JPS6244525B2 - - Google Patents
Info
- Publication number
- JPS6244525B2 JPS6244525B2 JP13043579A JP13043579A JPS6244525B2 JP S6244525 B2 JPS6244525 B2 JP S6244525B2 JP 13043579 A JP13043579 A JP 13043579A JP 13043579 A JP13043579 A JP 13043579A JP S6244525 B2 JPS6244525 B2 JP S6244525B2
- Authority
- JP
- Japan
- Prior art keywords
- phenylphthalazine
- group
- carbon atoms
- formula
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 101000783577 Dendroaspis angusticeps Thrombostatin Proteins 0.000 claims description 6
- 101000783578 Dendroaspis jamesoni kaimosae Dendroaspin Proteins 0.000 claims description 6
- 229940127218 antiplatelet drug Drugs 0.000 claims description 6
- 239000000106 platelet aggregation inhibitor Substances 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- -1 n -butyl Chemical group 0.000 description 50
- 150000001875 compounds Chemical class 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- 238000003786 synthesis reaction Methods 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- IGUVJKICKDRMPR-UHFFFAOYSA-N n-(4-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(C)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 IGUVJKICKDRMPR-UHFFFAOYSA-N 0.000 description 5
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- DOMCJMIKKKNQRH-UHFFFAOYSA-N 1-(2-methylphenoxy)-4-phenylphthalazine Chemical compound CC1=CC=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 DOMCJMIKKKNQRH-UHFFFAOYSA-N 0.000 description 4
- KHIILJVSYUGMSE-UHFFFAOYSA-N 1-phenylphthalazine Chemical class C1=CC=CC=C1C1=NN=CC2=CC=CC=C12 KHIILJVSYUGMSE-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- RGQBTUTXCYXHBS-UHFFFAOYSA-N n-(2-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound CC1=CC=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 RGQBTUTXCYXHBS-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- PTGXMBPJFXPBQV-UHFFFAOYSA-N 1-phenoxy-4-phenylphthalazine Chemical compound N=1N=C(C=2C=CC=CC=2)C2=CC=CC=C2C=1OC1=CC=CC=C1 PTGXMBPJFXPBQV-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- BEATZJALKXTWKH-UHFFFAOYSA-N n,4-diphenylphthalazin-1-amine Chemical compound N=1N=C(C=2C=CC=CC=2)C2=CC=CC=C2C=1NC1=CC=CC=C1 BEATZJALKXTWKH-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- MGNMFYVAYYJIPN-UHFFFAOYSA-N 1-(2,5-dichlorophenoxy)-4-phenylphthalazine Chemical compound ClC1=CC=C(Cl)C(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 MGNMFYVAYYJIPN-UHFFFAOYSA-N 0.000 description 2
- MWOVZLDGMRXYCS-UHFFFAOYSA-N 1-(2,5-diethylphenoxy)-4-phenylphthalazine Chemical compound CCC1=CC=C(CC)C(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 MWOVZLDGMRXYCS-UHFFFAOYSA-N 0.000 description 2
- NHSRKHZYSHMDJN-UHFFFAOYSA-N 1-(2,5-difluorophenoxy)-4-phenylphthalazine Chemical compound FC1=CC=C(F)C(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 NHSRKHZYSHMDJN-UHFFFAOYSA-N 0.000 description 2
- TWIRDKAZASCDRR-UHFFFAOYSA-N 1-(2,5-dimethylphenoxy)-4-phenylphthalazine Chemical compound CC1=CC=C(C)C(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 TWIRDKAZASCDRR-UHFFFAOYSA-N 0.000 description 2
- YORUYWHVRRWGQX-UHFFFAOYSA-N 1-(2,5-dipropylphenoxy)-4-phenylphthalazine Chemical compound CCCC1=CC=C(CCC)C(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 YORUYWHVRRWGQX-UHFFFAOYSA-N 0.000 description 2
