KE2554A - Substituted benzimidazol-2-yl-carbamic acid ketonoxime esters, processes for their manufacture and their fungicidal and microbiocidal use - Google Patents
Substituted benzimidazol-2-yl-carbamic acid ketonoxime esters, processes for their manufacture and their fungicidal and microbiocidal useInfo
- Publication number
- KE2554A KE2554A KE2554*UA KE255475A KE2554A KE 2554 A KE2554 A KE 2554A KE 255475 A KE255475 A KE 255475A KE 2554 A KE2554 A KE 2554A
- Authority
- KE
- Kenya
- Prior art keywords
- ketonoxime
- fungicidal
- esters
- manufacture
- processes
- Prior art date
Links
- WEYSQARHSRZNTC-UHFFFAOYSA-N 1h-benzimidazol-2-ylcarbamic acid Chemical class C1=CC=C2NC(NC(=O)O)=NC2=C1 WEYSQARHSRZNTC-UHFFFAOYSA-N 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
- 230000000855 fungicidal effect Effects 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 230000003641 microbiacidal effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2227920A DE2227920A1 (de) | 1972-06-08 | 1972-06-08 | Substituierte benzimidazol-2-yl-carbaminsaeure-ketonoximester, verfahren zu ihrer herstellung und ihre fungizide und mikrobizide verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KE2554A true KE2554A (en) | 1975-08-29 |
Family
ID=5847184
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KE2554*UA KE2554A (en) | 1972-06-08 | 1975-08-19 | Substituted benzimidazol-2-yl-carbamic acid ketonoxime esters, processes for their manufacture and their fungicidal and microbiocidal use |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3904643A (enExample) |
| JP (2) | JPS4992068A (enExample) |
| AR (1) | AR194798A1 (enExample) |
| BE (1) | BE800594A (enExample) |
| BR (1) | BR7304275D0 (enExample) |
| DD (1) | DD106773A5 (enExample) |
| DE (1) | DE2227920A1 (enExample) |
| FR (1) | FR2187787B1 (enExample) |
| GB (1) | GB1374957A (enExample) |
| IL (1) | IL42433A (enExample) |
| IT (1) | IT985329B (enExample) |
| KE (1) | KE2554A (enExample) |
| NL (1) | NL7307895A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4900736A (en) * | 1986-12-16 | 1990-02-13 | Schulke Mayr, Gmbh | Salts of alkyl-2-benzimidazole-carbamate and fungicidal compositions thereof suitable for paints and plaster |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3010968A (en) * | 1959-11-25 | 1961-11-28 | Du Pont | Process for manufacture of certain alkyl esters of benzimidazole carbamic acids |
| US3636005A (en) * | 1966-05-06 | 1972-01-18 | Du Pont | Acyl substituted 2-benzimidazolecarbamates |
| US3541213A (en) * | 1966-05-06 | 1970-11-17 | Du Pont | Fungicidal and mite ovicidal substituted 2-aminobenzimidazoles |
| DE1812005A1 (de) * | 1968-11-30 | 1970-06-18 | Bayer Ag | omega-Cyanalkylcarbamyl-benzimidazole |
| DE1936130A1 (de) * | 1969-07-16 | 1971-01-28 | Bayer Ag | Benzimidazol-Derivate,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung |
| US3641048A (en) * | 1969-07-29 | 1972-02-08 | Du Pont | Alkyl 1 - (substituted alkylideneaminooxycarbonyl) - 2 -benzimidazolecarbamates |
| US3631176A (en) * | 1970-07-20 | 1971-12-28 | Du Pont | Carbamoyl substituted 2-aminobenzimidazoles |
| GB1340100A (en) * | 1971-05-18 | 1973-12-05 | British American Tobacco Co | Smoking articles |
-
1972
- 1972-06-08 DE DE2227920A patent/DE2227920A1/de active Pending
-
1973
- 1973-05-18 DD DD170920A patent/DD106773A5/xx unknown
- 1973-05-24 US US363672A patent/US3904643A/en not_active Expired - Lifetime
- 1973-06-05 IL IL7342433A patent/IL42433A/en unknown
- 1973-06-06 IT IT50471/73A patent/IT985329B/it active
- 1973-06-06 NL NL7307895A patent/NL7307895A/xx unknown
- 1973-06-07 BE BE131993A patent/BE800594A/xx unknown
- 1973-06-07 BR BR4275/73A patent/BR7304275D0/pt unknown
- 1973-06-07 AR AR248464A patent/AR194798A1/es active
- 1973-06-08 JP JP48064028A patent/JPS4992068A/ja active Pending
- 1973-06-08 FR FR737320966A patent/FR2187787B1/fr not_active Expired
- 1973-06-08 JP JP48064029A patent/JPS49100231A/ja active Pending
- 1973-06-08 GB GB2745973A patent/GB1374957A/en not_active Expired
