JPS6133825B2 - - Google Patents
Info
- Publication number
- JPS6133825B2 JPS6133825B2 JP52026583A JP2658377A JPS6133825B2 JP S6133825 B2 JPS6133825 B2 JP S6133825B2 JP 52026583 A JP52026583 A JP 52026583A JP 2658377 A JP2658377 A JP 2658377A JP S6133825 B2 JPS6133825 B2 JP S6133825B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- compound
- acid
- mol
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 22
- YNNGZCVDIREDDK-UHFFFAOYSA-N aminocarbamodithioic acid Chemical compound NNC(S)=S YNNGZCVDIREDDK-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- PISGQDJVSNEGFL-UHFFFAOYSA-N SC1=CN=NO1 Chemical compound SC1=CN=NO1 PISGQDJVSNEGFL-UHFFFAOYSA-N 0.000 claims 1
- 238000007363 ring formation reaction Methods 0.000 claims 1
- -1 cephalosporin compounds Chemical class 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 229930186147 Cephalosporin Natural products 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 229940124587 cephalosporin Drugs 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- VURZDEHEWMEURT-UHFFFAOYSA-L dipotassium;(1z)-n-dithiocarboxy-2-sulfonatoethanehydrazonate Chemical compound [K+].[K+].[O-]S(=O)(=O)CC(/[O-])=N/NC(S)=S VURZDEHEWMEURT-UHFFFAOYSA-L 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- RGVLDGNDUQENKU-UHFFFAOYSA-M potassium;(2-sulfanylidene-3h-1,3,4-oxadiazol-5-yl)methanesulfonate Chemical compound [K+].[O-]S(=O)(=O)CC1=NNC(=S)O1 RGVLDGNDUQENKU-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- YVPPWLBQPPBIGX-UHFFFAOYSA-N 2-ethoxy-2-oxoethanesulfonic acid Chemical compound CCOC(=O)CS(O)(=O)=O YVPPWLBQPPBIGX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- KPCHOCIEAXFUHZ-UHFFFAOYSA-N oxadiazole-4-thiol Chemical class SC1=CON=N1 KPCHOCIEAXFUHZ-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- UDXMZGTZTVULCO-MRXJRLSOSA-N (6R)-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)CS(=O)(=O)O)C(=O)O)C1=O UDXMZGTZTVULCO-MRXJRLSOSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical group COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004285 Potassium sulphite Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SMBBZHGTZJNSRQ-UHFFFAOYSA-N n'-(6,6-dichlorohexyl)methanediimine Chemical compound ClC(Cl)CCCCCN=C=N SMBBZHGTZJNSRQ-UHFFFAOYSA-N 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Chemical group O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
- C07D271/113—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/666,095 US4041162A (en) | 1976-03-11 | 1976-03-11 | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52111590A JPS52111590A (en) | 1977-09-19 |
| JPS6133825B2 true JPS6133825B2 (Direct) | 1986-08-04 |
Family
ID=24672798
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2658377A Granted JPS52111590A (en) | 1976-03-11 | 1977-03-09 | Novel cephalospoline compounds |
Country Status (6)
| Country | Link |
|---|---|
| US (5) | US4041162A (Direct) |
| JP (1) | JPS52111590A (Direct) |
| BE (1) | BE852187A (Direct) |
| DE (1) | DE2710490A1 (Direct) |
| FR (3) | FR2343746A1 (Direct) |
| GB (3) | GB1580481A (Direct) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4079134A (en) * | 1976-09-24 | 1978-03-14 | Smithkline Corporation | 7-Acylamino-3-(5-sulfomethyl-1,3,4-thiadiazol-2-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4083975A (en) * | 1976-09-24 | 1978-04-11 | Smithkline Corporation | 7-Acylamino-3-(3-sulfomethyl-1,2,4-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4223134A (en) * | 1978-11-28 | 1980-09-16 | Eli Lilly And Company | Process for preparing cephalosporin antibiotics |
| AU2002222353A1 (en) * | 2001-12-11 | 2003-06-23 | Orchid Chemicals And Pharmaceuticals Limited | A new method for the preparation of ceftiofur sodium |
| WO2018193387A1 (en) * | 2017-04-19 | 2018-10-25 | Pi Industries Ltd. | Heterocyclic compounds with microbiocidal properties |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL294240A (Direct) * | 1962-06-19 | |||
| US3819623A (en) * | 1968-04-12 | 1974-06-25 | Fujisawa Pharmaceutical Co | 3,7-disubstituted cephalosporin compounds |
| BE759570A (fr) * | 1969-11-28 | 1971-05-27 | Ciba Geigy | Derives de l'acide 7-cyanacetylamino-cephalosporanique et procede pour leur preparation |
| US3867380A (en) * | 1971-02-18 | 1975-02-18 | Smithkline Corp | 3-Heterocyclic thiomethylcephalosporins |
| CH570407A5 (Direct) * | 1972-03-29 | 1975-12-15 | Ciba Geigy Ag | |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3946005A (en) * | 1972-11-14 | 1976-03-23 | Smithkline Corporation | 7-Amino-3-(1,2,4-triazolinylthiomethyl)cephalosporins |
| US3957768A (en) * | 1972-11-14 | 1976-05-18 | Smithkline Corporation | 3-heterocyclicthiomethylcephalosporins |
