JPH0238575B2 - - Google Patents
Info
- Publication number
- JPH0238575B2 JPH0238575B2 JP60261640A JP26164085A JPH0238575B2 JP H0238575 B2 JPH0238575 B2 JP H0238575B2 JP 60261640 A JP60261640 A JP 60261640A JP 26164085 A JP26164085 A JP 26164085A JP H0238575 B2 JPH0238575 B2 JP H0238575B2
- Authority
- JP
- Japan
- Prior art keywords
- alkali metal
- salt
- formula
- group
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 claims abstract description 30
- 239000003444 phase transfer catalyst Substances 0.000 claims abstract description 25
- 125000003118 aryl group Chemical group 0.000 claims abstract description 15
- 238000004519 manufacturing process Methods 0.000 claims abstract description 9
- 239000003960 organic solvent Substances 0.000 claims abstract description 9
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- -1 activated phthalimide compound Chemical class 0.000 claims description 41
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 33
- 229910052783 alkali metal Inorganic materials 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 18
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000000962 organic group Chemical group 0.000 claims description 6
- JBCHWGTZAAZJKG-UHFFFAOYSA-N 2-methyl-5-nitroisoindole-1,3-dione Chemical group C1=C([N+]([O-])=O)C=C2C(=O)N(C)C(=O)C2=C1 JBCHWGTZAAZJKG-UHFFFAOYSA-N 0.000 claims description 4
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 238000001556 precipitation Methods 0.000 claims description 3
- DDSDGDGCXAXZMM-UHFFFAOYSA-M 1-(2,2-dimethylpropyl)-4-(4-methylpiperidin-1-yl)pyridin-1-ium;chloride Chemical group [Cl-].C1CC(C)CCN1C1=CC=[N+](CC(C)(C)C)C=C1 DDSDGDGCXAXZMM-UHFFFAOYSA-M 0.000 claims description 2
- LCZJVTHGUXAYRP-UHFFFAOYSA-N 1-(2,2-dimethylpropyl)-n,n-dihexyl-2h-pyridin-4-amine Chemical group CCCCCCN(CCCCCC)C1=CCN(CC(C)(C)C)C=C1 LCZJVTHGUXAYRP-UHFFFAOYSA-N 0.000 claims description 2
- FWIZOFDVGZCRTB-UHFFFAOYSA-N 2-methyl-4-nitroisoindole-1,3-dione Chemical group C1=CC([N+]([O-])=O)=C2C(=O)N(C)C(=O)C2=C1 FWIZOFDVGZCRTB-UHFFFAOYSA-N 0.000 claims description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 238000000605 extraction Methods 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- UXELEGNBZNCRNI-UHFFFAOYSA-N n,n-dibutyl-1-(2,2-dimethylpropyl)-2h-pyridin-4-amine Chemical group CCCCN(CCCC)C1=CCN(CC(C)(C)C)C=C1 UXELEGNBZNCRNI-UHFFFAOYSA-N 0.000 claims description 2
- 238000003756 stirring Methods 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 4
- MFUPLJQNEXUUDW-UHFFFAOYSA-N 2-phenylisoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1 MFUPLJQNEXUUDW-UHFFFAOYSA-N 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 238000001816 cooling Methods 0.000 claims 1
- 238000011065 in-situ storage Methods 0.000 claims 1
- 150000003457 sulfones Chemical class 0.000 claims 1
- 150000008378 aryl ethers Chemical class 0.000 abstract description 22
- 150000002989 phenols Chemical class 0.000 abstract description 5
