JPS5625165A - Novel imidazole derivative - Google Patents
Novel imidazole derivativeInfo
- Publication number
- JPS5625165A JPS5625165A JP10168479A JP10168479A JPS5625165A JP S5625165 A JPS5625165 A JP S5625165A JP 10168479 A JP10168479 A JP 10168479A JP 10168479 A JP10168479 A JP 10168479A JP S5625165 A JPS5625165 A JP S5625165A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- carbamoyl
- derivative
- reactive derivative
- imidazole derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000002460 imidazoles Chemical class 0.000 title 1
- 239000002253 acid Substances 0.000 abstract 2
- -1 5-Carbamoyl-1H-imidazol-4-yl Chemical group 0.000 abstract 1
- 150000008065 acid anhydrides Chemical class 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 230000000843 anti-fungal effect Effects 0.000 abstract 1
- 230000003356 anti-rheumatic effect Effects 0.000 abstract 1
- 230000000840 anti-viral effect Effects 0.000 abstract 1
- 229940121375 antifungal agent Drugs 0.000 abstract 1
- 239000003435 antirheumatic agent Substances 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 230000003327 cancerostatic effect Effects 0.000 abstract 1
- 150000001735 carboxylic acids Chemical class 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 150000004820 halides Chemical class 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 230000001506 immunosuppresive effect Effects 0.000 abstract 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 abstract 1
- 229910052753 mercury Inorganic materials 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 229940049964 oleate Drugs 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 abstract 1
Abstract
NEW MATERIAL:Imidazole derivatives of the formula [R is heteroaroyl containing N, S and O which is unsubstituted or substituted with alkyl, aralkyl, acyl, halogen] or their acid adducts.
EXAMPLE: 5-Carbamoyl-1H-imidazol-4-yl furan-2'-carboxylate.
USE: Carcinostatic, immunosuppressive, antibacteial, antifungal, antiviral and antirheumatic.
PREPARATION: The reaction between 4-carbamoyl-imidazolium-5-oleate or its reactive derivative such trimethylsilyl, trialkyltin derivative or mercury or silver salt and a reactive derivative of a carboxylic acid represented by the formula: ROH such as acid halide, mixed acid anhydride or active ester affords the compound of the formula.
COPYRIGHT: (C)1981,JPO&Japio
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10168479A JPS5625165A (en) | 1979-08-08 | 1979-08-08 | Novel imidazole derivative |
| AU60947/80A AU530916B2 (en) | 1979-08-08 | 1980-07-31 | 4-carbamoyl imidazolium-5-olate derivatives |
| CA000357556A CA1151651A (en) | 1979-08-08 | 1980-08-01 | Antitumor and immunosuppressive 4-carbamoyl imidazolium-5-olate derivatives, pharmaceutical composition and production thereof |
| US06/175,688 US4317825A (en) | 1979-08-08 | 1980-08-05 | Antitumor and immunosuppressive 4-carbamoyl imidazolium-5-olate derivatives |
| AT80302716T ATE3287T1 (en) | 1979-08-08 | 1980-08-07 | ANTITUMORIC AND IMMUNOSUPPRESSIVE 4CARBAMOYLIMIDAZOLIUM-5-OLATE DERIVATIVES, PHARMACEUTICAL COMPOSITION AND THEIR PREPARATION. |
| DK340480A DK340480A (en) | 1979-08-08 | 1980-08-07 | 4-CARBAMOYLIMIDAZOLIUM-5-OLATE DERIVATIVES AND THEIR PREPARATION AND USE |
| EP80302716A EP0024172B1 (en) | 1979-08-08 | 1980-08-07 | Antitumor and immunosuppressive 4-carbamoylimidazolium-5-olate derivatives, pharmaceutical composition and production thereof |
| DE8080302716T DE3063136D1 (en) | 1979-08-08 | 1980-08-07 | Antitumor and immunosuppressive 4-carbamoylimidazolium-5-olate derivatives, pharmaceutical composition and production thereof |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10168479A JPS5625165A (en) | 1979-08-08 | 1979-08-08 | Novel imidazole derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS5625165A true JPS5625165A (en) | 1981-03-10 |
Family
ID=14307162
