JPS5853025B2 - 1:2− クロムサクセンリヨウノ セイホウ - Google Patents
1:2− クロムサクセンリヨウノ セイホウInfo
- Publication number
- JPS5853025B2 JPS5853025B2 JP49141100A JP14110074A JPS5853025B2 JP S5853025 B2 JPS5853025 B2 JP S5853025B2 JP 49141100 A JP49141100 A JP 49141100A JP 14110074 A JP14110074 A JP 14110074A JP S5853025 B2 JPS5853025 B2 JP S5853025B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- formula
- groups
- dye
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052804 chromium Inorganic materials 0.000 claims description 23
- 239000011651 chromium Substances 0.000 claims description 23
- -1 phenylazo group Chemical group 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 claims description 4
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical group C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 4
- 230000008878 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- XRZDIHADHZSFBB-UHFFFAOYSA-N 3-oxo-n,3-diphenylpropanamide Chemical compound C=1C=CC=CC=1NC(=O)CC(=O)C1=CC=CC=C1 XRZDIHADHZSFBB-UHFFFAOYSA-N 0.000 claims description 3
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 claims description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- KBUWQCXQODASRJ-UHFFFAOYSA-N 6-hydroxy-5-methyl-1h-pyridin-2-one Chemical compound CC1=CC=C(O)N=C1O KBUWQCXQODASRJ-UHFFFAOYSA-N 0.000 claims 1
- 150000002500 ions Chemical class 0.000 claims 1
- 239000000975 dye Substances 0.000 description 55
- 238000000034 method Methods 0.000 description 16
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 12
- 239000004952 Polyamide Substances 0.000 description 10
- 125000003545 alkoxy group Chemical group 0.000 description 10
- 238000004043 dyeing Methods 0.000 description 10
- 229920002647 polyamide Polymers 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 210000002268 wool Anatomy 0.000 description 8
- 150000001299 aldehydes Chemical class 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229940124530 sulfonamide Drugs 0.000 description 6
- 240000007817 Olea europaea Species 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 125000004442 acylamino group Chemical group 0.000 description 5
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 239000000987 azo dye Substances 0.000 description 4
- 229950011260 betanaphthol Drugs 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- LJAOOBNHPFKCDR-UHFFFAOYSA-K chromium(3+) trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] LJAOOBNHPFKCDR-UHFFFAOYSA-K 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 229960003742 phenol Drugs 0.000 description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 125000000565 sulfonamide group Chemical group 0.000 description 4
- 125000001174 sulfone group Chemical group 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 125000005236 alkanoylamino group Chemical group 0.000 description 3
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 230000000536 complexating effect Effects 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- WZUODJNEIXSNEU-UHFFFAOYSA-N 2-Hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(O)=C1 WZUODJNEIXSNEU-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- ILEIUTCVWLYZOM-UHFFFAOYSA-N 2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC=C(O)C(C=O)=C1 ILEIUTCVWLYZOM-UHFFFAOYSA-N 0.000 description 2
