVI20050010A1 (it) * | 2005-01-17 | 2006-07-18 | I M Z Spa | Metodo per la fabbricazione di un elemento balistico inerte per esercitazioni ed elemento balistico inerte fabbricato con tale metodo |
| USD813974S1 (en) | 2015-11-06 | 2018-03-27 | Vista Outdoor Operations Llc | Cartridge with an enhanced ball round |
| US10551154B2 (en) | 2017-01-20 | 2020-02-04 | Vista Outdoor Operations Llc | Rifle cartridge with improved bullet upset and separation |
| CA3065378A1 (en) * | 2017-05-30 | 2018-12-06 | Techventure Investments Pty Ltd | Single seal projectile |
| USD848569S1 (en) | 2018-01-20 | 2019-05-14 | Vista Outdoor Operations Llc | Rifle cartridge |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US183009A (en) * | 1876-10-10 | Improvement in projectiles | ||
| GB185301033A (OSRAM) * | ||||
| GB189600989A (en) * | 1896-01-14 | 1896-11-14 | Jacques Luciani | Improvements in Projectiles. |
| GB190503921A (en) * | 1905-02-24 | 1905-11-23 | William Henry Harvey | Improvements in Armour-piercing Projectiles. |
| US1292388A (en) * | 1917-04-14 | 1919-01-21 | Bowers Arms And Munitions Company | Tubular projectile. |
| BE344530A (OSRAM) * | 1926-08-26 | |||
| GB393891A (en) * | 1933-01-14 | 1933-06-15 | Hirtenberger Patronen | Target practice projectile |
| US2324346A (en) * | 1941-09-05 | 1943-07-13 | Albree George Norman | Projectile for firearms |
| US2386054A (en) * | 1942-04-16 | 1945-10-02 | William N Mcgee | Projectile |
| US2433334A (en) * | 1944-01-11 | 1947-12-30 | Birkeland Leigh Forstner | Ammunition |
| US2996992A (en) * | 1944-09-26 | 1961-08-22 | Charles L Critchfield | Projectile |
| US3019733A (en) * | 1957-05-21 | 1962-02-06 | Harvey Machine Co Inc | Projectile construction |
| US3027840A (en) * | 1960-06-09 | 1962-04-03 | Paul V Hannas | Dummy ammunition cartridge |
-
1965
- 1965-05-29 DE DE19651453827 patent/DE1453827A1/de active Pending
-
1966
- 1966-02-14 LU LU50450A patent/LU50450A1/xx unknown
- 1966-03-02 FR FR51736A patent/FR1470546A/fr not_active Expired
- 1966-03-04 NL NL6602864.A patent/NL165287C/xx not_active IP Right Cessation
- 1966-03-22 NO NO162235A patent/NO119168B/no unknown
- 1966-04-01 SE SE4420/66A patent/SE322442B/xx unknown
- 1966-05-25 CH CH762366A patent/CH447885A/de unknown
- 1966-05-26 GB GB23750/66A patent/GB1143436A/en not_active Expired
- 1966-05-27 BE BE681705D patent/BE681705A/xx not_active IP Right Cessation
- 1966-06-02 US US554853A patent/US3442205A/en not_active Expired - Lifetime
-
1967
- 1967-04-20 NO NO167815A patent/NO121319B/no unknown
- 1967-04-21 FI FI671180A patent/FI44199C/fi active
- 1967-05-17 US US639089A patent/US3476049A/en not_active Expired - Lifetime
- 1967-05-24 LU LU53741D patent/LU53741A1/xx unknown
- 1967-05-25 CH CH736167A patent/CH473375A/de not_active IP Right Cessation
- 1967-05-30 IL IL28076A patent/IL28076A/en unknown
- 1967-05-31 FR FR108656A patent/FR92545E/fr not_active Expired
- 1967-05-31 BE BE699263D patent/BE699263A/xx unknown
- 1967-05-31 GB GB25049/67A patent/GB1169079A/en not_active Expired
- 1967-05-31 SE SE7643/67*A patent/SE324122B/xx unknown
- 1967-05-31 AT AT507567A patent/AT282412B/de not_active IP Right Cessation
- 1967-06-01 NL NLAANVRAGE6707638,A patent/NL168936C/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| IL28076A (en) | 1971-08-25 |