| US3943129A (en) * | 1972-11-14 | 1976-03-09 | Smithkline Corporation | 7-Amino-3-(1,3,4-thiadiazolinylthio-methyl) cephalosporins |
| CA1022544A (en) * | 1972-12-21 | 1977-12-13 | Yukiyasu Murakami | Process of preparing a heterocyclic acyl group-substituted cephalosporin derivative |
| GB1478055A (en) | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
| US3883520A (en) * | 1973-08-17 | 1975-05-13 | Smithkline Corp | Substituted mercaptoacetamidocephalosporins |
| US3962232A (en) * | 1973-11-05 | 1976-06-08 | Eli Lilly And Company | 7-methoxycephalosporins |
| NZ176206A (en) * | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins |
| JPS57873B2 (Direct) | 1973-12-25 | 1982-01-08 | ||
| GB1509074A (en) | 1974-04-05 | 1978-04-26 | Yamanouchi Pharma Co Ltd | Cephalosporin derivatives |
| JPS51115493A (en) * | 1975-03-18 | 1976-10-12 | Smithkline Corp | Novel cephalosporine compound |
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
-
1976
- 1976-03-11 US US05/666,095 patent/US4041162A/en not_active Expired - Lifetime
-
1977
- 1977-03-07 BE BE175559A patent/BE852187A/xx not_active IP Right Cessation
- 1977-03-08 GB GB9724/77A patent/GB1580481A/en not_active Expired
- 1977-03-08 GB GB26757/79A patent/GB1580483A/en not_active Expired
- 1977-03-08 GB GB26610/79A patent/GB1580482A/en not_active Expired
- 1977-03-09 JP JP2658377A patent/JPS52111590A/ja active Granted
- 1977-03-10 DE DE19772710490 patent/DE2710490A1/de not_active Ceased
- 1977-03-10 FR FR7707181A patent/FR2343746A1/fr active Granted
- 1977-04-25 US US05/790,715 patent/US4130644A/en not_active Expired - Lifetime
- 1977-04-25 US US05/790,738 patent/US4112088A/en not_active Expired - Lifetime
- 1977-04-25 US US05/790,716 patent/US4067880A/en not_active Expired - Lifetime
- 1977-04-25 US US05/790,717 patent/US4138556A/en not_active Expired - Lifetime
- 1977-08-31 FR FR7726413A patent/FR2355840A1/fr active Granted
- 1977-08-31 FR FR7726412A patent/FR2355847A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2355840B1 (Direct) | 1980-04-11 |
| FR2343746B1 (Direct) | 1980-10-10 |
| US4112088A (en) | 1978-09-05 |
| JPS52111590A (en) | 1977-09-19 |
| GB1580483A (en) | 1980-12-03 |
| BE852187A (fr) | 1977-09-07 |
| FR2355840A1 (fr) | 1978-01-20 |
| US4041162A (en) | 1977-08-09 |
| US4138556A (en) | 1979-02-06 |
| DE2710490A1 (de) | 1977-09-22 |
| US4067880A (en) | 1978-01-10 |
| GB1580482A (en) | 1980-12-03 |
| FR2355847A1 (fr) | 1978-01-20 |
| US4130644A (en) | 1978-12-19 |
| FR2343746A1 (fr) | 1977-10-07 |
| GB1580481A (en) | 1980-12-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4142046A (en) | Intermediates for the preparation of 7-acyl-3-(substituted triazolylthiomethyl)cephalosporins | |
| US4025626A (en) | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins | |
| JPS6133825B2 (Direct) | ||
| EP0289002B1 (en) | Novel cephalosporin compounds and antibacterial agents | |
| JPH0633281B2 (ja) | 新規セファロスポリン化合物及び抗菌剤 | |
| US4131734A (en) | 7β-Acyloxy-3-heterocyclicthiomethyl cephalosporins | |
| US4101656A (en) | 7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4126682A (en) | 7-acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins and antibacterial compositions and methods employing them | |
| DE2619243C2 (de) | Verfahren zur Herstellung von 3-Acyloxymethyl-cephem-Verbindungen | |
| EP0000100B1 (en) | 7-acylamino-3-(1-(2-sulfamoylaminoethyl)-tetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids, a process for their preparation and compositions containing them | |
| US4117124A (en) | 7-Acylamino-3-[[3-(carboxymethyl)thio-1H-1,2,4-triazol-5-yl]thiomethyl]-3-cephem-4-carboxylic acids | |
| US4236001A (en) | 7β-Acyloxy-3-heterocyclicthiomethyl cephalosporins | |
| JPS6026800B2 (ja) | 新規な7α−メトキシセフアロスポリン類およびその製造法 | |
| US4111981A (en) | Intermediates for preparing substituted phenylglycylcephalosporins | |
| US4218564A (en) | 7β-Hydroxy-3-heterocyclicthio-methyl cephalosporin intermediates | |
| JPS6156238B2 (Direct) | ||
| US4171362A (en) | 7-Acylamino-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4118491A (en) | 7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4044047A (en) | Intermediates for preparing substituted phenylglycylcephalosporins | |
| US4171368A (en) | 7-Acylamino-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4022895A (en) | Substituted phenylglycylcephalosporins | |
| US4171433A (en) | 7-Amino-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporin intermediates for preparing 7-acylamino cephalosporins | |
| US4013764A (en) | Pharmaceutical compositions comprising substituted phenylglycylcephalosporins and methods of treating bacterial infections | |
| IE43541B1 (en) | Cephem compounds | |
| DE2724092A1 (de) | Cephalosporine, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |