KR101027434B1 - 근적외광을 이용한 들깨의 지방산 조성을 정량하는 방법 - Google Patents
근적외광을 이용한 들깨의 지방산 조성을 정량하는 방법 Download PDFInfo
- Publication number
- KR101027434B1 KR101027434B1 KR1020090005459A KR20090005459A KR101027434B1 KR 101027434 B1 KR101027434 B1 KR 101027434B1 KR 1020090005459 A KR1020090005459 A KR 1020090005459A KR 20090005459 A KR20090005459 A KR 20090005459A KR 101027434 B1 KR101027434 B1 KR 101027434B1
- Authority
- KR
- South Korea
- Prior art keywords
- perilla
- acid
- equation
- destructive
- wavelength
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 28
- 239000000203 mixture Substances 0.000 title claims abstract description 22
- 235000014113 dietary fatty acids Nutrition 0.000 title abstract description 29
- 239000000194 fatty acid Substances 0.000 title abstract description 29
- 229930195729 fatty acid Natural products 0.000 title abstract description 29
- 244000124853 Perilla frutescens Species 0.000 title description 3
- 235000004348 Perilla frutescens Nutrition 0.000 title description 3
- 125000005313 fatty acid group Chemical group 0.000 title 1
- 241000229722 Perilla <angiosperm> Species 0.000 claims abstract description 51
- 235000004347 Perilla Nutrition 0.000 claims abstract description 48
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 claims abstract description 21
- 235000020778 linoleic acid Nutrition 0.000 claims abstract description 21
- OYHQOLUKZRVURQ-IXWMQOLASA-N linoleic acid Natural products CCCCC\C=C/C\C=C\CCCCCCCC(O)=O OYHQOLUKZRVURQ-IXWMQOLASA-N 0.000 claims abstract description 21
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 claims abstract description 20
- 235000020661 alpha-linolenic acid Nutrition 0.000 claims abstract description 20
- 229960004488 linolenic acid Drugs 0.000 claims abstract description 20
- KQQKGWQCNNTQJW-UHFFFAOYSA-N linolenic acid Natural products CC=CCCC=CCC=CCCCCCCCC(O)=O KQQKGWQCNNTQJW-UHFFFAOYSA-N 0.000 claims abstract description 20
- 230000001066 destructive effect Effects 0.000 claims abstract description 15
- 238000004445 quantitative analysis Methods 0.000 claims abstract description 10
- 238000002329 infrared spectrum Methods 0.000 claims description 11
- 238000001228 spectrum Methods 0.000 claims description 9
- 238000012360 testing method Methods 0.000 claims description 8
- 238000000862 absorption spectrum Methods 0.000 claims description 6
- 239000013078 crystal Substances 0.000 claims description 6
- 230000001678 irradiating effect Effects 0.000 claims description 6
- 150000004665 fatty acids Chemical class 0.000 abstract description 28
- 238000011088 calibration curve Methods 0.000 abstract description 14
- 238000005259 measurement Methods 0.000 abstract description 6
- 238000012423 maintenance Methods 0.000 abstract description 4
- 239000003225 biodiesel Substances 0.000 abstract description 3
- 230000002068 genetic effect Effects 0.000 abstract description 3
- 239000012770 industrial material Substances 0.000 abstract description 2
- OYHQOLUKZRVURQ-NTGFUMLPSA-N (9Z,12Z)-9,10,12,13-tetratritiooctadeca-9,12-dienoic acid Chemical compound C(CCCCCCC\C(=C(/C\C(=C(/CCCCC)\[3H])\[3H])\[3H])\[3H])(=O)O OYHQOLUKZRVURQ-NTGFUMLPSA-N 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 12
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 7
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 6
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 6
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 6
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 6
- 239000005642 Oleic acid Substances 0.000 description 6
- 235000021314 Palmitic acid Nutrition 0.000 description 6
- 235000021355 Stearic acid Nutrition 0.000 description 6
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 6
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 6
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 6
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 6
- 239000008117 stearic acid Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 235000011511 Diospyros Nutrition 0.000 description 3
- 244000236655 Diospyros kaki Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910001873 dinitrogen Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 230000009261 transgenic effect Effects 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 238000002790 cross-validation Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000000769 gas chromatography-flame ionisation detection Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000011002 quantification Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 108091030071 RNAI Proteins 0.000 description 1
- 241000207961 Sesamum Species 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- 244000150738 Sesamum radiatum Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000019784 crude fat Nutrition 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000009368 gene silencing by RNA Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000008676 import Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000010422 internal standard material Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- YAQXGBBDJYBXKL-UHFFFAOYSA-N iron(2+);1,10-phenanthroline;dicyanide Chemical compound [Fe+2].N#[C-].N#[C-].C1=CN=C2C3=NC=CC=C3C=CC2=C1.C1=CN=C2C3=NC=CC=C3C=CC2=C1 YAQXGBBDJYBXKL-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000021081 unsaturated fats Nutrition 0.000 description 1
- 238000010200 validation analysis Methods 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Images
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N21/00—Investigating or analysing materials by the use of optical means, i.e. using sub-millimetre waves, infrared, visible or ultraviolet light
- G01N21/17—Systems in which incident light is modified in accordance with the properties of the material investigated
- G01N21/25—Colour; Spectral properties, i.e. comparison of effect of material on the light at two or more different wavelengths or wavelength bands
- G01N21/31—Investigating relative effect of material at wavelengths characteristic of specific elements or molecules, e.g. atomic absorption spectrometry
- G01N21/35—Investigating relative effect of material at wavelengths characteristic of specific elements or molecules, e.g. atomic absorption spectrometry using infrared light
- G01N21/359—Investigating relative effect of material at wavelengths characteristic of specific elements or molecules, e.g. atomic absorption spectrometry using infrared light using near infrared light
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N21/00—Investigating or analysing materials by the use of optical means, i.e. using sub-millimetre waves, infrared, visible or ultraviolet light
- G01N21/17—Systems in which incident light is modified in accordance with the properties of the material investigated
- G01N21/25—Colour; Spectral properties, i.e. comparison of effect of material on the light at two or more different wavelengths or wavelength bands
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N21/00—Investigating or analysing materials by the use of optical means, i.e. using sub-millimetre waves, infrared, visible or ultraviolet light
- G01N21/17—Systems in which incident light is modified in accordance with the properties of the material investigated
- G01N21/25—Colour; Spectral properties, i.e. comparison of effect of material on the light at two or more different wavelengths or wavelength bands
- G01N21/31—Investigating relative effect of material at wavelengths characteristic of specific elements or molecules, e.g. atomic absorption spectrometry
- G01N21/35—Investigating relative effect of material at wavelengths characteristic of specific elements or molecules, e.g. atomic absorption spectrometry using infrared light
- G01N21/3563—Investigating relative effect of material at wavelengths characteristic of specific elements or molecules, e.g. atomic absorption spectrometry using infrared light for analysing solids; Preparation of samples therefor
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N21/00—Investigating or analysing materials by the use of optical means, i.e. using sub-millimetre waves, infrared, visible or ultraviolet light
- G01N21/84—Systems specially adapted for particular applications
- G01N21/88—Investigating the presence of flaws or contamination
- G01N21/8851—Scan or image signal processing specially adapted therefor, e.g. for scan signal adjustment, for detecting different kinds of defects, for compensating for structures, markings, edges
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N33/00—Investigating or analysing materials by specific methods not covered by groups G01N1/00 - G01N31/00
- G01N33/02—Food
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Physics & Mathematics (AREA)
- Analytical Chemistry (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Immunology (AREA)
- Pathology (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Computer Vision & Pattern Recognition (AREA)
- Signal Processing (AREA)
- Medicinal Chemistry (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
Abstract
본 발명은 근적외광을 이용한 비파괴적 방법으로 들깨(Perilla frutescens)의 지방산의 조성비를 정량하는 방법에 관한 것으로, 비파괴된 들깨를 대상으로 근적외선 분광분석기를 이용하여 측정된 NIR 측정값의 1차 도함수 값을 통계적 다중결정계수(r2)가 0.99 이상의 정확성이 높은 검량 곡선식에 도입함으로써 지방산, 특히 리놀레산 및 리놀렌산의 조성비를 정량하는 방법에 관한 것이다. 본 발명의 방법은 들깨를 전처리하는 단계를 거치지 않고 들깨의 지방산 조성을 신속하고 대량으로 탐색할 수 있으므로, 유지자원별 유전자원을 효과적으로 평가하여 고품질 유지자원용 소재 또는 바이오 디젤 등 산업적 소재 개발에 유용하게 이용될 수 있다.
비파괴적 정량방법, 들깨, 지방산, 리놀레산, 리놀렌산, NIR, 대량탐색
Description
본 발명은 근적외광을 이용한 비파괴적 방법으로 들깨(Perilla frutescens)의 지방산 조성을 정량하는 방법에 관한 것이다.
들깨(Perilla frutescens)는 통화식물목(筒花植物目) 꿀풀과(科)의 한해살이 풀로서 동남아시아가 원산이고 키는 1 m 정도 된다. 열매의 형태적 특성에 따라서 몇 종으로 나뉘는데 한국에서는 거의 갈색 열매의 종을 재배하고 씨는 볶아서 깨소금으로, 또는 기름을 짜서 쓰기도 한다. 산업적으로는 페인트, 니스, 리놀륨, 인쇄잉크, 포마드, 비누원료 등으로 이용되기도 하는데 한국, 중국, 인도, 일본 등지에 널리 분포한다.
우리나라에서 들깨는 주로 기름을 얻기 위한 작물(식용과 등화용)로서 예부터 재배되어 왔으며 조지방이 35~54%로서 비교적 유량이 많고 리놀렌산의 함량이 63%에 이르는 고도의 불포화지방 조성을 하고 있어서 기름으로 보관하면 쉽게 산패 되는 특성이 있다. 들깨는 우리나라의 전통적인 유료작물로 정착해 왔지만 서구뿐만 아니라 다른 나라에서는 거의 재배되고 있지 않은 작물로서 국내에서 소비되는 유지류의 90% 이상을 수입에 의존하고 있는 우리로서는 식용유 대체생산뿐만 아니라, 바이오디젤 소재 등의 육종소재나 자급화에 매우 큰 잠재력이 있다고 할 수 있다.
이와 같이 유용한 유지성 작물의 지방산 조성 대량 탐색방법으로 지금까지는 작물의 1차 가공품이라 할 수 있는 유지(오일) 등을 사용하였거나 작물을 비파괴 적으로 측정하였더라도 오일의 전체 함량 정도를 측정하였으나, 상기 들깨의 유용성이 점점 커지면서 지방산 조성을 신속하고 대량으로 탐색할 수 있는 방법이 필요성이 대두하였다.
이에 본 발명자들은 전처리를 거치지 않은 들깨의 근적외선 스펙트럼을 반복적으로 수득한 후, 통계적 처리를 거쳐서 다중결정계수(r2)가 0.99 이상인 검량 곡선을 설계하였고, 상기 검량 곡선이 비파괴적으로 들깨의 지방산 조성을 정량하는 데에 유용하게 사용될 수 있음을 확인함으로써 본 발명을 완성하였다.
본 발명의 목적은 들깨의 리놀레산 성분의 조성비에 대한 비파괴 정량 방법을 제공하는 것이다.
본 발명의 목적은 들깨의 리놀렌산 성분의 조성비에 대한 비파괴 정량 방법을 제공하는 것이다.
