JPS6328929B2 - - Google Patents
Info
- Publication number
- JPS6328929B2 JPS6328929B2 JP52149974A JP14997477A JPS6328929B2 JP S6328929 B2 JPS6328929 B2 JP S6328929B2 JP 52149974 A JP52149974 A JP 52149974A JP 14997477 A JP14997477 A JP 14997477A JP S6328929 B2 JPS6328929 B2 JP S6328929B2
- Authority
- JP
- Japan
- Prior art keywords
- carbonate
- polycarbonate
- aromatic
- aromatic carbonate
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 claims description 20
- 239000004417 polycarbonate Substances 0.000 claims description 20
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 19
- 229920000642 polymer Polymers 0.000 claims description 17
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 16
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 12
- 229920001577 copolymer Polymers 0.000 claims description 4
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 claims 1
- 150000002989 phenols Chemical class 0.000 description 8
- 239000000370 acceptor Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 150000001491 aromatic compounds Chemical class 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003607 modifier Substances 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- -1 carbonyl halide Chemical class 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000005067 haloformyl group Chemical group 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 description 2
- IYMHDNMZTMQXJC-UHFFFAOYSA-N (2,4-dichloro-3-phenylnaphthalen-1-yl) hydrogen carbonate Chemical compound ClC=1C2=CC=CC=C2C(OC(=O)O)=C(Cl)C=1C1=CC=CC=C1 IYMHDNMZTMQXJC-UHFFFAOYSA-N 0.000 description 1
- ZGSHFDSKHTZINF-UHFFFAOYSA-N (2-methyl-6-phenylphenyl) hydrogen carbonate Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1OC(O)=O ZGSHFDSKHTZINF-UHFFFAOYSA-N 0.000 description 1
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- UITKHKNFVCYWNG-UHFFFAOYSA-N 4-(3,4-dicarboxybenzoyl)phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1C(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 UITKHKNFVCYWNG-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- VQVIHDPBMFABCQ-UHFFFAOYSA-N 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC(C(C=2C=C3C(=O)OC(=O)C3=CC=2)=O)=C1 VQVIHDPBMFABCQ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- VCYAMSXIIWQHKV-UHFFFAOYSA-N bis(2,3,4-tribromophenyl) carbonate Chemical compound BrC1=C(Br)C(Br)=CC=C1OC(=O)OC1=CC=C(Br)C(Br)=C1Br VCYAMSXIIWQHKV-UHFFFAOYSA-N 0.000 description 1
- DSEORJACOQDMQX-UHFFFAOYSA-N bis(2,3,4-trichlorophenyl) carbonate Chemical compound ClC1=C(Cl)C(Cl)=CC=C1OC(=O)OC1=CC=C(Cl)C(Cl)=C1Cl DSEORJACOQDMQX-UHFFFAOYSA-N 0.000 description 1
- LUQQDEDMRRRWGN-UHFFFAOYSA-N bis(2-bromophenyl) carbonate Chemical compound BrC1=CC=CC=C1OC(=O)OC1=CC=CC=C1Br LUQQDEDMRRRWGN-UHFFFAOYSA-N 0.000 description 1
- SJWFGMZZMOUDTF-UHFFFAOYSA-N bis(2-chloronaphthalen-1-yl) carbonate Chemical compound C1=CC=C2C(OC(=O)OC3=C4C=CC=CC4=CC=C3Cl)=C(Cl)C=CC2=C1 SJWFGMZZMOUDTF-UHFFFAOYSA-N 0.000 description 1
- MUCRFDZUHPMASM-UHFFFAOYSA-N bis(2-chlorophenyl) carbonate Chemical compound ClC1=CC=CC=C1OC(=O)OC1=CC=CC=C1Cl MUCRFDZUHPMASM-UHFFFAOYSA-N 0.000 description 1
- POZGCGJFBOZPCM-UHFFFAOYSA-N bis(2-methylphenyl) carbonate Chemical compound CC1=CC=CC=C1OC(=O)OC1=CC=CC=C1C POZGCGJFBOZPCM-UHFFFAOYSA-N 0.000 description 1