-
1975
- 1975-08-19 KE KE2554*UA patent/KE2554A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49100231A (enExample) | 1974-09-21 |
| FR2187787A1 (enExample) | 1974-01-18 |
| IT985329B (it) | 1974-11-30 |
| DD106773A5 (enExample) | 1974-07-05 |
| IL42433A (en) | 1976-08-31 |
| JPS4992068A (enExample) | 1974-09-03 |
| GB1374957A (en) | 1974-11-20 |
| AR194798A1 (es) | 1973-08-14 |
| FR2187787B1 (enExample) | 1977-02-11 |
| NL7307895A (enExample) | 1973-12-11 |
| BE800594A (fr) | 1973-12-07 |
| US3904643A (en) | 1975-09-09 |
| DE2227920A1 (de) | 1973-12-20 |
| BR7304275D0 (pt) | 1974-08-15 |
| IL42433A0 (en) | 1973-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL42344A0 (en) | N-sulphenylated n-methylcarbamic acid aryl esters,their production and their use as pesticides | |
| ZA73891B (en) | 1-aminosulphonyl-2-aminobenzimidazoles,process for their preparation and their fungicidal use | |
| IL41935A0 (en) | O-(n-alkoxy-benzimidoyl)-phosphoric-,thionophosphoric-,phosphonic-and-thionophorphonic acid esters,their production and their use as insecticides and acaricides | |
| IL42062A0 (en) | O-pyrazolo-phosphoric,-thiono-phosphoric,-phosphonic and-thionophosphonic acid esters,their production and their use as insecticides and acaricides | |
| EG10795A (en) | Novel n-sulphenylated carbamidoximes,a process for their preparation and their fungicidal and bactericidal use | |
| IL41838A (en) | Halogenophenyl-pyridazino-thionophosphoric and thionophosphonic acid esters,their production and their use as insecticides and acaricides | |
| IL37933A0 (en) | New triazolyl-thiophosphonic acid esters,their production and their use for pest control | |
| KE2554A (en) | Substituted benzimidazol-2-yl-carbamic acid ketonoxime esters, processes for their manufacture and their fungicidal and microbiocidal use | |
| EG11415A (en) | New thiolphosphoric acid esters,processes for their manufacture and their use as insecticides | |
| IL41500A0 (en) | O-alkyl-s-carbamoyloxymethyl-thiophosphoric,thionothiolphosphoric,thiolphosphonic and thionothiolphosphonic acid esters,their production and their use as insecticides and acaricides | |
| KE2703A (en) | Fungicidal active phtalimides | |
| IL42084A (en) | Thiolphosphoric acid esters,their manufacture and their use as pesticides | |
| IL41984A0 (en) | Naphthisoxazole-thionophosphoric acid esters,their production and their use as insecticides or acaricides | |
| IL41934A0 (en) | Novel dithio-and trithiophosphonic acid esters,their production and their use as pesticides | |
| IL41985A0 (en) | Thionaphthenyl-thiono-alkanephosphonic acid esters,their production and their use as insecticides,acaricides and acaricides | |
| ZA702752B (en) | N-sulphenylated n-methylcarbamic acid aryl esters,processes for their manufacture and their biocidal use | |
| IL41653A0 (en) | Thiol-and thionothiol-phosphoric and-phosphonic acid their use as pesticides | |
| ZA71662B (en) | Aromatic perfluoroalkylalkylmonocarboxylic acid esters,processes for their manufacture and their use | |
| ZA735792B (en) | Haloalkylthionophosphoric acid esters,processes for their production and their use as insecticides and nematocides | |
| IL42926A (en) | Quinoline-thionophosphonic acid esters,their preparation and their use as insecticides and acaricides | |
| EG10199A (en) | O,o dialkyl-s-phenyl-dithiophosphoric acid esters,process for their preparation,and their use as insecticides | |
| IL43241A0 (en) | Vinylphosphoric acid diester-amides,their production and their use as insecticides,acaricides and fungicides | |
| CA983040A (en) | Phenylhydrazonoimidazolenines, processes for their preparation, and their fungicidal and bactericidal use | |
| IL41687A0 (en) | Thio-and thionothio-phosphoric and-phosphonic acid esters,their preparation and their use as insecticides and acaricides | |
| IL34100A0 (en) | O-alkyl-o-phenyl-thiono-thiolphosphoric acid esters,their production and their use as insecticides and acaricides |