NO117727B - - Google Patents
Download PDFInfo
- Publication number
- NO117727B NO117727B NO170789A NO17078967A NO117727B NO 117727 B NO117727 B NO 117727B NO 170789 A NO170789 A NO 170789A NO 17078967 A NO17078967 A NO 17078967A NO 117727 B NO117727 B NO 117727B
- Authority
- NO
- Norway
- Prior art keywords
- melting point
- tetrazole
- well
- sensitive
- coupling elements
- Prior art date
Links
- 230000008878 coupling Effects 0.000 claims description 5
- 238000010168 coupling process Methods 0.000 claims description 5
- 238000005859 coupling reaction Methods 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 4
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 claims description 4
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 claims description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 claims description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 150000003536 tetrazoles Chemical class 0.000 claims description 3
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 claims description 2
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 2
- 239000005751 Copper oxide Substances 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229910000431 copper oxide Inorganic materials 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 235000010333 potassium nitrate Nutrition 0.000 claims description 2
- 239000004323 potassium nitrate Substances 0.000 claims description 2
- 239000003380 propellant Substances 0.000 description 3
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003721 gunpowder Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B43/00—Compositions characterised by explosive or thermic constituents not provided for in groups C06B25/00 - C06B41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Air Bags (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0052299 | 1967-02-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117727B true NO117727B (enExample) | 1969-09-15 |
Family
ID=7054058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO170789A NO117727B (enExample) | 1967-02-17 | 1967-12-01 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3468730A (enExample) |
| BE (1) | BE710782A (enExample) |
| FR (1) | FR1556513A (enExample) |
| GB (1) | GB1210461A (enExample) |
| NL (1) | NL6800604A (enExample) |
| NO (1) | NO117727B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5015309A (en) * | 1989-05-04 | 1991-05-14 | Morton International, Inc. | Gas generant compositions containing salts of 5-nitrobarbituric acid, salts of nitroorotic acid, or 5-nitrouracil |
| US5197758A (en) * | 1991-10-09 | 1993-03-30 | Morton International, Inc. | Non-azide gas generant formulation, method, and apparatus |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| JP3182010B2 (ja) * | 1992-11-30 | 2001-07-03 | 東洋化成工業株式会社 | エアーバック用ガス発生剤 |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5468866A (en) * | 1994-01-04 | 1995-11-21 | Thiokol Corporation | Methods for synthesizing and processing bis-(1(2)H-tetrazol-5-yl)-amine |
| US5451682A (en) * | 1994-01-10 | 1995-09-19 | Thiokol Corporation | Method for synthesizing 5-aminotetrazole |
| US5516377A (en) * | 1994-01-10 | 1996-05-14 | Thiokol Corporation | Gas generating compositions based on salts of 5-nitraminotetrazole |
| US5472535A (en) * | 1995-04-06 | 1995-12-05 | Morton International, Inc. | Gas generant compositions containing stabilizer |
| US5514230A (en) * | 1995-04-14 | 1996-05-07 | Automotive Systems Laboratory, Inc. | Nonazide gas generating compositions with a built-in catalyst |
| US5685562A (en) * | 1995-08-16 | 1997-11-11 | Morton International, Inc. | Automotive airbags containing eliminators of undesirable gases |
