JPS5473756A - Cyclohexane derivative and herbicides - Google Patents
Cyclohexane derivative and herbicidesInfo
- Publication number
- JPS5473756A JPS5473756A JP13676577A JP13676577A JPS5473756A JP S5473756 A JPS5473756 A JP S5473756A JP 13676577 A JP13676577 A JP 13676577A JP 13676577 A JP13676577 A JP 13676577A JP S5473756 A JPS5473756 A JP S5473756A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- herbicides
- lower alkyl
- cyclohexane derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000004009 herbicide Substances 0.000 title abstract 2
- 125000000113 cyclohexyl group Chemical class [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 title 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 1
- GMPKIPWJBDOURN-UHFFFAOYSA-N Methoxyamine Chemical compound CON GMPKIPWJBDOURN-UHFFFAOYSA-N 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 238000009835 boiling Methods 0.000 abstract 1
- HJSLFCCWAKVHIW-UHFFFAOYSA-N cyclohexane-1,3-dione Chemical compound O=C1CCCC(=O)C1 HJSLFCCWAKVHIW-UHFFFAOYSA-N 0.000 abstract 1
- 238000010438 heat treatment Methods 0.000 abstract 1
- 239000012442 inert solvent Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- KPTCZURLWZSRKB-UHFFFAOYSA-N o-prop-2-enylhydroxylamine Chemical compound NOCC=C KPTCZURLWZSRKB-UHFFFAOYSA-N 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (36)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13676577A JPS5473756A (en) | 1977-11-16 | 1977-11-16 | Cyclohexane derivative and herbicides |
| IL54560A IL54560A (en) | 1977-05-23 | 1978-04-20 | Substituted 2-aminoalkylidene-1,3-cyclohexanediones,their preparation and their use as herbicides |
| US05/898,110 US4249937A (en) | 1977-05-23 | 1978-04-20 | Cyclohexane derivatives |
| AU35314/78A AU503917B1 (en) | 1977-05-23 | 1978-04-20 | Cyclohexane-1, 3-dione derivatives |
| NZ187064A NZ187064A (en) | 1977-05-23 | 1978-04-24 | Cyclohexane-1 3-diones substituted in the 2 and 5 positions and herbicidal compositions containing them |
| MX78100937U MX5010E (es) | 1977-05-23 | 1978-04-25 | Procedimiento para preparar derivados de ciclohexano |
| GR56112A GR69790B (enrdf_load_stackoverflow) | 1977-05-23 | 1978-04-26 | |
| CA302,269A CA1104583A (en) | 1977-05-23 | 1978-04-28 | Cyclohexane derivatives |
| FR7812719A FR2391999A1 (fr) | 1977-05-23 | 1978-04-28 | Derives de cyclohexane a utiliser comme herbicides selectifs |
| GB17199/78A GB1589003A (en) | 1977-05-23 | 1978-05-02 | Substituted cyclohexane 1,3-dione derivatives their preparation and their use as selective herbicides |
| SE7805033A SE430688B (sv) | 1977-05-23 | 1978-05-02 | Vissa cyklohexan-1,3-dion-derivat till omvendning som herbicider samt anvendning deran for att kontrollera ogres |
| CH485078A CH635824A5 (de) | 1977-05-23 | 1978-05-03 | Cyclohexane sowie diese verbindungen enthaltende herbizide. |
| RO7894051A RO75519A (ro) | 1977-05-23 | 1978-05-11 | Procedeu de preparare a unor derivati de 1,3-ciclohexadione substituite |
| PL1978206808A PL109259B1 (en) | 1977-05-23 | 1978-05-15 | Herbicide |
| PL1978215803A PL123270B1 (en) | 1977-05-23 | 1978-05-15 | Process for preparing novel derivatives of cyclohexan-1,3-dione |
| BG039769A BG29121A3 (en) | 1977-05-23 | 1978-05-16 | Herbicide means |
| YU1175/78A YU41098B (en) | 1977-05-23 | 1978-05-16 | Process for obtaining cyclohexane derivatives |
| BE187709A BE867093A (fr) | 1977-05-23 | 1978-05-16 | Derives du cyclohexane |
| TR19918A TR19918A (tr) | 1977-05-23 | 1978-05-16 | Siklohegzan muestakki,bunun istihsal uesuelue ve herbisid unsur |
| BG040931A BG29132A3 (en) | 1977-05-23 | 1978-05-16 | Method of obtaining of cyclohexan derivatives |
| HU78NI214A HU179738B (en) | 1977-05-23 | 1978-05-17 | Selective herbicide compositions containing cyclohexane-1,3-dione derivatives and process for producing the active agents |
| CS783240A CS197322B2 (en) | 1977-05-23 | 1978-05-18 | Herbicide means and method of making the active agent |
| AT365078A AT357363B (de) | 1977-05-23 | 1978-05-19 | Herbizide zusammensetzungen |
| DD78216233A DD146455A5 (de) | 1977-05-23 | 1978-05-19 | Verfahren zur herstellung neuer cyclohexanderivate mit herbizider wirkung |
| DD78205484A DD138594A5 (de) | 1977-05-23 | 1978-05-19 | Herbizide zusammensetzung |
| AR272257A AR218913A1 (es) | 1977-05-23 | 1978-05-19 | Nuevos derivados de 2-(1-alquil)-o alquenil)-oxiamino-alquiliden)-5-(alquil o fenil)-(tio-,sulfinil o sulfonil)-alquil)-ciclohexan-1,3-diona |
