NL185481C - Lagedruknatriumdampontladingslamp. - Google Patents
Lagedruknatriumdampontladingslamp.Info
- Publication number
- NL185481C NL185481C NLAANVRAGE7908311,A NL7908311A NL185481C NL 185481 C NL185481 C NL 185481C NL 7908311 A NL7908311 A NL 7908311A NL 185481 C NL185481 C NL 185481C
- Authority
- NL
- Netherlands
- Prior art keywords
- low pressure
- discharge lamp
- vapor discharge
- pressure sodium
- sodium vapor
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title 1
- 229910052708 sodium Inorganic materials 0.000 title 1
- 239000011734 sodium Substances 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/35—Vessels; Containers provided with coatings on the walls thereof; Selection of materials for the coatings
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7908311,A NL185481C (nl) | 1979-11-14 | 1979-11-14 | Lagedruknatriumdampontladingslamp. |
| CA000364122A CA1155897A (en) | 1979-11-14 | 1980-11-06 | Low-pressure sodium vapour discharge lamp |
| GB8036081A GB2063557B (en) | 1979-11-14 | 1980-11-10 | Low-pressure sodium vapour discharge lamp |
| HU802704A HU191328B (en) | 1979-11-14 | 1980-11-11 | Lew pressure sodium-vapeur lamp |
| JP15778880A JPS5682562A (en) | 1979-11-14 | 1980-11-11 | Low voltage sodium vapor discharge lamp |
| FR8024041A FR2469800A1 (fr) | 1979-11-14 | 1980-11-12 | Lampe a decharge dans la vapeur de sodium a basse pression |
| BE0/202768A BE886118A (fr) | 1979-11-14 | 1980-11-12 | Lampe a decharge dans la vapeur de sodium a basse pression |
| DE19803042753 DE3042753A1 (de) | 1979-11-14 | 1980-11-13 | Niederdrucknatriumdampfentladungslampe |
| US06/497,215 US4441045A (en) | 1979-11-14 | 1983-05-25 | Low-pressure sodium vapor discharge lamp |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7908311 | 1979-11-14 | ||
| NLAANVRAGE7908311,A NL185481C (nl) | 1979-11-14 | 1979-11-14 | Lagedruknatriumdampontladingslamp. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NL7908311A NL7908311A (nl) | 1981-06-16 |
| NL185481B NL185481B (nl) | 1989-11-16 |
| NL185481C true NL185481C (nl) | 1990-04-17 |
Family
ID=19834167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NLAANVRAGE7908311,A NL185481C (nl) | 1979-11-14 | 1979-11-14 | Lagedruknatriumdampontladingslamp. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4441045A (enExample) |
| JP (1) | JPS5682562A (enExample) |
| BE (1) | BE886118A (enExample) |
| CA (1) | CA1155897A (enExample) |
| DE (1) | DE3042753A1 (enExample) |
| FR (1) | FR2469800A1 (enExample) |
| GB (1) | GB2063557B (enExample) |
| HU (1) | HU191328B (enExample) |
| NL (1) | NL185481C (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4591752A (en) * | 1983-10-14 | 1986-05-27 | Duro-Test Corporation | Incandescent lamp with high pressure rare gas filled tungsten-halogen element and transparent thick walled safety envelope |
| US5021718A (en) * | 1990-02-01 | 1991-06-04 | Gte Products Corporation | Negative glow discharge lamp |
| US5266864A (en) * | 1990-02-01 | 1993-11-30 | Gte Products Corporation | Negative glow discharge lamp with fill containing cesium or sodium |
| US5272406A (en) * | 1991-05-13 | 1993-12-21 | Gte Products Corporation | Miniature low-wattage neon light source |
| US5134336A (en) * | 1991-05-13 | 1992-07-28 | Gte Products Corporation | Fluorescent lamp having double-bore inner capillary tube |
| US5153479A (en) * | 1991-05-13 | 1992-10-06 | Gte Products Corporation | Miniature low-wattage neon light source |
| DE102004011976A1 (de) * | 2004-03-10 | 2005-09-29 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Leuchtmittel mit einem Schichtsystem zur Reflektierung abgegebener infraroter Strahlung |