- 239000006227 byproduct Substances 0.000 abstract description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 abstract description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 238000006073 displacement reaction Methods 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 150000001491 aromatic compounds Chemical group 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000003495 polar organic solvent Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 229940106691 bisphenol a Drugs 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M nitrite group Chemical group N(=O)[O-] IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 3
- 150000004714 phosphonium salts Chemical class 0.000 description 3
- 125000005543 phthalimide group Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- LVLNPXCISNPHLE-UHFFFAOYSA-N 2-[(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1O LVLNPXCISNPHLE-UHFFFAOYSA-N 0.000 description 2
- DPYPKRLYESDBOK-UHFFFAOYSA-N 5-fluoro-2-methylisoindole-1,3-dione Chemical compound C1=C(F)C=C2C(=O)N(C)C(=O)C2=C1 DPYPKRLYESDBOK-UHFFFAOYSA-N 0.000 description 2
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 2
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical group CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- PFZCOWLKXHIVII-UHFFFAOYSA-N pyridin-1-ium-1-amine Chemical class N[N+]1=CC=CC=C1 PFZCOWLKXHIVII-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 2
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 2
- HUYKZYIAFUBPAQ-UHFFFAOYSA-N (2-hydroxyphenyl)-(4-hydroxyphenyl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1O HUYKZYIAFUBPAQ-UHFFFAOYSA-N 0.000 description 1
- MGAXYKDBRBNWKT-UHFFFAOYSA-N (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC(=O)CC1 MGAXYKDBRBNWKT-UHFFFAOYSA-N 0.000 description 1
- HCNHNBLSNVSJTJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)ethane Chemical compound C=1C=C(O)C=CC=1C(C)C1=CC=C(O)C=C1 HCNHNBLSNVSJTJ-UHFFFAOYSA-N 0.000 description 1
- YKPAABNCNAGAAJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)propane Chemical compound C=1C=C(O)C=CC=1C(CC)C1=CC=C(O)C=C1 YKPAABNCNAGAAJ-UHFFFAOYSA-N 0.000 description 1
- GBDZXPJXOMHESU-UHFFFAOYSA-N 1,2,3,4-tetrachlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1Cl GBDZXPJXOMHESU-UHFFFAOYSA-N 0.000 description 1
- IZUKQUVSCNEFMJ-UHFFFAOYSA-N 1,2-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1[N+]([O-])=O IZUKQUVSCNEFMJ-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- FYFDQJRXFWGIBS-UHFFFAOYSA-N 1,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1 FYFDQJRXFWGIBS-UHFFFAOYSA-N 0.000 description 1
- UDZPBPJBGCGJFK-UHFFFAOYSA-N 1-(2,2-dimethylpropyl)-4-(4-methylpiperidin-1-yl)-2h-pyridine Chemical compound C1CC(C)CCN1C1=CCN(CC(C)(C)C)C=C1 UDZPBPJBGCGJFK-UHFFFAOYSA-N 0.000 description 1
- YSIURUANICEKRV-UHFFFAOYSA-M 1-(2,2-dimethylpropyl)-4-hexoxypyridin-1-ium;bromide Chemical compound [Br-].CCCCCCOC1=CC=[N+](CC(C)(C)C)C=C1 YSIURUANICEKRV-UHFFFAOYSA-M 0.000 description 1
- JZBNHSHHESYMFT-UHFFFAOYSA-N 1-(2-ethylhexyl)-4-(4-methylpiperidin-1-yl)-2h-pyridine Chemical compound C1=CN(CC(CC)CCCC)CC=C1N1CCC(C)CC1 JZBNHSHHESYMFT-UHFFFAOYSA-N 0.000 description 1