상기 목적을 달성하기 위하여, 본 발명은 1) 비파쇄 들깨 종자를 품종에 따라 구분하여 테스트 시험관에 넣어 근적외광 분석기에 삽입한 후, 근적외광을 조사하여 408 내지 2484 ㎚ 영역의 흡수 스펙트럼을 수득하는 단계;
2) 상기 근적외선 스펙트럼에 1차 미분법을 적용하고 측정 파장별 갭을 8 ㎚으로 1차 도함수 값을 수득하는 단계;
3) 상기 파장별 1차 도함수 값을 하기 수학식 1의 함수에 대입하여, 들깨 시료 내 리놀레산 함량을 결정하는 단계를 포함하는 들깨의 리놀레산 성분의 조성비에 대한 비파괴 정량 방법을 제공한다.
또한, 본 발명은 1) 비파쇄 들깨 종자를 품종에 따라 구분하여 테스트 시험관에 넣어 근적외광 분석기에 삽입한 후, 근적외광을 조사하여 408 내지 2484 ㎚ 영역의 흡수 스펙트럼을 수득하는 단계;
2) 상기 근적외선 스펙트럼에 1차 미분법을 적용하고 측정 파장별 갭을 8 ㎚ 으로 1차 도함수 값을 수득하는 단계;
3) 상기 파장별 1차 도함수 값을 하기 수학식 2의 함수에 대입하여, 들깨 시료 내 리놀렌산 함량을 결정하는 단계를 포함하는 들깨의 리놀렌산 성분의 조성비에 대한 비파괴 정량 방법을 제공한다.
이하, 본 발명을 상세히 설명한다.
본 발명은 1) 비파쇄 들깨 종자를 품종에 따라 구분하여 테스트 시험관에 넣어 근적외광 분석기에 삽입한 후, 근적외광을 조사하여 408 내지 2484 ㎚ 영역의 흡수 스펙트럼을 수득하는 단계;
2) 상기 근적외선 스펙트럼에 1차 미분법을 적용하고 측정 파장별 갭을 8 ㎚으로 1차 도함수 값을 수득하는 단계;
3) 상기 파장별 1차 도함수 값을 하기 수학식 1의 함수에 대입하여, 들깨 시료 내 리놀레산 함량을 결정하는 단계를 포함하는 들깨의 리놀레산 성분의 조성비에 대한 비파괴 정량 방법을 제공한다:
[수학식 1]
리놀레산 함량(%) = 17.948 + 0.4431x'408 + 2.8241x'416 - 12.905x'424 - 3.6207x'432 + 1.2902x'440 + 1.5259x'448 - 14.3795x'456 - 2.8442x'464 + 4.3859x'472 - 10.9486x'480 - 5.9771x'488 + 5.4596x'496 + 4.7831x'504 + 22.9702x'512 + 5.1547x'520 - 6.242x'528 - 5.5237x'536 + 1.2284x'544 + 0.4326x'552 + 6.7523x'560 - 8.1339x'568 - 11.6013x'576 - 1.5559x'584 - 7.4499x'592 - 3.4363x'600 - 11.7663x'608 - 3.3829x'616 - 4.1756x'624 - 6.0593x'632 - 5.7922x'640 + 1.4358x'648 + 2.9629x'656 + 5.6959x'664 + 4.5027x'672 + 0.7846x'680 - 1.5461x'688 - 1.285x'696 - 1.2309x'704 - 2.5205x'712 - 2.2193x'720 - 1.8973x'728 - 3.1492x'736 + 10.5798x'744 + 9.3956x'752 + 7.049x'760 - 6.0099x'768 - 6.417x'776 - 1.0252x'784 - 2.6032x'792 - 2.8008x'800 - 2.8341x'808 - 3.006x'816 - 2.795x'824 - 1.5355x'832 - 0.3222x'840 + 0.6095x'848 + 1.4882x'856 + 2.2921x'864 + 3.0237x'872 + 3.8114x'880 + 3.4498x'888 + 3.4529x'896 + 3.272x'904 + 4.2226x'912 + 4.9872x'920 + 3.3665x'928 + 1.9003x'936 + 1.133x'944 + 0.9621x'952 + 1.3728x'960 + 1.0015x'968 + 1.4056x'976 + 2.2063x'984 + 2.9788x'992 + 4.1935x'1000 + 4.6964x'1008 + 4.2016x'1016 + 3.689x'1024 + 2.9088x'1032 + 2.3174x'1040 + 1.2318x'1048 + 1.1709x'1056 + 0.7108x'1064 + 1.4199x'1072 + 1.4735x'1080 + 1.7777x'1088 + 4.6723x'1108 + 6.3004x'1116 + 9.7034x'1124 + 14.87x'1132 + 21.1947x'1140 + 24.0196x'1148 + 18.6233x'1156 + 4.0914x'1164 - 0.1498x'1172 + 5.48x'1180 + 5.0485x'1188 + 2.0593x'1196 - 0.1587x'1204 - 4.9297x'1212 - 10.0394x'1220 - 11.7021x'1228 - 9.7185x'1236 - 5.338x'1244 - 4.0959x'1252 - 1.8562x'1260 + 0.0288x'1268 + 1.0326x'1276 + 1.1174x'1284 + 1.7299x'1292 + 1.1163x'1300 + 0.2151x'1308 + 0.5936x'1316 - 0.2913x'1324 - 2.1229x'1332 - 0.9168x'1340 + 3.5476x'1348 + 4.9232x'1356 + 6.1524x'1364 + 9.8917x'1372 + 3.4875x'1380 - 4.3148x'1388 - 7.8427x'1396 - 7.9719x'1404 - 5.8841x'1412 - 3.2971x'1420 - 1.7889x'1428 - 0.4107x'1436 + 0.5002x'1444 + 1.2842x'1452 - 0.5552x'1460 - 0.446x'1468 + 0.8701x'1476 + 0.0493x'1484 + 0.3809x'1492 - 2.5367x'1500 - 2.768x'1508 + 1.0456x'1516 + 4.4522x'1524 + 5.1791x'1532 + 5.0879x'1540 + 4.0856x'1548 + 3.2078x'1556 + 2.8124x'1564 + 1.2715x'1572 + 2.1923x'1580 + 2.4615x'1588 + 2.3328x'1596 + 4.0869x'1604 + 3.1971x'1612 + 2.8002x'1620 + 2.0255x'1628 + 2.0906x'1636 + 2.4905x'1644 + 0.4147x'1652 - 5.781x'1660 - 6.5243x'1668 - 2.9722x'1676 - 6.2083x'1684 - 10.3664x'1692 - 12.6734x'1700 - 7.7327x'1708 - 4.4172x'1716 + 0.0595x'1724 + 6.6086x'1732 + 6.233x'1740 + 1.8968x'1748 + 1.2026x'1756 + 4.4687x'1764 + 5.8048x'1772 + 3.1084x'1780 + 1.5785x'1788 + 1.3736x'1796 + 1.2761x'1804 + 1.3303x'1812 + 2.0324x'1820 + 1.0257x'1828 + 0.8541x'1836 + 1.1652x'1844 + 1.2573x'1852 + 1.2266x'1860 - 5.6704x'1868 - 5.7255x'1876 - 1.5312x'1884 + 5.9776x'1892 + 6.4681x'1900 + 8.3639x'1908 + 6.1471x'1916 + 0.4329x'1924 - 2.8789x'1932 - 1.3176x'1940 - 2.1196x'1948 - 6.6286x'1956 - 7.0162x'1964 - 7.03x'1972 - 5.5552x'1980 - 3.3773x'1988 - 3.3318x'1996 - 3.1522x'2004 - 3.8277x'2012 - 4.0891x'2020 - 3.7648x'2028 - 3.6338x'2036 - 0.7422x'2044 + 1.8158x'2052 + 4.4087x'2060 + 3.1039x'2068 + 4.1973x'2076 + 1.6969x'2084 + 0.7089x'2092 - 0.815x'2100 + 0.9705x'2108 + 1.4563x'2116 - 0.1745x'2124 - 4.0029x'2132 - 4.9642x'2140 - 3.6994x'2148 - 5.2599x'2156 - 4.8357x'2164 - 1.3293x'2172 - 2.1387x'2180 - 2.5725x'2188 - 0.2334x'2196 + 0.696x'2204 + 3.6449x'2212 - 1.4123x'2220 + 2.127x'2228 + 1.4376x'2236 - 2.3667x'2244 - 6.234x'2252 - 3.242x'2260 - 3.9855x'2268 - 0.8093x'2276 - 1.2993x'2284 - 0.3575x'2292 + 6.8319x'2300 + 5.5592x'2308 + 5.8458x'2316 + 4.7073x'2324 + 0.5239x'2332 - 1.2448x'2340 + 4.6243x'2348 + 0.45x'2356 + 1.4734x'2364 + 5.2383x'2372 + 3.3473x'2380 + 3.7529x'2388 + 4.7428x'2396 + 7.9684x'2404 + 5.9251x'2412 + 9.4423x'2420 + 5.4177x'2428 + 3.9373x'2436 + 8.6313x'2444 + 6.1647x'2452 + 3.8317x'2460 + 0.0844x'2468 + 2.7452x'2476 + 1.4267x'2484.
상기 수학식 1의 x'408 내지 x'2484는 408 내지 2484 ㎚ 사이의 스펙트럼에서 8 ㎚ 간격으로 측정된 1차 도함수 값을 의미한다.
본 발명의 구체적인 실시예에서 Δ15 탈포화효소(desaturase)의 발현이 차단된 262점의 들깨 형질전환체(transgenic plant)를 대상으로, 파괴적 지방산 분석(표 2 참조) 및 근적외선 분광기를 이용한 비파괴적 지방산 분석(표 3 참조)을 수 행한 후, 1차 또는 2차 미분법 및 8 ㎚의 측정 파 장 갭으로 수처리를 수행한 상기 비파괴적 지방산 조성비 분석 결과를 파괴적 지방산 조성비 분석 결과와 변형 부분최소자승법(MPLS: Modified Partial Least Squares)으로 유의상관 관계를 조사함으로써 각 지방산별 검량 곡선(도 2 참조) 및 각 검량 곡선의 다중결정계수(R2: squared coefficient of multiple determination in calibration)(표 3 참조)를 수득하였다. 그 결과, 리놀레산(수학식 1)과 리놀렌산(수학식 2)의 검량 곡선의 다중결정계수가 0.99 이상으로 정확성이 높은 것으로 나타났다.
이에, 상기 수학식 1 및 수학식 2의 검량 곡선을 이용함으로써 비파괴적 방법으로 들깨의 지방산 조성비를 신속하고 정확하게 측정하는 것이 가능할 수 있다.
본 발명의 방법은 시료를 전처리 없이 있는 그대로 측정하기가 용이하며, 시약 등을 사용하지 않고 시료의 정량, 혼합, 가열, 추출 등의 과정의 전처리 과정이 필요 없어 신속하고 동시에 다성분을 분석할 수 있을 뿐만 아니라 측정시료를 손상 없이 회수하여 이용 및 보관 또는 기타 분석에 사용할 수 있는 장점이 있다.
본 발명에서 근적외선 스펙트럼은 들깨 그대로의 상태로 당업계에서 통상적으로 사용하는 모든 방식으로 스캐닝하여 얻을 수 있으며, 바람직하게는 확산 반사(Diffuse Reflectance) 또는 투과(Transmission)의 방식으로 얻을 수 있다.