- PMFAZAUPKYLWFQ-UHFFFAOYSA-N 1-(2,6-dichlorophenoxy)-4-phenylphthalazine Chemical compound ClC1=CC=CC(Cl)=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 PMFAZAUPKYLWFQ-UHFFFAOYSA-N 0.000 description 2
- XULLEBJAVLJYCY-UHFFFAOYSA-N 1-(2-chlorophenoxy)-4-phenylphthalazine Chemical compound ClC1=CC=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 XULLEBJAVLJYCY-UHFFFAOYSA-N 0.000 description 2
- VBSCNAAFFFZKAZ-UHFFFAOYSA-N 1-(3,4-dimethoxyphenoxy)-4-phenylphthalazine Chemical compound C1=C(OC)C(OC)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 VBSCNAAFFFZKAZ-UHFFFAOYSA-N 0.000 description 2
- LDHZNIMIVNNHSD-UHFFFAOYSA-N 1-(3-bromophenoxy)-4-phenylphthalazine Chemical compound BrC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 LDHZNIMIVNNHSD-UHFFFAOYSA-N 0.000 description 2
- XSGNJHXFWOGNOG-UHFFFAOYSA-N 1-(3-butoxyphenoxy)-4-phenylphthalazine Chemical compound CCCCOC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 XSGNJHXFWOGNOG-UHFFFAOYSA-N 0.000 description 2
- MMBCCBHIMLNMOI-UHFFFAOYSA-N 1-(3-butylphenoxy)-4-phenylphthalazine Chemical compound CCCCC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 MMBCCBHIMLNMOI-UHFFFAOYSA-N 0.000 description 2
- OIIDCQKFULERQS-UHFFFAOYSA-N 1-(3-chloro-4-methylphenoxy)-4-phenylphthalazine Chemical compound Cc1ccc(Oc2nnc(-c3ccccc3)c3ccccc23)cc1Cl OIIDCQKFULERQS-UHFFFAOYSA-N 0.000 description 2
- QVKSDSNZMRSGNE-UHFFFAOYSA-N 1-(3-chlorophenoxy)-4-phenylphthalazine Chemical compound ClC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 QVKSDSNZMRSGNE-UHFFFAOYSA-N 0.000 description 2
- KQNMQWSQPCROIE-UHFFFAOYSA-N 1-(3-fluoro-4-methylphenoxy)-4-phenylphthalazine Chemical compound Cc1ccc(Oc2nnc(-c3ccccc3)c3ccccc23)cc1F KQNMQWSQPCROIE-UHFFFAOYSA-N 0.000 description 2
- ZZZQQEAIFDZMJL-UHFFFAOYSA-N 1-(3-fluorophenoxy)-4-phenylphthalazine Chemical compound FC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 ZZZQQEAIFDZMJL-UHFFFAOYSA-N 0.000 description 2
- MLQLEGJPAPMIAW-UHFFFAOYSA-N 1-(3-methoxyphenoxy)-4-phenylphthalazine Chemical compound COC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 MLQLEGJPAPMIAW-UHFFFAOYSA-N 0.000 description 2
- ZRNCXLJPTVVIOX-UHFFFAOYSA-N 1-(3-methylphenoxy)-4-phenylphthalazine Chemical compound CC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 ZRNCXLJPTVVIOX-UHFFFAOYSA-N 0.000 description 2
- CXHLEBQTMXEKNP-UHFFFAOYSA-N 1-(4-bromophenoxy)-4-phenylphthalazine Chemical compound C1=CC(Br)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 CXHLEBQTMXEKNP-UHFFFAOYSA-N 0.000 description 2
- FKKRFXAFQLSVQW-UHFFFAOYSA-N 1-(4-butylphenoxy)-4-phenylphthalazine Chemical compound C1=CC(CCCC)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 FKKRFXAFQLSVQW-UHFFFAOYSA-N 0.000 description 2
- GDOUMGMIUYAYEG-UHFFFAOYSA-N 1-(4-chloro-2-methoxyphenoxy)-4-phenylphthalazine Chemical compound COc1cc(Cl)ccc1Oc1nnc(-c2ccccc2)c2ccccc12 GDOUMGMIUYAYEG-UHFFFAOYSA-N 0.000 description 2
- IHLUZEFCMPAJFV-UHFFFAOYSA-N 1-(4-chloro-3-methylphenoxy)-4-phenylphthalazine Chemical compound Cc1cc(Oc2nnc(-c3ccccc3)c3ccccc23)ccc1Cl IHLUZEFCMPAJFV-UHFFFAOYSA-N 0.000 description 2
- PLNNDWSJRGHNKF-UHFFFAOYSA-N 1-(4-chlorophenoxy)-4-phenylphthalazine Chemical compound C1=CC(Cl)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 PLNNDWSJRGHNKF-UHFFFAOYSA-N 0.000 description 2
- SDFDHZJYVFXTPW-UHFFFAOYSA-N 1-(4-fluorophenoxy)-4-phenylphthalazine Chemical compound C1=CC(F)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 SDFDHZJYVFXTPW-UHFFFAOYSA-N 0.000 description 2
