JPH0440386B2 - - Google Patents
Info
- Publication number
- JPH0440386B2 JPH0440386B2 JP3898681A JP3898681A JPH0440386B2 JP H0440386 B2 JPH0440386 B2 JP H0440386B2 JP 3898681 A JP3898681 A JP 3898681A JP 3898681 A JP3898681 A JP 3898681A JP H0440386 B2 JPH0440386 B2 JP H0440386B2
- Authority
- JP
- Japan
- Prior art keywords
- compound
- poly
- acylalkyleneimine
- group
- polymer composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 35
- 229920001059 synthetic polymer Polymers 0.000 claims description 20
- -1 sulfonate anion Chemical class 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 16
- 229920000642 polymer Polymers 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 229920000728 polyester Polymers 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 229920002647 polyamide Polymers 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 229920000098 polyolefin Polymers 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 229920002873 Polyethylenimine Polymers 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 2
- 239000004800 polyvinyl chloride Substances 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 238000000034 method Methods 0.000 description 9
- 239000000835 fiber Substances 0.000 description 8
- 229920000139 polyethylene terephthalate Polymers 0.000 description 5
- 239000005020 polyethylene terephthalate Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 229920002292 Nylon 6 Polymers 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- CSPVUHYZUZZRGF-RNFRBKRXSA-N (4R,6R)-hydroxy-2,2,6-trimethylcyclohexanone Chemical compound C[C@@H]1C[C@@H](O)CC(C)(C)C1=O CSPVUHYZUZZRGF-RNFRBKRXSA-N 0.000 description 2
- 229930185327 Actinol Natural products 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 238000010538 cationic polymerization reaction Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 238000002074 melt spinning Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 238000009991 scouring Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 1
- OTIXUSNHAKOJBX-UHFFFAOYSA-N 1-(aziridin-1-yl)ethanone Chemical compound CC(=O)N1CC1 OTIXUSNHAKOJBX-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- BYVSMDBDTBXASR-UHFFFAOYSA-N 5,6-dihydro-4h-oxazine Chemical compound C1CON=CC1 BYVSMDBDTBXASR-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical group C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical compound O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000010035 extrusion spinning Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 229920001600 hydrophobic polymer Polymers 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000004893 oxazines Chemical class 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229960000380 propiolactone Drugs 0.000 description 1
- HKPHUICWPSKEMR-UHFFFAOYSA-M sodium;chloromethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CCl HKPHUICWPSKEMR-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Landscapes
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3898681A JPS57153048A (en) | 1981-03-17 | 1981-03-17 | Polymer composition |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3898681A JPS57153048A (en) | 1981-03-17 | 1981-03-17 | Polymer composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57153048A JPS57153048A (en) | 1982-09-21 |
| JPH0440386B2 true JPH0440386B2 (ru) | 1992-07-02 |
Family
ID=12540461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3898681A Granted JPS57153048A (en) | 1981-03-17 | 1981-03-17 | Polymer composition |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57153048A (ru) |
-
1981
- 1981-03-17 JP JP3898681A patent/JPS57153048A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS57153048A (en) | 1982-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3514498A (en) | Antistatic synthetic resin composition containing a polyether - polyamide block copolymer wherein an ionic functional group is made to coexist | |
| US3900676A (en) | Antistatic filaments | |
| US3639502A (en) | Antistatic shaped articles containing polyetherpolyamide block copolymer and a polyamide polyester or polyolefin | |
| JPS5819694B2 (ja) | 安定化されたポリオレフインを基礎とする重合組成物 | |
| US3553286A (en) | Polyamides and sulfonic acid group containing vinyl polymers | |
| US3374288A (en) | Polycarbonamide filaments containing polyalkylene oxide, sodium phenyl phosphinate and sodium aminoalkylphosphinate | |
| US3522329A (en) | Composition comprising polyester and polyether-polyamide blockcopolymer | |
| US3395107A (en) | Antistatic composition for synthetic fibers | |
| US3431322A (en) | Dyeable polyolefin compositions and products therefrom | |
| US3502607A (en) | Art of making dyeable polyacrylonitrile products | |
| JPH0440386B2 (ru) | ||
| US3492368A (en) | Fiber forming linear polyesters with improved dyeability | |
| US3888944A (en) | Antistatic fiber containing chain-extended tetrols based on diamines | |
| US3399251A (en) | Alkylbenzyl adducts of polyethyleneimine blended with crystalline polyolefins | |
| US3859380A (en) | Antistatic polyamide fiber | |
| US3706707A (en) | Adducts of a polymer of a cyclic ether and a sultone | |
| US3454670A (en) | Polypropylene composition having improved dye receptivity containing epichlorohydrin/diamine/diphenol polycondensate | |
| US3821184A (en) | Antistatic and dyeable thermoplastic molding compositions and shaped articles of polyolefins | |
| US3873639A (en) | Antistatic fiber containing chain-extended tetrols based on diamines | |
| US3642713A (en) | Polyamide composition containing succinic imide compound | |
| US3668278A (en) | Blends of polyolefins and polyamides | |
| USRE28167E (en) | Blends of polyolefins and poly amides | |
| US3560594A (en) | Dye-receptive polyolefin compositions | |
| JPS6337828B2 (ru) | ||
| US2719134A (en) | Mixtures comprising acrylonitrile polymers with polymeric phosphonic acid diamides |