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP10168479A Pending JPS5625165A (en) | 1979-08-08 | 1979-08-08 | Novel imidazole derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5625165A (en) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013047758A1 (en) * | 2011-09-28 | 2013-04-04 | 富士フイルム株式会社 | Crystal of 5-hydroxy-1h-imidazole-4-carboxamide hydrate, crystal of 5-hydroxy-1h-imidazole-4-carboxamide 3/4 hydrate, and method for producing same |
| JP2013082708A (en) * | 2011-09-28 | 2013-05-09 | Fujifilm Corp | Crystal of 5-hydroxy-1h-imidazole-4-carboxamide 3/4 hydrate, and method for producing the same |
| JP2013082706A (en) * | 2011-09-28 | 2013-05-09 | Fujifilm Corp | Crystal of 5-hydroxy-1h-imidazole-4-carboxamide hydrate |
-
1979
- 1979-08-08 JP JP10168479A patent/JPS5625165A/en active Pending
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013047758A1 (en) * | 2011-09-28 | 2013-04-04 | 富士フイルム株式会社 | Crystal of 5-hydroxy-1h-imidazole-4-carboxamide hydrate, crystal of 5-hydroxy-1h-imidazole-4-carboxamide 3/4 hydrate, and method for producing same |
| JP2013082708A (en) * | 2011-09-28 | 2013-05-09 | Fujifilm Corp | Crystal of 5-hydroxy-1h-imidazole-4-carboxamide 3/4 hydrate, and method for producing the same |
| JP2013082706A (en) * | 2011-09-28 | 2013-05-09 | Fujifilm Corp | Crystal of 5-hydroxy-1h-imidazole-4-carboxamide hydrate |
| JP2015110644A (en) * | 2011-09-28 | 2015-06-18 | 富士フイルム株式会社 | Crystals of 5-hydroxy-1h-imidazole-4-carboxamide 3/4 hydrate and method for producing the same |
| US9108928B2 (en) | 2011-09-28 | 2015-08-18 | Fujifilm Corporation | Crystal of 5-hydroxy-1H-imidazole-4-carboxamide 3/4 hydrate, method for producing the same and crystal of 5-hydroxy-1H-imidazole-4-carboxamide hydrate |
| US9567303B2 (en) | 2011-09-28 | 2017-02-14 | Fujifilm Corporation | Crystal of 5-hydroxy-1H-imidazole-4-carboxamide hydrate and pharmaceutical composition thereof |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5297950A (en) | Chalconeether derivatives | |
| JPS5432460A (en) | Cycloalkylidenemethylphenylacetic acid derivative and their preparation | |
| JPS5625165A (en) | Novel imidazole derivative | |
| JPS57163369A (en) | Novel geldanamycin derivative, its preparation, and drug comprising it as active ingredient | |
| JPS5225740A (en) | Preparation of o-acyl-amidinophenols or acid addition salts thereof | |
| JPS559060A (en) | Thia(oxa)zolidinecarboxylic acid derivative and its prepatation | |
| JPS523046A (en) | Prepration of 4-homotwistane-3-carboxylic acid esters | |
| JPS56154427A (en) | Novel 2-phenylpropyl ether derivative, its preparation and insecticide and miticide with low toxicity to fish containing the same | |
| JPS5427546A (en) | Liquid crystal compound | |
| JPS5273842A (en) | Preparation of 2,2-dimethyl-3-)alpha-hydroxy-alphe-trihalogenomethylme thyl) -cyclopropane carboxylic acid derivatives | |
| JPS5359664A (en) | Novel imidazole derivatives | |
| JPS5265299A (en) | Synthesis of 2-substituted-thioadenosine-n-oxides | |
| JPS5427578A (en) | 1-carboxyalkylcarbamoyl-5-fluorouracil derivatives and their preparation | |
| JPS554334A (en) | Pyranopyrazole derivative | |
| JPS5262295A (en) | Preparation of n1-oxy-2-thioadenosines | |
| JPS5427573A (en) | 3,4-dihydrocarbostyril derivatives | |
| JPS5387330A (en) | Novel thiohydroxymate derivative, its preparation and bactericideand herbicide containing the same | |
| JPS5273843A (en) | Preparation of 2,2-dimethyl-3-trihalogeno-acetylcyclopropane carboxyli c acid derivatives | |
| JPS5359656A (en) | Silacyclopropene derivatives and process for preparation of the same | |
| JPS527919A (en) | Process for preparation of beta-sulfenylacrylic acid and its salt | |
| JPS57114549A (en) | Preparation of cyclopentenediol monoester | |
| JPS57188595A (en) | 7alpha-methoxycephem compound and its preparation | |
| JPS5219685A (en) | Preparation of novel 2,3-dioxopiperazine derivatives | |
| JPS5268184A (en) | Preparation of 4,5-disulfornaphthalimides | |
| JPS5353647A (en) | 7-oxo-6-azabicyclo 3,2,1 oct-2-ene-2,8-dicarboxylic acid derivatives, theirmolecular compounds and preparation |