NL7513670A - Roentgenbuis met draaianode. - Google Patents
Roentgenbuis met draaianode.Info
- Publication number
- NL7513670A NL7513670A NL7513670A NL7513670A NL7513670A NL 7513670 A NL7513670 A NL 7513670A NL 7513670 A NL7513670 A NL 7513670A NL 7513670 A NL7513670 A NL 7513670A NL 7513670 A NL7513670 A NL 7513670A
- Authority
- NL
- Netherlands
- Prior art keywords
- twist
- code
- rose
- tube
- rose tube
- Prior art date
Links
- 241000220317 Rosa Species 0.000 title 1
- ONCZDRURRATYFI-QTCHDTBASA-N methyl (2z)-2-methoxyimino-2-[2-[[(e)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate Chemical compound CO\N=C(/C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-QTCHDTBASA-N 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J35/00—X-ray tubes
- H01J35/02—Details
- H01J35/04—Electrodes ; Mutual position thereof; Constructional adaptations therefor
- H01J35/08—Anodes; Anti cathodes
- H01J35/10—Rotary anodes; Arrangements for rotating anodes; Cooling rotary anodes
- H01J35/101—Arrangements for rotating anodes, e.g. supporting means, means for greasing, means for sealing the axle or means for shielding or protecting the driving
- H01J35/1017—Bearings for rotating anodes
- H01J35/103—Magnetic bearings
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J35/00—X-ray tubes
- H01J35/02—Details
- H01J35/04—Electrodes ; Mutual position thereof; Constructional adaptations therefor
- H01J35/08—Anodes; Anti cathodes
- H01J35/10—Rotary anodes; Arrangements for rotating anodes; Cooling rotary anodes
- H01J35/101—Arrangements for rotating anodes, e.g. supporting means, means for greasing, means for sealing the axle or means for shielding or protecting the driving
- H01J35/1017—Bearings for rotating anodes
- H01J35/1024—Rolling bearings
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J2235/00—X-ray tubes
- H01J2235/10—Drive means for anode (target) substrate
- H01J2235/1026—Means (motors) for driving the target (anode)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2455974A DE2455974C3 (de) | 1974-11-27 | 1974-11-27 | Drehanodenröntgenröhre |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL7513670A true NL7513670A (nl) | 1976-05-31 |
Family
ID=5931797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL7513670A NL7513670A (nl) | 1974-11-27 | 1975-11-24 | Roentgenbuis met draaianode. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4024424A (enExample) |
| JP (1) | JPS5543586B2 (enExample) |
| BE (1) | BE835925A (enExample) |
| BR (1) | BR7507765A (enExample) |
| CA (1) | CA1043844A (enExample) |
| DE (1) | DE2455974C3 (enExample) |
| FR (1) | FR2293054A1 (enExample) |
| GB (1) | GB1527239A (enExample) |
| IT (1) | IT1051273B (enExample) |
| NL (1) | NL7513670A (enExample) |
| SE (1) | SE409527B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2506841C2 (de) * | 1975-02-18 | 1986-07-03 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Hochspannungs-Vakuumröhre |
| DE2601529C2 (de) * | 1976-01-16 | 1982-04-29 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Magnetische Lagerung der Drehwelle der Drehanode für eine Röntgenröhre |
| NL7713634A (nl) * | 1977-12-09 | 1979-06-12 | Philips Nv | Roentgenbuis met draaianode. |
| EP0009946A1 (en) * | 1978-10-02 | 1980-04-16 | Pfizer Inc. | X-ray tube |
| DE2845007C2 (de) * | 1978-10-16 | 1983-05-05 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Drehanoden-Röntgenröhre mit einem Metallkolben |
| US4309637A (en) * | 1979-11-13 | 1982-01-05 | Emi Limited | Rotating anode X-ray tube |
| DE3016376A1 (de) * | 1980-04-28 | 1981-10-29 | Siemens AG, 1000 Berlin und 8000 München | Verfahren und einrichtung zum betrieb von drehanoden-roentgenroehren |
| DE3116169A1 (de) * | 1981-04-23 | 1982-11-11 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Hochspannungs-vakuumroehre, insbesondere roentgenroehre |
| DE3142281A1 (de) * | 1981-10-24 | 1983-05-05 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Roentgenroehre mit einem metallteil und einer gegenueber dem metallteil positive hochspannung fuehrenden elektrode |
| US4884292A (en) * | 1981-12-02 | 1989-11-28 | Medical Electronic Imaging Corporation | Air-cooled X-ray tube |
| US4811375A (en) * | 1981-12-02 | 1989-03-07 | Medical Electronic Imaging Corporation | X-ray tubes |
