JPS6221783B2 - - Google Patents
Info
- Publication number
- JPS6221783B2 JPS6221783B2 JP53154290A JP15429078A JPS6221783B2 JP S6221783 B2 JPS6221783 B2 JP S6221783B2 JP 53154290 A JP53154290 A JP 53154290A JP 15429078 A JP15429078 A JP 15429078A JP S6221783 B2 JPS6221783 B2 JP S6221783B2
- Authority
- JP
- Japan
- Prior art keywords
- chloride
- formula
- dichloro
- mol
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 16
- -1 C1 - C4 -carbalkoxy Chemical group 0.000 claims description 9
- 239000002841 Lewis acid Substances 0.000 claims description 9
- 150000007517 lewis acids Chemical class 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000004104 aryloxy group Chemical group 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical compound ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 16
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 16
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 16
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000004508 fractional distillation Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- MFHPYLFZSCSNST-UHFFFAOYSA-N 1-chloro-2-(trichloromethyl)benzene Chemical compound ClC1=CC=CC=C1C(Cl)(Cl)Cl MFHPYLFZSCSNST-UHFFFAOYSA-N 0.000 description 2
- LVZPKYYPPLUECL-UHFFFAOYSA-N 1-chloro-4-(trichloromethyl)benzene Chemical compound ClC1=CC=C(C(Cl)(Cl)Cl)C=C1 LVZPKYYPPLUECL-UHFFFAOYSA-N 0.000 description 2
- JXQGEFXHPTWIDZ-UHFFFAOYSA-N 1-phenyl-4-(trichloromethyl)benzene Chemical compound C1=CC(C(Cl)(Cl)Cl)=CC=C1C1=CC=CC=C1 JXQGEFXHPTWIDZ-UHFFFAOYSA-N 0.000 description 2
- OMRXVBREYFZQHU-UHFFFAOYSA-N 2,4-dichloro-1,3,5-triazine Chemical group ClC1=NC=NC(Cl)=N1 OMRXVBREYFZQHU-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- JCSOVYOOGCAVSC-UHFFFAOYSA-N 1,2-dichloro-3-(trichloromethoxy)benzene Chemical compound ClC1=CC=CC(OC(Cl)(Cl)Cl)=C1Cl JCSOVYOOGCAVSC-UHFFFAOYSA-N 0.000 description 1
- GKGPLSQWIBJJPC-UHFFFAOYSA-N 1,2-dichloro-3-(trichloromethyl)benzene Chemical compound ClC1=CC=CC(C(Cl)(Cl)Cl)=C1Cl GKGPLSQWIBJJPC-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- JYAVJLTUVOJMPZ-UHFFFAOYSA-N 1-bromo-4-(tribromomethyl)benzene Chemical compound BrC1=CC=C(C(Br)(Br)Br)C=C1 JYAVJLTUVOJMPZ-UHFFFAOYSA-N 0.000 description 1
- HYKCSUJRSCZRFZ-UHFFFAOYSA-N 1-bromo-4-(trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=C(Br)C=C1 HYKCSUJRSCZRFZ-UHFFFAOYSA-N 0.000 description 1
- YCFMAERJURIFJE-UHFFFAOYSA-N 1-chloro-2-nitro-3-(trichloromethoxy)benzene Chemical compound [O-][N+](=O)C1=C(Cl)C=CC=C1OC(Cl)(Cl)Cl YCFMAERJURIFJE-UHFFFAOYSA-N 0.000 description 1
- SFTPDMXEKLOAAX-UHFFFAOYSA-N 1-chloro-3-(trichloromethoxy)benzene Chemical compound ClC1=CC=CC(OC(Cl)(Cl)Cl)=C1 SFTPDMXEKLOAAX-UHFFFAOYSA-N 0.000 description 1
- ZVPXXRHACIEOFJ-UHFFFAOYSA-N 1-chloro-3-(trichloromethyl)benzene Chemical compound ClC1=CC=CC(C(Cl)(Cl)Cl)=C1 ZVPXXRHACIEOFJ-UHFFFAOYSA-N 0.000 description 1
- WSDQYJBWCOIPQM-UHFFFAOYSA-N 1-methoxy-4-(tribromomethyl)benzene Chemical compound COC1=CC=C(C(Br)(Br)Br)C=C1 WSDQYJBWCOIPQM-UHFFFAOYSA-N 0.000 description 1
- ONBZGCATMMPOHG-UHFFFAOYSA-N 1-methoxy-4-(trichloromethoxy)benzene Chemical compound COC1=CC=C(OC(Cl)(Cl)Cl)C=C1 ONBZGCATMMPOHG-UHFFFAOYSA-N 0.000 description 1
