JPS646017A - Heat-resistant polyurethane elastomer - Google Patents
Heat-resistant polyurethane elastomerInfo
- Publication number
- JPS646017A JPS646017A JP62161997A JP16199787A JPS646017A JP S646017 A JPS646017 A JP S646017A JP 62161997 A JP62161997 A JP 62161997A JP 16199787 A JP16199787 A JP 16199787A JP S646017 A JPS646017 A JP S646017A
- Authority
- JP
- Japan
- Prior art keywords
- heat
- reacting
- produced
- diphenylmethane diisocyanate
- elastomer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920003225 polyurethane elastomer Polymers 0.000 title 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 abstract 2
- 229920001971 elastomer Polymers 0.000 abstract 2
- 239000000806 elastomer Substances 0.000 abstract 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 abstract 1
- 239000004215 Carbon black (E152) Substances 0.000 abstract 1
- 238000013329 compounding Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000012530 fluid Substances 0.000 abstract 1
- 239000012760 heat stabilizer Substances 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 230000000640 hydroxylating effect Effects 0.000 abstract 1
- 229910052740 iodine Inorganic materials 0.000 abstract 1
- 239000011630 iodine Substances 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- -1 isocyanate compound Chemical class 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000000178 monomer Substances 0.000 abstract 1
- 229920001228 polyisocyanate Polymers 0.000 abstract 1
- 239000005056 polyisocyanate Substances 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 abstract 1
- 230000000379 polymerizing effect Effects 0.000 abstract 1
- 229920005862 polyol Polymers 0.000 abstract 1
- 150000003077 polyols Chemical class 0.000 abstract 1
- 238000004382 potting Methods 0.000 abstract 1
- 238000010526 radical polymerization reaction Methods 0.000 abstract 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract 1
- 229920002554 vinyl polymer Polymers 0.000 abstract 1
Landscapes
- Polyurethanes Or Polyureas (AREA)
Abstract
PURPOSE:To obtain the titled elastomer having excellent heat-resistance and hydrolysis resistance without compounding a heat-stabilizer and suitable as electronic part, potting material, etc., by reacting a specific polyol with a polyisocyanate compound. CONSTITUTION:The objective elastomer is produced by reacting (A) a polyhydroxy-hydrocarbon polymer having an average number of hydroxyl groups of 1-8, a number-average molecular weight of 500-20,000 and an iodine value of <=100, fluid at normal temperature and produced e.g. by radically polymerizing a vinyl monomer and hydroxylating the terminal of the radical polymerization product with (B) an isocyanate compound selected from diphenylmethane diisocyanate, polymeric diphenylmethane diisocyanate and their derivatives preferably at an NCO/OH ratio of 0.7-1.5.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP62161997A JPS646017A (en) | 1987-06-29 | 1987-06-29 | Heat-resistant polyurethane elastomer |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP62161997A JPS646017A (en) | 1987-06-29 | 1987-06-29 | Heat-resistant polyurethane elastomer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS646017A true JPS646017A (en) | 1989-01-10 |
Family
ID=15746073
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP62161997A Pending JPS646017A (en) | 1987-06-29 | 1987-06-29 | Heat-resistant polyurethane elastomer |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS646017A (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5115007A (en) * | 1989-11-30 | 1992-05-19 | Gencorp Inc. | Abrasion resistant polyurethane blend compositions |
| US5221707A (en) * | 1989-11-30 | 1993-06-22 | Gencorp Inc. | Coating blend compositions |
| US5488092A (en) * | 1994-04-26 | 1996-01-30 | Gencorp Inc. | Low VOC, primerless, polyurethane compostions |
| US6914117B2 (en) | 2001-05-21 | 2005-07-05 | Huntsman International Llc | Elastomeric polyurethane material |
| WO2004083272A3 (en) * | 2003-03-13 | 2005-07-14 | Fuller H B Licensing Financ | Moisture curable, radiation curable sealant composition |
| JP2019183151A (en) * | 2018-04-02 | 2019-10-24 | 株式会社エフコンサルタント | Coating material |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5282946A (en) * | 1975-12-29 | 1977-07-11 | Mitsubishi Electric Corp | Curable rubber compositions |
| JPS52117950A (en) * | 1976-03-31 | 1977-10-03 | Mitsubishi Electric Corp | Curable polymer compositions |
| JPS59117522A (en) * | 1982-12-17 | 1984-07-06 | Nippon Soda Co Ltd | Polyurethane elastomer |