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 2
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 2
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000001845 chromium compounds Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-dioxonaphthalene Natural products C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- LLSNTRRAZWBTCK-UHFFFAOYSA-N 1-(3-hydroxynaphthalen-1-yl)ethanone Chemical compound C1=CC=C2C(C(=O)C)=CC(O)=CC2=C1 LLSNTRRAZWBTCK-UHFFFAOYSA-N 0.000 description 1
- IWRHUCBSLVVLJD-UHFFFAOYSA-N 1-(6-hydroxynaphthalen-2-yl)ethanone Chemical compound C1=C(O)C=CC2=CC(C(=O)C)=CC=C21 IWRHUCBSLVVLJD-UHFFFAOYSA-N 0.000 description 1
- ISNBNFDDASNNHS-UHFFFAOYSA-N 1-(dimethylsulfamoylamino)-7-hydroxynaphthalene Chemical compound C1=C(O)C=C2C(NS(=O)(=O)N(C)C)=CC=CC2=C1 ISNBNFDDASNNHS-UHFFFAOYSA-N 0.000 description 1
- AIDFJGKWTOULTC-UHFFFAOYSA-N 1-butylsulfonylbutane Chemical compound CCCCS(=O)(=O)CCCC AIDFJGKWTOULTC-UHFFFAOYSA-N 0.000 description 1
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- QQDKXJSYZGJGKJ-UHFFFAOYSA-N 2-amino-3,4,6-trichlorophenol Chemical compound NC1=C(O)C(Cl)=CC(Cl)=C1Cl QQDKXJSYZGJGKJ-UHFFFAOYSA-N 0.000 description 1
- UVIBWGFLURLRHR-UHFFFAOYSA-N 2-amino-4,5-dichlorophenol Chemical compound NC1=CC(Cl)=C(Cl)C=C1O UVIBWGFLURLRHR-UHFFFAOYSA-N 0.000 description 1
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 1
- TUADYTFWZPZZTP-UHFFFAOYSA-N 2-amino-4-methoxyphenol Chemical compound COC1=CC=C(O)C(N)=C1 TUADYTFWZPZZTP-UHFFFAOYSA-N 0.000 description 1
- RDFIUQJNELYXKG-UHFFFAOYSA-N 2-amino-5-chloro-4-methoxyphenol Chemical compound COC1=CC(N)=C(O)C=C1Cl RDFIUQJNELYXKG-UHFFFAOYSA-N 0.000 description 1
- AACMNEWXGKOJJK-UHFFFAOYSA-N 2-amino-6-nitrophenol Chemical compound NC1=CC=CC([N+]([O-])=O)=C1O AACMNEWXGKOJJK-UHFFFAOYSA-N 0.000 description 1
- ZMXYNJXDULEQCK-UHFFFAOYSA-N 2-amino-p-cresol Chemical compound CC1=CC=C(O)C(N)=C1 ZMXYNJXDULEQCK-UHFFFAOYSA-N 0.000 description 1
- OCBRMKSDSMYVKP-UHFFFAOYSA-N 2-aminophenol;4-(phenylcarbamoyl)anthracene-1-sulfonic acid Chemical compound NC1=CC=CC=C1O.C12=CC3=CC=CC=C3C=C2C(S(=O)(=O)O)=CC=C1C(=O)NC1=CC=CC=C1 OCBRMKSDSMYVKP-UHFFFAOYSA-N 0.000 description 1
- LNEVUNYUJNORRV-UHFFFAOYSA-N 2-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(Cl)=C1 LNEVUNYUJNORRV-UHFFFAOYSA-N 0.000 description 1
- WTHUWXPBPNTSHJ-UHFFFAOYSA-N 2-hydroxy-3,6-dimethylbenzaldehyde Chemical compound CC1=CC=C(C)C(C=O)=C1O WTHUWXPBPNTSHJ-UHFFFAOYSA-N 0.000 description 1
- IHFRMUGEILMHNU-UHFFFAOYSA-N 2-hydroxy-5-nitrobenzaldehyde Chemical compound OC1=CC=C([N+]([O-])=O)C=C1C=O IHFRMUGEILMHNU-UHFFFAOYSA-N 0.000 description 1
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 1
- ZEWCASRNRWXXSO-UHFFFAOYSA-N 3-amino-4-hydroxybenzonitrile Chemical compound NC1=CC(C#N)=CC=C1O ZEWCASRNRWXXSO-UHFFFAOYSA-N 0.000 description 1
- OEUMLWRWURKDRL-UHFFFAOYSA-N 3-chloro-2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC(Cl)=C(O)C(C=O)=C1 OEUMLWRWURKDRL-UHFFFAOYSA-N 0.000 description 1