- QTJZOTSGXMWLMP-UHFFFAOYSA-N 1-(2-ethylhexyl)-n,n-dihexyl-2h-pyridin-4-amine Chemical compound CCCCCCN(CCCCCC)C1=CCN(CC(CC)CCCC)C=C1 QTJZOTSGXMWLMP-UHFFFAOYSA-N 0.000 description 1
- GUJZTGRPONXROY-UHFFFAOYSA-N 1-(2-ethylhexyl)-n,n-dimethyl-2h-pyridin-4-amine Chemical compound CCCCC(CC)CN1CC=C(N(C)C)C=C1 GUJZTGRPONXROY-UHFFFAOYSA-N 0.000 description 1
- OFCFYWOKHPOXKF-UHFFFAOYSA-N 1-(benzenesulfonyl)-4-chlorobenzene Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC=CC=C1 OFCFYWOKHPOXKF-UHFFFAOYSA-N 0.000 description 1
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- AVFQTGVDWLOSDJ-UHFFFAOYSA-N 1-butyl-n,n-dimethyl-2h-pyridin-4-amine Chemical compound CCCCN1CC=C(N(C)C)C=C1 AVFQTGVDWLOSDJ-UHFFFAOYSA-N 0.000 description 1
- XCMICSXWKMUYMG-UHFFFAOYSA-N 1-chloro-2-nitrobenzene 1-chloro-4-nitrobenzene Chemical compound ClC1=CC=C(C=C1)[N+](=O)[O-].ClC1=C(C=CC=C1)[N+](=O)[O-] XCMICSXWKMUYMG-UHFFFAOYSA-N 0.000 description 1
- INZFKZVKSBJRNK-UHFFFAOYSA-N 1-dodecyl-n,n-dimethyl-2h-pyridin-4-amine Chemical compound CCCCCCCCCCCCN1CC=C(N(C)C)C=C1 INZFKZVKSBJRNK-UHFFFAOYSA-N 0.000 description 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- MQXNNWDXHFBFEB-UHFFFAOYSA-N 2,2-bis(2-hydroxyphenyl)propane Chemical compound C=1C=CC=C(O)C=1C(C)(C)C1=CC=CC=C1O MQXNNWDXHFBFEB-UHFFFAOYSA-N 0.000 description 1
- KNIBMLHGILXPOS-UHFFFAOYSA-N 2,2-dimethylpropyl methanesulfonate Chemical compound CC(C)(C)COS(C)(=O)=O KNIBMLHGILXPOS-UHFFFAOYSA-N 0.000 description 1
- ZUBZWNWADAKBMV-UHFFFAOYSA-M 2-(2,2-dimethylpropyl)-n,n-dihexylpyridin-1-ium-1-amine;bromide Chemical compound [Br-].CCCCCCN(CCCCCC)[N+]1=CC=CC=C1CC(C)(C)C ZUBZWNWADAKBMV-UHFFFAOYSA-M 0.000 description 1
- UHIVFYFOQJBFRD-UHFFFAOYSA-M 2-(2,2-dimethylpropyl)-n,n-dimethylpyridin-1-ium-1-amine;bromide Chemical compound [Br-].CN(C)[N+]1=CC=CC=C1CC(C)(C)C UHIVFYFOQJBFRD-UHFFFAOYSA-M 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- GPAPPPVRLPGFEQ-UHFFFAOYSA-N 4,4'-dichlorodiphenyl sulfone Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1 GPAPPPVRLPGFEQ-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- YGYPMFPGZQPETF-UHFFFAOYSA-N 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol Chemical group CC1=C(O)C(C)=CC(C=2C=C(C)C(O)=C(C)C=2)=C1 YGYPMFPGZQPETF-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- RQCACQIALULDSK-UHFFFAOYSA-N 4-(4-hydroxyphenyl)sulfinylphenol Chemical compound C1=CC(O)=CC=C1S(=O)C1=CC=C(O)C=C1 RQCACQIALULDSK-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 1
- WCUDAIJOADOKAW-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCC)C1=CC=C(O)C=C1 WCUDAIJOADOKAW-UHFFFAOYSA-N 0.000 description 1
- JXEBMICIRKHPED-UHFFFAOYSA-N 4-chloro-2-methylisoindole-1,3-dione Chemical compound C1=CC(Cl)=C2C(=O)N(C)C(=O)C2=C1 JXEBMICIRKHPED-UHFFFAOYSA-N 0.000 description 1
- GJNGXPDXRVXSEH-UHFFFAOYSA-N 4-chlorobenzonitrile Chemical compound ClC1=CC=C(C#N)C=C1 GJNGXPDXRVXSEH-UHFFFAOYSA-N 0.000 description 1
- AEKVBBNGWBBYLL-UHFFFAOYSA-N 4-fluorobenzonitrile Chemical compound FC1=CC=C(C#N)C=C1 AEKVBBNGWBBYLL-UHFFFAOYSA-N 0.000 description 1
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 1
