JPS6466257A - One-pack stabilizer for halogen-containing resin - Google Patents
One-pack stabilizer for halogen-containing resinInfo
- Publication number
- JPS6466257A JPS6466257A JP22507587A JP22507587A JPS6466257A JP S6466257 A JPS6466257 A JP S6466257A JP 22507587 A JP22507587 A JP 22507587A JP 22507587 A JP22507587 A JP 22507587A JP S6466257 A JPS6466257 A JP S6466257A
- Authority
- JP
- Japan
- Prior art keywords
- stabilizer
- halogen
- containing resin
- incorporating
- kinds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000003381 stabilizer Substances 0.000 title abstract 7
- 239000011347 resin Substances 0.000 title abstract 2
- 229920005989 resin Polymers 0.000 title abstract 2
- 229910052736 halogen Inorganic materials 0.000 title 1
- 150000002367 halogens Chemical class 0.000 title 1
- -1 ester compound Chemical class 0.000 abstract 2
- 239000007788 liquid Substances 0.000 abstract 2
- 229940051841 polyoxyethylene ether Drugs 0.000 abstract 2
- 229920000056 polyoxyethylene ether Polymers 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000002877 alkyl aryl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- YAHBZWSDRFSFOO-UHFFFAOYSA-L dimethyltin(2+);2-(2-ethylhexoxy)-2-oxoethanethiolate Chemical compound CCCCC(CC)COC(=O)CS[Sn](C)(C)SCC(=O)OCC(CC)CCCC YAHBZWSDRFSFOO-UHFFFAOYSA-L 0.000 abstract 1
- IRFPIPNMASANJY-UHFFFAOYSA-L dimethyltin(2+);2-(6-methylheptoxy)-2-oxoethanethiolate Chemical compound CC(C)CCCCCOC(=O)CS[Sn](C)(C)SCC(=O)OCCCCCC(C)C IRFPIPNMASANJY-UHFFFAOYSA-L 0.000 abstract 1
Landscapes
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP22507587A JPS6466257A (en) | 1987-09-07 | 1987-09-07 | One-pack stabilizer for halogen-containing resin |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP22507587A JPS6466257A (en) | 1987-09-07 | 1987-09-07 | One-pack stabilizer for halogen-containing resin |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6466257A true JPS6466257A (en) | 1989-03-13 |
| JPH0518344B2 JPH0518344B2 (enExample) | 1993-03-11 |
Family
ID=16823629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP22507587A Granted JPS6466257A (en) | 1987-09-07 | 1987-09-07 | One-pack stabilizer for halogen-containing resin |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS6466257A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5527842A (en) * | 1995-03-10 | 1996-06-18 | Witco Corporation | Alkyl-thio-glycolate PVC stabilizers with added aromatic ether alcohol to prevent precipitation |
| WO1996038501A1 (en) * | 1995-06-01 | 1996-12-05 | Witco Corporation | Alkyl-tin pvc stabilizers with added aromatic ether alcohol to prevent precipitation |
| WO2002017972A3 (en) * | 2000-09-01 | 2002-09-06 | Occidental Chem Co | Preparing sterile articles from polymers containing a stabiliser based on a poly(oxyalkylene) |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS502048A (enExample) * | 1973-05-07 | 1975-01-10 | ||
| JPS5051147A (enExample) * | 1973-09-07 | 1975-05-07 | ||
| JPS5338102A (en) * | 1976-09-20 | 1978-04-07 | Taiyou Kaihatsu Kk | Apparatus for regenerating water collecting pipe |
| JPS5361169A (en) * | 1976-11-11 | 1978-06-01 | Shizuo Sagawa | Method of cleaning pipe |
| JPS54143455A (en) * | 1977-03-21 | 1979-11-08 | Tenneco Chem | Liquid stabilizer and halogenated vinyl resin containig it |
| JPS5661448A (en) * | 1979-10-25 | 1981-05-26 | Mitsubishi Plastics Ind Ltd | Vinyl resin composition having good gamma radiation resistance |
| JPS5786676A (en) * | 1980-11-14 | 1982-05-29 | Yamatake Honeywell Co Ltd | Actuator |
| JPS585353A (ja) * | 1981-07-03 | 1983-01-12 | Nippon Carbide Ind Co Ltd | 塩化ビニル系フイルムおよびその製造法 |
-
1987
- 1987-09-07 JP JP22507587A patent/JPS6466257A/ja active Granted
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS502048A (enExample) * | 1973-05-07 | 1975-01-10 | ||