- IKWKJIWDLVYZIY-UHFFFAOYSA-M butyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCC)C1=CC=CC=C1 IKWKJIWDLVYZIY-UHFFFAOYSA-M 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical class OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- ZQUZPFYNEARCQO-UHFFFAOYSA-N dinaphthalen-1-yl carbonate Chemical compound C1=CC=C2C(OC(OC=3C4=CC=CC=C4C=CC=3)=O)=CC=CC2=C1 ZQUZPFYNEARCQO-UHFFFAOYSA-N 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NNYHMCFMPHPHOQ-UHFFFAOYSA-N mellitic anhydride Chemical compound O=C1OC(=O)C2=C1C(C(OC1=O)=O)=C1C1=C2C(=O)OC1=O NNYHMCFMPHPHOQ-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- LSEFCHWGJNHZNT-UHFFFAOYSA-M methyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 LSEFCHWGJNHZNT-UHFFFAOYSA-M 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012778 molding material Substances 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- KCSOHLKZTZMKQA-UHFFFAOYSA-M tetraheptylazanium;iodide Chemical compound [I-].CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC KCSOHLKZTZMKQA-UHFFFAOYSA-M 0.000 description 1
- BGQMOFGZRJUORO-UHFFFAOYSA-M tetrapropylammonium bromide Chemical compound [Br-].CCC[N+](CCC)(CCC)CCC BGQMOFGZRJUORO-UHFFFAOYSA-M 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- HNJXPTMEWIVQQM-UHFFFAOYSA-M triethyl(hexadecyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](CC)(CC)CC HNJXPTMEWIVQQM-UHFFFAOYSA-M 0.000 description 1
- NJMOHBDCGXJLNJ-UHFFFAOYSA-N trimellitic anhydride chloride Chemical compound ClC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 NJMOHBDCGXJLNJ-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/37—Thiols
- C08K5/375—Thiols containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/751,433 US4123436A (en) | 1976-12-16 | 1976-12-16 | Polycarbonate composition plasticized with esters |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5394535A JPS5394535A (en) | 1978-08-18 |
| JPS6328929B2 true JPS6328929B2 (esLanguage) | 1988-06-10 |
Family
ID=25021960
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP14997477A Granted JPS5394535A (en) | 1976-12-16 | 1977-12-15 | Plasticized polycarbonate composition |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4123436A (esLanguage) |
| JP (1) | JPS5394535A (esLanguage) |
| AU (1) | AU509306B2 (esLanguage) |
| BR (1) | BR7708413A (esLanguage) |
| DE (1) | DE2750991A1 (esLanguage) |
| FR (1) | FR2374374A1 (esLanguage) |
| GB (1) | GB1558352A (esLanguage) |
| IT (1) | IT1089961B (esLanguage) |
| MX (1) | MX146735A (esLanguage) |
| NL (1) | NL7713187A (esLanguage) |
Families Citing this family (120)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282134A (en) * | 1978-11-03 | 1981-08-04 | General Electric Company | Plasticized polycarbonate composition |
| DE3277772D1 (en) * | 1981-09-09 | 1988-01-14 | Sumitomo Naugatuck | Thermoplastic composition |
| US4563502A (en) * | 1982-09-23 | 1986-01-07 | General Electric Company | Composition |
| US4666985A (en) * | 1982-09-23 | 1987-05-19 | General Electric Company | Composition |
| US4520164A (en) * | 1982-12-22 | 1985-05-28 | General Electric Company | Blends of aromatic polycarbonate resins, polyolefins and olefin copolymers, and acrylate interpolymer resins |
| US4454287A (en) * | 1982-12-22 | 1984-06-12 | General Electric Company | Glass reinforced polyolefin composites modified with aromatic polycarbonates |
| US4880856A (en) * | 1987-12-22 | 1989-11-14 | General Electric Company | Enhancing color stability of sterilizing radiation of polymer compositions |