- OMOHDUGKQSTKSR-UHFFFAOYSA-N 4-nitro-2-phenylisoindole-1,3-dione Chemical compound O=C1C=2C([N+](=O)[O-])=CC=CC=2C(=O)N1C1=CC=CC=C1 OMOHDUGKQSTKSR-UHFFFAOYSA-N 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- BZVFOFUEOBUNSR-UHFFFAOYSA-M 4-tert-butyl-1-(2,2-dimethylpropyl)pyridin-1-ium;bromide Chemical compound [Br-].CC(C)(C)C[N+]1=CC=C(C(C)(C)C)C=C1 BZVFOFUEOBUNSR-UHFFFAOYSA-M 0.000 description 1
- DCFSQEWFDPNDPQ-UHFFFAOYSA-N 5-chloro-2-methylisoindole-1,3-dione Chemical compound C1=C(Cl)C=C2C(=O)N(C)C(=O)C2=C1 DCFSQEWFDPNDPQ-UHFFFAOYSA-N 0.000 description 1
- HNNCFMUZZXJQLR-UHFFFAOYSA-N 5-nitro-2-phenylisoindole-1,3-dione Chemical compound O=C1C2=CC([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=CC=C1 HNNCFMUZZXJQLR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- WGMBWDBRVAKMOO-UHFFFAOYSA-L disodium;4-[2-(4-oxidophenyl)propan-2-yl]phenolate Chemical compound [Na+].[Na+].C=1C=C([O-])C=CC=1C(C)(C)C1=CC=C([O-])C=C1 WGMBWDBRVAKMOO-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- FZTDWZQGFQIIDA-UHFFFAOYSA-N ethoxyethane;isoindole-1,3-dione Chemical compound CCOCC.C1=CC=C2C(=O)NC(=O)C2=C1 FZTDWZQGFQIIDA-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000012886 linear function Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- MZVRZMXMVXWEQW-UHFFFAOYSA-M n,n-dibutyl-1-(2,2-dimethylpropyl)pyridin-1-ium-4-amine;chloride Chemical compound [Cl-].CCCCN(CCCC)C1=CC=[N+](CC(C)(C)C)C=C1 MZVRZMXMVXWEQW-UHFFFAOYSA-M 0.000 description 1
- GOSQQMYSNOUYHH-UHFFFAOYSA-N n,n-dibutyl-1-(2-ethylhexyl)-2h-pyridin-4-amine Chemical compound CCCCC(CC)CN1CC=C(N(CCCC)CCCC)C=C1 GOSQQMYSNOUYHH-UHFFFAOYSA-N 0.000 description 1
- NPUHGMPAHSKYLV-UHFFFAOYSA-M n,n-dibutyl-2-(2,2-dimethylpropyl)pyridin-1-ium-1-amine;chloride Chemical compound [Cl-].CCCCN(CCCC)[N+]1=CC=CC=C1CC(C)(C)C NPUHGMPAHSKYLV-UHFFFAOYSA-M 0.000 description 1
- VRWJOISQKOAUMR-UHFFFAOYSA-N n,n-dibutylpyridin-4-amine Chemical compound CCCCN(CCCC)C1=CC=NC=C1 VRWJOISQKOAUMR-UHFFFAOYSA-N 0.000 description 1
- XUQIFOGEVSWOOY-UHFFFAOYSA-N n,n-dihexylpyridin-4-amine Chemical compound CCCCCCN(CCCCCC)C1=CC=NC=C1 XUQIFOGEVSWOOY-UHFFFAOYSA-N 0.000 description 1
- ZOTDNDFSPQYKLY-UHFFFAOYSA-N n,n-dimethyl-1-octyl-2h-pyridin-4-amine Chemical compound CCCCCCCCN1CC=C(N(C)C)C=C1 ZOTDNDFSPQYKLY-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pyridine Compounds (AREA)
- Indole Compounds (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US489689 | 1983-04-28 | ||
| US06/489,689 US4513141A (en) | 1983-04-28 | 1983-04-28 | Method for making aromatic ethers using diorganoamino pyridinum salt catalyst |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS61197537A JPS61197537A (ja) | 1986-09-01 |
| JPH0238575B2 true JPH0238575B2 (enExample) | 1990-08-31 |
Family
ID=23944877
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59084197A Granted JPS604134A (ja) | 1983-04-28 | 1984-04-27 | 相間移動触媒 |
| JP60261640A Granted JPS61197537A (ja) | 1983-04-28 | 1985-11-22 | 芳香族エ−テルの製法 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59084197A Granted JPS604134A (ja) | 1983-04-28 | 1984-04-27 | 相間移動触媒 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4513141A (enExample) |
