JPS5540616A - Preparation of benzo-hetero-compound - Google Patents
Preparation of benzo-hetero-compoundInfo
- Publication number
- JPS5540616A JPS5540616A JP11310478A JP11310478A JPS5540616A JP S5540616 A JPS5540616 A JP S5540616A JP 11310478 A JP11310478 A JP 11310478A JP 11310478 A JP11310478 A JP 11310478A JP S5540616 A JPS5540616 A JP S5540616A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- benzo
- hetero
- alkoxy
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 229910052736 halogen Inorganic materials 0.000 abstract 3
- 150000002367 halogens Chemical class 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- XHWOXLCXKDATQS-UHFFFAOYSA-N (2-oxo-3,4-dihydro-1h-quinolin-5-yl) methanesulfonate Chemical compound N1C(=O)CCC2=C1C=CC=C2OS(=O)(=O)C XHWOXLCXKDATQS-UHFFFAOYSA-N 0.000 abstract 1
- TXLWDZJPQCYYQY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinolin-5-yl methanesulfonate Chemical compound N1CCCC2=C1C=CC=C2OS(=O)(=O)C TXLWDZJPQCYYQY-UHFFFAOYSA-N 0.000 abstract 1
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical class C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 abstract 1
- 239000003242 anti bacterial agent Substances 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000002071 phenylalkoxy group Chemical group 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 229910000033 sodium borohydride Inorganic materials 0.000 abstract 1
- 239000012279 sodium borohydride Substances 0.000 abstract 1
Landscapes
- Quinoline Compounds (AREA)
- Indole Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11310478A JPS5540616A (en) | 1978-09-14 | 1978-09-14 | Preparation of benzo-hetero-compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11310478A JPS5540616A (en) | 1978-09-14 | 1978-09-14 | Preparation of benzo-hetero-compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5540616A true JPS5540616A (en) | 1980-03-22 |
| JPS6237628B2 JPS6237628B2 (cg-RX-API-DMAC10.html) | 1987-08-13 |
Family
ID=14603577
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP11310478A Granted JPS5540616A (en) | 1978-09-14 | 1978-09-14 | Preparation of benzo-hetero-compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5540616A (cg-RX-API-DMAC10.html) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4416884A (en) * | 1978-04-12 | 1983-11-22 | Otsuka Pharmaceutical Co., Ltd. | Piperazinylbenzoheterocyclic compounds |
| US4552879A (en) * | 1980-11-10 | 1985-11-12 | Otsuka Pharmaceutical Co., Ltd. | Benzoheterocyclic compounds and pharmaceutical composition thereof |
| US4594347A (en) * | 1983-01-26 | 1986-06-10 | Otsuka Pharmaceutical Co. Limited | Pyrrolo [3,2,1-ij]-quinoline carboxylic acid compound |
| JPS61194074A (ja) * | 1985-02-22 | 1986-08-28 | Sumitomo Chem Co Ltd | 7―アミノ―1―アルキル―6―フルオロキノリン―2(1h)―オン |
| US5283336A (en) * | 1992-09-08 | 1994-02-01 | The United States Of America As Represented By The United States Department Of Energy | Method for preparation of 7-hydroxy-1,2,3,4-tetrahydroquinoline from 1,2,3,4-tetrahydroquinoline |
| WO2002006228A1 (en) * | 2000-07-19 | 2002-01-24 | Ube Industries, Ltd. | Process for producing 5-fluorooxyindole and for producing intermediate therefor |
| DE102008022221A1 (de) | 2008-05-06 | 2009-11-12 | Universität des Saarlandes | Inhibitoren der humanen Aldosteronsynthase CYP11B2 |
| US8541404B2 (en) | 2009-11-09 | 2013-09-24 | Elexopharm Gmbh | Inhibitors of the human aldosterone synthase CYP11B2 |