| US4874783A (en) * | 1984-02-10 | 1989-10-17 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4939185A (en) * | 1984-02-10 | 1990-07-03 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4996247A (en) * | 1984-02-10 | 1991-02-26 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4880855A (en) * | 1984-02-10 | 1989-11-14 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4939186A (en) * | 1984-02-10 | 1990-07-03 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4996246A (en) * | 1984-02-10 | 1991-02-26 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4880853A (en) * | 1984-02-10 | 1989-11-14 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4996245A (en) * | 1984-02-10 | 1991-02-26 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4880854A (en) * | 1984-02-10 | 1989-11-14 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4880850A (en) * | 1984-02-10 | 1989-11-14 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4876309A (en) * | 1984-02-10 | 1989-10-24 | General Electric Company | Enhancing color stability to sterlizing radiation of polymer compositions |
| US4996248A (en) * | 1984-02-10 | 1991-02-26 | General Electic Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4882366A (en) * | 1984-02-10 | 1989-11-21 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4996244A (en) * | 1984-02-10 | 1991-02-26 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4762896A (en) * | 1984-12-28 | 1988-08-09 | General Electric Company | Process for preparing aromatic polycarbonate of improved melt processability with fatty acid |
| US5041617A (en) * | 1985-11-14 | 1991-08-20 | Mallinckrodt Specialty Chemicals Company | Dithiodialkanoic acid esters and polymers stabilized therewith |
| US4624972A (en) * | 1985-11-25 | 1986-11-25 | The Dow Chemical Company | Gamma radiation resistant carbonate polymer compositions |
| US4798874A (en) * | 1985-12-23 | 1989-01-17 | General Electric Company | Thermoplastic blends comprising polycarbonate resin and amorphous polyamide |
| GB8630819D0 (en) * | 1986-12-23 | 1987-02-04 | Exxon Chemical Patents Inc | Polycarbonate compositions |
| US4816527A (en) * | 1987-08-20 | 1989-03-28 | General Electric Company | Polycarbonate-siloxane polyetherimide copolymer blends |
| US4897448A (en) * | 1988-04-01 | 1990-01-30 | Eastman Kodak Company | Polyester/polycarbonate blends |
| US4965308A (en) * | 1988-05-25 | 1990-10-23 | General Electric Company | Polymer mixture comprising an aromatic polycarbonate, an aromatic polyester and an inorganic sulfur compound |
| US4879355A (en) * | 1988-09-29 | 1989-11-07 | Eastman Kodak | Compatible tricomponent polymer blends |
| US5051483A (en) * | 1988-11-14 | 1991-09-24 | General Electric Company | Flame resistant polyetherimide resin blends |
| US4904717A (en) * | 1989-02-22 | 1990-02-27 | The Dow Chemical Company | Aliphatic thio additive for polycarbonate |
| US5420212A (en) * | 1994-03-31 | 1995-05-30 | Eastman Chemical Company | Polyester/polycarbonate/polycaprolactone blends |
| US5840798A (en) * | 1997-06-06 | 1998-11-24 | General Electric Company | Glass filled polyester molding composition |
| US6066694A (en) * | 1998-03-04 | 2000-05-23 | General Electric Company | Polyester molding composition |
| US6221556B1 (en) * | 1999-03-05 | 2001-04-24 | General Electric Company | Article for optical data storage device |
| US6524420B1 (en) | 1999-05-28 | 2003-02-25 | General Electric | Composite and process for making |
| US6291574B1 (en) | 1999-08-27 | 2001-09-18 | General Electric Company | Polyester molded articles |
| US6476158B1 (en) | 1999-08-31 | 2002-11-05 | General Electric Company | Process for colored polycarbonate-polyester compositions with improved weathering |
| US6207344B1 (en) | 1999-09-29 | 2001-03-27 | General Electric Company | Composition for laser marking |
| US6486251B1 (en) | 2000-02-29 | 2002-11-26 | General Electric Company | Special visual effect polycarbonate-polyester composition |
| US20030114575A1 (en) * | 2000-08-25 | 2003-06-19 | General Electric Company | Fiber reinforced thermoplastic composition |
| US6989190B2 (en) * | 2000-10-17 | 2006-01-24 | General Electric Company | Transparent polycarbonate polyester composition and process |
| US6569957B2 (en) | 2000-11-03 | 2003-05-27 | Eastman Chemical Company | Blends of polycarbonate and polyester and sheets and films formed therefrom |
| US20020082360A1 (en) * | 2000-11-03 | 2002-06-27 | Conn Roy Lee | Films and articles formed from blends of polycarbonate and polyester |
| US6599966B2 (en) | 2000-12-15 | 2003-07-29 | General Electric Company | Polycarbonate-polyester compositions with enhanced flow |
| US6635698B2 (en) | 2000-12-22 | 2003-10-21 | General Electric Company | Flame retardant polycarbonate polyester composition |
| US6458913B1 (en) | 2001-03-22 | 2002-10-01 | General Electric Company | Insert molded article |
| US6465102B1 (en) | 2001-03-22 | 2002-10-15 | General Electric Company | Formed decorative article |
| EP1316419A3 (en) * | 2001-11-30 | 2004-01-28 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| US6641920B2 (en) | 2002-02-08 | 2003-11-04 | Eastman Chemical Company | Ultraviolet protected multi-layer structures of copolyester/polycarbonate blends |
| US6723768B2 (en) | 2002-03-27 | 2004-04-20 | Eastman Chemical Company | Polyester/polycarbonate blends with reduced yellowness |
| US20050038145A1 (en) * | 2003-08-11 | 2005-02-17 | General Electric Company | Flame retardant fiber reinforced composition with improved flow |
| US7649040B2 (en) * | 2002-04-11 | 2010-01-19 | Sabic Innovative Plastics Ip B.V. | Flame retardant fiber reinforced composition with improved flow |
| US20030216508A1 (en) * | 2002-05-14 | 2003-11-20 | Lee Coreen Y. | Polycarbonate and acrylonitrile-butadiene-styrene polymeric blends with improved impact resistance |
| US20040014887A1 (en) * | 2002-05-14 | 2004-01-22 | Lee Coreen Y. | Polycarbonate and acrylonitrile-butadiene-styrene polymeric blends with improved impact resistance |
| US6887573B2 (en) | 2002-07-30 | 2005-05-03 | General Electric Company | Polycarbonate polyester articles with enhanced adhesion between outer layer and base substrate |
| US7132149B2 (en) | 2002-08-23 | 2006-11-07 | General Electric Company | Data storage medium and method for the preparation thereof |
| US7128959B2 (en) * | 2002-08-23 | 2006-10-31 | General Electric Company | Reflective article and method for the preparation thereof |
| US7329462B2 (en) | 2002-08-23 | 2008-02-12 | General Electric Company | Reflective article and method for the preparation thereof |
| US7300742B2 (en) * | 2002-08-23 | 2007-11-27 | General Electric Company | Data storage medium and method for the preparation thereof |
| US20040127653A1 (en) * | 2002-08-30 | 2004-07-01 | General Electric Company | Polycarbonate/polyester copolymer blends and process for making thereof |
| US7118799B2 (en) | 2002-11-22 | 2006-10-10 | Eastman Chemical Company | Thermoplastic article having a decorative material embedded therein |
| US6896966B2 (en) * | 2002-11-22 | 2005-05-24 | Eastman Chemical Company | Articles of manufacture incorporating polyester/polycarbonate blends |
| US6887940B2 (en) * | 2002-11-27 | 2005-05-03 | Basell Poliolefine Italia S.P.A. | Compatibilizing agent for engineering thermoplastic/polyolefin blend |
| US7022764B2 (en) * | 2002-12-18 | 2006-04-04 | General Electric Company | Static dissipating resin composition and methods for manufacture thereof |
| US20070049703A1 (en) * | 2002-12-18 | 2007-03-01 | Murray Michael C | Static dissipating resin compositions, methods for manufacture and articles made therefrom |
| US6825266B2 (en) * | 2002-12-30 | 2004-11-30 | General Electric Company | Polycarbonate molding compositions and articles with improved surface aesthetics |