- ZOBPXBWFLDRTPE-UHFFFAOYSA-N 1-(4-methoxyphenoxy)-4-phenylphthalazine Chemical compound C1=CC(OC)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 ZOBPXBWFLDRTPE-UHFFFAOYSA-N 0.000 description 2
- NMQQXMBZDOOJDH-UHFFFAOYSA-N 1-(4-methylphenoxy)-4-phenylphthalazine Chemical compound C1=CC(C)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 NMQQXMBZDOOJDH-UHFFFAOYSA-N 0.000 description 2
- BVAZYGMDXRXDTJ-UHFFFAOYSA-N 1-(4-tert-butylphenoxy)-4-phenylphthalazine Chemical compound C1=CC(C(C)(C)C)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 BVAZYGMDXRXDTJ-UHFFFAOYSA-N 0.000 description 2
- KUZXRBPVTGBFLV-UHFFFAOYSA-N 1-[2-methyl-4-(trifluoromethyl)phenoxy]-4-phenylphthalazine Chemical compound Cc1cc(ccc1Oc1nnc(-c2ccccc2)c2ccccc12)C(F)(F)F KUZXRBPVTGBFLV-UHFFFAOYSA-N 0.000 description 2
- HBOUYHAOPPRVCU-UHFFFAOYSA-N 1-[4-(4-phenylphthalazin-1-yl)oxyphenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 HBOUYHAOPPRVCU-UHFFFAOYSA-N 0.000 description 2
- ZSBMYVJJLUUBKA-UHFFFAOYSA-N 1-[4-[(4-phenylphthalazin-1-yl)amino]phenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 ZSBMYVJJLUUBKA-UHFFFAOYSA-N 0.000 description 2
- WJJDLSHYLZRFDD-UHFFFAOYSA-N 1-chloro-4-phenylphthalazine Chemical compound C12=CC=CC=C2C(Cl)=NN=C1C1=CC=CC=C1 WJJDLSHYLZRFDD-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- MXBPGYQJSPGSHX-UHFFFAOYSA-N 1-phenyl-4-(2,4,6-trimethylphenoxy)phthalazine Chemical compound Cc1cc(C)c(Oc2nnc(-c3ccccc3)c3ccccc23)c(C)c1 MXBPGYQJSPGSHX-UHFFFAOYSA-N 0.000 description 2
- VNMFPZOFFCNRGY-UHFFFAOYSA-N 1-phenyl-4-(3-propoxyphenoxy)phthalazine Chemical compound CCCOC1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 VNMFPZOFFCNRGY-UHFFFAOYSA-N 0.000 description 2
- VAKBICSGFMGSBO-UHFFFAOYSA-N 1-phenyl-4-[3-(trifluoromethyl)phenoxy]phthalazine Chemical compound FC(F)(F)C1=CC=CC(OC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 VAKBICSGFMGSBO-UHFFFAOYSA-N 0.000 description 2
- DGYHSCMCBBHYSW-UHFFFAOYSA-N 1-phenyl-4-[4-(trifluoromethyl)phenoxy]phthalazine Chemical compound FC(F)(F)c1ccc(Oc2nnc(-c3ccccc3)c3ccccc23)cc1 DGYHSCMCBBHYSW-UHFFFAOYSA-N 0.000 description 2
- DLMXLUFVYVOLOC-UHFFFAOYSA-N 4-(4-phenylphthalazin-1-yl)oxybenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 DLMXLUFVYVOLOC-UHFFFAOYSA-N 0.000 description 2
- KNJJELJJBCAVFR-UHFFFAOYSA-N 4-(4-phenylphthalazin-1-yl)oxybenzonitrile Chemical compound C1=CC(C#N)=CC=C1OC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 KNJJELJJBCAVFR-UHFFFAOYSA-N 0.000 description 2
- QUWWOEGYJCSXMX-UHFFFAOYSA-N 4-[(4-phenylphthalazin-1-yl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 QUWWOEGYJCSXMX-UHFFFAOYSA-N 0.000 description 2
- QQBQYLIRZPWUNC-UHFFFAOYSA-N 4-[(4-phenylphthalazin-1-yl)amino]benzonitrile Chemical compound C1=CC(C#N)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 QQBQYLIRZPWUNC-UHFFFAOYSA-N 0.000 description 2
- XCPBIZQYJAYOQZ-UHFFFAOYSA-N 4-phenyl-N-(2,4,6-trimethylphenyl)phthalazin-1-amine Chemical compound Cc1cc(C)c(Nc2nnc(-c3ccccc3)c3ccccc23)c(C)c1 XCPBIZQYJAYOQZ-UHFFFAOYSA-N 0.000 description 2
- SCRIQDJLKMSGIG-UHFFFAOYSA-N 4-phenyl-N-(3,4,5-trimethoxyphenyl)phthalazin-1-amine Chemical compound COc1cc(Nc2nnc(-c3ccccc3)c3ccccc23)cc(OC)c1OC SCRIQDJLKMSGIG-UHFFFAOYSA-N 0.000 description 2
- MBXGTKMFGHWQQK-UHFFFAOYSA-N 4-phenyl-N-[2-(trifluoromethyl)phenyl]phthalazin-1-amine Chemical compound FC(F)(F)c1ccccc1Nc1nnc(-c2ccccc2)c2ccccc12 MBXGTKMFGHWQQK-UHFFFAOYSA-N 0.000 description 2