| EP (1) | EP0126950B1 (enExample) |
| JP (2) | JPS604134A (enExample) |
| DE (1) | DE3484862D1 (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4681949A (en) * | 1983-11-21 | 1987-07-21 | General Electric Company | Bis-aminopyridinium salts as phase transfer catalysts for aromatic ether imide preparation |
| DE3681033D1 (de) * | 1986-01-06 | 1991-09-26 | Mallinckrodt Inc | Katalytisches verfahren zur herstellung von fluoraomatischen verbindungen mittels n-sek-alkylpyridiniumsalze. |
| DE3681032D1 (de) * | 1986-01-06 | 1991-09-26 | Mallinckrodt Inc | Katalytisches verfahren zur herstellung von fluoraromatischen verbindungen mit substituierten pyridiniumsalzen. |
| DE3681919D1 (de) * | 1986-01-06 | 1991-11-14 | Mallinckrodt Speciality Chemic | Katalytisches verfahren zur herstellung von fluoraromatischen verbindungen mittels verzweigter alkylpyridiniumsalze. |
| US5068353A (en) * | 1986-12-31 | 1991-11-26 | General Electric Company | Synthesis of aromatic bis(ether phthalimide) compounds |
| US4973772A (en) * | 1987-02-07 | 1990-11-27 | Mallinckrodt, Inc. | Catalytic method for producing fluoroarmatic compounds using substituted pyridinium salts |
| US4808731A (en) * | 1988-03-04 | 1989-02-28 | General Electric Company | Method for making oxydiphthalic anhydride |
| US5132423A (en) * | 1990-02-05 | 1992-07-21 | General Electric Company | Method for conducting organic reactions using guanidinium salt as phase transfer catalyst |
| US5229482A (en) * | 1991-02-28 | 1993-07-20 | General Electric Company | Phase transfer catalyzed preparation of aromatic polyether polymers |
| US5663275A (en) * | 1996-07-05 | 1997-09-02 | General Electric Company | Preparation of polyether polymers using bisphenol hydrate as intermediate |
| US20060029671A1 (en) * | 2004-08-06 | 2006-02-09 | Grain Processing Corporation | Tablet coating composition |
| US20060069291A1 (en) * | 2004-09-24 | 2006-03-30 | General Electric Company | Phosphazenium salt phase transfer catalysts |
| US7273919B1 (en) * | 2005-11-21 | 2007-09-25 | General Electric Company | High heat polyethersulfone compositions |
| US20070117962A1 (en) * | 2005-11-21 | 2007-05-24 | General Electric Company | High heat polyethersulfone compositions |
| US20080004443A1 (en) * | 2006-07-03 | 2008-01-03 | General Electric Company | Sulfonated polyaryletherketone-block-polyethersulfone copolymers |
| US8080671B2 (en) | 2008-05-23 | 2011-12-20 | Sabic Innovative Plastics Ip B.V. | Production of low color polyetherimides |
| JP6548954B2 (ja) | 2015-05-21 | 2019-07-24 | 株式会社東芝 | 還元触媒及び化学反応装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852242A (en) * | 1973-12-03 | 1974-12-03 | Gen Electric | Method for making polyetherimide |
| US4140853A (en) * | 1975-04-18 | 1979-02-20 | Schering Aktiengesellschaft | Process for the preparation of aminopyridines |
| GB1539183A (en) * | 1975-07-31 | 1979-01-31 | Ici Ltd | Process for the manufacture of aromatic ethers |
| US4158093A (en) * | 1977-12-15 | 1979-06-12 | Reilly Tar & Chemical Corporation | Process for substituting and dequaternizing pyridylethyl quaternary salts of pyridine and bypyridine bases |