- SWJLDCGQSPSOKX-UHFFFAOYSA-N 1-methoxy-4-(trichloromethyl)benzene Chemical compound COC1=CC=C(C(Cl)(Cl)Cl)C=C1 SWJLDCGQSPSOKX-UHFFFAOYSA-N 0.000 description 1
- WREWVOPYGFFLBB-UHFFFAOYSA-N 1-methyl-4-(trichloromethoxy)benzene Chemical compound CC1=CC=C(OC(Cl)(Cl)Cl)C=C1 WREWVOPYGFFLBB-UHFFFAOYSA-N 0.000 description 1
- KMGZJUDZDIVXFG-UHFFFAOYSA-N 1-methyl-4-(trichloromethyl)benzene Chemical compound CC1=CC=C(C(Cl)(Cl)Cl)C=C1 KMGZJUDZDIVXFG-UHFFFAOYSA-N 0.000 description 1
- NVWIABBTWOXJSP-UHFFFAOYSA-N 1-nitro-4-(trichloromethoxy)benzene Chemical compound [O-][N+](=O)C1=CC=C(OC(Cl)(Cl)Cl)C=C1 NVWIABBTWOXJSP-UHFFFAOYSA-N 0.000 description 1
- KZSNBJMYJWDVTK-UHFFFAOYSA-N 2,4-dichloro-1-(trichloromethyl)benzene Chemical compound ClC1=CC=C(C(Cl)(Cl)Cl)C(Cl)=C1 KZSNBJMYJWDVTK-UHFFFAOYSA-N 0.000 description 1
- VCJQGRGZZDMYIR-UHFFFAOYSA-N 2,4-dichloro-6-(2,4-dichlorophenyl)-1,3,5-triazine Chemical compound ClC1=CC(Cl)=CC=C1C1=NC(Cl)=NC(Cl)=N1 VCJQGRGZZDMYIR-UHFFFAOYSA-N 0.000 description 1
- AAEQGYSFKVMOCN-UHFFFAOYSA-N 2,6-dichloro-6-(trichloromethoxy)cyclohexa-1,3-diene Chemical compound ClC1(CC=CC(=C1)Cl)OC(Cl)(Cl)Cl AAEQGYSFKVMOCN-UHFFFAOYSA-N 0.000 description 1
- LMHFNDQRDLJZGV-UHFFFAOYSA-N 2-(4-chlorophenyl)-1,3,5-triazine Chemical compound C1=CC(Cl)=CC=C1C1=NC=NC=N1 LMHFNDQRDLJZGV-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GGPYFVKXLDSOKV-UHFFFAOYSA-N N1C=NC(Cl)=NC1(Cl)C1=CC=C(Cl)C=C1 Chemical compound N1C=NC(Cl)=NC1(Cl)C1=CC=C(Cl)C=C1 GGPYFVKXLDSOKV-UHFFFAOYSA-N 0.000 description 1
- 101150101537 Olah gene Proteins 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- QWXJEVFZPLFTHT-UHFFFAOYSA-N ethyl 4-(trichloromethoxy)benzoate Chemical compound CCOC(=O)C1=CC=C(OC(Cl)(Cl)Cl)C=C1 QWXJEVFZPLFTHT-UHFFFAOYSA-N 0.000 description 1
- WJJYJYAJDWGTBA-UHFFFAOYSA-N ethyl 4-(trichloromethyl)benzoate Chemical compound CCOC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 WJJYJYAJDWGTBA-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- PWFPDRYHJFGZDV-UHFFFAOYSA-N methyl 4-(trichloromethyl)benzoate Chemical compound COC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 PWFPDRYHJFGZDV-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- MVDRXYIEGOGRAI-UHFFFAOYSA-N tribromomethylbenzene Chemical compound BrC(Br)(Br)C1=CC=CC=C1 MVDRXYIEGOGRAI-UHFFFAOYSA-N 0.000 description 1
- CLYZNABPUKUSDX-UHFFFAOYSA-N trichloromethoxybenzene Chemical compound ClC(Cl)(Cl)OC1=CC=CC=C1 CLYZNABPUKUSDX-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 238000005829 trimerization reaction Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772756438 DE2756438A1 (de) | 1977-12-17 | 1977-12-17 | Verfahren zur herstellung von 4,6-dihalogen-triazinen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5488283A JPS5488283A (en) | 1979-07-13 |
| JPS6221783B2 true JPS6221783B2 (enExample) | 1987-05-14 |
Family
ID=6026480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP15429078A Granted JPS5488283A (en) | 1977-12-17 | 1978-12-15 | Manufacture of 4*66dihalogeno triazine |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4220765A (enExample) |
| EP (1) | EP0002493B1 (enExample) |
| JP (1) | JPS5488283A (enExample) |