- WCXHPHAFYNVZQB-UHFFFAOYSA-N 4-phenyl-N-[4-(trifluoromethyl)phenyl]phthalazin-1-amine Chemical compound FC(F)(F)c1ccc(Nc2nnc(-c3ccccc3)c3ccccc23)cc1 WCXHPHAFYNVZQB-UHFFFAOYSA-N 0.000 description 2
- KNYVGNRPDDBAIP-UHFFFAOYSA-N 4-phenyl-n-[3-(trifluoromethyl)phenyl]phthalazin-1-amine Chemical compound FC(F)(F)C1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 KNYVGNRPDDBAIP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- YWSLEWNOZWXQQN-UHFFFAOYSA-N C1=CC=C(C=C1)C2=NN=C(C3=CC=CC=C32)OC4=CC(=CC=C4)I Chemical compound C1=CC=C(C=C1)C2=NN=C(C3=CC=CC=C32)OC4=CC(=CC=C4)I YWSLEWNOZWXQQN-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- FNMLHKZMAXXQFU-UHFFFAOYSA-N N-(2-methoxy-5-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound COc1ccc(C)cc1Nc1nnc(-c2ccccc2)c2ccccc12 FNMLHKZMAXXQFU-UHFFFAOYSA-N 0.000 description 2
- NYTZTBXNGPXPDU-UHFFFAOYSA-N N-(3-chloro-2-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound Cc1c(Cl)cccc1Nc1nnc(-c2ccccc2)c2ccccc12 NYTZTBXNGPXPDU-UHFFFAOYSA-N 0.000 description 2
- MGHYQBWVEBFXLH-UHFFFAOYSA-N N-(3-chloro-4-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound Cc1ccc(Nc2nnc(-c3ccccc3)c3ccccc23)cc1Cl MGHYQBWVEBFXLH-UHFFFAOYSA-N 0.000 description 2
- CEHQLKSLMFIHBF-UHFFFAOYSA-N N-(3-chlorophenyl)-4-phenyl-1-phthalazinamine Chemical compound ClC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 CEHQLKSLMFIHBF-UHFFFAOYSA-N 0.000 description 2
- OQGZORZDENPRGX-UHFFFAOYSA-N N-(3-fluoro-4-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound Cc1ccc(Nc2nnc(-c3ccccc3)c3ccccc23)cc1F OQGZORZDENPRGX-UHFFFAOYSA-N 0.000 description 2
- OTZXRQZHKFCVNZ-UHFFFAOYSA-N N-(4-chloro-2-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound Cc1cc(Cl)ccc1Nc1nnc(-c2ccccc2)c2ccccc12 OTZXRQZHKFCVNZ-UHFFFAOYSA-N 0.000 description 2
- APSAQONFMSJDED-UHFFFAOYSA-N N-(4-chloro-3-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound Cc1cc(Nc2nnc(-c3ccccc3)c3ccccc23)ccc1Cl APSAQONFMSJDED-UHFFFAOYSA-N 0.000 description 2
- LFXHJPHQSQODTB-UHFFFAOYSA-N N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-phenylphthalazin-1-amine Chemical compound COC1=C(NC2=NN=C(C3=CC=CC=C23)C2=CC=CC=C2)C=C(C=C1)C(F)(F)F LFXHJPHQSQODTB-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 229940099112 cornstarch Drugs 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- HDVONPFBZBEUCH-UHFFFAOYSA-N ethyl 4-(4-phenylphthalazin-1-yl)oxybenzoate Chemical compound CCOC(=O)c1ccc(Oc2nnc(-c3ccccc3)c3ccccc23)cc1 HDVONPFBZBEUCH-UHFFFAOYSA-N 0.000 description 2
- DENHKCMZPFZGQV-UHFFFAOYSA-N ethyl 4-[(4-phenylphthalazin-1-yl)amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 DENHKCMZPFZGQV-UHFFFAOYSA-N 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- SIQOFGFJLHIZLO-UHFFFAOYSA-N n-(2,3-dimethylphenyl)-4-phenylphthalazin-1-amine Chemical compound CC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1C SIQOFGFJLHIZLO-UHFFFAOYSA-N 0.000 description 2
- VGDXSCKJQOPRMD-UHFFFAOYSA-N n-(2,4-dimethylphenyl)-4-phenylphthalazin-1-amine Chemical compound CC1=CC(C)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 VGDXSCKJQOPRMD-UHFFFAOYSA-N 0.000 description 2
- UKFBEBVXSPHQQO-UHFFFAOYSA-N n-(2,5-dichlorophenyl)-4-phenylphthalazin-1-amine Chemical compound ClC1=CC=C(Cl)C(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 UKFBEBVXSPHQQO-UHFFFAOYSA-N 0.000 description 2
- HBKGZFRWYJGCOS-UHFFFAOYSA-N n-(2,5-diethylphenyl)-4-phenylphthalazin-1-amine Chemical compound CCC1=CC=C(CC)C(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 HBKGZFRWYJGCOS-UHFFFAOYSA-N 0.000 description 2
- UAWOOWYTPUXVTB-UHFFFAOYSA-N n-(2,5-difluorophenyl)-4-phenylphthalazin-1-amine Chemical compound FC1=CC=C(F)C(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 UAWOOWYTPUXVTB-UHFFFAOYSA-N 0.000 description 2
- ABHZPKTUBOFGIX-UHFFFAOYSA-N n-(2,5-dimethoxyphenyl)-4-phenylphthalazin-1-amine Chemical compound COC1=CC=C(OC)C(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 ABHZPKTUBOFGIX-UHFFFAOYSA-N 0.000 description 2
- JKNCOSKWGCKFMN-UHFFFAOYSA-N n-(2,5-dimethylphenyl)-4-phenylphthalazin-1-amine Chemical compound CC1=CC=C(C)C(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 JKNCOSKWGCKFMN-UHFFFAOYSA-N 0.000 description 2
- VDTOTKUCBRNURI-UHFFFAOYSA-N n-(2,5-dipropylphenyl)-4-phenylphthalazin-1-amine Chemical compound CCCC1=CC=C(CCC)C(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 VDTOTKUCBRNURI-UHFFFAOYSA-N 0.000 description 2
- AJILKKQHKCETQO-UHFFFAOYSA-N n-(2-chlorophenyl)-4-phenylphthalazin-1-amine Chemical compound ClC1=CC=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 AJILKKQHKCETQO-UHFFFAOYSA-N 0.000 description 2
- BFRVIFVHCXRTGU-UHFFFAOYSA-N n-(2-fluorophenyl)-4-phenylphthalazin-1-amine Chemical compound FC1=CC=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 BFRVIFVHCXRTGU-UHFFFAOYSA-N 0.000 description 2
- DIESCXTYJZOHSB-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-4-phenylphthalazin-1-amine Chemical compound C1=C(Cl)C(Cl)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 DIESCXTYJZOHSB-UHFFFAOYSA-N 0.000 description 2
- FZCOURGTQRSDQW-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-4-phenylphthalazin-1-amine Chemical compound C1=C(OC)C(OC)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 FZCOURGTQRSDQW-UHFFFAOYSA-N 0.000 description 2
- GHJGIWRYKHMZMY-UHFFFAOYSA-N n-(3,4-dimethylphenyl)-4-phenylphthalazin-1-amine Chemical compound C1=C(C)C(C)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 GHJGIWRYKHMZMY-UHFFFAOYSA-N 0.000 description 2
- JCVZOWFIEHBKJA-UHFFFAOYSA-N n-(3-bromophenyl)-4-phenylphthalazin-1-amine Chemical compound BrC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 JCVZOWFIEHBKJA-UHFFFAOYSA-N 0.000 description 2
- PKLTYEYJYNEWBZ-UHFFFAOYSA-N n-(3-butylphenyl)-4-phenylphthalazin-1-amine Chemical compound CCCCC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 PKLTYEYJYNEWBZ-UHFFFAOYSA-N 0.000 description 2
- LZADJUJGYOEGTQ-UHFFFAOYSA-N n-(3-fluorophenyl)-4-phenylphthalazin-1-amine Chemical compound FC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 LZADJUJGYOEGTQ-UHFFFAOYSA-N 0.000 description 2
- DNXBARXRZPODIL-UHFFFAOYSA-N n-(3-iodophenyl)-4-phenylphthalazin-1-amine Chemical compound IC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 DNXBARXRZPODIL-UHFFFAOYSA-N 0.000 description 2
- NWFGFUZFLNFCAY-UHFFFAOYSA-N n-(3-methoxyphenyl)-4-phenylphthalazin-1-amine Chemical compound COC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 NWFGFUZFLNFCAY-UHFFFAOYSA-N 0.000 description 2
- BBMRDCBMRNUOKY-UHFFFAOYSA-N n-(3-methylphenyl)-4-phenylphthalazin-1-amine Chemical compound CC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 BBMRDCBMRNUOKY-UHFFFAOYSA-N 0.000 description 2
- SYHWJLXARVLGQM-UHFFFAOYSA-N n-(4-butoxyphenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(OCCCC)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 SYHWJLXARVLGQM-UHFFFAOYSA-N 0.000 description 2
- NSMLPKMOJGYBDS-UHFFFAOYSA-N n-(4-fluorophenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(F)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 NSMLPKMOJGYBDS-UHFFFAOYSA-N 0.000 description 2
- NTQBYEVYQCTMAQ-UHFFFAOYSA-N n-(4-iodophenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(I)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 NTQBYEVYQCTMAQ-UHFFFAOYSA-N 0.000 description 2
- ZEXOYEKJRIIUNG-UHFFFAOYSA-N n-(4-methoxyphenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(OC)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 ZEXOYEKJRIIUNG-UHFFFAOYSA-N 0.000 description 2
- VUCQDHXWTYYKML-UHFFFAOYSA-N n-(4-tert-butylphenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(C(C)(C)C)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 VUCQDHXWTYYKML-UHFFFAOYSA-N 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- DUQOOLBWGUKRAJ-UHFFFAOYSA-N oxagrelate Chemical compound OCC1=NNC(=O)C2=C(C)C(C(=O)OCC)=C(C)C=C21 DUQOOLBWGUKRAJ-UHFFFAOYSA-N 0.000 description 2
- 229950004599 oxagrelate Drugs 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007901 soft capsule Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CSHSXUZQMJVDJY-UHFFFAOYSA-N 1-phenoxyphthalazine Chemical class N=1N=CC2=CC=CC=C2C=1OC1=CC=CC=C1 CSHSXUZQMJVDJY-UHFFFAOYSA-N 0.000 description 1
- GCMUHGJHZLTCPV-UHFFFAOYSA-N 1-phenyl-4-piperazin-1-ylphthalazine Chemical class C1CNCCN1C(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 GCMUHGJHZLTCPV-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MMPMZTYQPIDJFE-UHFFFAOYSA-N 4-phenyl-n-(3-propoxyphenyl)phthalazin-1-amine Chemical compound CCCOC1=CC=CC(NC=2C3=CC=CC=C3C(C=3C=CC=CC=3)=NN=2)=C1 MMPMZTYQPIDJFE-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 206010008132 Cerebral thrombosis Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010060891 General symptom Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 201000001429 Intracranial Thrombosis Diseases 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 206010050661 Platelet aggregation inhibition Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 206010008118 cerebral infarction Diseases 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- GCFHZZWXZLABBL-UHFFFAOYSA-N ethanol;hexane Chemical compound CCO.CCCCCC GCFHZZWXZLABBL-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- KTAOSDUHMXUHPU-UHFFFAOYSA-N n-(4-bromophenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(Br)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 KTAOSDUHMXUHPU-UHFFFAOYSA-N 0.000 description 1
- AAUGIQYXZOLAEN-UHFFFAOYSA-N n-(4-chlorophenyl)-4-phenylphthalazin-1-amine Chemical compound C1=CC(Cl)=CC=C1NC(C1=CC=CC=C11)=NN=C1C1=CC=CC=C1 AAUGIQYXZOLAEN-UHFFFAOYSA-N 0.000 description 1
- GZLPQVREIBIVAT-UHFFFAOYSA-N n-phenylphthalazin-1-amine Chemical class N=1N=CC2=CC=CC=C2C=1NC1=CC=CC=C1 GZLPQVREIBIVAT-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- RZXMPPFPUUCRFN-UHFFFAOYSA-N para-methylaniline Natural products CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 210000004623 platelet-rich plasma Anatomy 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13043579A JPS5653659A (en) | 1979-10-09 | 1979-10-09 | Blood platelet coagulation suppressing agent |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13043579A JPS5653659A (en) | 1979-10-09 | 1979-10-09 | Blood platelet coagulation suppressing agent |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5653659A JPS5653659A (en) | 1981-05-13 |