| US10870721B2 (en) | 2013-06-18 | 2020-12-22 | Panasonic Intellectual Property Management Co., Ltd. | Polyphenylene ether resin composition, prepreg, metal-clad laminate and printed wiring board |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0519662U (ja) * | 1991-05-28 | 1993-03-12 | 株式会社中村自工 | ドライブシヤフト |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4876898A (cg-RX-API-DMAC10.html) * | 1971-12-30 | 1973-10-16 | ||
| JPS4941539A (cg-RX-API-DMAC10.html) * | 1972-05-17 | 1974-04-18 | ||
| JPS4982672A (cg-RX-API-DMAC10.html) * | 1972-12-21 | 1974-08-08 | ||
| JPS4982670A (cg-RX-API-DMAC10.html) * | 1972-12-18 | 1974-08-08 | ||
| JPS49125530A (cg-RX-API-DMAC10.html) * | 1973-03-26 | 1974-12-02 | ||
| JPS5024296A (cg-RX-API-DMAC10.html) * | 1973-04-05 | 1975-03-15 | ||
| JPS50108271A (cg-RX-API-DMAC10.html) * | 1974-02-09 | 1975-08-26 | ||
| JPS50108277A (cg-RX-API-DMAC10.html) * | 1974-02-12 | 1975-08-26 | ||
| US3917609A (en) * | 1973-06-27 | 1975-11-04 | Minnesota Mining & Mfg | Pyrroloquinoline carboxylic acids and derivatives |
| JPS51146476A (en) * | 1975-06-06 | 1976-12-16 | Chinoin Gyogyszer Es Vegyeszet | New preparation method of quinolinee33carbonic acid |
| JPS5236606A (en) * | 1975-09-12 | 1977-03-22 | Tanabe Seiyaku Co Ltd | Process for preparation of amino compounds |
| JPS5365887A (en) * | 1976-11-22 | 1978-06-12 | Kyorin Seiyaku Kk | Substituted quinoline*arboxylate and process for preparing same |
| JPS5382799A (en) * | 1976-12-28 | 1978-07-21 | Kyorin Seiyaku Kk | Substituted pyroloquinolinecarboxylate and process for preparing same |
-
1978
- 1978-09-14 JP JP11310478A patent/JPS5540616A/ja active Granted
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4876898A (cg-RX-API-DMAC10.html) * | 1971-12-30 | 1973-10-16 | ||
| JPS4941539A (cg-RX-API-DMAC10.html) * | 1972-05-17 | 1974-04-18 | ||
| JPS4982670A (cg-RX-API-DMAC10.html) * | 1972-12-18 | 1974-08-08 | ||
| JPS4982672A (cg-RX-API-DMAC10.html) * | 1972-12-21 | 1974-08-08 | ||
| JPS49125530A (cg-RX-API-DMAC10.html) * | 1973-03-26 | 1974-12-02 | ||
| JPS5024296A (cg-RX-API-DMAC10.html) * | 1973-04-05 | 1975-03-15 | ||
| US3917609A (en) * | 1973-06-27 | 1975-11-04 | Minnesota Mining & Mfg | Pyrroloquinoline carboxylic acids and derivatives |
| JPS50108271A (cg-RX-API-DMAC10.html) * | 1974-02-09 | 1975-08-26 | ||
| JPS50108277A (cg-RX-API-DMAC10.html) * | 1974-02-12 | 1975-08-26 | ||
| JPS51146476A (en) * | 1975-06-06 | 1976-12-16 | Chinoin Gyogyszer Es Vegyeszet | New preparation method of quinolinee33carbonic acid |
| JPS5236606A (en) * | 1975-09-12 | 1977-03-22 | Tanabe Seiyaku Co Ltd | Process for preparation of amino compounds |
| JPS5365887A (en) * | 1976-11-22 | 1978-06-12 | Kyorin Seiyaku Kk | Substituted quinoline*arboxylate and process for preparing same |
| JPS5382799A (en) * | 1976-12-28 | 1978-07-21 | Kyorin Seiyaku Kk | Substituted pyroloquinolinecarboxylate and process for preparing same |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4416884A (en) * | 1978-04-12 | 1983-11-22 | Otsuka Pharmaceutical Co., Ltd. | Piperazinylbenzoheterocyclic compounds |
| US4552879A (en) * | 1980-11-10 | 1985-11-12 | Otsuka Pharmaceutical Co., Ltd. | Benzoheterocyclic compounds and pharmaceutical composition thereof |
| US4594347A (en) * | 1983-01-26 | 1986-06-10 | Otsuka Pharmaceutical Co. Limited | Pyrrolo [3,2,1-ij]-quinoline carboxylic acid compound |
| JPS61194074A (ja) * | 1985-02-22 | 1986-08-28 | Sumitomo Chem Co Ltd | 7―アミノ―1―アルキル―6―フルオロキノリン―2(1h)―オン |