| JPS5051147A (enExample) * | 1973-09-07 | 1975-05-07 | ||
| JPS5338102A (en) * | 1976-09-20 | 1978-04-07 | Taiyou Kaihatsu Kk | Apparatus for regenerating water collecting pipe |
| JPS5361169A (en) * | 1976-11-11 | 1978-06-01 | Shizuo Sagawa | Method of cleaning pipe |
| JPS54143455A (en) * | 1977-03-21 | 1979-11-08 | Tenneco Chem | Liquid stabilizer and halogenated vinyl resin containig it |
| JPS5661448A (en) * | 1979-10-25 | 1981-05-26 | Mitsubishi Plastics Ind Ltd | Vinyl resin composition having good gamma radiation resistance |
| JPS5786676A (en) * | 1980-11-14 | 1982-05-29 | Yamatake Honeywell Co Ltd | Actuator |
| JPS585353A (ja) * | 1981-07-03 | 1983-01-12 | Nippon Carbide Ind Co Ltd | 塩化ビニル系フイルムおよびその製造法 |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5527842A (en) * | 1995-03-10 | 1996-06-18 | Witco Corporation | Alkyl-thio-glycolate PVC stabilizers with added aromatic ether alcohol to prevent precipitation |
| WO1996028506A1 (en) * | 1995-03-10 | 1996-09-19 | Witco Corporation | Alkyl-thio-glycolate pvc stabilizers with added aromatic ether alcohol to prevent precipitation |
| WO1996038501A1 (en) * | 1995-06-01 | 1996-12-05 | Witco Corporation | Alkyl-tin pvc stabilizers with added aromatic ether alcohol to prevent precipitation |
| WO2002017972A3 (en) * | 2000-09-01 | 2002-09-06 | Occidental Chem Co | Preparing sterile articles from polymers containing a stabiliser based on a poly(oxyalkylene) |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0518344B2 (enExample) | 1993-03-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5661446A (en) | Stabilizer for halogen-containing resin | |
| EP0181001A3 (en) | Polypeptide, a process for preparing the same, a pharmaceutical composition containing said polypeptide as well as the use thereof | |
| IT1190369B (it) | Composizioni covulcanizzabili di fluoroelastomeri a migliorata stabilita' chimica | |
| SE8404930D0 (sv) | Aqueous compositions containing stabilized enzymes | |
| EP0332409A3 (en) | Novel substituted naphthalene compounds and liquid crystal compositions containing same | |
| GR851777B (enExample) | ||
| JPS6466257A (en) | One-pack stabilizer for halogen-containing resin | |
| ATE50773T1 (de) | Alkylresorcinolphosphite. | |
| IT1190386B (it) | Composizioni covulcanizzabili di fluoroelastomeri a migliorata stabilita' chimica | |
| IT1199836B (it) | Composizioni trasparenti a ridotta opacita'e procedimento per la loro preparazione | |
| DE3873166D1 (de) | Polyarylensulfidharzzusammensetzungen. | |
| DE3873109D1 (de) | Polyamidzubereitungen. | |
| JPS57209943A (en) | Stabilized halogen-containing resin composition | |
| NO155343C (no) | Nye halogenerte forbindelser, samt anvendelse av disse som flammehemmende polymerpreparater. | |
| IE800885L (en) | Thermal stabilization of vinyl resins | |
| JPS5617045A (en) | Conductive molding material based on halogen-containing resin composition | |
| JPS5525424A (en) | Stabilization of halogen-containing polymer | |
| JPS57170948A (en) | Composition of vinyl chloride resin | |
| JPS5584340A (en) | Stabilizer for chlorine-containing resin | |
| DE3662037D1 (en) | Process for the preparation of aromatic 1,1-difluoroperhaloalkoxy or 1,1-difluoroperhalothioalkyl derivatives | |
| JPS5527351A (en) | Stabilization of halogen-containing polymer | |
| JPS6476059A (en) | Electrophotographic sensitive body | |
| EP0358183A3 (en) | Structures having a silicone elastomer component in juxtaposition with a thermoplastic elastomer | |
| JPS5736143A (ja) | Anteikasaretaensoganjujushisoseibutsu | |
| JPS5335752A (en) | Halonge-containing resin composition indluding weak-smelling stalilizer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Cancellation because of no payment of annual fees |