JPS57159730A - 3-(trans-4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene - Google Patents
3-(trans-4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzeneInfo
- Publication number
- JPS57159730A JPS57159730A JP4606581A JP4606581A JPS57159730A JP S57159730 A JPS57159730 A JP S57159730A JP 4606581 A JP4606581 A JP 4606581A JP 4606581 A JP4606581 A JP 4606581A JP S57159730 A JPS57159730 A JP S57159730A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- trans
- formula
- chlorobenzene
- cyclohexyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 title 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 2
- IKNKLQFEARKTTG-KBQPQWKXSA-N C(CCCCCC)[C@@H]1CC[C@H](CC1)[C@@H]1CC[C@H](CC1)C=1C=C(C=CC=1)Cl Chemical compound C(CCCCCC)[C@@H]1CC[C@H](CC1)[C@@H]1CC[C@H](CC1)C=1C=C(C=CC=1)Cl IKNKLQFEARKTTG-KBQPQWKXSA-N 0.000 abstract 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000004973 liquid crystal related substance Substances 0.000 abstract 1
- 229910052749 magnesium Inorganic materials 0.000 abstract 1
- 239000011777 magnesium Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 abstract 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4606581A JPS57159730A (en) | 1981-03-28 | 1981-03-28 | 3-(trans-4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene |
| US06/302,517 US4405488A (en) | 1980-10-09 | 1981-09-16 | Liquid-crystalline halogenobenzene derivatives |
| DE3139130A DE3139130C2 (de) | 1980-10-09 | 1981-10-01 | Flüssigkristalline Halogenbenzolderivate und diese Verbindungen enthaltende Flüssigkristallzusammensetzungen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4606581A JPS57159730A (en) | 1981-03-28 | 1981-03-28 | 3-(trans-4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57159730A true JPS57159730A (en) | 1982-10-01 |
| JPS6348252B2 JPS6348252B2 (enExample) | 1988-09-28 |
Family
ID=12736596
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4606581A Granted JPS57159730A (en) | 1980-10-09 | 1981-03-28 | 3-(trans-4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57159730A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4415470A (en) * | 1980-11-10 | 1983-11-15 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Liquid crystalline fluorine-containing cyclohexylbiphenyls and dielectrics and electro-optical display elements based thereon |
| US4419264A (en) * | 1981-04-30 | 1983-12-06 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Fluorine-containing 4,4'-bis-(cyclohexyl)-biphenyl derivatives, and dielectrics and electro-optical display elements containing them |
-
1981
- 1981-03-28 JP JP4606581A patent/JPS57159730A/ja active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4415470A (en) * | 1980-11-10 | 1983-11-15 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Liquid crystalline fluorine-containing cyclohexylbiphenyls and dielectrics and electro-optical display elements based thereon |
| US4545922A (en) * | 1980-11-10 | 1985-10-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Liquid crystalline fluorine-containing cyclohexylbiphenyls and dielectrics and electro-optical display elements based thereon |
| US4419264A (en) * | 1981-04-30 | 1983-12-06 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Fluorine-containing 4,4'-bis-(cyclohexyl)-biphenyl derivatives, and dielectrics and electro-optical display elements containing them |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6348252B2 (enExample) | 1988-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57165328A (en) | 4-substituted-(trans-4'-(trans-4"-alkylcylohexyl) cyclohexyl)benzene | |
| JPS57118526A (en) | Dicyclohexylethane derivative | |
| JPS5721359A (en) | 4'''-cyano-4"-biphenylyl 4-(trans-4'-alkylcyclohexyl)benzoate | |
| JPS574960A (en) | 4'''-cyanobiphenyl trans-4-(trans-4'-alkylcyclohexyl)- cyclohexanecarboxylate | |
| JPS57159730A (en) | 3-(trans-4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene | |
| JPS57154135A (en) | 1,2-difluoro-4-(trans-4'-(trans-4"-alkylcyclohexyl)cyclo- hexyl)benzene | |
| JPS57165326A (en) | Trans-4-alkyl-(4'-fluorobiphenyl-4)cyclohexane | |
| JPS57114531A (en) | 4-(trans 4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene | |
| JPS56108740A (en) | Liquid crystalline substance | |
| JPS57171936A (en) | Trans-4-(trans-4'-alkylcyclohexyl)cyclohexanole derivative | |
| JPS57159725A (en) | 4-substituted-(trans-4'-(4"-alkylphenyl)cyclohexyl) benzene | |
| JPS572226A (en) | Trans-4-alkyl-4'-halogenophenylcyclohexane | |
| JPS54101784A (en) | Liquid crystal composition | |
| JPS56118481A (en) | Nematic liquid crystal composition | |
| JPS5749688A (en) | Liquid crystal display element | |
| JPS5740581A (en) | Liquid crystal composition | |
| JPS57114530A (en) | 4-(4'-(trans-4"-alkylcyclohexyl)cyclohexen-1'-yl) chlorobenzene | |
| JPS57139074A (en) | P-(trans-5-alkyl-1,3-dioxane-2-yl)phenyl p- halogenobenzoate | |
| JPS5775939A (en) | 3-(trans-4"-alkylcyclohexyl)cyclohexyl) fluorobenzene | |
| JPS57185230A (en) | 3,4-difluoro-4'-(trans-4"-alkylcyclohexyl)biphenyl | |
| JPS574927A (en) | 4'-substituted-1'-cyclohexen-1'-yl-4-fluorobenzene | |
| JPS57165327A (en) | 4-substituted-(4'-(trans-4"-alkylcylohexyl)cyclohexene- 1'-yl)benzene | |
| JPS6436A (en) | Cyclohexane derivative | |
| JPS5795933A (en) | Trans-4-alkylcyclohexylmethyl-4'-(4"-fluorophenyl) phenyl ether | |
| JPS5683449A (en) | Cyclohexanecarboxylic acid cyclohexyl ester derivative |