| BR7803248A BR7803248A (pt) | 1977-05-23 | 1978-05-22 | Composicao herbicida e processo para controle de ervas daninhas |
| EG32878A EG13349A (en) | 1977-05-23 | 1978-05-22 | Cyclohexane derivatives and their use as herbicides |
| DE2822304A DE2822304C3 (de) | 1977-05-23 | 1978-05-22 | Substituierte Cyclohexan-13-dion-Derivate, Herstellungsverfahren und herbizides Mittel |
| DK228678A DK150507C (da) | 1977-05-23 | 1978-05-23 | Cyklohexanderivater til anvendelse som herbicider samt herbicidt middel og fremgangsmaade til bekaempelse af ukrudt |
| NLAANVRAGE7805581,A NL176558C (nl) | 1977-05-23 | 1978-05-23 | Gevormd preparaat met herbicide eigenschappen, alsmede daarvoor geschikt cyclohexaanderivaat. |
| IT49492/78A IT1105411B (it) | 1977-05-23 | 1978-05-23 | Derivati di ciclosano |
| ES470134A ES470134A1 (es) | 1977-05-23 | 1978-05-23 | Un procedimiento para la produccion de derivados sustituidosde ciclohexano-1,3-diona |
| SU792705001A SU884567A3 (ru) | 1977-05-23 | 1979-01-05 | Способ получени производных циклогексана или их солей |
| AT477679A AT365566B (de) | 1977-05-23 | 1979-07-09 | Verfahren zur herstellung von neuen substituierten 2-(1-alkoxy- oder -alkenyloxyaminoalkyliden)-cyclohexan-1,3-dionen und deren metall- und ammoniumsalzen |
| MY146/82A MY8200146A (en) | 1977-05-23 | 1982-12-30 | Substituted cyclohexane 1,3-dione derivatives their preparation and their use as selective herbicides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13676577A JPS5473756A (en) | 1977-11-16 | 1977-11-16 | Cyclohexane derivative and herbicides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5473756A true JPS5473756A (en) | 1979-06-13 |
| JPS5647184B2 JPS5647184B2 (enrdf_load_stackoverflow) | 1981-11-07 |
Family
ID=15182975
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13676577A Granted JPS5473756A (en) | 1977-05-23 | 1977-11-16 | Cyclohexane derivative and herbicides |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5473756A (enrdf_load_stackoverflow) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS63200090U (enrdf_load_stackoverflow) * | 1987-06-09 | 1988-12-22 | ||
| JPS63200091U (enrdf_load_stackoverflow) * | 1987-06-10 | 1988-12-22 |
-
1977
- 1977-11-16 JP JP13676577A patent/JPS5473756A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5647184B2 (enrdf_load_stackoverflow) | 1981-11-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS54117486A (en) | 2-phenoxypyrimidine derivative | |
| JPS5473756A (en) | Cyclohexane derivative and herbicides | |
| JPS55111460A (en) | Novel vitamin d3 derivative and its preparation | |
| JPS57203053A (en) | Preparation of cyanoacetic acid ester | |
| JPS55145648A (en) | New derivative of anthranylic acid | |
| JPS5463052A (en) | Preparation of cyclohexane-dione derivatives | |
| JPS5419945A (en) | Cyclohexane derivatives, their preparation and herbicides | |
| JPS5517323A (en) | Substituted oxime ether, its preparation, and insecticide and miticide containing the same | |
| JPS5788142A (en) | Preparation of cyclopentenolone compound | |
| JPS56152447A (en) | N-dimethylbenzyl-tert-butylacetamide derivative, its preparation, and herbicide comprising it as active ingredient | |
| JPS5711956A (en) | Novel nitro compound and its preparation | |
| JPS574965A (en) | 2-cyclohexen-1-one derivative and selective herbicide | |
| JPS574936A (en) | 2-n-amyl-3-hydroxy-3-methyl-4-cyclopentenone and its preparation | |
| JPS57188541A (en) | Ether derivative of cyclopentenone compound | |
| JPS5675448A (en) | Preparation of cis-3-alkenals | |
| JPS54106481A (en) | Novel 2,3-dioxopiperazine derivative and its preparation | |
| JPS5711957A (en) | Novel aldehyde compound and its preparation | |
| JPS5629542A (en) | Preparation of phenylacetic acid derivative | |
| JPS5566534A (en) | Novel cyclic ketone compound and its preparation | |
| JPS5612361A (en) | Isopropylamine derivative and its preparation | |
| JPS562957A (en) | N-adamantylthioamide derivative | |
| JPS574933A (en) | 2-n-amyl-3-hydroxy-3-methylcyclopentanone and its preparation | |
| JPS5562079A (en) | Novel furan compound and its preparation | |
| JPS5735554A (en) | Novel-4-homoisotwist-3-isocarbamic acid ester | |
| JPS54125640A (en) | Cyclohexenecarboxylic acid derivative and herbicides comprising it |