단계 2)에서 수득한 상기 근적외선 스펙트럼은 복잡하고 흡광 봉우리들의 겹침과 물리적인 성질에 변화를 주는 확인되지 않은 변화요인들이 존재하기 때문에 비어(Beer's)의 법칙에 잘 맞지 않는다. 구체적으로, 근적외선 스펙트럼은 바탕선 변동과 흡광도 방해가 발생한다. 바탕선의 변화요인들은 입 도크기, 시료의 밀집상태, 원산지, 높이, 단기 변화 등이 있고, 흡광도의 방해요인들로는 봉우리가 넓고, 겹치고, 복잡하고 불확실한 상태 등이 있다. 이러한 문제점을 해결하기 위해서 다양한 통계처리를 수행하여 최적의 검량선을 유도한다. 구체적으로, 본 발명에서는 미분법을 적용하며, 바람직하게는 상기 스펙트럼을 1차 미분 또는 2차 미분의 수학적 전처리하는 과정을 거치게 된다. 상기 수학적 전처리는 시료에 조사된 빛의 산란 효과를 일차적으로 보정을 해주며, 검량선을 안정하게 하는 필수적인 도구로써 시료를 전처리해주며, 크로마토그래피의 칼럼처럼 분리해 주는 역할을 수행한다. 또한 오버-피팅(over-fitting) 등 스펙트럼이 잘못 해석되는 것을 방지하기 위하여 측정 파장별 갭(gap)을 조절하는데, 본 발명에서는 4∼10 ㎚가 바람직하다. 본 발명의 들깨에 함유된 리놀레산 및 리놀렌산 함량 측정에 있어서, 1차 미분법을 이용하는 것이 가장 바람직하며, 측정 파장별 갭이 8 ㎚인 것이 가장 바람직하다.
또한, 본 발명은 1) 비파쇄 들깨 종자를 품종에 따라 구분하여 테스트 시험관에 넣어 근적외광 분석기에 삽입한 후, 근적외광을 조사하여 408 내지 2484 ㎚ 영역의 흡수 스펙트럼을 수득하는 단계;
2) 상기 근적외선 스펙트럼에 1차 미분법을 적용하고 측정 파장별 갭을 8 ㎚으로 1차 도함수 값을 수득하는 단계;
3) 상기 파장별 1차 도함수 값을 하기 수학식 2의 함수에 대입하여, 들깨 시료 내 리놀렌산 함량을 결정하는 단계를 포함하는 들깨의 리놀렌산 성분의 조성비 에 대한 비파괴 정량 방법을 제공한다:
[수학식 2]
리놀렌산 함량(%) = 34.0365 - 19.6492x'408 - 10.3899x'416 + 4.5674x'424 - 15.5765x'432 - 0.4301x'440 - 52.7929x'448 + 20.4971x'456 - 4.8475x'464 - 7.7334x'472 + 10.8945x'480 - 11.5166x'488 - 9.2508x'496 - 16.6529x'504 + 4.9646x'512 - 17.9783x'520 - 13.1767x'528 - 4.569x'536 + 3.7045x'544 + 10.3093x'552 - 8.6473x'560 - 0.1298x'568 + 23.8852x'576 - 1.944x'584 + 19.5038x'592 - 4.3612x'600 + 3.7813x'608 - 0.4945x'616 + 6.5086x'624 + 8.6207x'632 + 5.8564x'640 + 0.026x'648 - 2.3833x'656 + 8.5371x'664 + 6.6601x'672 + 14.1656x'680 + 18.7526x'688 + 10.1709x'696 + 11.012x'704 + 6.8726x'712 - 3.1514x'720 - 0.3495x'728 + 7.4496x'736 + 2.1718x'744 + 17.3671x'752 - 20.3102x'760 + 10.2325x'768 + 21.5059x'776 + 13.0923x'784 + 13.9562x'792 + 11.9728x'800 + 11.554x'808 + 8.7378x'816 + 6.355x'824 + 1.0231x'832 - 3.1717x'840 - 6.3512x'848 - 8.7943x'856 - 11.5437x'864 - 12.8443x'872 - 13.0813x'880 - 11.6672x'888 - 14.259x'896 - 14.1463x'904 - 13.6661x'912 - 14.2719x'920 - 15.4881x'928 - 18.1802x'936 - 15.3626x'944 - 8.7624x'952 - 5.4511x'960 - 2.5853x'968 - 2.8064x'976 - 4.1134x'984 - 4.9154x'992 - 5.0592x'1000 - 4.1286x'1008 - 4.7246x'1016 - 6.4564x'1024 - 6.1706x'1032 - 6.5617x'1040 - 7.7849x'1048 - 9.4754x'1056 - 7.4361x'1064 - 5.2902x'1072 - 4.1819x'1080 - 3.616x'1088 + 10.2313x'1108 + 17.5225x'1116 + 24.9089x'1124 + 22.8047x'1132 + 8.7804x'1140 - 4.4118x'1148 - 7.8025x'1156 + 9.7551x'1164 + 16.0001x'1172 + 2.4764x'1180 + 0.9294x'1188 + 7.0774x'1196 + 12.1215x'1204 + 20.2809x'1212 + 25.8x'1220 + 23.243x'1228 + 18.9115x'1236 + 10.4844x'1244 + 10.062x'1252 + 7.0441x'1260 + 4.95x'1268 + 3.3244x'1276 + 2.7387x'1284 + 3.4822x'1292 + 6.7655x'1300 + 9.5417x'1308 + 10.3576x'1316 + 14.0737x'1324 + 19.7812x'1332 + 18.2894x'1340 + 5.4077x'1348 - 2.6008x'1356 - 9.9415x'1364 - 19.9209x'1372 - 9.0534x'1380 + 13.5327x'1388 + 21.8552x'1396 + 17.1352x'1404 + 14.4388x'1412 - 0.2517x'1420 - 6.1894x'1428 - 6.8332x'1436 - 5.8892x'1444 - 4.7638x'1452 - 3.1169x'1460 - 3.508x'1468 - 5.5423x'1476 - 5.3824x'1484 - 6.6253x'1492 - 5.9869x'1500 - 4.7606x'1508 - 6.2127x'1516 - 4.8115x'1524 - 4.4258x'1532 - 3.2899x'1540 - 4.9115x'1548 - 7.1991x'1556 - 6.7083x'1564 - 3.6877x'1572 - 4.9836x'1580 - 6.954x'1588 - 8.4045x'1596 - 14.503x'1604 - 13.2802x'1612 - 10.2938x'1620 - 5.8121x'1628 - 6.3307x'1636 - 10.2177x'1644 - 5.3828x'1652 + 13.22x'1660 + 17.738x'1668 - 3.7732x'1676 - 11.5682x'1684 - 4.5606x'1692 + 4.836x'1700 + 14.1497x'1708 + 20.3469x'1716 + 3.0116x'1724 - 11.4683x'1732 - 12.3291x'1740 - 6.0572x'1748 - 1.8626x'1756 - 2.1749x'1764 - 1.1452x'1772 + 2.1598x'1780 + 0.3936x'1788 + 0.7001x'1796 + 2.2329x'1804 + 1.7359x'1812 - 1.5165x'1820 + 0.7965x'1828 - 2.5538x'1836 - 1.3988x'1844 + 0.793x'1852 + 6.7795x'1860 + 16.7756x'1868 + 28.384x'1876 + 31.4473x'1884 + 16.6206x'1892 - 16.6664x'1900 - 43.9152x'1908 - 40.71x'1916 - 22.8746x'1924 - 4.2343x'1932 - 0.8942x'1940 + 6.6224x'1948 + 11.9573x'1956 + 10.4207x'1964 + 8.7189x'1972 + 5.8039x'1980 + 0.0461x'1988 + 1.3181x'1996 + 6.2145x'2004 + 8.837x'2012 + 10.3784x'2020 + 6.9866x'2028 + 2.1313x'2036 - 5.1567x'2044 - 3.7942x'2052 - 3.4113x'2060 - 2.5809x'2068 - 2.5207x'2076 - 0.7632x'2084 - 0.8853x'2092 + 1.7095x'2100 - 3.0469x'2108 - 13.2375x'2116 - 8.8789x'2124 - 8.5186x'2132 - 6.4953x'2140 - 0.316x'2148 + 5.509x'2156 + 9.0223x'2164 + 6.4544x'2172 + 6.22x'2180 + 8.8485x'2188 + 6.581x'2196 + 19.1322x'2204 + 11.7631x'2212 + 20.2774x'2220 + 19.9111x'2228 + 14.5272x'2236 + 18.4477x'2244 + 10.7763x'2252 - 13.5119x'2260 - 9.3296x'2268 - 6.7219x'2276 - 7.4329x'2284 + 0.0027x'2292 - 17.6023x'2300 - 14.1736x'2308 - 3.1316x'2316 - 0.0152x'2324 - 3.0427x'2332 + 1.1999x'2340 - 5.9044x'2348 + 12.1312x'2356 - 1.3262x'2364 - 9.2043x'2372 - 7.5179x'2380 - 6.4723x'2388 - 9.6722x'2396 - 13.0834x'2404 - 20.216x'2412 - 23.9121x'2420 - 22.1313x'2428 - 26.401x'2436 - 38.5057x'2444 - 45.1729x'2452 - 33.1816x'2460 - 23.7698x'2468 - 19.8987x'2476 - 27.6818x'2484.
본 발명의 방법은 들깨를 전처리하는 단계를 거치지 않고 들깨의 지방산 조성을 신속하고 대량으로 탐색할 수 있으므로, 유지자원별 유전자원을 효과적으로 평가하여 고품질 유지자원용 소재 또는 바이오 디젤 등 산업적 소재 개발에 유용하게 이용될 수 있다.
이하, 본 발명을 실시예에 의해 상세히 설명한다.
단, 하기 실시예는 본 발명을 예시하는 것일 뿐, 본 발명의 내용이 하기 실시예에 한정되는 것은 아니다.
<
실시예
1> 분석 대상
RNAi 방법으로 Δ15 탈포화효소(desaturase)의 발현이 차단된 262점의 들깨 형질전환체(transgenic plant), 대표적인 들깨 1종(대조군) 및 야생형 들깨 5종(대조구)을 대상으로 하였다. 상기 262점은 본 발명자들이 기존의 연구를 통해 축적한 연구 산물이고, 나머지 대조군 및 대조구는 국립농업유전자원센터에서 분양받아 사용하였다. 표 1에서 나타난 바와 같이 들깨 형질전환체는 지방산 생합성 과정 중에서 Δ15 탈포화효소를 차단하여 리놀렌산으로 합성되는 과정을 차단하였기 때문에 상대적으로 리놀레산의 함량비가 증가하였음을 나타내주고 있으며 262점의 시 료가 모두 같은 비율로 달라진 것이 아니고 가감의 정도가 다른 함량비를 나타내준다. 따라서 이들 시료는 지방산의 함량비를 조사하는 NIR의 검량선 작성용으로는 오히려 장점으로 활용되었음을 알 수 있다.
