NO116466B - - Google Patents
Download PDFInfo
- Publication number
- NO116466B NO116466B NO16319466A NO16319466A NO116466B NO 116466 B NO116466 B NO 116466B NO 16319466 A NO16319466 A NO 16319466A NO 16319466 A NO16319466 A NO 16319466A NO 116466 B NO116466 B NO 116466B
- Authority
- NO
- Norway
- Prior art keywords
- group
- carbon atoms
- substituted
- parts
- compound
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 125000001931 aliphatic group Chemical class 0.000 claims description 7
- 239000003945 anionic surfactant Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 125000003118 aryl group Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000047 product Substances 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 239000007859 condensation product Substances 0.000 claims description 2
- 125000001033 ether group Chemical group 0.000 claims description 2
- 125000000468 ketone group Chemical group 0.000 claims description 2
- 229940125904 compound 1 Drugs 0.000 claims 2
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 229940125782 compound 2 Drugs 0.000 claims 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 150000008054 sulfonate salts Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 16
- 239000007795 chemical reaction product Substances 0.000 description 13
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000005639 Lauric acid Substances 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- -1 hydroxyl compound Chemical class 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000012459 cleaning agent Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- QZXSMBBFBXPQHI-UHFFFAOYSA-N N-(dodecanoyl)ethanolamine Chemical compound CCCCCCCCCCCC(=O)NCCO QZXSMBBFBXPQHI-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001721 carbon Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 125000001419 myristoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004028 organic sulfates Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229940104261 taurate Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000008403 very hard water Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Landscapes
- Detergent Compositions (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO16319466A NO116466B (enExample) | 1961-03-22 | 1966-05-27 |
Applications Claiming Priority (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9743461A | 1961-03-22 | 1961-03-22 | |
| US16461562A | 1962-01-05 | 1962-01-05 | |
| NO14373562 | 1962-03-21 | ||
| US28693563 US3161654A (en) | 1962-01-05 | 1963-06-11 | alpha-(1-aroyl-3-indolyl) alkanoic acids |
| US296451A US3201414A (en) | 1963-07-22 | 1963-07-22 | New 1-heteroacyl-3-indolyl aliphatic acids |
| US31047763A | 1963-09-20 | 1963-09-20 | |
| US31045463A | 1963-09-20 | 1963-09-20 | |
| US314503A US3242185A (en) | 1963-10-07 | 1963-10-07 | Lower aliphatic acids, salts and derivatives thereof |
| US32386363A | 1963-11-04 | 1963-11-04 | |
| US321328A US3275644A (en) | 1962-01-05 | 1963-11-04 | Certain 1-azolylindol-3-ylaliphatic acids |
| US321686A US3275645A (en) | 1962-01-05 | 1963-11-06 | N-(1-acyl-3-indolyl)-acids |
| US437338A US3338921A (en) | 1962-01-05 | 1965-01-26 | Thenoic and furoic acids |
| US442152A US3328423A (en) | 1962-01-05 | 1965-03-23 | alpha-(3-indolyl)-cyclopropyl lower aliphatic acids |
| US528020A US3316267A (en) | 1962-01-05 | 1966-02-15 | Indolyl acids |
| NO16319466A NO116466B (enExample) | 1961-03-22 | 1966-05-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO116466B true NO116466B (enExample) | 1969-03-31 |
Family
ID=27585427
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16319466A NO116466B (enExample) | 1961-03-22 | 1966-05-27 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO116466B (enExample) |
-
1966
- 1966-05-27 NO NO16319466A patent/NO116466B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4229313A (en) | Alkali metal hypochlorite bleaching and cleaning compositions thickened with branch chain amine oxides | |
| FI66399C (fi) | Foerfarande foer framstaellning av katjoniska staerkelseetrar | |
| CA1326024C (en) | Low foam alkali surface active composition and certain novel compounds useful therein | |
| GB849907A (en) | Dichlorocyanuric acid and compositions containing the same | |
| US2820043A (en) | Preparation of imidazoline propionic acid derivatives | |
| US2268395A (en) | Quaternary ammonium compounds | |
| US2653156A (en) | Quaternary ammonium compounds and process for producing the same | |
| NO150275B (no) | Organiske nitrogenholdige forbindelser og fremgangsmaate til deres fremsilling, samt anvendelse av forbindelsene i sjampo | |
| GB930296A (en) | The preparation of acylamino compounds | |
| US3196173A (en) | Aminoalkanesulfonic acids | |
| US2781357A (en) | Imidazoline derivatives and process | |
| US3803137A (en) | Mixtures of aliphatic amines and quaternary ammonium compounds thereof | |
| NO155668B (no) | Vandig blekemiddel med rensevirkning. | |
| US2970160A (en) | Process for making amphoteric surface active agents | |
| NO116466B (enExample) | ||
| US2781349A (en) | Certain salts of 2-hydrocarbon imidazolinium di-alkanoic acid salts of detergent sulfonic acids or sulfate acids | |
| US2644831A (en) | Alkali metal and ammonium sulfates of hydroxy ethers | |
| US2326270A (en) | Chemical compound and process | |
| US2993918A (en) | Novel compositions of matter and methods for preparing them | |
| US2781391A (en) | Detergent sulphonic acid and sulphate salts of certain amphoteric detergents | |
| US2907791A (en) | Amphoteric surface-active organic compounds | |
| DE2448388A1 (de) | Durch mikroorganismen abbaubare netzmittel | |
| US2781372A (en) | Detergent sulphonic acid and sulphate salts of certain amphoteric detergents | |
| US2316636A (en) | Polycarboxylic acids | |
| US2786869A (en) | Nu-trialkylcarbinyl-nu-(hydroxyethyl-polyoxyethyl) glycines |