- BOTGCZBEERTTDQ-UHFFFAOYSA-N 4-Methoxy-1-naphthol Chemical compound C1=CC=C2C(OC)=CC=C(O)C2=C1 BOTGCZBEERTTDQ-UHFFFAOYSA-N 0.000 description 1
- WJASNMAUXFNVNB-UHFFFAOYSA-N 4-chloro-2-hydroxy-5-nitrobenzaldehyde Chemical compound OC1=CC(Cl)=C([N+]([O-])=O)C=C1C=O WJASNMAUXFNVNB-UHFFFAOYSA-N 0.000 description 1
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 1
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 1
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 4-methoxyguaiacol Natural products COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 1
- KEGNUIZNBCHWLZ-UHFFFAOYSA-N 5,8-dichloronaphthalen-1-ol Chemical compound C1=CC(Cl)=C2C(O)=CC=CC2=C1Cl KEGNUIZNBCHWLZ-UHFFFAOYSA-N 0.000 description 1
- RMXFTNYYIDMHAB-UHFFFAOYSA-N 5-butyl-2-hydroxybenzaldehyde Chemical compound CCCCC1=CC=C(O)C(C=O)=C1 RMXFTNYYIDMHAB-UHFFFAOYSA-N 0.000 description 1
- NSKZAOKQZDLHGO-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(Cl)=CC(C=O)=C1O NSKZAOKQZDLHGO-UHFFFAOYSA-N 0.000 description 1
- IPZJPYHEVWLBNH-UHFFFAOYSA-N 5-chloronaphthalen-1-ol Chemical compound C1=CC=C2C(O)=CC=CC2=C1Cl IPZJPYHEVWLBNH-UHFFFAOYSA-N 0.000 description 1
- GSUBEKBKJCYWBJ-UHFFFAOYSA-N 6-methylnaphthalen-2-amine Chemical compound C1=C(N)C=CC2=CC(C)=CC=C21 GSUBEKBKJCYWBJ-UHFFFAOYSA-N 0.000 description 1
- TWLMSPNQBKSXOP-UHFFFAOYSA-N 6358-09-4 Chemical compound NC1=CC([N+]([O-])=O)=CC(Cl)=C1O TWLMSPNQBKSXOP-UHFFFAOYSA-N 0.000 description 1
- KVHHMYZBFBSVDI-UHFFFAOYSA-N 8-aminonaphthalen-2-ol Chemical compound C1=C(O)C=C2C(N)=CC=CC2=C1 KVHHMYZBFBSVDI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000134630 Cordia sebestena Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 101150012845 RHO2 gene Proteins 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- DCDIOQFWUFOPJE-UHFFFAOYSA-N butan-1-olate;chromium(3+) Chemical compound [Cr+3].CCCC[O-].CCCC[O-].CCCC[O-] DCDIOQFWUFOPJE-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- QOWZHEWZFLTYQP-UHFFFAOYSA-K chromium(3+);triformate Chemical compound [Cr+3].[O-]C=O.[O-]C=O.[O-]C=O QOWZHEWZFLTYQP-UHFFFAOYSA-K 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000010026 decatizing Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- KJADDPWIRVBKPZ-UHFFFAOYSA-N ethyl n-(7-hydroxynaphthalen-1-yl)carbamate Chemical compound C1=C(O)C=C2C(NC(=O)OCC)=CC=CC2=C1 KJADDPWIRVBKPZ-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- HGVIAKXYAZRSEG-UHFFFAOYSA-N n-(2,4-dimethylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(C)C=C1C HGVIAKXYAZRSEG-UHFFFAOYSA-N 0.000 description 1
- IYGXQHCKSGMPRG-UHFFFAOYSA-N n-(3-amino-4-hydroxy-5-nitrophenyl)acetamide Chemical compound CC(=O)NC1=CC(N)=C(O)C([N+]([O-])=O)=C1 IYGXQHCKSGMPRG-UHFFFAOYSA-N 0.000 description 1
- ALEBAWIMALZDCP-UHFFFAOYSA-N n-(3-amino-5-chloro-2-hydroxyphenyl)acetamide Chemical compound CC(=O)NC1=CC(Cl)=CC(N)=C1O ALEBAWIMALZDCP-UHFFFAOYSA-N 0.000 description 1
- ALNWQAFPXMGLTJ-UHFFFAOYSA-N n-(7-hydroxynaphthalen-1-yl)acetamide Chemical compound C1=C(O)C=C2C(NC(=O)C)=CC=CC2=C1 ALNWQAFPXMGLTJ-UHFFFAOYSA-N 0.000 description 1