번호 | 지방산 농도 (%) | 전체 (mg g-1) |
||||
팔미트산 (C 16:0) |
스테아르산 (C 18:0) |
올레산 (C 18:1) |
리놀레산 (C 18:2) |
리놀렌산 (C 18:3) |
||
wild type(대조) | 7.2 | 3.3 | 19.1 | 13.1 | 57.3 | 440.7 |
형질전환체 | 7.4 | 2.8 | 17.4 | 59.3 | 13.1 | 397.4 |
<
실시예
2> 파괴적 지방산 조성 조사
원심분리용 튜브에 실시예 1의 들깨 시료를 각각 0.2 g씩 취한 후, 추출용매(chloroform : methanol =2 : 1) 5 ㎖과 내부 표준물질[MeOH에 1000 ppm으로 녹인 펜타디카노익 산(pentadecanoic acid): Sigma-Aldrich, USA] 1 ㎖을 넣고 1시간 동안 초음파 처리하였다. 이후 5 ㎖의 0.58% NaCl 용액(물에 녹임)을 넣고 10분 동안 초음파 처리하였다. 추출액을 2000 rpm으로 15분 동안 원심분리하여 클로로포름 분획(하층)을 취하여 질소가스로 용매를 날려서 농축하였다. 이후 0.5 ㎖ 톨루엔과 2 ㎖의 0.5N NaOH(메탄올에 녹임)를 넣고, 뜨거운 물(80℃)에서 5분 동안 중탕하였다. 상기 뜨거운 용액을 방냉한 후, 다시 2.5 ㎖의 14% BF3(Boron trifloride methanol solution 14%: Sigma-Aldrich, USA)를 넣고, 뜨거운 물(80℃)에서 5분 동안 중탕 후 방냉하였다. 상기 시료에 10 ㎖의 석유에테르(petroleum ether)와 15 ㎖의 증류수를 넣어 다른 시험관으로 옮겨 담은 후, 볼텍싱한 다음 2000 rpm으로 10분 동안 4℃에서 원심분리하였다. 상층액만 취하여 새 검사 튜브로 여과한(sodium sulfate, Whatman filter, USA) 후, 여과액을 질소가스로 농축하여 1 ㎖ 석유에테르에 용해시켜 GC/FID(Hewlett Packard, 5890 series Ⅱ, USA)로 분석하였다.
본 실험에 사용된 GC-FID 조건은 분석컬럼으로 DB-WAX capillary column(60 m X 0.25 ㎜ I.D, 0.25 ㎛; J&W Scientific, USA)을 사용하여 180℃에서 등온으로 분석하였고 주입기(injector)와 검출기(detector)의 온도는 각각 200℃와 220℃로 유지하였다. 이동상(질소가스) 속도는 1 ㎖/분, 스플리트(split) 비율은 1:15, 주입량은 1 ㎕로 하였다. 정량은 크로마토그램에 나타난 각각의 피크 면적을 내부표준물질 펜타디카노익 산(pentadecanoic acid: Sigma-Aldrich, USA)과 비교하여 계산하였다. 크로마토그램 상에 나타난 지방산별 지연 시간(retention time)은 팔미트산 12.1, 스테아르산 19.7, 올레산 20.6, 니놀레산 23.2, 니놀렌산 27.6으로 단위는 분(minute)이다.
그 결과, 표 2에서 나타난 바와 같이 P6001 내지 P6262의 262점의 들깨, 대조군(대표적인 들깨 종) 및 Pc1 내지 Pc5의 야생형 들깨 5종(3반복)의 팔미트산(C 16:0), 스테아르산(C 18:0), 올레산(C 18:1), 리놀레산(C 18:2), 리놀렌산(C 18:3) 및 전체 지방산의 함량을 측정하였다.
번호 | 지방산 농도(%) | 전체 지방산 (mg g-1) |
||||
팔미트산(C 16:0) | 스테아르산(C 18:0) | 올레산 (C 18:1) |
리놀레산 (C 18:2) |
리놀렌산 (C 18:3) |
||
P6001 | 7.7 | 2.7 | 17.3 | 67.4 | 4.8 | 371.0 |
P6002 | 7.7 | 2.7 | 18.1 | 66.3 | 5.3 | 359.2 |
P6003 | 7.7 | 2.6 | 18.5 | 66.8 | 4.3 | 372.0 |
P6004 | 7.9 | 3.2 | 18.2 | 66.0 | 4.7 | 317.6 |
P6005 | 7.7 | 4.1 | 18.2 | 63.5 | 6.4 | 323.8 |
P6006 | 8.0 | 3.1 | 17.9 | 66.1 | 5.0 | 365.5 |
P6007 | 7.5 | 2.7 | 20.3 | 65.0 | 4.4 | 412.4 |
P6008 | 8.0 | 3.3 | 17.7 | 66.1 | 4.8 | 410.5 |
P6009 | 7.8 | 2.9 | 18.4 | 65.8 | 5.1 | 393.9 |
P6010 | 7.9 | 2.5 | 18.5 | 66.5 | 4.7 | 380.8 |
P6011 | 7.6 | 2.6 | 18.1 | 66.6 | 5.1 | 418.6 |
P6012 | 7.5 | 2.6 | 17.5 | 45.3 | 27.2 | 417.1 |
P6013 | 7.6 | 2.6 | 17.6 | 60.2 | 12.0 | 406.1 |
P6014 | 7.5 | 2.7 | 18.1 | 67.0 | 4.7 | 428.2 |
P6015 | 7.3 | 2.6 | 17.4 | 48.9 | 23.9 | 400.8 |
P6016 | 7.2 | 2.5 | 17.7 | 52.0 | 20.5 | 421.7 |
P6017 | 7.5 | 2.5 | 18.5 | 67.1 | 4.4 | 442.3 |
P6018 | 7.5 | 2.5 | 17.4 | 54.8 | 17.8 | 376.8 |
P6019 | 7.2 | 2.4 | 18.9 | 66.7 | 4.9 | 415.9 |
P6020 | 7.5 | 2.6 | 17.6 | 67.6 | 4.7 | 406.8 |
P6021 | 7.4 | 2.6 | 19.0 | 49.3 | 21.7 | 450.9 |
P6022 | 7.4 | 2.6 | 18.0 | 48.7 | 23.2 | 388.1 |
P6023 | 7.3 | 2.8 | 18.0 | 51.2 | 20.7 | 395.4 |
P6024 | 7.8 | 2.6 | 19.2 | 65.8 | 4.7 | 380.4 |
P6025 | 7.6 | 2.7 | 18.8 | 66.3 | 4.6 | 404.8 |
P6026 | 7.5 | 2.7 | 17.6 | 53.4 | 18.8 | 434.7 |
P6027 | 7.7 | 2.5 | 17.6 | 67.6 | 4.6 | 380.1 |
P6028 | 7.4 | 2.5 | 19.1 | 53.8 | 17.2 | 386.1 |
P6029 | 7.5 | 2.5 | 19.1 | 66.0 | 4.9 | 426.3 |
P6030 | 7.4 | 2.4 | 17.1 | 47.7 | 25.4 | 424.4 |
P6031 | 7.7 | 2.7 | 18.5 | 52.3 | 18.7 | 394.2 |
P6032 | 7.7 | 2.6 | 17.3 | 54.3 | 18.2 | 415.1 |
P6033 | 7.7 | 2.5 | 17.0 | 46.0 | 26.9 | 436.9 |
P6034 | 7.3 | 2.7 | 17.9 | 53.1 | 19.0 | 435.2 |
P6035 | 7.7 | 2.8 | 16.8 | 48.9 | 23.8 | 415.1 |
P6036 | 7.7 | 2.6 | 18.1 | 52.3 | 19.2 | 407.0 |
P6037 | 8.1 | 2.5 | 16.8 | 67.4 | 5.3 | 358.0 |
P6038 | 7.7 | 2.5 | 17.5 | 68.0 | 4.4 | 386.4 |
P6039 | 7.8 | 2.8 | 19.3 | 65.6 | 4.6 | 432.7 |
P6040 | 8.0 | 3.3 | 21.1 | 62.1 | 5.6 | 400.2 |
P6041 | 7.5 | 2.8 | 18.1 | 66.6 | 5.0 | 383.5 |
P6042 | 7.6 | 2.6 | 17.2 | 68.2 | 4.4 | 403.7 |
P6043 | 7.8 | 3.1 | 19.2 | 65.7 | 4.2 | 423.0 |
P6044 | 7.7 | 3.4 | 19.4 | 64.9 | 4.6 | 387.0 |
P6045 | 8.0 | 3.0 | 16.6 | 66.9 | 5.5 | 352.0 |
P6046 | 8.0 | 3.1 | 19.2 | 64.8 | 4.9 | 443.3 |
P6047 | 7.6 | 2.8 | 21.0 | 63.4 | 5.3 | 375.2 |
P6048 | 7.8 | 2.7 | 18.8 | 66.6 | 4.1 | 408.2 |
P6049 | 7.7 | 2.8 | 19.1 | 66.2 | 4.2 | 403.6 |
P6050 | 7.7 | 2.8 | 18.9 | 55.8 | 14.9 | 411.0 |
P6051 | 7.6 | 3.2 | 18.6 | 50.9 | 19.7 | 390.0 |
P6052 | 7.8 | 2.7 | 17.0 | 51.4 | 21.1 | 367.5 |
P6053 | 7.6 | 2.8 | 19.0 | 65.8 | 4.8 | 416.0 |
P6054 | 7.7 | 2.8 | 19.3 | 48.6 | 21.7 | 385.4 |
P6055 | 7.9 | 2.7 | 18.0 | 67.3 | 4.1 | 421.9 |
P6056 | 7.6 | 2.7 | 17.3 | 51.1 | 21.3 | 409.4 |
P6057 | 7.5 | 2.7 | 18.4 | 66.8 | 4.7 | 409.9 |
P6058 | 7.5 | 2.7 | 18.4 | 49.7 | 21.7 | 398.4 |
P6059 | 7.6 | 2.6 | 17.5 | 48.8 | 23.5 | 398.3 |
P6060 | 7.4 | 3.0 | 17.0 | 57.2 | 15.4 | 445.1 |
P6061 | 7.3 | 2.8 | 18.1 | 57.4 | 14.4 | 463.1 |
P6062 | 7.4 | 2.6 | 16.8 | 62.1 | 11.2 | 460.1 |
P6063 | 7.8 | 3.0 | 18.8 | 56.2 | 14.1 | 425.8 |
P6064 | 7.2 | 2.8 | 18.0 | 57.3 | 14.7 | 417.2 |
P6065 | 7.4 | 2.8 | 17.4 | 59.3 | 13.1 | 397.4 |
P6066 | 7.4 | 2.9 | 16.9 | 48.9 | 23.9 | 447.2 |
P6067 | 7.5 | 2.8 | 17.8 | 60.1 | 11.7 | 419.7 |
P6068 | 7.1 | 2.8 | 17.8 | 55.0 | 17.2 | 436.8 |
P6069 | 7.4 | 2.6 | 16.5 | 55.7 | 17.8 | 425.2 |
P6070 | 7.7 | 2.8 | 16.2 | 38.8 | 34.5 | 415.6 |
P6071 | 7.3 | 2.7 | 16.3 | 43.8 | 29.8 | 475.8 |
P6072 | 7.3 | 2.8 | 17.7 | 59.9 | 12.3 | 435.9 |
P6073 | 7.4 | 2.7 | 17.5 | 59.9 | 12.6 | 436.8 |
P6074 | 7.1 | 2.6 | 16.1 | 39.4 | 34.8 | 436.2 |
P6075 | 7.4 | 2.8 | 18.1 | 43.9 | 27.9 | 441.7 |