| JPS6244525B2 true JPS6244525B2 (enExample) | 1987-09-21 |
Family
ID=15034159
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13043579A Granted JPS5653659A (en) | 1979-10-09 | 1979-10-09 | Blood platelet coagulation suppressing agent |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5653659A (enExample) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW279162B (enExample) * | 1991-09-26 | 1996-06-21 | Mitsubishi Chem Corp | |
| DK0682947T3 (da) | 1994-05-19 | 1998-05-04 | Mitsubishi Chem Corp | Medikament til terapeutisk og profylaktisk behandling af sygdomme forårsaget af glatmuskelcelle-hyperplasi |
| US5696159A (en) * | 1994-08-03 | 1997-12-09 | Cell Pathways, Inc. | Lactone compounds for treating patients with precancerous lesions |
| US5776962A (en) * | 1994-08-03 | 1998-07-07 | Cell Pathways, Inc. | Lactone compounds for treating patient with precancerous lesions |
| US5874440A (en) * | 1995-06-07 | 1999-02-23 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl pyrimidinone derivatives |
| US6262059B1 (en) | 1995-06-07 | 2001-07-17 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with quinazoline derivatives |
| US6046216A (en) * | 1995-06-07 | 2000-04-04 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl pyridinone derivatives |
| US6060477A (en) * | 1995-06-07 | 2000-05-09 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl cycloamino pyrimidinone derivatives |
| US6232312B1 (en) | 1995-06-07 | 2001-05-15 | Cell Pathways, Inc. | Method for treating patient having precancerous lesions with a combination of pyrimidopyrimidine derivatives and esters and amides of substituted indenyl acetic acides |
| US6046206A (en) * | 1995-06-07 | 2000-04-04 | Cell Pathways, Inc. | Method of treating a patient having a precancerous lesions with amide quinazoline derivatives |
| US5858694A (en) * | 1997-05-30 | 1999-01-12 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of cancerous lesions |
| CA2238283C (en) | 1997-05-30 | 2002-08-20 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of neoplastic lesions, pharmaceutical compositions from such compounds and uses of such compounds and compositions for treating neoplastic lesions |
| US5852035A (en) * | 1997-12-12 | 1998-12-22 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to substituted N- arylmethyl and heterocyclmethyl-1H-pyrazolo (3,4-B) quinolin-4-amines |
| US6046199A (en) * | 1998-01-14 | 2000-04-04 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with tetracyclic pyrido[3,4-B]indole derivatives |
| US6410584B1 (en) | 1998-01-14 | 2002-06-25 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells with indole derivatives |
| US5942520A (en) * | 1998-01-27 | 1999-08-24 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells by exposure to substituted N-cycloalkylmethyl-1-H-pyrazolo (3,4-B) quinolone-4 amines |
| US5990117A (en) * | 1998-04-15 | 1999-11-23 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to quinazoline derivatives |
| US6268372B1 (en) | 1998-09-11 | 2001-07-31 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,9-disubstituted purin-6-ones |