- IJNQJQRKLLCLMC-UHFFFAOYSA-N n-methylnaphthalen-2-amine Chemical compound C1=CC=CC2=CC(NC)=CC=C21 IJNQJQRKLLCLMC-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- KQTXINGLCJCFJE-UHFFFAOYSA-N propyl n-(7-hydroxynaphthalen-1-yl)carbamate Chemical compound C1=C(O)C=C2C(NC(=O)OCCC)=CC=CC2=C1 KQTXINGLCJCFJE-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B55/00—Azomethine dyes
- C09B55/001—Azomethine dyes forming a 1,2 complex metal compound, e.g. with Co or Cr, with an other dye, e.g. with an azo or azomethine dye
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/14—Monoazo compounds
- C09B45/16—Monoazo compounds containing chromium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1719673A CH584274A5 (enExample) | 1973-12-07 | 1973-12-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5087418A JPS5087418A (enExample) | 1975-07-14 |
| JPS5853025B2 true JPS5853025B2 (ja) | 1983-11-26 |
Family
ID=4423508
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP49141100A Expired JPS5853025B2 (ja) | 1973-12-07 | 1974-12-07 | 1:2− クロムサクセンリヨウノ セイホウ |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3978037A (enExample) |
| JP (1) | JPS5853025B2 (enExample) |
| BE (1) | BE823044A (enExample) |
| CA (1) | CA1035770A (enExample) |
| CH (1) | CH584274A5 (enExample) |
| DD (1) | DD116253A5 (enExample) |
| DE (1) | DE2457590C2 (enExample) |
| ES (1) | ES432660A1 (enExample) |
| FR (1) | FR2253792B1 (enExample) |
| GB (1) | GB1487356A (enExample) |
| SU (1) | SU556734A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4145339A (en) * | 1976-04-24 | 1979-03-20 | Hoechst Aktiengesellschaft | Water-soluble 1:2-cobalt complex dyestuffs of an azomethine and of an azo compound |
| DE3034002A1 (de) | 1980-09-10 | 1982-04-22 | Basf Ag, 6700 Ludwigshafen | Sulfonsaeuregruppenhaltige 1 zu 2-chromkomplexfarbstoffe |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA558620A (en) * | 1958-06-10 | Schetty Guido | Azo dyestuffs containing heavy metal | |
| CA511437A (en) * | 1955-03-29 | Steinemann Willy | Metallizable monoazo dyestuffs | |
| US3189594A (en) * | 1965-06-15 | Oh xsojxnhx chjxo chjxohx chi chi | ||
| US2711404A (en) * | 1951-01-11 | 1955-06-21 | Geigy Ag J R | Brown chrome containing dyestuffs |
| US2814614A (en) * | 1953-04-02 | 1957-11-26 | Ciba Ltd | New conversion products of azo dyestuffs containing metal compounds in complex union |
| US2855393A (en) * | 1953-11-26 | 1958-10-07 | Geigy Ag J R | Chromium containing dyestuffs |
| US2985646A (en) * | 1957-03-14 | 1961-05-23 | Geigy Ag J R | Chromium-containing dyestuffs |
| CH352432A (de) * | 1957-03-14 | 1961-02-28 | Geigy Ag J R | Verfahren zur Herstellung von wasserlöslichen chromhaltigen Farbstoffen |
| GB924452A (en) * | 1959-08-13 | 1963-04-24 | Ciba Ltd | Metalliferous azo-dyestuffs and process for their manufacture |
| BE629818A (enExample) * | 1963-03-19 | |||
| CH443518A (de) * | 1964-07-31 | 1967-09-15 | Geigy Ag J R | Verfahren zur Herstellung wasserlöslicher chromhaltiger Farbstoffe |
| CH492002A (de) * | 1967-11-29 | 1970-06-15 | Geigy Ag J R | Verfahren zur Herstellung von Chromkomplexfarbstoffen |
-
1973
- 1973-12-07 CH CH1719673A patent/CH584274A5/xx not_active IP Right Cessation
-
1974
- 1974-12-03 FR FR7439493A patent/FR2253792B1/fr not_active Expired