| US4577339A (en) * | 1983-10-28 | 1986-03-18 | Klostermann Heinrich F | Cable termination for x-ray tubes |
| US4545064A (en) * | 1983-10-28 | 1985-10-01 | Litton Systems, Inc. | X-ray tube rotor mounting |
| DE3838539A1 (de) * | 1988-11-14 | 1990-05-17 | Philips Patentverwaltung | Roentgenroehre |
| US5173931A (en) * | 1991-11-04 | 1992-12-22 | Norman Pond | High-intensity x-ray source with variable cooling |
| US5386451A (en) * | 1993-08-30 | 1995-01-31 | General Electric Company | Anode potential stator design |
| US5483570A (en) * | 1994-06-24 | 1996-01-09 | General Electric Company | Bearings for x-ray tubes |
| US6118203A (en) * | 1999-06-03 | 2000-09-12 | General Electric Company | High efficiency motor for x-ray generation |
| US6570960B1 (en) * | 2000-03-07 | 2003-05-27 | Koninklijke Philips Electronics N.V. | High voltage isolated rotor drive for rotating anode x-ray tube |
| FR2845241B1 (fr) * | 2002-09-26 | 2005-04-22 | Ge Med Sys Global Tech Co Llc | Dispositif d'emission de rayons x et appareil a rayons x. |
| US8284901B2 (en) * | 2010-10-26 | 2012-10-09 | General Electric Company | Apparatus and method for improved transient response in an electromagnetically controlled x-ray tube |
| CN103903940B (zh) | 2012-12-27 | 2017-09-26 | 清华大学 | 一种产生分布式x射线的设备和方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2939015A (en) * | 1956-05-08 | 1960-05-31 | Philips Corp | X-ray tube |
| DE2213184A1 (de) * | 1972-03-17 | 1973-09-27 | Siemens Ag | Drehanoden-roentgenroehre |
-
1974
- 1974-11-27 DE DE2455974A patent/DE2455974C3/de not_active Expired
-
1975
- 1975-11-17 US US05/632,587 patent/US4024424A/en not_active Expired - Lifetime
- 1975-11-22 JP JP14071275A patent/JPS5543586B2/ja not_active Expired
- 1975-11-24 NL NL7513670A patent/NL7513670A/xx not_active Application Discontinuation
- 1975-11-24 CA CA240,260A patent/CA1043844A/en not_active Expired
- 1975-11-24 IT IT69892/75A patent/IT1051273B/it active
- 1975-11-24 GB GB48194/75A patent/GB1527239A/en not_active Expired
- 1975-11-24 BR BR7507765*A patent/BR7507765A/pt unknown
- 1975-11-24 SE SE7513144A patent/SE409527B/xx unknown
- 1975-11-25 BE BE162165A patent/BE835925A/xx unknown
- 1975-11-26 FR FR7536145A patent/FR2293054A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE409527B (sv) | 1979-08-20 |
| US4024424A (en) | 1977-05-17 |
| FR2293054A1 (fr) | 1976-06-25 |
| GB1527239A (en) | 1978-10-04 |
| JPS5182587A (enExample) | 1976-07-20 |
| DE2455974A1 (de) | 1976-08-12 |
| FR2293054B1 (enExample) | 1979-08-10 |
| IT1051273B (it) | 1981-04-21 |
| DE2455974C3 (de) | 1979-08-09 |
| JPS5543586B2 (enExample) | 1980-11-07 |
| SE7513144L (sv) | 1976-05-28 |
| BR7507765A (pt) | 1976-08-10 |
| BE835925A (fr) | 1976-05-25 |
| CA1043844A (en) | 1978-12-05 |
| DE2455974B2 (de) | 1978-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL7713634A (nl) | Roentgenbuis met draaianode. | |
| NL7513670A (nl) | Roentgenbuis met draaianode. | |
| NL7414225A (nl) | Buisfitting. | |
| NL7803243A (nl) | Roentgenbuis met draaianode. | |
| NL7500969A (nl) | Driewieler. | |
| NL7503223A (nl) | Putconstructie. | |
| HU173108B (hu) | Sposob poluchenija novykh proizvodnykh izoindolinil-, pirrolopirazinil-, oksatiinopirrolil- i ditiinopirrolil-oksi-karbonil-piperazina | |
| NL7417000A (nl) | Afsluitkap. | |
| NL178624C (nl) | Buisisolatie. | |
| NL7507715A (nl) | Rijwiel. | |
| NL7506941A (nl) | Aangedreven pijpdraaitang. | |
| HU174752B (hu) | Sposob poluchenija proizvodnykh imidazo-kvadratnaja skobka-1,5-a-kvadratnaja skobka zakryta-kvadratnaja skobka-1,4-kvadratnaja skobka zakryta-diazepina | |
| NL7504025A (nl) | Buisklep. | |
| NL7504649A (nl) | Codeerinrichting. | |
| NL7504978A (nl) | Omheining. | |
| NL7513888A (nl) | Lamp. | |
| SE7505223L (sv) | Ergometer. | |
| NL7509221A (nl) | Codeeromzetinrichting. | |
| DK135492B (da) | Lastpalle. | |
| NL7501436A (nl) | Vergelijkingsmicroskoop. | |
| NO142723C (no) | Foldesjalusi. | |
| BE830554A (fr) | 9-thia-ou oxothia- et dioxothia- 11,12-seco-prostaglandines | |
| HU174287B (hu) | Sposob poluchenija omega-nor-cikloalkil-13,14-degidro-prostaglandinov | |
| NL7506968A (nl) | Cilindrische tenk. | |
| NL7805726A (nl) | Roentgenbuis met draaianode. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BV | The patent application has lapsed |