| US7087682B2 (en) * | 2003-05-02 | 2006-08-08 | General Electric | Polymeric blends for optical devices and method of manufacture thereof |
| US20040253402A1 (en) * | 2003-06-10 | 2004-12-16 | General Electric Company | Crate for containers |
| US20040253400A1 (en) * | 2003-06-10 | 2004-12-16 | Wal Ronald Van Der | Crate for containers |
| US7411021B2 (en) * | 2003-12-18 | 2008-08-12 | Sabic Innovative Plastics Ip B.V. | Polycarbonate polyester molding composition |
| US20050137359A1 (en) * | 2003-12-18 | 2005-06-23 | General Electric Company | Polyester molding composition |
| US20050165207A1 (en) * | 2003-12-31 | 2005-07-28 | General Electric Company | Polyester molding composition and process for its preparartion |
| US7960031B2 (en) * | 2004-06-30 | 2011-06-14 | Sabic Innovative Plastics Ip B.V. | Coated sheet, method of formation thereof, and articles derived therefrom |
| US20080014446A1 (en) * | 2004-10-07 | 2008-01-17 | General Electric Company | Window shade and a multi-layered article, and methods of making the same |
| US20060287486A1 (en) | 2005-06-17 | 2006-12-21 | Crawford Emmett D | Optical media comprising polyester compositions formed from 2,2,4,4-tetramethyl-1,3-cyclobutanediol and 1,4-cyclohexanedimethanol |
| US8084550B2 (en) * | 2005-05-23 | 2011-12-27 | Sabic Innovative Plastics Ip B.V. | Low gloss thermoplastic composition |
| US20070173619A1 (en) * | 2005-05-23 | 2007-07-26 | Yu Claire Q | Low gloss thermoplastic articles |
| US20060270767A1 (en) * | 2005-05-26 | 2006-11-30 | Van Gisbergen Josephus Gerardu | Mineral filled polyester polycarbonate composition |
| US7504472B2 (en) * | 2005-06-02 | 2009-03-17 | E. I. Du Pont De Nemours + Company | Rapidly crystallizing polycarbonate composition |
| DE102006018602A1 (de) * | 2005-06-09 | 2006-12-14 | Bayer Materialscience Ag | Flammwidrige beschichtete Polycarbonat-Formkörper |
| US8557950B2 (en) | 2005-06-16 | 2013-10-15 | Grupo Petrotemex, S.A. De C.V. | High intrinsic viscosity melt phase polyester polymers with acceptable acetaldehyde generation rates |
| US20060287429A1 (en) * | 2005-06-17 | 2006-12-21 | Gaggar Satish K | Glass fiber thermoplastic composite |
| US9267007B2 (en) | 2005-09-16 | 2016-02-23 | Grupo Petrotemex, S.A. De C.V. | Method for addition of additives into a polymer melt |
| US7655746B2 (en) | 2005-09-16 | 2010-02-02 | Eastman Chemical Company | Phosphorus containing compounds for reducing acetaldehyde in polyesters polymers |
| US7838596B2 (en) | 2005-09-16 | 2010-11-23 | Eastman Chemical Company | Late addition to effect compositional modifications in condensation polymers |
| US7374718B2 (en) | 2005-10-06 | 2008-05-20 | General Electric Company | Radiation stable aromatic carbonate polymer compositions |
| US20080085390A1 (en) | 2006-10-04 | 2008-04-10 | Ryan Thomas Neill | Encapsulation of electrically energized articles |
| US8287991B2 (en) | 2006-10-04 | 2012-10-16 | Eastman Chemical Company | Using branched polymers to control the dimensional stability of articles in the lamination process |
| US9061480B2 (en) * | 2007-03-09 | 2015-06-23 | Sabic Global Technologies B.V. | Plastic laminates and methods for making the same |
| US8642176B2 (en) * | 2007-06-19 | 2014-02-04 | Sabic Innovative Plastics Ip B.V. | Plastic laminates and methods for making the same |
| US20080318053A1 (en) * | 2007-06-19 | 2008-12-25 | General Electric Company | Plastic Laminates and Methods for Making the Same |
| US9289795B2 (en) | 2008-07-01 | 2016-03-22 | Precision Coating Innovations, Llc | Pressurization coating systems, methods, and apparatuses |