P6076 | 7.2 | 2.6 | 17.6 | 50.4 | 22.1 | 463.0 |
P6077 | 7.2 | 2.5 | 15.9 | 47.8 | 26.6 | 465.5 |
P6078 | 7.2 | 2.7 | 17.6 | 55.3 | 17.2 | 461.0 |
P6079 | 7.4 | 2.8 | 18.4 | 45.7 | 25.7 | 399.9 |
P6080 | 7.5 | 2.7 | 16.1 | 56.4 | 17.4 | 466.5 |
P6081 | 7.2 | 2.9 | 17.4 | 57.6 | 14.9 | 440.0 |
P6082 | 7.2 | 2.5 | 16.5 | 51.7 | 22.1 | 460.7 |
P6083 | 7.2 | 2.9 | 17.9 | 46.8 | 25.1 | 390.0 |
P6084 | 7.4 | 3.1 | 16.8 | 52.8 | 19.9 | 391.9 |
P6085 | 7.2 | 3.1 | 17.9 | 58.0 | 13.7 | 464.3 |
P6086 | 7.2 | 2.9 | 18.1 | 52.5 | 19.4 | 454.7 |
P6087 | 7.2 | 2.8 | 16.6 | 55.5 | 17.9 | 452.4 |
P6088 | 7.4 | 2.7 | 17.0 | 51.4 | 21.5 | 408.2 |
P6089 | 7.3 | 2.7 | 18.3 | 47.3 | 24.3 | 411.0 |
P6090 | 7.6 | 2.7 | 17.3 | 53.4 | 19.0 | 419.1 |
P6091 | 7.4 | 2.9 | 18.5 | 48.5 | 22.7 | 397.5 |
P6092 | 7.7 | 2.7 | 18.4 | 60.0 | 11.2 | 422.1 |
P6093 | 7.6 | 3.0 | 18.7 | 58.8 | 12.0 | 436.4 |
P6094 | 7.6 | 2.7 | 18.6 | 52.8 | 18.3 | 434.1 |
P6095 | 7.5 | 3.1 | 18.5 | 47.2 | 23.8 | 437.6 |
P6096 | 7.5 | 3.0 | 17.9 | 46.6 | 25.0 | 466.6 |
P6097 | 7.5 | 2.8 | 19.4 | 44.8 | 25.4 | 434.7 |
P6098 | 7.7 | 2.8 | 18.3 | 60.0 | 11.3 | 448.2 |
P6099 | 7.9 | 2.8 | 17.9 | 48.4 | 23.0 | 445.9 |
P6100 | 7.5 | 2.9 | 18.4 | 55.0 | 16.2 | 602.9 |
P6101 | 7.7 | 2.8 | 18.3 | 59.0 | 12.3 | 427.7 |
P6102 | 7.5 | 2.9 | 18.4 | 56.1 | 15.2 | 415.4 |
P6103 | 7.5 | 2.9 | 18.1 | 56.9 | 14.6 | 402.4 |
P6104 | 7.4 | 2.8 | 18.8 | 59.9 | 11.1 | 426.0 |
P6105 | 7.5 | 2.8 | 18.9 | 60.2 | 10.5 | 488.8 |
P6106 | 7.4 | 2.9 | 19.1 | 56.8 | 13.8 | 435.4 |
P6107 | 7.3 | 2.8 | 19.4 | 56.1 | 14.4 | 429.1 |
P6108 | 7.5 | 2.7 | 17.5 | 57.8 | 14.4 | 421.5 |
P6109 | 7.2 | 2.9 | 19.8 | 13.8 | 56.2 | 388.5 |
P6110 | 7.4 | 3.3 | 22.8 | 15.9 | 50.5 | 405.4 |
P6111 | 7.4 | 3.5 | 19.9 | 15.6 | 53.6 | 386.4 |
P6112 | 7.7 | 3.3 | 20.2 | 17.6 | 51.3 | 383.6 |
P6113 | 7.3 | 3.3 | 20.4 | 14.5 | 54.6 | 383.0 |
P6114 | 7.5 | 3.4 | 20.8 | 15.6 | 52.8 | 376.7 |
P6115 | 7.4 | 3.2 | 20.6 | 15.8 | 53.0 | 387.7 |
P6116 | 7.2 | 3.5 | 15.7 | 13.0 | 60.6 | 421.9 |
P6117 | 7.4 | 3.1 | 15.5 | 13.1 | 61.0 | 435.9 |
P6118 | 7.3 | 3.1 | 17.8 | 14.3 | 57.6 | 399.6 |
P6119 | 7.0 | 2.9 | 16.2 | 13.2 | 60.7 | 409.2 |
P6120 | 6.9 | 3.5 | 17.1 | 13.3 | 59.2 | 428.0 |
P6121 | 7.2 | 3.0 | 14.8 | 13.6 | 61.4 | 413.9 |
P6122 | 7.1 | 3.0 | 15.9 | 14.0 | 60.0 | 429.1 |
P6123 | 7.1 | 2.8 | 15.6 | 13.4 | 61.1 | 415.8 |
P6124 | 7.3 | 3.1 | 15.5 | 14.6 | 59.5 | 410.1 |
P6125 | 7.4 | 3.1 | 16.3 | 13.8 | 59.3 | 428.1 |
P6126 | 7.2 | 3.3 | 18.1 | 13.2 | 58.3 | 407.3 |
P6127 | 7.3 | 3.4 | 17.5 | 13.6 | 58.3 | 408.5 |
P6128 | 7.5 | 3.7 | 17.3 | 13.5 | 58.1 | 389.3 |
P6129 | 7.0 | 3.1 | 16.9 | 12.8 | 60.2 | 413.7 |
P6130 | 7.1 | 3.2 | 17.5 | 13.4 | 58.8 | 358.7 |
P6131 | 7.2 | 3.1 | 17.0 | 13.4 | 59.3 | 414.2 |
P6132 | 7.1 | 3.1 | 16.8 | 13.6 | 59.4 | 400.3 |
P6133 | 7.1 | 3.0 | 16.8 | 13.2 | 59.8 | 339.2 |
P6134 | 7.2 | 2.9 | 15.9 | 13.3 | 60.7 | 402.1 |
P6135 | 7.2 | 3.1 | 19.2 | 13.4 | 57.2 | 398.1 |
P6136 | 7.1 | 3.0 | 17.8 | 13.4 | 58.6 | 376.6 |
P6137 | 7.1 | 3.0 | 17.6 | 14.5 | 57.7 | 381.8 |
P6138 | 7.3 | 2.9 | 16.7 | 12.8 | 60.3 | 377.4 |
P6139 | 7.2 | 3.3 | 18.0 | 14.5 | 57.1 | 429.6 |
P6140 | 7.1 | 3.3 | 18.4 | 13.4 | 57.8 | 384.9 |
P6141 | 7.3 | 3.2 | 17.7 | 13.1 | 58.7 | 386.2 |
P6142 | 7.2 | 2.7 | 15.6 | 13.3 | 61.2 | 387.1 |
P6143 | 6.8 | 2.8 | 15.4 | 11.9 | 63.1 | 397.2 |
P6144 | 7.0 | 2.9 | 16.8 | 11.7 | 61.6 | 404.2 |
P6145 | 7.2 | 3.0 | 16.1 | 12.0 | 61.8 | 417.2 |
P6146 | 7.0 | 2.8 | 15.0 | 12.7 | 62.4 | 399.5 |
P6147 | 7.0 | 3.0 | 17.4 | 12.3 | 60.3 | 383.2 |
P6148 | 7.0 | 3.0 | 15.2 | 12.5 | 62.3 | 427.2 |
P6149 | 6.9 | 3.1 | 16.5 | 12.7 | 60.9 | 413.5 |
P6150 | 8.1 | 3.7 | 2.0 | 14.0 | 72.2 | 359.0 |
P6151 | 7.1 | 3.0 | 17.7 | 12.2 | 60.1 | 410.2 |
P6152 | 7.0 | 3.0 | 16.8 | 12.5 | 60.7 | 433.5 |
P6153 | 7.3 | 3.3 | 20.6 | 14.5 | 54.4 | 364.3 |
P6154 | 7.4 | 3.1 | 17.6 | 13.1 | 58.8 | 399.3 |
P6155 | 7.1 | 3.2 | 18.8 | 13.5 | 57.4 | 398.1 |
P6156 | 7.0 | 3.1 | 18.1 | 12.8 | 58.9 | 430.8 |
P6157 | 7.0 | 2.9 | 15.3 | 13.2 | 61.6 | 438.0 |
P6158 | 7.2 | 3.2 | 17.4 | 13.7 | 58.5 | 422.8 |
P6159 | 7.1 | 3.1 | 16.8 | 13.6 | 59.5 | 468.3 |
P6160 | 7.0 | 3.2 | 17.2 | 13.6 | 58.9 | 442.6 |
P6161 | 7.0 | 3.2 | 17.7 | 13.6 | 58.6 | 438.4 |
P6162 | 7.2 | 3.3 | 20.5 | 13.2 | 55.9 | 411.7 |
P6163 | 7.2 | 3.0 | 17.9 | 13.0 | 59.0 | 411.4 |
P6164 | 7.2 | 3.1 | 19.5 | 12.5 | 57.7 | 428.7 |
P6165 | 7.3 | 3.2 | 20.0 | 12.3 | 57.1 | 415.0 |
P6166 | 7.1 | 3.7 | 21.0 | 11.8 | 56.4 | 411.1 |
P6167 | 7.2 | 3.1 | 16.6 | 12.4 | 60.7 | 405.0 |
P6168 | 7.3 | 3.1 | 15.3 | 13.7 | 60.6 | 432.5 |
P6169 | 7.4 | 3.5 | 18.3 | 12.9 | 58.0 | 437.1 |
P6170 | 7.4 | 3.6 | 18.5 | 12.8 | 57.7 | 410.3 |
P6171 | 7.1 | 3.2 | 18.9 | 12.7 | 58.1 | 470.2 |
P6172 | 7.4 | 3.2 | 18.2 | 12.2 | 58.9 | 416.9 |
P6173 | 7.4 | 3.6 | 16.8 | 12.8 | 59.3 | 399.6 |
P6174 | 7.1 | 3.1 | 17.9 | 12.2 | 59.6 | 459.5 |
P6175 | 6.9 | 3.3 | 18.5 | 12.6 | 58.7 | 450.5 |
P6176 | 7.4 | 3.1 | 15.0 | 12.9 | 61.6 | 434.9 |
P6177 | 7.2 | 2.9 | 15.5 | 12.3 | 62.1 | 381.0 |
P6178 | 7.1 | 2.8 | 15.6 | 12.0 | 62.5 | 337.1 |
P6179 | 7.2 | 2.8 | 15.5 | 11.9 | 62.6 | 369.9 |
P6180 | 7.1 | 2.9 | 15.9 | 11.6 | 62.4 | 396.7 |
P6181 | 7.9 | 2.9 | 15.8 | 13.2 | 60.2 | 322.4 |
P6182 | 7.2 | 2.7 | 15.8 | 12.3 | 62.1 | 402.7 |
P6183 | 7.3 | 2.9 | 15.0 | 12.7 | 62.2 | 404.9 |
P6184 | 7.3 | 2.8 | 15.7 | 12.3 | 61.9 | 378.4 |
P6185 | 7.2 | 3.0 | 16.9 | 12.1 | 60.8 | 389.3 |
P6186 | 8.9 | 3.4 | 17.3 | 13.2 | 57.2 | 192.9 |
