JPS5271444A - Synthesis of phenyl-onn-azoxycyanides - Google Patents
Synthesis of phenyl-onn-azoxycyanidesInfo
- Publication number
- JPS5271444A JPS5271444A JP14832375A JP14832375A JPS5271444A JP S5271444 A JPS5271444 A JP S5271444A JP 14832375 A JP14832375 A JP 14832375A JP 14832375 A JP14832375 A JP 14832375A JP S5271444 A JPS5271444 A JP S5271444A
- Authority
- JP
- Japan
- Prior art keywords
- onn
- azoxycyanides
- phenyl
- synthesis
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 230000015572 biosynthetic process Effects 0.000 title 1
- IIYWDRMGBBSUQS-UHFFFAOYSA-N cyanoimino-oxido-phenylazanium Chemical class N#CN=[N+]([O-])C1=CC=CC=C1 IIYWDRMGBBSUQS-UHFFFAOYSA-N 0.000 title 1
- 238000003786 synthesis reaction Methods 0.000 title 1
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- SVZNDHRXPRCOFI-UHFFFAOYSA-N (3-carboxyphenyl)-cyanoimino-oxidoazanium Chemical compound OC(=O)C1=CC=CC([N+]([O-])=NC#N)=C1 SVZNDHRXPRCOFI-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
Landscapes
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14832375A JPS5271444A (en) | 1975-12-11 | 1975-12-11 | Synthesis of phenyl-onn-azoxycyanides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14832375A JPS5271444A (en) | 1975-12-11 | 1975-12-11 | Synthesis of phenyl-onn-azoxycyanides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5271444A true JPS5271444A (en) | 1977-06-14 |
| JPS5735871B2 JPS5735871B2 (enExample) | 1982-07-31 |
Family
ID=15450205
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP14832375A Granted JPS5271444A (en) | 1975-12-11 | 1975-12-11 | Synthesis of phenyl-onn-azoxycyanides |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5271444A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5089486A (en) * | 1989-08-04 | 1992-02-18 | Shell Research Limited | Biocidal azophenyl compounds |
| US5387580A (en) * | 1989-08-04 | 1995-02-07 | Shell Research Limited | Biocidal azophenyl compositions |
| EP0644184A1 (en) * | 1993-08-18 | 1995-03-22 | Shell Internationale Researchmaatschappij B.V. | Azoxycyanobenzene derivatives and their use as fungicides |
| US5439897A (en) * | 1993-08-18 | 1995-08-08 | American Cyanamid Company | Azoxycyanobenzene derivatives, compositions containing them and their use as fungicides |
| US5627175A (en) * | 1992-12-02 | 1997-05-06 | Shellinternationale Research Maatschappij B.V. | Azoxycyanobenzene compounds |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH07116572A (ja) * | 1993-10-25 | 1995-05-09 | Hatsuta Kakusanki Kk | 散布装置 |
-
1975
- 1975-12-11 JP JP14832375A patent/JPS5271444A/ja active Granted
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5089486A (en) * | 1989-08-04 | 1992-02-18 | Shell Research Limited | Biocidal azophenyl compounds |
| US5387580A (en) * | 1989-08-04 | 1995-02-07 | Shell Research Limited | Biocidal azophenyl compositions |
| US5627175A (en) * | 1992-12-02 | 1997-05-06 | Shellinternationale Research Maatschappij B.V. | Azoxycyanobenzene compounds |
| EP0644184A1 (en) * | 1993-08-18 | 1995-03-22 | Shell Internationale Researchmaatschappij B.V. | Azoxycyanobenzene derivatives and their use as fungicides |
| US5439897A (en) * | 1993-08-18 | 1995-08-08 | American Cyanamid Company | Azoxycyanobenzene derivatives, compositions containing them and their use as fungicides |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5735871B2 (enExample) | 1982-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5297950A (en) | Chalconeether derivatives | |
| JPS5271444A (en) | Synthesis of phenyl-onn-azoxycyanides | |
| JPS5265299A (en) | Synthesis of 2-substituted-thioadenosine-n-oxides | |
| JPS5273878A (en) | Synthesis of 6-carboxyacetyl-3,4-dihydrocarbostyril | |
| JPS5262295A (en) | Preparation of n1-oxy-2-thioadenosines | |
| JPS5359656A (en) | Silacyclopropene derivatives and process for preparation of the same | |
| JPS5225785A (en) | Preparation of 2-substituted-4- trichloromethyl-6-trifluoromethyl-s- t riazines | |
| JPS52131590A (en) | Bis-trimethoxybenzylpiperazino-alkanes | |
| JPS5231067A (en) | Synthesis of 2-(2-formyl-1-pyrrolyl)- benzophenone derivatives | |
| JPS5368777A (en) | Preparation of phenyathridine | |
| JPS52133949A (en) | 3'-deoxy-5-0-pentoforanosyl-neamine derivatives | |
| JPS52133979A (en) | 2-substituted-3-(3-chloro-4-allyloxybenzal)-5-oxazolones | |
| JPS5293730A (en) | Thioethers | |
| JPS52116472A (en) | Baciferacins | |
| JPS5289675A (en) | Preparation of xanthone compounds | |
| JPS5346955A (en) | Polyoxypregnane type compound | |
| JPS537631A (en) | Novel catechol-amine derivatives | |
| JPS52102274A (en) | 8-azaprostanic acid derivatives | |
| JPS5223049A (en) | Preparation of 4-acloxy-4'- cyanobiphenyls | |
| JPS5328186A (en) | Preparation of novel s-triazine compound | |
| JPS52133948A (en) | Novel 3'-deoxykanamycin a derivatives | |
| JPS5293708A (en) | 1,1,-bis-(1-methyl-2-vinyl-4,6-heptadienoxy)-alkane | |
| JPS5285172A (en) | 2-pyridylthio-zincoxy complex | |
| JPS5231064A (en) | Preparation o 6beta-halogenmethyl-19-nor- 5(10)-chol esten-3beta -ols | |
| JPS52118461A (en) | Thiophene-silylenole-ether |