| US20100015456A1 (en) | 2008-07-16 | 2010-01-21 | Eastman Chemical Company | Thermoplastic formulations for enhanced paintability toughness and melt process ability |
| US8445568B2 (en) * | 2008-09-25 | 2013-05-21 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic composition and articles formed therefrom |
| US8771829B2 (en) * | 2008-09-25 | 2014-07-08 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polymer composition, method of manufacture, and articles formed therefrom |
| US20100280159A1 (en) * | 2008-09-25 | 2010-11-04 | Christianus Johannes Jacobus Maas | Flame retardant thermoplastic composition and articles formed therefrom |
| US8889248B2 (en) * | 2008-10-31 | 2014-11-18 | Sabic Global Technologies B.V. | Multiwall sheet, an article, a method of making a multiwall sheet |
| US8945699B2 (en) * | 2008-11-03 | 2015-02-03 | Sabic Global Technologies B.V. | Sheet, an article, and a method of making a sheet |
| US8043688B2 (en) * | 2008-11-25 | 2011-10-25 | Sabic Innovative Plastics Ip B.V. | Multiwall sheet, an article, a method of making a multiwall sheet |
| US8734909B2 (en) | 2010-03-10 | 2014-05-27 | Eastman Chemical Company | Methods and apparatus for coating substrates |
| US9074092B2 (en) | 2010-12-20 | 2015-07-07 | Eastman Chemical Company | Miscible polyester blends utilizing recycled polyesters |
| US9150006B2 (en) | 2011-06-23 | 2015-10-06 | Eastman Chemical Company | Lamination process optimization utilizing neopentyl glycol-modified polyesters |
| US8557158B2 (en) | 2011-08-23 | 2013-10-15 | Sabic Innovative Plastics Ip B.V. | Molded article having enhanced aesthetic effect and method and system for making the molded article |
| US9616457B2 (en) | 2012-04-30 | 2017-04-11 | Innovative Coatings, Inc. | Pressurization coating systems, methods, and apparatuses |
| US8865261B2 (en) | 2012-12-06 | 2014-10-21 | Eastman Chemical Company | Extrusion coating of elongated substrates |
| US9920526B2 (en) | 2013-10-18 | 2018-03-20 | Eastman Chemical Company | Coated structural members having improved resistance to cracking |
| US9744707B2 (en) | 2013-10-18 | 2017-08-29 | Eastman Chemical Company | Extrusion-coated structural members having extruded profile members |
| CN105873742B (zh) | 2013-11-21 | 2017-10-17 | 沙特基础工业全球技术有限公司 | 密度减小的制品 |
| WO2015156880A2 (en) | 2014-01-28 | 2015-10-15 | Inman Mills | Sheath and core yarn for thermoplastic composite |
| EP3113934B1 (en) | 2014-03-06 | 2018-04-11 | SABIC Global Technologies B.V. | Additive manufactured items with flame resistance, process for making and process for testing their flame performance |
| CN106660268A (zh) | 2014-06-16 | 2017-05-10 | 沙特基础工业全球技术有限公司 | 在材料挤出增材制造中用于增强粘结的方法和装置 |
| WO2016044695A1 (en) * | 2014-09-18 | 2016-03-24 | Momentive Performance Materials Inc. | Polysiloxane co-or terpolymers and polymers made therefrom |
| US20180036952A1 (en) | 2014-12-17 | 2018-02-08 | Sabic Global Technologies B.V., | Multilayer extrusion method for material extrusion additive manufacturing |
| KR20170140159A (ko) | 2015-01-29 | 2017-12-20 | 이머리스 탈크 아메리카, 인코포레이티드 | 폴리카르보네이트 충전제로서 사용하기 위한 엔지니어드 광물질 및 이것을 폴리카르보네이트의 보강에 사용하는 방법 |
| US11512198B2 (en) | 2017-06-21 | 2022-11-29 | Eastman Chemical Company | Polyvinyl chloride and copolyester compositions and articles made using these compositions |
| US11198781B2 (en) | 2018-12-14 | 2021-12-14 | Eastman Chemical Company | Polyvinyl chloride, polycarbonate and copolyester compositions and articles made using these compositions |
| US11198782B2 (en) | 2018-12-14 | 2021-12-14 | Eastman Chemical Company | Polyvinyl chloride, polycarbonate and copolyester compositions and articles made using these compositions |