| US4202993A (en) * | 1979-05-09 | 1980-05-13 | General Electric Company | Method for making substantially anhydrous alkali metal bisphenol salts |
| US4273712A (en) * | 1979-05-09 | 1981-06-16 | General Electric Company | Method for making aromatic ether imides |
| US4257953A (en) * | 1979-05-09 | 1981-03-24 | General Electric Company | Method for making bisphenoxide salts and bisimides derived therefrom |
-
1983
- 1983-04-28 US US06/489,689 patent/US4513141A/en not_active Expired - Lifetime
-
1984
- 1984-04-18 DE DE8484104386T patent/DE3484862D1/de not_active Expired - Lifetime
- 1984-04-18 EP EP84104386A patent/EP0126950B1/en not_active Expired
- 1984-04-27 JP JP59084197A patent/JPS604134A/ja active Granted
-
1985
- 1985-11-22 JP JP60261640A patent/JPS61197537A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0126950A2 (en) | 1984-12-05 |
| EP0126950A3 (en) | 1987-12-09 |
| JPS604134A (ja) | 1985-01-10 |
| EP0126950B1 (en) | 1991-07-31 |
| DE3484862D1 (de) | 1991-09-05 |
| JPS6338350B2 (enExample) | 1988-07-29 |
| US4513141A (en) | 1985-04-23 |
| JPS61197537A (ja) | 1986-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0238575B2 (enExample) | ||
| JPS6345381B2 (enExample) | ||
| EP0126951B1 (en) | Phase transfer catalysts | |
| US4257953A (en) | Method for making bisphenoxide salts and bisimides derived therefrom | |
| US5132423A (en) | Method for conducting organic reactions using guanidinium salt as phase transfer catalyst | |
| US5081298A (en) | Bis(pentaalkylguanidinium) alkane salts as phase transfer catalysts | |
| JPH0336576B2 (enExample) | ||
| US4329292A (en) | Continuous method for making aromatic bis(ether phthalic acid) or aromatic bis(ether anhydride) | |
| EP0142835B1 (en) | Bis-aminopyridinium salts and their use as phase transfer catalysts for aromatic ether imide preparation | |
| US4605745A (en) | N-neopentyl-4-diorganoamino pyridinium compounds | |
| US4681949A (en) | Bis-aminopyridinium salts as phase transfer catalysts for aromatic ether imide preparation | |
| US4302616A (en) | Method for making alkali metal bisphenoxide salts and bisimides derived therefrom | |
| EP0141692A1 (en) | Bis-quaternary salts as phase transfer catalysts for aromatic ether imide preparation | |
| JP3179649B2 (ja) | 芳香族エーテルビスイミドの製法 | |
| EP0108682B1 (en) | Solvent free preparation of diarylthioethers | |
| US4476309A (en) | Method for making aromatic etherimides | |
| EP0172298B1 (en) | Method for making thioether(bisphthalimide)s | |
| US6881815B2 (en) | Method for the preparation poly(etherimide)s | |
| EP0107542A1 (en) | Method for making aromatic bis(etherimide)s | |
| CA2034435A1 (en) | Method for conducting organic reactions using hexaalkylguanidinium salt as phase transfer catalyst | |
| JP3376598B2 (ja) | 2−プロパノール化合物の製造方法 | |
| CA2044470A1 (en) | Method for conducting organic reactions using guanidinium salt as phase transfer catalyst | |
| JPS60204761A (ja) | 芳香族エ−テルイミドの製造法 | |
| CA1144554A (en) | Method for making aromatic ether imides | |
| JPH0225902B2 (enExample) |