| US6124303A (en) * | 1998-09-11 | 2000-09-26 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 9-substituted 2-(2-N-aloxyphenyl) purin-6-ones |
| US6130053A (en) * | 1999-08-03 | 2000-10-10 | Cell Pathways, Inc. | Method for selecting compounds for inhibition of neoplastic lesions |
| US6200771B1 (en) | 1998-10-15 | 2001-03-13 | Cell Pathways, Inc. | Method of using a novel phosphodiesterase in pharmaceutical screeing to identify compounds for treatment of neoplasia |
| US6133271A (en) * | 1998-11-19 | 2000-10-17 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure thienopyrimidine derivatives |
| US6187779B1 (en) | 1998-11-20 | 2001-02-13 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,8-disubstituted quinazoline derivatives |
| US6369092B1 (en) | 1998-11-23 | 2002-04-09 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted benzimidazole derivatives |
| US6034099A (en) * | 1998-11-24 | 2000-03-07 | Cell Pathways, Inc. | Method for inhibiting neoplastic lesions by administering 4-(arylmethylene)- 2, 3- dihydro-pyrazol-3-ones |
| US6486155B1 (en) | 1998-11-24 | 2002-11-26 | Cell Pathways Inc | Method of inhibiting neoplastic cells with isoquinoline derivatives |
| US6077842A (en) * | 1998-11-24 | 2000-06-20 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with pyrazolopyridylpyridazinone derivatives |
| US6020379A (en) * | 1999-02-19 | 2000-02-01 | Cell Pathways, Inc. | Position 7 substituted indenyl-3-acetic acid derivatives and amides thereof for the treatment of neoplasia |
| US6555547B1 (en) | 2000-02-28 | 2003-04-29 | Cell Pathways, Inc. | Method for treating a patient with neoplasia by treatment with a vinca alkaloid derivative |
| US6569638B1 (en) | 2000-03-03 | 2003-05-27 | Cell Pathways, Inc | Method for screening compounds for the treatment of neoplasia |
-
1979
- 1979-10-09 JP JP13043579A patent/JPS5653659A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5653659A (en) | 1981-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6244525B2 (enExample) | ||
| US11247993B2 (en) | Pyridone derivative, composition and use as antiviral drug thereof | |
| JP3929700B2 (ja) | 新規三環式化合物 | |
| JPS6089474A (ja) | モルフイナン誘導体,その製造方法,及び該化合物を含有する抗腫瘍剤 | |
| EP0288189A1 (en) | Improvements in or relating to leukotriene antagonists | |
| JPH0912560A (ja) | 改良された抗ウイルス化合物 | |
| JP4882744B2 (ja) | 止痒剤 | |
| CN111303147B (zh) | 吡啶酮衍生物、其组合物及作为抗流感病毒药物的应用 | |
| JPH0667919B2 (ja) | 新規なインデノチアゾ−ル誘導体及びその製造法 | |
| KR870000545B1 (ko) | 디히드록시벤즈아미드 유도체의 제조방법 | |
| JP2707936B2 (ja) | β−オキソ−β−ベンゼンプロパンチオアミド誘導体 | |
| JP2016516814A (ja) | コンブレタスタチン類似体 | |
| EP0717734B1 (en) | Pyridazinone derivatives or their salts, processes for their production, and anti-shock agents containing them | |
| EP0282077A2 (en) | Pyridyloxy derivatives | |
| JPH0578554B2 (enExample) | ||
| JP3042915B2 (ja) | 3−(1h−インダゾール−3−イル)−4−ピリジンアミンおよびその製造法 | |
| JPS6242901B2 (enExample) | ||
| JPS5840544B2 (ja) | 1−(2−(b− ナフチルオキシ )−エチル)−3− メチル − ピラゾロン −(5) ノセイゾウホウホウ | |
| JPS6254111B2 (enExample) | ||
| EP0027679A2 (en) | Substituted-5-((7-chloro-4-quinolinyl)amino)-3-(amino-methyl)-(1,1'-biphenyl)-2-ol compounds; processes for their production; and pharmaceutical compositions containing the compounds | |
| US4152438A (en) | Phenoxyalkylaminepyridylethers | |
| JP3227616B2 (ja) | ヘキサヒドロインデノ〔1,2−b〕ピロール誘導体 | |
| JPS6053016B2 (ja) | 新規な3,4−ジヒドロカルボスチリル誘導体 | |
| JPS6334871B2 (enExample) | ||
| JPH03284669A (ja) | 4―フェニルフタラジン誘導体 |