| US20060170361A1 (en) * | 2005-01-31 | 2006-08-03 | Osram Sylvania Inc. | Single-ended Arc Discharge Vessel with a Divider Wall |
| JP2009535772A (ja) * | 2006-05-01 | 2009-10-01 | コーニンクレッカ フィリップス エレクトロニクス エヌ ヴィ | 低圧放電ランプ |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE535143A (enExample) * | 1954-01-27 | |||
| FR1199913A (fr) * | 1957-07-18 | 1959-12-17 | Philips Nv | Tube à décharge dans la vapeur de sodium, présentant la forme d'un u |
| NL269925A (enExample) * | 1961-10-04 | |||
| US3949259A (en) * | 1973-08-17 | 1976-04-06 | U.S. Philips Corporation | Light-transmitting, thermal-radiation reflecting filter |
| NL180464C (nl) * | 1976-10-29 | 1987-02-16 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| NL180156C (nl) * | 1976-10-29 | 1987-01-02 | Philips Nv | Gas- en/of dampontladingslamp. |
-
1979
- 1979-11-14 NL NLAANVRAGE7908311,A patent/NL185481C/xx not_active IP Right Cessation
-
1980
- 1980-11-06 CA CA000364122A patent/CA1155897A/en not_active Expired
- 1980-11-10 GB GB8036081A patent/GB2063557B/en not_active Expired
- 1980-11-11 JP JP15778880A patent/JPS5682562A/ja active Pending
- 1980-11-11 HU HU802704A patent/HU191328B/hu unknown
- 1980-11-12 BE BE0/202768A patent/BE886118A/fr not_active IP Right Cessation
- 1980-11-12 FR FR8024041A patent/FR2469800A1/fr active Granted
- 1980-11-13 DE DE19803042753 patent/DE3042753A1/de active Granted
-
1983
- 1983-05-25 US US06/497,215 patent/US4441045A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| BE886118A (fr) | 1981-05-12 |
| DE3042753C2 (enExample) | 1989-04-06 |
| FR2469800B1 (enExample) | 1983-07-22 |
| GB2063557A (en) | 1981-06-03 |
| FR2469800A1 (fr) | 1981-05-22 |
| HU191328B (en) | 1987-02-27 |
| GB2063557B (en) | 1983-10-05 |
| DE3042753A1 (de) | 1981-09-24 |
| JPS5682562A (en) | 1981-07-06 |
| CA1155897A (en) | 1983-10-25 |
| NL185481B (nl) | 1989-11-16 |
| NL7908311A (nl) | 1981-06-16 |
| US4441045A (en) | 1984-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL185479C (nl) | Lagedrukgasontladingslamp. | |
| NL7802992A (nl) | Hogedruk-kwikdampontladingslamp. | |
| NL179855C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL177058C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL178107C (nl) | Hogedrukontladingslamp. | |
| NL184032C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL183794C (nl) | Hogedrukkwikontladingslamp. | |
| NL184712C (nl) | Lagedrukkwikdampontladingslamp. | |
| NL181469C (nl) | Hogedrukkwikdampontladingslamp. | |
| NL181157C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL185481C (nl) | Lagedruknatriumdampontladingslamp. | |
| NL7703705A (nl) | Hogedrukkwikdamp-ontladingslamp. | |
| NL7801635A (nl) | Lagedruknatriumdampontladingslamp. | |
| NL7714424A (nl) | Natriumdampontladingslamp. | |
| NL180464C (nl) | Lagedruknatriumdampontladingslamp. | |
| NL185478C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL175770C (nl) | Hogedruknatriumdampontladingslamp. | |
| AT375790B (de) | Hochdrucknatriumdampfentladungslampe | |
| NL7708430A (nl) | Hogedruk-natriumdamplamp. | |
| NL7713348A (nl) | Hogedruknatriumdampontladingslamp. | |
| NL193707B (nl) | Hogedrukboogontladingslamp. | |
| NL7712059A (nl) | Lagedruknatriumdampontladingslamp. | |
| NL177639C (nl) | Hogedruk natriumdampontladingslamp. | |
| NL185480C (nl) | Hogedruknatriumdampontladingslamp. | |
| AT376065B (de) | Niederdruckmetalldampfentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1B | A search report has been drawn up | ||
| A85 | Still pending on 85-01-01 | ||
| BC | A request for examination has been filed | ||
| V1 | Lapsed because of non-payment of the annual fee |