P6187 | 7.7 | 4.0 | 19.3 | 12.0 | 56.9 | 362.5 |
P6188 | 7.7 | 3.7 | 18.4 | 12.0 | 58.3 | 384.3 |
P6189 | 7.3 | 3.3 | 16.3 | 12.3 | 60.8 | 401.5 |
P6190 | 7.4 | 3.3 | 18.4 | 11.6 | 59.4 | 432.1 |
P6191 | 7.4 | 3.2 | 20.0 | 11.7 | 57.6 | 411.7 |
P6192 | 7.3 | 3.2 | 14.8 | 13.4 | 61.2 | 390.7 |
P6193 | 7.3 | 3.6 | 19.5 | 12.0 | 57.7 | 387.3 |
P6194 | 7.9 | 3.8 | 19.2 | 11.8 | 57.3 | 360.3 |
P6195 | 7.2 | 2.8 | 14.4 | 13.1 | 62.5 | 376.1 |
P6196 | 7.0 | 2.8 | 14.8 | 13.5 | 61.8 | 432.2 |
P6197 | 7.1 | 2.8 | 15.1 | 13.9 | 61.2 | 420.1 |
P6198 | 6.9 | 3.5 | 16.1 | 15.0 | 58.6 | 393.4 |
P6199 | 7.1 | 3.1 | 15.1 | 13.9 | 60.9 | 417.7 |
P6200 | 7.2 | 2.8 | 16.6 | 12.0 | 61.4 | 416.1 |
P6201 | 8.4 | 3.2 | 19.3 | 13.9 | 55.3 | 338.4 |
P6202 | 7.5 | 3.0 | 16.6 | 13.1 | 59.8 | 387.4 |
P6203 | 7.1 | 3.0 | 19.1 | 12.4 | 58.3 | 395.0 |
P6204 | 7.1 | 3.3 | 19.0 | 12.4 | 58.1 | 380.3 |
P6205 | 7.4 | 5.1 | 16.1 | 14.0 | 57.4 | 367.8 |
P6206 | 6.9 | 3.0 | 15.7 | 12.7 | 61.7 | 485.1 |
P6207 | 7.0 | 2.9 | 16.0 | 12.6 | 61.6 | 440.7 |
P6208 | 7.1 | 3.2 | 15.7 | 13.8 | 60.2 | 440.2 |
P6209 | 7.5 | 3.1 | 14.9 | 14.1 | 60.4 | 418.3 |
P6210 | 7.2 | 3.3 | 17.0 | 12.4 | 60.0 | 316.2 |
P6211 | 6.9 | 3.2 | 16.6 | 12.5 | 60.8 | 438.8 |
P6212 | 7.1 | 3.1 | 15.9 | 13.2 | 60.6 | 439.7 |
P6213 | 7.0 | 3.1 | 16.1 | 12.7 | 61.1 | 442.0 |
P6214 | 6.9 | 3.2 | 14.9 | 13.0 | 62.1 | 448.4 |
P6215 | 6.9 | 3.1 | 16.2 | 12.6 | 61.2 | 437.6 |
P6216 | 6.8 | 2.9 | 14.6 | 13.1 | 62.6 | 468.6 |
P6217 | 7.1 | 3.0 | 16.0 | 12.9 | 61.1 | 444.7 |
P6218 | 6.9 | 3.1 | 15.8 | 12.0 | 62.2 | 452.0 |
P6219 | 6.7 | 2.9 | 14.0 | 13.1 | 63.3 | 491.0 |
P6220 | 6.9 | 3.2 | 17.2 | 13.1 | 59.6 | 419.4 |
P6221 | 6.9 | 3.2 | 16.4 | 12.8 | 60.8 | 420.0 |
P6222 | 7.2 | 3.1 | 15.3 | 12.8 | 61.7 | 434.1 |
P6223 | 7.1 | 3.0 | 16.3 | 13.5 | 60.0 | 445.0 |
P6224 | 6.8 | 3.2 | 15.3 | 12.9 | 61.9 | 410.1 |
P6225 | 7.1 | 3.4 | 17.5 | 12.8 | 59.1 | 422.0 |
P6226 | 7.2 | 3.2 | 14.8 | 13.1 | 61.8 | 406.7 |
P6227 | 7.3 | 3.8 | 15.9 | 12.1 | 60.9 | 362.0 |
P6228 | 6.8 | 3.1 | 15.7 | 12.2 | 62.2 | 436.6 |
P6229 | 7.5 | 3.7 | 15.8 | 13.0 | 60.0 | 302.5 |
P6230 | 7.9 | 3.8 | 16.4 | 13.4 | 58.5 | 327.1 |
P6231 | 7.7 | 3.6 | 16.7 | 12.8 | 59.3 | 383.4 |
P6232 | 7.0 | 3.3 | 16.7 | 11.7 | 61.3 | 365.2 |
P6233 | 7.3 | 3.3 | 15.9 | 13.2 | 60.3 | 419.6 |
P6234 | 7.0 | 3.4 | 16.0 | 12.9 | 60.7 | 462.0 |
P6235 | 7.5 | 3.8 | 18.1 | 13.3 | 57.3 | 367.4 |
P6236 | 6.9 | 4.9 | 18.2 | 14.6 | 55.3 | 365.4 |
P6237 | 7.2 | 3.8 | 15.5 | 13.5 | 60.0 | 398.7 |
P6238 | 6.8 | 3.2 | 16.0 | 13.4 | 60.7 | 465.8 |
P6239 | 6.8 | 2.9 | 15.3 | 12.8 | 62.1 | 447.1 |
P6240 | 6.9 | 3.7 | 18.1 | 13.1 | 58.2 | 347.3 |
P6241 | 7.0 | 3.3 | 18.0 | 12.1 | 59.5 | 425.4 |
P6242 | 7.0 | 3.2 | 16.1 | 12.8 | 60.9 | 438.6 |
P6243 | 7.0 | 3.2 | 15.0 | 12.4 | 62.4 | 411.5 |
P6244 | 7.6 | 3.9 | 14.4 | 13.1 | 61.0 | 401.5 |
P6245 | 7.9 | 3.5 | 18.7 | 12.8 | 57.1 | 330.6 |
P6246 | 7.6 | 4.7 | 18.7 | 13.4 | 55.6 | 324.1 |
P6247 | 8.2 | 3.0 | 15.5 | 15.5 | 57.9 | 424.7 |
P6248 | 8.2 | 2.7 | 14.5 | 14.6 | 60.0 | 384.0 |
P6249 | 8.2 | 2.7 | 14.7 | 13.9 | 60.5 | 427.6 |
P6250 | 7.8 | 3.2 | 15.2 | 14.2 | 59.6 | 403.5 |
P6251 | 7.6 | 3.2 | 16.0 | 14.1 | 59.1 | 431.6 |
P6252 | 7.8 | 3.1 | 15.5 | 15.6 | 57.9 | 421.8 |
P6253 | 8.1 | 3.5 | 18.7 | 14.0 | 55.7 | 370.4 |
P6254 | 7.9 | 3.6 | 20.5 | 13.6 | 54.3 | 375.5 |
P6255 | 7.8 | 3.4 | 20.1 | 13.2 | 55.5 | 377.1 |
P6256 | 8.0 | 3.5 | 18.8 | 13.8 | 55.9 | 374.4 |
P6257 | 8.1 | 3.6 | 19.1 | 12.5 | 56.7 | 400.4 |
P6258 | 8.0 | 3.3 | 18.7 | 14.1 | 55.9 | 370.0 |
P6259 | 7.8 | 3.1 | 16.2 | 13.9 | 59.1 | 403.4 |
P6260 | 7.8 | 3.4 | 19.9 | 14.9 | 54.0 | 399.1 |
P6261 | 7.5 | 3.2 | 18.8 | 14.0 | 56.5 | 394.0 |
P6262 | 7.6 | 3.3 | 19.3 | 13.7 | 56.2 | 393.2 |
대조군 | 7.2 | 3.3 | 19.1 | 13.1 | 57.3 | 440.8 |
Pc1-1 | 7.1 | 3.0 | 16.1 | 15.2 | 58.6 | 400.6 |
Pc1-2 | 7.6 | 3.0 | 15.6 | 13.3 | 60.5 | 333.6 |
Pc1-3 | 7.6 | 2.8 | 16.7 | 13.6 | 59.3 | 331.8 |
Pc2-1 | 7.9 | 4.0 | 21.7 | 12.0 | 54.4 | 285.2 |
Pc2-2 | 7.2 | 3.5 | 21.6 | 11.6 | 56.1 | 351.5 |
Pc2-3 | 6.8 | 6.3 | 20.3 | 13.0 | 53.6 | 319.4 |
Pc3-1 | 5.3 | 6.2 | 18.6 | 14.9 | 55.0 | 255.3 |
Pc3-2 | 6.8 | 5.8 | 18.8 | 15.2 | 53.4 | 366.5 |
Pc3-3 | 7.1 | 3.2 | 17.9 | 13.4 | 58.4 | 415.7 |
Pc4-1 | 7.2 | 3.1 | 17.7 | 12.5 | 59.4 | 397.1 |
Pc4-2 | 7.2 | 3.1 | 16.2 | 12.8 | 60.8 | 359.1 |
Pc4-3 | 7.4 | 3.0 | 16.3 | 12.3 | 61.1 | 375.8 |
Pc5-1 | 6.7 | 3.1 | 19.7 | 11.1 | 59.4 | 422.2 |
Pc5-2 | 6.7 | 3.1 | 19.8 | 11.0 | 59.4 | 440.5 |
Pc5-3 | 6.8 | 3.0 | 18.6 | 11.1 | 60.5 | 441.1 |
평균 | 7.3 | 3.1 | 17.5 | 30.2 | 41.9 | 406.8 |
SD | 0.4 | 0.5 | 1.8 | 22.0 | 22.5 | 39.7 |
최소값 | 5.3 | 2.4 | 2.0 | 11.0 | 4.1 | 192.9 |
최대값 | 8.9 | 6.3 | 22.8 | 68.2 | 72.2 | 602.9 |
<
실시예
3> 들깨의
NIR
스펙트럼 프로파일 작성
1) 근적외선 분광광도계 6500(FOSS NIRsystems, INc., 한국) 자체의 전체 진단테스트(Diagnodtics)를 수행하여 장비 점검을 모두 통과하였다. 새 파일을 생성한 후 1100-2350 ㎚의 파장에서 스펙트럼을 작성하도록 설정하였다.
2) 실온에서 3일 이상 건조된 실시예 1의 들깨 시료 0.7 g을 시료 셀(지름 18 ㎜, 깊이 0.4 ㎜: IH-0348, Foss, USA)에 적재하였다. 전체 262점의 들깨 시료당 1분 동안 파장 1100-2350 ㎚에서 스펙트럼 프로파일을 작성하였다. 이때, 내부 표준물질로는 세라믹(Ceramic; Foss, USA)
그 결과, 도 1에서 나타난 바와 같은 들깨 262점에 대한 스펙트럼 프로파일을 수득하였다.
<
실시예
4> 들깨의 지방산 정량용 검량 곡선 작성
상기 도 1의 근적외선 스펙트럼을 1차 또는 2차 미분법 및 8 ㎚의 측정 파 장 갭으로 수처리를 수행하였다. 이를 다시 변형 부분최소자승법(MPLS: Modified Partial Least Squares)을 이용하여 통계적 분석을 한 후, 실시예 2의 파괴적 정량값 및 실시예 3의 비파괴적 정량값 간에 고도의 유의 상관을 나타내는 적정의 검량식을 도출하였다. 검증 검량식이 얻어지면 이 검량식의 적용이 합당한지를 검증하여야 하므로, 검량식을 만들 때 교차검증(Cross Validation; CV)을 사용하여 검량 세트 내에서 내부 검증하였다.