| DE (2) | DE2756438A1 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU703967B2 (en) * | 1994-10-10 | 1999-04-01 | Ciba Specialty Chemicals Holding Inc. | Bisresorcinyltriazines |
| DE19504800A1 (de) | 1995-02-14 | 1996-08-22 | Hoechst Ag | Faserreaktive Anthrachinonfarbstoffe |
| DE19628017A1 (de) * | 1996-07-11 | 1998-01-15 | Wacker Chemie Gmbh | Permanente Organosiliciumverbindungen, deren Herstellung und Verwendung |
| JP4541809B2 (ja) * | 2004-09-08 | 2010-09-08 | キヤノン株式会社 | 有機化合物及び有機発光素子 |
| CN112645893A (zh) * | 2020-12-28 | 2021-04-13 | 营口昌成新材料科技有限公司 | 一种二卤代均三嗪的合成方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2858310A (en) * | 1956-05-08 | 1958-10-28 | Olin Mathieson | New triazine compounds |
-
1977
- 1977-12-17 DE DE19772756438 patent/DE2756438A1/de not_active Withdrawn
-
1978
- 1978-11-30 US US05/965,379 patent/US4220765A/en not_active Expired - Lifetime
- 1978-12-06 DE DE7878101580T patent/DE2860107D1/de not_active Expired
- 1978-12-06 EP EP78101580A patent/EP0002493B1/de not_active Expired
- 1978-12-15 JP JP15429078A patent/JPS5488283A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4220765A (en) | 1980-09-02 |
| JPS5488283A (en) | 1979-07-13 |
| EP0002493B1 (de) | 1980-07-23 |
| EP0002493A1 (de) | 1979-06-27 |
| DE2756438A1 (de) | 1979-06-21 |
| DE2860107D1 (en) | 1980-11-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Finger et al. | Aromatic fluorine compounds. VII. Replacement of aromatic-Cl and-NO2 groups by-F1, 2 | |
| CA2348749A1 (en) | Process for preparing triazines using a combination of lewis acids and reaction promoters | |
| DK149446B (da) | Fremgangsmaade til fremstilling af acylcyanider | |
| JPS6221783B2 (enExample) | ||
| US4155940A (en) | M-Bromo-benzotrifluorides | |
| JPH0251424B2 (enExample) | ||
| US4421694A (en) | Process for the preparation of nitroanilines | |
| US4238412A (en) | Process for the preparation of acyl cyanides | |
| US2150595A (en) | Process of preparing alpha aryl phthalides | |
| US4093669A (en) | Method for preparing trichloromethyl-trifluoromethyl-benzenes | |
| US2691018A (en) | Process of chlorinating hydroxy triazines with thionyl chloride | |
| US2734073A (en) | Alpha- | |
| US4079090A (en) | Preparation of trichloromethyl-trifluoro methyl-benzenes | |
| Chambers et al. | Polyfluoroheterocyclic compounds. Part VII. Heptafluoro-quinoline and-isoquinoline | |
| US4500471A (en) | Preparation of trifluoromethyl-benzoyl halides | |
| US4137412A (en) | Process for the preparation of substituted chloropyrimidines | |
| US5095157A (en) | Process for the preparation of 2-chloro-4-nitro-alkylbenzene | |
| US5792892A (en) | Processes for preparing aromatic, bromine-containing compounds, novel bromine-containing compounds, and their use as intermediate products in the synthesis of active agents | |
| US4191711A (en) | Process for the preparation of certain nuclear chlorinated benzotrichlorides | |
| US3576804A (en) | Fluorotriazine compounds | |
| JP2005330283A (ja) | 塩化フタロイルの製造方法 | |
| HU195202B (en) | Process for producing 4-alkyl-phthalic anhydride | |
| US4581179A (en) | Process for the preparation of trifluoromethylbenzoyl chlorides and bromides from trifluoromethylbenzoyl fluorides | |
| JPH0120144B2 (enExample) | ||
| JP2941501B2 (ja) | トリフルオロ−及びクロロジフルオロ−メトキシ−1、3、5−トリアジン及びその製法 |