| JPS59210928A (en) * | 1983-05-14 | 1984-11-29 | Nippon Soda Co Ltd | Polyurethane elastomer |
| JPS60171249A (en) * | 1984-02-13 | 1985-09-04 | Nitto Electric Ind Co Ltd | Covering material for optical glass fiber |
| JPS60173011A (en) * | 1984-02-20 | 1985-09-06 | Mitsubishi Chem Ind Ltd | Polymer composition |
-
1987
- 1987-06-29 JP JP62161997A patent/JPS646017A/en active Pending
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5282946A (en) * | 1975-12-29 | 1977-07-11 | Mitsubishi Electric Corp | Curable rubber compositions |
| JPS52117950A (en) * | 1976-03-31 | 1977-10-03 | Mitsubishi Electric Corp | Curable polymer compositions |
| JPS59117522A (en) * | 1982-12-17 | 1984-07-06 | Nippon Soda Co Ltd | Polyurethane elastomer |
| JPS59210928A (en) * | 1983-05-14 | 1984-11-29 | Nippon Soda Co Ltd | Polyurethane elastomer |
| JPS60171249A (en) * | 1984-02-13 | 1985-09-04 | Nitto Electric Ind Co Ltd | Covering material for optical glass fiber |
| JPS60173011A (en) * | 1984-02-20 | 1985-09-06 | Mitsubishi Chem Ind Ltd | Polymer composition |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5115007A (en) * | 1989-11-30 | 1992-05-19 | Gencorp Inc. | Abrasion resistant polyurethane blend compositions |
| US5221707A (en) * | 1989-11-30 | 1993-06-22 | Gencorp Inc. | Coating blend compositions |
| US5488092A (en) * | 1994-04-26 | 1996-01-30 | Gencorp Inc. | Low VOC, primerless, polyurethane compostions |
| US5674567A (en) * | 1994-04-26 | 1997-10-07 | Gencorp Inc. | Low VOC, primerless, polyurethane compositions |
| US6914117B2 (en) | 2001-05-21 | 2005-07-05 | Huntsman International Llc | Elastomeric polyurethane material |
| JP2008133475A (en) * | 2001-05-21 | 2008-06-12 | Huntsman Internatl Llc | Very soft polyurethane elastomer |
| WO2004083272A3 (en) * | 2003-03-13 | 2005-07-14 | Fuller H B Licensing Financ | Moisture curable, radiation curable sealant composition |
| JP2019183151A (en) * | 2018-04-02 | 2019-10-24 | 株式会社エフコンサルタント | Coating material |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4447590A (en) | Extrudable polyurethane for prosthetic devices prepared from a diisocyanate, a polytetramethylene ether polyol and 1,4 butane diol | |
| US4523005A (en) | Extrudable polyurethane for prosthetic devices prepared from a diisocyanate, a polytetramethylene ether polyol, and 1,4-butane diol | |
| US4810749A (en) | Polyurethanes | |
| US4739013A (en) | Polyurethanes | |
| DE68911241T2 (en) | Elastomeric poly (perfluoroalkyl (enoxide) blocks and rigid blocks containing fluorinated polyurethanes. | |
| US4526952A (en) | Antistatic or electrically conductive thermoplastic polyurethanes: process for their preparation and their use | |
| US3431235A (en) | Polydiene resins including cyclized polydiene resins,method of manufacture and uses | |
| CA1313285C (en) | Process for the production of radiation-crosslinked thermoplastic polyurethanes | |
| DE69128974D1 (en) | Production of polymer foams | |
| ES8303495A1 (en) | Polymer/polyisocyanate compositions, processes for making same and processes for making polyurethane products therefrom. | |
| GB2111067A (en) | Extrudable polyurethane for prosthetic devices | |
| CA2157217A1 (en) | Low-viscosity, stable, agglomerate-free polymer polyols, a process for their preparation and their use in producing polyurethane plastics | |
| US3635891A (en) | Internally plasticized polyidene resins | |
| EP0409735A1 (en) | A polycaprolactone polyol and hydrolysis resistant polyurethane resins prepared therefrom | |
| US3987012A (en) | Thermoplastic polyurethane-polymer compositions and their preparation | |
| US5043410A (en) | Cross-linkable polyurethane rubbers containing polyoxyperfluoroalkylene blocks | |
| JPS646017A (en) | Heat-resistant polyurethane elastomer | |
| CA2121660A1 (en) | Biostable polyurethane and medical article therefrom | |
| Ulubayram et al. | Polyurethanes: effect of chemical composition on mechanical properties and oxygen permeability | |
| WO2001002630A1 (en) | Melt processable, bleach resistant, durable fibers having high elastic recovery and low stress relaxation from polyurethane elastomers | |
| US3025269A (en) | Ethylene-diethylene glycol monovinyl ether copolymer | |
| US4202950A (en) | Process for preparing polyurethane elastomers | |
| HUP0401704A2 (en) | Ionomer polyurethane thermoplastic, process for producing it and using it for producing aqueous tpu dispersion | |
| CN111499826B (en) | Thermoplastic polyurethane elastomer and preparation method thereof | |
| JPS57112409A (en) | Production of polyurethane elastic yarn |