그 결과, 도 2에서 나타난 바와 같이 각 지방산별 검량 곡선을 수득하였고, 표 3에서 나타난 바와 같이 각 검량 곡선의 다중결정계수(R2: squared coefficient of multiple determination in calibration)를 수득하였다. 특히 리놀레산(수학식 1)과 리놀렌산(수학식 2)의 검량 곡선의 다중결정계수가 0.99 이상으로 정확성이 높은 것으로 나타났다.
시료 | RSQ(r2) | |||||
팔미트산 (C 16:0) |
스테아르산 (C 18:0) |
올레산 (C 18:1) |
리놀레산 (C 18:2) |
리놀렌산 (C 18:3) |
전체 지방산 | |
결정계수 ( r2) |
0.684 | 0.538 | 0.761 | 0.993 | 0.994 | 0.308 |
도 1은 262점 들깨 시료의 NIR 스펙트럼을 나타낸 도이다.
도 2는 들깨 지방산별 검량곡선을 나타낸 도이다:
Slope: 기울기, RSQ: 다중결정계수, SEP: 표준예측오차, BIAS: 절편, SEP(C): 표준예측오차(corrected);
a: 리놀레산;
b: 리놀렌산;
c: 올레산;
d: 팔미트산;
e: 스테아르산; 및,
f: 전체 지방산.
Claims (6)
1) 비파쇄 들깨 종자를 품종에 따라 구분하여 테스트 시험관에 넣어 근적외광 분석기에 삽입한 후, 근적외광을 조사하여 408 내지 2484 ㎚ 영역의 흡수 스펙트럼을 수득하는 단계;
2) 상기 근적외선 스펙트럼에 1차 미분법을 적용하고 측정 파장별 갭을 8 ㎚으로 1차 도함수 값을 수득하는 단계;
3) 상기 파장별 1차 도함수 값을 하기 수학식 1의 함수에 대입하여, 들깨 시료 내 리놀레산 함량을 결정하는 단계를 포함하는 들깨의 리놀레산 성분의 조성비에 대한 비파괴 정량 방법:
[수학식 1]
리놀레산 함량(%) = 17.948 + 0.4431x'408 + 2.8241x'416 - 12.905x'424 - 3.6207x'432 + 1.2902x'440 + 1.5259x'448 - 14.3795x'456 - 2.8442x'464 + 4.3859x'472 - 10.9486x'480 - 5.9771x'488 + 5.4596x'496 + 4.7831x'504 + 22.9702x'512 + 5.1547x'520 - 6.242x'528 - 5.5237x'536 + 1.2284x'544 + 0.4326x'552 + 6.7523x'560 - 8.1339x'568 - 11.6013x'576 - 1.5559x'584 - 7.4499x'592 - 3.4363x'600 - 11.7663x'608 - 3.3829x'616 - 4.1756x'624 - 6.0593x'632 - 5.7922x'640 + 1.4358x'648 + 2.9629x'656 + 5.6959x'664 + 4.5027x'672 + 0.7846x'680 - 1.5461x'688 - 1.285x'696 - 1.2309x'704 - 2.5205x'712 - 2.2193x'720 - 1.8973x'728 - 3.1492x'736 + 10.5798x'744 + 9.3956x'752 + 7.049x'760 - 6.0099x'768 - 6.417x'776 - 1.0252x'784 - 2.6032x'792 - 2.8008x'800 - 2.8341x'808 - 3.006x'816 - 2.795x'824 - 1.5355x'832 - 0.3222x'840 + 0.6095x'848 + 1.4882x'856 + 2.2921x'864 + 3.0237x'872 + 3.8114x'880 + 3.4498x'888 + 3.4529x'896 + 3.272x'904 + 4.2226x'912 + 4.9872x'920 + 3.3665x'928 + 1.9003x'936 + 1.133x'944 + 0.9621x'952 + 1.3728x'960 + 1.0015x'968 + 1.4056x'976 + 2.2063x'984 + 2.9788x'992 + 4.1935x'1000 + 4.6964x'1008 + 4.2016x'1016 + 3.689x'1024 + 2.9088x'1032 + 2.3174x'1040 + 1.2318x'1048 + 1.1709x'1056 + 0.7108x'1064 + 1.4199x'1072 + 1.4735x'1080 + 1.7777x'1088 + 4.6723x'1108 + 6.3004x'1116 + 9.7034x'1124 + 14.87x'1132 + 21.1947x'1140 + 24.0196x'1148 + 18.6233x'1156 + 4.0914x'1164 - 0.1498x'1172 + 5.48x'1180 + 5.0485x'1188 + 2.0593x'1196 - 0.1587x'1204 - 4.9297x'1212 - 10.0394x'1220 - 11.7021x'1228 - 9.7185x'1236 - 5.338x'1244 - 4.0959x'1252 - 1.8562x'1260 + 0.0288x'1268 + 1.0326x'1276 + 1.1174x'1284 + 1.7299x'1292 + 1.1163x'1300 + 0.2151x'1308 + 0.5936x'1316 - 0.2913x'1324 - 2.1229x'1332 - 0.9168x'1340 + 3.5476x'1348 + 4.9232x'1356 + 6.1524x'1364 + 9.8917x'1372 + 3.4875x'1380 - 4.3148x'1388 - 7.8427x'1396 - 7.9719x'1404 - 5.8841x'1412 - 3.2971x'1420 - 1.7889x'1428 - 0.4107x'1436 + 0.5002x'1444 + 1.2842x'1452 - 0.5552x'1460 - 0.446x'1468 + 0.8701x'1476 + 0.0493x'1484 + 0.3809x'1492 - 2.5367x'1500 - 2.768x'1508 + 1.0456x'1516 + 4.4522x'1524 + 5.1791x'1532 + 5.0879x'1540 + 4.0856x'1548 + 3.2078x'1556 + 2.8124x'1564 + 1.2715x'1572 + 2.1923x'1580 + 2.4615x'1588 + 2.3328x'1596 + 4.0869x'1604 + 3.1971x'1612 + 2.8002x'1620 + 2.0255x'1628 + 2.0906x'1636 + 2.4905x'1644 + 0.4147x'1652 - 5.781x'1660 - 6.5243x'1668 - 2.9722x'1676 - 6.2083x'1684 - 10.3664x'1692 - 12.6734x'1700 - 7.7327x'1708 - 4.4172x'1716 + 0.0595x'1724 + 6.6086x'1732 + 6.233x'1740 + 1.8968x'1748 + 1.2026x'1756 + 4.4687x'1764 + 5.8048x'1772 + 3.1084x'1780 + 1.5785x'1788 + 1.3736x'1796 + 1.2761x'1804 + 1.3303x'1812 + 2.0324x'1820 + 1.0257x'1828 + 0.8541x'1836 + 1.1652x'1844 + 1.2573x'1852 + 1.2266x'1860 - 5.6704x'1868 - 5.7255x'1876 - 1.5312x'1884 + 5.9776x'1892 + 6.4681x'1900 + 8.3639x'1908 + 6.1471x'1916 + 0.4329x'1924 - 2.8789x'1932 - 1.3176x'1940 - 2.1196x'1948 - 6.6286x'1956 - 7.0162x'1964 - 7.03x'1972 - 5.5552x'1980 - 3.3773x'1988 - 3.3318x'1996 - 3.1522x'2004 - 3.8277x'2012 - 4.0891x'2020 - 3.7648x'2028 - 3.6338x'2036 - 0.7422x'2044 + 1.8158x'2052 + 4.4087x'2060 + 3.1039x'2068 + 4.1973x'2076 + 1.6969x'2084 + 0.7089x'2092 - 0.815x'2100 + 0.9705x'2108 + 1.4563x'2116 - 0.1745x'2124 - 4.0029x'2132 - 4.9642x'2140 - 3.6994x'2148 - 5.2599x'2156 - 4.8357x'2164 - 1.3293x'2172 - 2.1387x'2180 - 2.5725x'2188 - 0.2334x'2196 + 0.696x'2204 + 3.6449x'2212 - 1.4123x'2220 + 2.127x'2228 + 1.4376x'2236 - 2.3667x'2244 - 6.234x'2252 - 3.242x'2260 - 3.9855x'2268 - 0.8093x'2276 - 1.2993x'2284 - 0.3575x'2292 + 6.8319x'2300 + 5.5592x'2308 + 5.8458x'2316 + 4.7073x'2324 + 0.5239x'2332 - 1.2448x'2340 + 4.6243x'2348 + 0.45x'2356 + 1.4734x'2364 + 5.2383x'2372 + 3.3473x'2380 + 3.7529x'2388 + 4.7428x'2396 + 7.9684x'2404 + 5.9251x'2412 + 9.4423x'2420 + 5.4177x'2428 + 3.9373x'2436 + 8.6313x'2444 + 6.1647x'2452 + 3.8317x'2460 + 0.0844x'2468 + 2.7452x'2476 + 1.4267x'2484.
제 1항에 있어서, 상기 수학식 1의 함수의 다중결정계수(R2)는 0.993인 것을 특징으로 하는 비파괴 정량 방법.
제 1항에 있어서, 상기 x'408 내지 x'2484는 408 내지 2484 ㎚ 사이의 스펙트럼에서 8 ㎚ 간격으로 측정된 1차 도함수 값인 것을 특징으로 하는 비파괴 정량 방법.