| LU50450A1 (OSRAM) | 1966-04-14 |
| GB1143436A (en) | 1969-02-19 |
| NL6602864A (OSRAM) | 1966-11-30 |
| NL6707638A (OSRAM) | 1967-12-04 |
| FI44199C (fi) | 1971-09-10 |
| NL168936C (nl) | 1982-05-17 |
| FR92545E (fr) | 1968-11-22 |
| CH473375A (de) | 1969-05-31 |
| DE1578103A1 (de) | 1971-03-11 |
| BE681705A (OSRAM) | 1966-10-31 |
| BE699263A (OSRAM) | 1967-11-03 |
| US3442205A (en) | 1969-05-06 |
| US3476049A (en) | 1969-11-04 |
| DE1453827A1 (OSRAM) | 1969-10-23 |
| LU53741A1 (OSRAM) | 1967-07-24 |
| FR1470546A (fr) | 1967-02-24 |
| AT282412B (de) | 1970-06-25 |
| SE322442B (OSRAM) | 1970-04-06 |
| FI44199B (OSRAM) | 1971-06-01 |
| NL168936B (nl) | 1981-12-16 |
| NL165287B (nl) | 1980-10-15 |
| NO119168B (OSRAM) | 1970-03-31 |
| CH447885A (de) | 1967-11-30 |
| SE324122B (OSRAM) | 1970-05-19 |
| DE1578103B2 (de) | 1976-02-26 |
| NL165287C (nl) | 1981-03-16 |
| GB1169079A (en) | 1969-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO121319B (OSRAM) | ||
| US2681879A (en) | Carbamic acid esters as well as pest combatting agents and a method of making the same | |
| US2843519A (en) | Pesticidal compositions comprising dimethyl carbamates of dimethyl amino and hetero-substituted methyl phenols and method of using same | |
| US2687348A (en) | Herbicidal compositions | |
| US2679453A (en) | Method and composition for the control of undesired vegetation | |
| US3513240A (en) | Controlling beetles with 3,5-dimethyl-4-dimethylaminomethylphenyl - n - methylcarbamate | |
| US2553778A (en) | Parasiticidal compositions containing reaction products of mercapto acetic acid esters and perchloromethylmercaptan | |
| US3202573A (en) | Propargoxyphenyl nu-methylcarbamates and their use as pesticides | |
| US3507962A (en) | Controlling leafminer insects with selected carbamate insecticides,including 3,5-dimethyl-4-dimethylamino-methyl phenyl-n-methylcarbamate | |
| US3652770A (en) | Combatting phytopathogenic fungi on plants with sub-phytotoxic fungicidally effective amounts of herbicidal oximes of 3 5-dihalosalicylaldehyde | |
| US2582204A (en) | Tetraalkyl monothiopyrophosphate as an insecticide | |
| US3065066A (en) | Method of defoliating plants employing aminos | |
| US2192927A (en) | Insecticide | |
| US2898263A (en) | Pesticidal petroleum composition and use thereof | |
| US2696496A (en) | S-crotonyl alkylxanthates | |
| US2934420A (en) | Pesticidal and herbicidal compositions of matter | |
| US2728653A (en) | Tetrahydrofurfuryl ester of 4-chloro-2-methylphenoxyacetic acid | |
| US2774658A (en) | Herbicidal alkyl-amino-phosphonium halides | |
| US3433622A (en) | Method of defoliating plants with organomercurials | |
| US2992967A (en) | Insecticidal compositions comprising condensates of hexachlorocyclopentadiene with 1, 2-dichlorobutene-3 | |
| US2375095A (en) | Insecticides | |
| US3203855A (en) | Method for combating fungi with 2-(2, 2, 2-trichloro-1-hydroxyethylamino) pyridine | |
| US3116335A (en) | Organic sulfur-containing compounds | |
| US2766166A (en) | 2(dialkoxy-thionophosphonyl-thio)-1, 4-dithianes | |
| US2936262A (en) | Diels-alder adduct of tetrachloro cyclopentadiene with quinone as a fungicide |