- 1974-12-04 US US05/529,670 patent/US3978037A/en not_active Expired - Lifetime
- 1974-12-04 SU SU2080816A patent/SU556734A3/ru active
- 1974-12-05 CA CA215,305A patent/CA1035770A/en not_active Expired
- 1974-12-05 DE DE2457590A patent/DE2457590C2/de not_active Expired
- 1974-12-05 DD DD182812A patent/DD116253A5/xx unknown
- 1974-12-06 BE BE151238A patent/BE823044A/xx not_active IP Right Cessation
- 1974-12-06 ES ES432660A patent/ES432660A1/es not_active Expired
- 1974-12-06 GB GB52914/74A patent/GB1487356A/en not_active Expired
- 1974-12-07 JP JP49141100A patent/JPS5853025B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2253792B1 (enExample) | 1977-03-25 |
| BE823044A (fr) | 1975-06-06 |
| JPS5087418A (enExample) | 1975-07-14 |
| ES432660A1 (es) | 1976-12-16 |
| GB1487356A (en) | 1977-09-28 |
| US3978037A (en) | 1976-08-31 |
| DE2457590A1 (de) | 1975-06-12 |
| SU556734A3 (ru) | 1977-04-30 |
| CH584274A5 (enExample) | 1977-01-31 |
| DD116253A5 (enExample) | 1975-11-12 |
| FR2253792A1 (enExample) | 1975-07-04 |
| CA1035770A (en) | 1978-08-01 |
| DE2457590C2 (de) | 1984-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2806760A (en) | Process for dyeing nitrogenous fibers with metalliferous monoazo dyestuffs | |
| US2985646A (en) | Chromium-containing dyestuffs | |
| CA1059997A (en) | Chromium complex dyes, their manufacture and use | |
| US4150942A (en) | 1:2 Metal complexes of azo compounds having 1-hydroxynaphthalene-3-sulfonic acid coupling component radicals at least one of which is a disazo compound | |
| EP0278910B1 (de) | Schwermetallkomplexfarbstoffe, deren Herstellung und Verwendung | |
| US3516980A (en) | Heterogeneous 1:2 cobalt or chromium complex azo dyestuffs | |
| US3221003A (en) | Chrgmium cqmplex mixed azo dyestuffs | |
| JPS5853025B2 (ja) | 1:2− クロムサクセンリヨウノ セイホウ | |
| US3516979A (en) | Heterogenous 1:2 metal complexes of monoazo dyes | |
| US2749332A (en) | Metalliferous azo-dyestuffs | |
| JPH0778181B2 (ja) | ポリアゾ染料のクロム錯体 | |
| US2820784A (en) | Soichi | |
| US3144437A (en) | Chromium and cobalt complex compounds of monoazo dyestuffs | |
| US3925346A (en) | Mixed chromium-containing azo dyestuffs containing, per atom of chromium, one molecule of an o,o'-dihydroxy-sulphophenylene-azo-naphthalene and one molecule of an -o-hydroxyphenylene-azo-acetoacetamide | |
| JPH0521152B2 (enExample) | ||
| US2813853A (en) | Monoazo dyestuffs and metal complex compounds thereof | |
| US3213077A (en) | Metallized azo dyes | |
| US2784179A (en) | Metalliferous azo-dyestuffs | |
| US2933490A (en) | Chromium-containing azo dyestuffs | |
| US2852502A (en) | Half metal complexes of acylacetonitrile azo dyes containing the sulfonamide group | |
| US4013630A (en) | Chromium complex disazo dyes | |
| US2802817A (en) | Monoazo dyestuffs | |
| US1959507A (en) | Ortho-hydroxyazo-dyestuffs containing chromium and process of making same | |
| EP0009466A1 (de) | 1 : 2-Bis-chromkomplexfarbstoffe aus Polyazo- oder Disazo-azomethinverbindungen, deren Herstellung und Verwendung | |
| US4625017A (en) | Metal complexes of azo dyes containing a 2-(P-N-aceloacetylaminophenyl) benzothiozole moiety |