1) 비파쇄 들깨 종자를 품종에 따라 구분하여 테스트 시험관에 넣어 근적외광 분석기에 삽입한 후, 근적외광을 조사하여 408 내지 2484 ㎚ 영역의 흡수 스펙트럼을 수득하는 단계;
2) 상기 근적외선 스펙트럼에 1차 미분법을 적용하고 측정 파장별 갭을 8 ㎚으로 1차 도함수 값을 수득하는 단계;
3) 상기 파장별 1차 도함수 값을 하기 수학식 2의 함수에 대입하여, 들깨 시료 내 리놀렌산 함량을 결정하는 단계를 포함하는 들깨의 리놀렌산 성분의 조성비에 대한 비파괴 정량 방법:
[수학식 2]
리놀렌산 함량(%) = 34.0365 - 19.6492x'408 - 10.3899x'416 + 4.5674x'424 - 15.5765x'432 - 0.4301x'440 - 52.7929x'448 + 20.4971x'456 - 4.8475x'464 - 7.7334x'472 + 10.8945x'480 - 11.5166x'488 - 9.2508x'496 - 16.6529x'504 + 4.9646x'512 - 17.9783x'520 - 13.1767x'528 - 4.569x'536 + 3.7045x'544 + 10.3093x'552 - 8.6473x'560 - 0.1298x'568 + 23.8852x'576 - 1.944x'584 + 19.5038x'592 - 4.3612x'600 + 3.7813x'608 - 0.4945x'616 + 6.5086x'624 + 8.6207x'632 + 5.8564x'640 + 0.026x'648 - 2.3833x'656 + 8.5371x'664 + 6.6601x'672 + 14.1656x'680 + 18.7526x'688 + 10.1709x'696 + 11.012x'704 + 6.8726x'712 - 3.1514x'720 - 0.3495x'728 + 7.4496x'736 + 2.1718x'744 + 17.3671x'752 - 20.3102x'760 + 10.2325x'768 + 21.5059x'776 + 13.0923x'784 + 13.9562x'792 + 11.9728x'800 + 11.554x'808 + 8.7378x'816 + 6.355x'824 + 1.0231x'832 - 3.1717x'840 - 6.3512x'848 - 8.7943x'856 - 11.5437x'864 - 12.8443x'872 - 13.0813x'880 - 11.6672x'888 - 14.259x'896 - 14.1463x'904 - 13.6661x'912 - 14.2719x'920 - 15.4881x'928 - 18.1802x'936 - 15.3626x'944 - 8.7624x'952 - 5.4511x'960 - 2.5853x'968 - 2.8064x'976 - 4.1134x'984 - 4.9154x'992 - 5.0592x'1000 - 4.1286x'1008 - 4.7246x'1016 - 6.4564x'1024 - 6.1706x'1032 - 6.5617x'1040 - 7.7849x'1048 - 9.4754x'1056 - 7.4361x'1064 - 5.2902x'1072 - 4.1819x'1080 - 3.616x'1088 + 10.2313x'1108 + 17.5225x'1116 + 24.9089x'1124 + 22.8047x'1132 + 8.7804x'1140 - 4.4118x'1148 - 7.8025x'1156 + 9.7551x'1164 + 16.0001x'1172 + 2.4764x'1180 + 0.9294x'1188 + 7.0774x'1196 + 12.1215x'1204 + 20.2809x'1212 + 25.8x'1220 + 23.243x'1228 + 18.9115x'1236 + 10.4844x'1244 + 10.062x'1252 + 7.0441x'1260 + 4.95x'1268 + 3.3244x'1276 + 2.7387x'1284 + 3.4822x'1292 + 6.7655x'1300 + 9.5417x'1308 + 10.3576x'1316 + 14.0737x'1324 + 19.7812x'1332 + 18.2894x'1340 + 5.4077x'1348 - 2.6008x'1356 - 9.9415x'1364 - 19.9209x'1372 - 9.0534x'1380 + 13.5327x'1388 + 21.8552x'1396 + 17.1352x'1404 + 14.4388x'1412 - 0.2517x'1420 - 6.1894x'1428 - 6.8332x'1436 - 5.8892x'1444 - 4.7638x'1452 - 3.1169x'1460 - 3.508x'1468 - 5.5423x'1476 - 5.3824x'1484 - 6.6253x'1492 - 5.9869x'1500 - 4.7606x'1508 - 6.2127x'1516 - 4.8115x'1524 - 4.4258x'1532 - 3.2899x'1540 - 4.9115x'1548 - 7.1991x'1556 - 6.7083x'1564 - 3.6877x'1572 - 4.9836x'1580 - 6.954x'1588 - 8.4045x'1596 - 14.503x'1604 - 13.2802x'1612 - 10.2938x'1620 - 5.8121x'1628 - 6.3307x'1636 - 10.2177x'1644 - 5.3828x'1652 + 13.22x'1660 + 17.738x'1668 - 3.7732x'1676 - 11.5682x'1684 - 4.5606x'1692 + 4.836x'1700 + 14.1497x'1708 + 20.3469x'1716 + 3.0116x'1724 - 11.4683x'1732 - 12.3291x'1740 - 6.0572x'1748 - 1.8626x'1756 - 2.1749x'1764 - 1.1452x'1772 + 2.1598x'1780 + 0.3936x'1788 + 0.7001x'1796 + 2.2329x'1804 + 1.7359x'1812 - 1.5165x'1820 + 0.7965x'1828 - 2.5538x'1836 - 1.3988x'1844 + 0.793x'1852 + 6.7795x'1860 + 16.7756x'1868 + 28.384x'1876 + 31.4473x'1884 + 16.6206x'1892 - 16.6664x'1900 - 43.9152x'1908 - 40.71x'1916 - 22.8746x'1924 - 4.2343x'1932 - 0.8942x'1940 + 6.6224x'1948 + 11.9573x'1956 + 10.4207x'1964 + 8.7189x'1972 + 5.8039x'1980 + 0.0461x'1988 + 1.3181x'1996 + 6.2145x'2004 + 8.837x'2012 + 10.3784x'2020 + 6.9866x'2028 + 2.1313x'2036 - 5.1567x'2044 - 3.7942x'2052 - 3.4113x'2060 - 2.5809x'2068 - 2.5207x'2076 - 0.7632x'2084 - 0.8853x'2092 + 1.7095x'2100 - 3.0469x'2108 - 13.2375x'2116 - 8.8789x'2124 - 8.5186x'2132 - 6.4953x'2140 - 0.316x'2148 + 5.509x'2156 + 9.0223x'2164 + 6.4544x'2172 + 6.22x'2180 + 8.8485x'2188 + 6.581x'2196 + 19.1322x'2204 + 11.7631x'2212 + 20.2774x'2220 + 19.9111x'2228 + 14.5272x'2236 + 18.4477x'2244 + 10.7763x'2252 - 13.5119x'2260 - 9.3296x'2268 - 6.7219x'2276 - 7.4329x'2284 + 0.0027x'2292 - 17.6023x'2300 - 14.1736x'2308 - 3.1316x'2316 - 0.0152x'2324 - 3.0427x'2332 + 1.1999x'2340 - 5.9044x'2348 + 12.1312x'2356 - 1.3262x'2364 - 9.2043x'2372 - 7.5179x'2380 - 6.4723x'2388 - 9.6722x'2396 - 13.0834x'2404 - 20.216x'2412 - 23.9121x'2420 - 22.1313x'2428 - 26.401x'2436 - 38.5057x'2444 - 45.1729x'2452 - 33.1816x'2460 - 23.7698x'2468 - 19.8987x'2476 - 27.6818x'2484.
제 4항에 있어서, 상기 수학식 2의 함수의 다중결정계수는 0.994인 것을 특징으로 하는 비파괴 정량 방법.
제 4항에 있어서, 상기 x'408 내지 x'2484는 408 내지 2484 ㎚ 사이의 스펙트럼에서 8 ㎚ 간격으로 측정된 1차 도함수 값인 것을 특징으로 하는 비파괴 정량 방법.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020090005459A KR101027434B1 (ko) | 2009-01-22 | 2009-01-22 | 근적외광을 이용한 들깨의 지방산 조성을 정량하는 방법 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020090005459A KR101027434B1 (ko) | 2009-01-22 | 2009-01-22 | 근적외광을 이용한 들깨의 지방산 조성을 정량하는 방법 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20100086217A KR20100086217A (ko) | 2010-07-30 |
KR101027434B1 true KR101027434B1 (ko) | 2011-04-25 |
Family
ID=42644830
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020090005459A KR101027434B1 (ko) | 2009-01-22 | 2009-01-22 | 근적외광을 이용한 들깨의 지방산 조성을 정량하는 방법 |
Country Status (1)
Country | Link |
---|---|
KR (1) | KR101027434B1 (ko) |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR102141154B1 (ko) | 2019-10-28 | 2020-08-05 | 조선대학교산학협력단 | 근적외선 및 케모메트릭스를 이용한 고구마의 비파괴 품질평가 방법 |
Families Citing this family (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN102252972B (zh) * | 2011-04-20 | 2012-10-10 | 湖南省农产品加工研究所 | 基于近红外光谱快速鉴别油茶籽油真实属性的检测方法 |
CN107300595A (zh) * | 2017-07-10 | 2017-10-27 | 湖南时代阳光药业股份有限公司 | 一种紫苏叶油组分含量分析方法 |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP2002346483A (ja) | 2001-05-29 | 2002-12-03 | Shizuoka Seiki Co Ltd | 穀物成分分析装置 |
KR20030010025A (ko) * | 2001-07-25 | 2003-02-05 | 대한민국 (관리부서 농촌진흥청) | 근적외선 흡수스펙트럼을 이용한 곡물 1립 비파괴 분석방법 |
-
2009
- 2009-01-22 KR KR1020090005459A patent/KR101027434B1/ko active IP Right Grant
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP2002346483A (ja) | 2001-05-29 | 2002-12-03 | Shizuoka Seiki Co Ltd | 穀物成分分析装置 |
KR20030010025A (ko) * | 2001-07-25 | 2003-02-05 | 대한민국 (관리부서 농촌진흥청) | 근적외선 흡수스펙트럼을 이용한 곡물 1립 비파괴 분석방법 |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR102141154B1 (ko) | 2019-10-28 | 2020-08-05 | 조선대학교산학협력단 | 근적외선 및 케모메트릭스를 이용한 고구마의 비파괴 품질평가 방법 |
Also Published As
Publication number | Publication date |
---|---|
KR20100086217A (ko) | 2010-07-30 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
Correia et al. | Portable near infrared spectroscopy applied to quality control of Brazilian coffee | |
Caporaso et al. | Non-destructive analysis of sucrose, caffeine and trigonelline on single green coffee beans by hyperspectral imaging | |
Ozulku et al. | Rapid detection of adulteration of cold pressed sesame oil adultered with hazelnut, canola, and sunflower oils using ATR-FTIR spectroscopy combined with chemometric | |
Uncu et al. | A comparative study of mid-infrared, UV–Visible and fluorescence spectroscopy in combination with chemometrics for the detection of adulteration of fresh olive oils with old olive oils | |
de Oliveira et al. | Comparison of NIR and MIR spectroscopic methods for determination of individual sugars, organic acids and carotenoids in passion fruit | |
Barbin et al. | Application of infrared spectral techniques on quality and compositional attributes of coffee: An overview | |
Frizon et al. | Determination of total phenolic compounds in yerba mate (Ilex paraguariensis) combining near infrared spectroscopy (NIR) and multivariate analysis | |
Yuan et al. | Prediction of fatty acid composition in Camellia oleifera oil by near infrared transmittance spectroscopy (NITS) | |
Amanah et al. | Nondestructive measurement of anthocyanin in intact soybean seed using Fourier Transform Near-Infrared (FT-NIR) and Fourier Transform Infrared (FT-IR) spectroscopy | |
Teixeira et al. | A review on the application of vibrational spectroscopy to the chemistry of nuts | |
Marquez et al. | Using optical NIR sensor for on-line virgin olive oils characterization | |
US20180052144A1 (en) | Method And Technique For Verification Of Olive Oil Composition | |
Choi et al. | Discriminating the origin of basil seeds (Ocimum basilicum L.) using hyperspectral imaging analysis | |
KR20100001401A (ko) | 근적외선 분광분석법을 이용한 차나무 생엽의 비파괴분석방법 | |
Cayuela et al. | NIR prediction of fruit moisture, free acidity and oil content in intact olives | |
dos Santos Scholz et al. | Application of near infrared spectroscopy for green coffee biochemical phenotyping | |
KR101027434B1 (ko) | 근적외광을 이용한 들깨의 지방산 조성을 정량하는 방법 | |
KR100871681B1 (ko) | 근적외선을 이용한 고춧가루의 고추씨 함량 분석방법 | |
Khodabakhshian et al. | Carob moth, Ectomyelois ceratoniae, detection in pomegranate using visible/near infrared spectroscopy | |
Cayuela | Rapid NIR determination of alkyl esters in virgin olive oil | |
Ben Mansour et al. | Oil quality parameters and quantitative measurement of major secoiridoid derivatives in Neb Jmel olive oil from various Tunisian origins using qNMR | |
Camps et al. | Determination of artemisinin and moisture content of Artemisia annua L. dry powder using a hand-held near infrared spectroscopy device | |
Liu et al. | Classification and quantification analysis of peach kernel from different origins with near-infrared diffuse reflection spectroscopy | |
CN110672578A (zh) | 针对煎炸油极性组分检测的模型通用性及稳定性验证方法 | |
Rohman et al. | Simultaneous quantitative analysis of two functional food oils, extra virgin olive oil and virgin coconut oil using FTIR spectroscopy and multivariate calibration |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
E701 | Decision to grant or registration of patent right | ||
GRNT | Written decision to grant |