| JP2023530126A (ja) | 2020-06-15 | 2023-07-13 | イーストマン ケミカル カンパニー | ポリ塩化ビニル、ポリカーボネートおよびコポリエステル組成物、ならびにこれらの組成物を使用して作製された物品 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3186961A (en) * | 1962-10-08 | 1965-06-01 | Monsanto Co | Plasticized polycarbonate resins |
| US3285255A (en) * | 1965-06-07 | 1966-11-15 | Eastman Kodak Co | Polyolefin filter |
| BE792564A (fr) * | 1972-04-25 | 1973-06-12 | Bayer Ag | Masses de moulage thermoplastiques et corps moules en polycarbonate montrant une meilleure aptitude au demoulage lors du moulage par injectio |
| DE2507745A1 (de) * | 1975-02-22 | 1976-09-02 | Ernst Pahl | Tischtennistisch |
-
1976
- 1976-12-16 US US05/751,433 patent/US4123436A/en not_active Expired - Lifetime
-
1977
- 1977-10-20 GB GB43890/77A patent/GB1558352A/en not_active Expired
- 1977-11-15 DE DE19772750991 patent/DE2750991A1/de not_active Withdrawn
- 1977-11-29 NL NL7713187A patent/NL7713187A/xx not_active Application Discontinuation
- 1977-12-12 IT IT30598/77A patent/IT1089961B/it active
- 1977-12-13 FR FR7737489A patent/FR2374374A1/fr active Granted
- 1977-12-15 JP JP14997477A patent/JPS5394535A/ja active Granted
- 1977-12-15 AU AU31617/77A patent/AU509306B2/en not_active Expired
- 1977-12-16 BR BR7708413A patent/BR7708413A/pt unknown
- 1977-12-16 MX MX171773A patent/MX146735A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1558352A (en) | 1979-12-28 |
| IT1089961B (it) | 1985-06-18 |
| JPS5394535A (en) | 1978-08-18 |
| AU3161777A (en) | 1979-06-21 |
| AU509306B2 (en) | 1980-05-01 |
| MX146735A (es) | 1982-08-04 |
| FR2374374A1 (fr) | 1978-07-13 |
| DE2750991A1 (de) | 1978-06-22 |
| FR2374374B1 (esLanguage) | 1984-08-17 |
| US4123436A (en) | 1978-10-31 |
| NL7713187A (nl) | 1978-06-20 |
| BR7708413A (pt) | 1978-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6328929B2 (esLanguage) | ||
| US4130530A (en) | Cyclic siloxane plasticized polycarbonate composition | |
| US4224215A (en) | Filled polycarbonate compositions | |
| US4129546A (en) | Plasticized with a minor amount of an oligomeric polymeric polycarbonate | |
| US4093582A (en) | Organo phosphorus ester plasticized polycarbonate composition | |
| US4335032A (en) | Polycarbonate resin impact modified with polyolefins and containing polyorganosiloxane fluids | |
| JPS6141939B2 (esLanguage) | ||
| US4123413A (en) | Polycarbonate composition containing urethane plasticizer | |
| US4211679A (en) | Organoboron plasticized polycarbonate composition | |
| US4148773A (en) | Polycarbonate composition containing siloxane plasticizer | |
| US4521562A (en) | Polycarbonate resin impact modified with polyolefins and containing paraffin derivatives | |
| US4218357A (en) | Plasticized polycarbonate composition | |
| US4184994A (en) | Plasticized polycarbonate composition employing solid ketones | |
| US4145329A (en) | Plasticized polycarbonate composition | |
| US4098751A (en) | Organic carbonate plasticized polycarbonate composition | |
| US4143023A (en) | Plasticized polycarbonate composition | |
| US4290934A (en) | Plasticized polycarbonate composition | |
| US4111883A (en) | Plasticized polycarbonate composition | |
| US4098750A (en) | Organic oxalate plasticized polycarbonate composition | |
| US4119603A (en) | Plasticized polycarbonate composition | |
| US4282134A (en) | Plasticized polycarbonate composition | |
| US4083814A (en) | Polycarbonate compositions plasticized with urea compounds | |
| US4230611A (en) | Silane plasticized polycarbonate composition | |
| US4243570A (en) | Plasticized polycarbonate composition | |
| US4108820A (en) | Polycarbonate composition containing oligomeric-polymeric oxalate plasticizer |