| US5844164A (en) * | 1996-02-23 | 1998-12-01 | Breed Automotive Technologies, Inc. | Gas generating device with specific composition |
| US5661261A (en) * | 1996-02-23 | 1997-08-26 | Breed Automotive Technology, Inc. | Gas generating composition |
| US5629494A (en) * | 1996-02-29 | 1997-05-13 | Morton International, Inc. | Hydrogen-less, non-azide gas generants |
| US20040154711A1 (en) * | 1998-12-30 | 2004-08-12 | Per Sjoberg | Gas-generating material for gas-actuated car safety devices |
| SE513315C2 (sv) * | 1998-12-30 | 2000-08-21 | Nexplo Bofors Ab | Sätt att framställa gasbildare för gasdrivna bilsäkerhetsdetaljer och pyrotekiska gasbildare framställd i enlighet med sättet |
| SE514336C2 (sv) | 1999-05-12 | 2001-02-12 | Bofors Bepab Ab | Sammansatt gasbildare för gasdrivna bilsäkerhetsdetaljer |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1511771A (en) * | 1921-08-22 | 1924-10-14 | Rathsburg Hans | Explosive compound for primers and detonators |
| US3055911A (en) * | 1958-04-29 | 1962-09-25 | William G Finnegan | Substituted tetrazoles |
| US3096312A (en) * | 1960-08-26 | 1963-07-02 | Ronald A Henry | Polymers and copolymers of 5-vinyltetrazole |
| US3138609A (en) * | 1962-10-15 | 1964-06-23 | Wayne R Carpenter | Process for synthesis of various tetrazoles |
| US3386968A (en) * | 1962-11-15 | 1968-06-04 | Navy Usa | Tetrazole polymers |
| US3354172A (en) * | 1966-04-12 | 1967-11-21 | American Cyanamid Co | Triaminoguanidinium 5-aminotetrazo-late and its preparation |
-
1967
- 1967-12-01 NO NO170789A patent/NO117727B/no unknown
-
1968
- 1968-01-15 NL NL6800604A patent/NL6800604A/xx unknown
- 1968-02-13 FR FR1556513D patent/FR1556513A/fr not_active Expired
- 1968-02-14 BE BE710782D patent/BE710782A/xx unknown
- 1968-02-15 GB GB7550/68A patent/GB1210461A/en not_active Expired
- 1968-02-16 US US705912A patent/US3468730A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE710782A (enExample) | 1968-06-17 |
| US3468730A (en) | 1969-09-23 |
| GB1210461A (en) | 1970-10-28 |
| FR1556513A (enExample) | 1969-02-07 |
| NL6800604A (enExample) | 1968-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO117727B (enExample) | ||
| CA2029751C (en) | Modular, electronic safe-arm device | |
| US2486362A (en) | Acceleration switch | |
| NO870832L (no) | Aktuator for detonator og detonatorsystem til bruk ved sprengningsarbeider. | |
| NO339841B1 (no) | Seismisk ladningspakke og system for anvendelse i seismiske undersøkelser, og fremgangsmåte for seismisk undersøkelse | |
| US10234248B1 (en) | Micro-electric-pyrotechnic energy-harvesting apparatus for munitions | |
| US3589294A (en) | System for multiple point simultaneous initiation of explosive charges | |
| US2892411A (en) | Crystal point detonation fuze | |
| US3359904A (en) | Piezoelectric projectile fuze | |
| US3162127A (en) | Delay train for fuze | |
| US12123696B2 (en) | Inertial igniters for low-G and long-duration firing acceleration munitions and the like | |
| US3618523A (en) | Stab-electric detonator | |
| NO170789B (no) | Sammenbrettbart ark | |
| EP0232602A3 (en) | Detonation safety mechanism | |
| NO119402B (enExample) | ||
| US3165059A (en) | Lanyard operated, delay arming mechanism | |
| GB911587A (en) | Devices for initiating detonations and deflagrations | |
| US7069861B1 (en) | Micro-scale firetrain for ultra-miniature electro-mechanical safety and arming device | |
| ATE268000T1 (de) | Sicherheitsvorrichtung für einen geschosszünder | |
| US8037824B1 (en) | Exploding foil initiator actuated cartridge | |
| US1372617A (en) | Submarine mine | |
| US3001478A (en) | Safety device for rocket steered projectiles | |
| US9921041B1 (en) | Primerless digital time-delay initiator system | |
| GB926680A (en) | Detonator for explosive charges | |
| US2938432A (en) | Remote control device |