| US5283336A (en) * | 1992-09-08 | 1994-02-01 | The United States Of America As Represented By The United States Department Of Energy | Method for preparation of 7-hydroxy-1,2,3,4-tetrahydroquinoline from 1,2,3,4-tetrahydroquinoline |
| WO2002006228A1 (en) * | 2000-07-19 | 2002-01-24 | Ube Industries, Ltd. | Process for producing 5-fluorooxyindole and for producing intermediate therefor |
| US6900335B2 (en) | 2000-07-19 | 2005-05-31 | Ube Industries, Ltd. | Process for producing 5-fluorooxindole and for producing intermediates therefor |
| US7342040B2 (en) | 2000-07-19 | 2008-03-11 | Ube Industries, Ltd. | 5-fluorooxindole-3-carboxylic acid ester |
| DE102008022221A1 (de) | 2008-05-06 | 2009-11-12 | Universität des Saarlandes | Inhibitoren der humanen Aldosteronsynthase CYP11B2 |
| US8685960B2 (en) | 2008-05-06 | 2014-04-01 | Elexopharm Gmbh | 6-pyridin-3-yl-3,4-dihydro-1h-quinolin-2-one derivatives and related compounds as inhibitors of the human aldosterone synthase CYP11B2 |
| US8541404B2 (en) | 2009-11-09 | 2013-09-24 | Elexopharm Gmbh | Inhibitors of the human aldosterone synthase CYP11B2 |
| US10870721B2 (en) | 2013-06-18 | 2020-12-22 | Panasonic Intellectual Property Management Co., Ltd. | Polyphenylene ether resin composition, prepreg, metal-clad laminate and printed wiring board |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6237628B2 (cg-RX-API-DMAC10.html) | 1987-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5540616A (en) | Preparation of benzo-hetero-compound | |
| DE3264760D1 (en) | New pyrazoline derivatives, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds | |
| JPS5692239A (en) | Preparation of 5-oxohexyl compound | |
| JPS53111096A (en) | 1-azaxanthone-3-carboxylic acid derivative and its preparation | |
| JPS5424829A (en) | Organic phosphate compound, its preparation, and insecticide, miticide and nematocide containing the same | |
| JPS5742643A (en) | 6,10,14,18-tetramethyl-5,9,13,17-nonadecatetraene-2-ol | |
| JPS53132547A (en) | Novel trisazo compound and its preparation | |
| ES485157A1 (es) | Procedimiento para la obtencion de esteres de acido benzimi-dazolilcarbamico,de efecto antihelmintico | |
| JPS53101308A (en) | Derivative of 5,6-dihydro-2h-pyran and its preparation | |
| JPS53121787A (en) | Preparation of oxazolinoazetidinylpentenoic acid derivatives | |
| JPS53111070A (en) | 2-aminochromone-3-carboxaldehyde derivative and its preparation | |
| AU8714082A (en) | N-substituted-tetrahydroisophthalimide derivatives | |
| JPS5414951A (en) | Preparation of vitamin d derivatives | |
| JPS5422376A (en) | Carbostyril derivative | |
| JPS5412385A (en) | Carbostyril derivative | |
| JPS5368777A (en) | Preparation of phenyathridine | |
| JPS5692229A (en) | Preparation of 5-hexynyl alcohol | |
| JPS5412355A (en) | Alkyl cyclohexyldichlorosilane compounds and their preparation | |
| JPS53149924A (en) | Beta-hydroxy-alpha-amino acid compound and its preparation | |
| JPS5422355A (en) | 7-alkylnorcamphor, its preparation, and perfume composition comprising the compounds | |
| JPS5283706A (en) | Novel propargyl alcohol derivatives and preparation thereof | |
| JPS53135998A (en) | Preparation of 6 alpha-acylaminopenicillanic acid 1-oxide | |
| JPS53108989A (en) | Carbostyril derivative | |
| JPS5247027A (en) | Preparation of monoazomethine pigment of barbituric acid | |
| JPS53103415A (en) | Preparation of trihalocarboxylic acid ester |