JPS52148090A - Cephem-carboxylic acid esters - Google Patents
Cephem-carboxylic acid estersInfo
- Publication number
- JPS52148090A JPS52148090A JP6257276A JP6257276A JPS52148090A JP S52148090 A JPS52148090 A JP S52148090A JP 6257276 A JP6257276 A JP 6257276A JP 6257276 A JP6257276 A JP 6257276A JP S52148090 A JPS52148090 A JP S52148090A
- Authority
- JP
- Japan
- Prior art keywords
- cephem
- carboxylic acid
- acid esters
- alkyl
- phnylacetamido
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- UDTVQXNZIKQKOI-BAFYGKSASA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylic acid Chemical class C1=CC(C(=O)O)S[C@@H]2CC(=O)N21 UDTVQXNZIKQKOI-BAFYGKSASA-N 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 150000001540 azides Chemical class 0.000 abstract 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
Landscapes
- Cephalosporin Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6257276A JPS52148090A (en) | 1976-05-29 | 1976-05-29 | Cephem-carboxylic acid esters |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6257276A JPS52148090A (en) | 1976-05-29 | 1976-05-29 | Cephem-carboxylic acid esters |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52148090A true JPS52148090A (en) | 1977-12-08 |
| JPS6139953B2 JPS6139953B2 (enrdf_load_stackoverflow) | 1986-09-06 |
Family
ID=13204137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP6257276A Granted JPS52148090A (en) | 1976-05-29 | 1976-05-29 | Cephem-carboxylic acid esters |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS52148090A (enrdf_load_stackoverflow) |
-
1976
- 1976-05-29 JP JP6257276A patent/JPS52148090A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6139953B2 (enrdf_load_stackoverflow) | 1986-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5334794A (en) | Cephalosporin derivatives and their preparation | |
| JPS5297950A (en) | Chalconeether derivatives | |
| JPS52108980A (en) | Carbostyril derivatives and their preparation | |
| JPS52148090A (en) | Cephem-carboxylic acid esters | |
| JPS52148091A (en) | Novel cephem-carboxlic acid esters | |
| JPS52125626A (en) | Herbicides | |
| JPS523099A (en) | Pyrido 2,3-c acridine-1-hydroxy-2-carboxylic preparing the same | |
| JPS5340719A (en) | Organophosphorus compound and chlorine-containing resin composition | |
| JPS5359656A (en) | Silacyclopropene derivatives and process for preparation of the same | |
| JPS5340770A (en) | Preparation of 3-amino-1,3-thiazolidine-2,4-dions and repellent against water organisms containing the same | |
| JPS5346994A (en) | Novel 7-(5-amino-1,3,4-thiadiazol-2-yl)thioacetamide-d3-cephem-4-carboxylic acid derivatives and their preparation | |
| JPS5283777A (en) | Novel 7-methoxycepharosporin | |
| JPS52136143A (en) | Metaphenoxybenzoic acid amide derivatives and their preparation | |
| JPS5295665A (en) | 1,3-di-substituted-2-imidazolidines | |
| JPS5291886A (en) | Cephalosporins and their preparation | |
| JPS532483A (en) | 1-substituted-5-fluorouracils and method of preparing same | |
| JPS5356642A (en) | Trans-4-aminomethylcyclohexanecarboxylic acid esters | |
| JPS52142076A (en) | Preparation of 7-substituted-quinolinecarboxylic acid derivatives | |
| JPS5210219A (en) | Preparation of beta-sulfonylacrylic beta-sulfonylacrylic their esters and acids their esters and amides | |
| JPS5368771A (en) | Alpha-thioacetic acid derivatives | |
| JPS5353638A (en) | Alpha-acetyl cinnamic acid ester derivatives, their preparation and theirherbicides containing the same | |
| JPS5212192A (en) | Thiazolo-thiadiazines bactericides for agriculture and horiculture | |
| JPS5366437A (en) | Lipid lowering agents | |
| JPS5363389A (en) | 5-fluorouracil derivs. and process for their preparation | |
| JPS5283865A (en) | Cephalosporin derivatives |