JPH0215563B2 - - Google Patents
Info
- Publication number
- JPH0215563B2 JPH0215563B2 JP60098175A JP9817585A JPH0215563B2 JP H0215563 B2 JPH0215563 B2 JP H0215563B2 JP 60098175 A JP60098175 A JP 60098175A JP 9817585 A JP9817585 A JP 9817585A JP H0215563 B2 JPH0215563 B2 JP H0215563B2
- Authority
- JP
- Japan
- Prior art keywords
- compound
- polymerization
- lithium
- examples
- modifier
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 cyclic acetal Chemical class 0.000 claims description 37
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 claims description 32
- 150000001993 dienes Chemical class 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 30
- 238000006116 polymerization reaction Methods 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 20
- 229940015043 glyoxal Drugs 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 15
- 239000000178 monomer Substances 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 9
- 230000000379 polymerizing effect Effects 0.000 claims description 9
- 239000011777 magnesium Substances 0.000 claims description 8
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 7
- 229910052749 magnesium Inorganic materials 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 150000002681 magnesium compounds Chemical class 0.000 claims description 5
- 125000005702 oxyalkylene group Chemical group 0.000 claims description 5
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- 150000001491 aromatic compounds Chemical class 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 150000002642 lithium compounds Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 239000012454 non-polar solvent Substances 0.000 claims 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 43
- 239000003607 modifier Substances 0.000 description 35
- 239000003999 initiator Substances 0.000 description 32
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 30
- 229920000642 polymer Polymers 0.000 description 25
- 229910052744 lithium Inorganic materials 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 20
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 19
- 239000000047 product Substances 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 125000000129 anionic group Chemical group 0.000 description 7
- 229920001577 copolymer Polymers 0.000 description 7
- 229920001971 elastomer Polymers 0.000 description 7
- 150000002902 organometallic compounds Chemical class 0.000 description 7
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- KJJBSBKRXUVBMX-UHFFFAOYSA-N magnesium;butane Chemical compound [Mg+2].CCC[CH2-].CCC[CH2-] KJJBSBKRXUVBMX-UHFFFAOYSA-N 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 125000002524 organometallic group Chemical group 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 229920002857 polybutadiene Polymers 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000005062 Polybutadiene Substances 0.000 description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 2
- BVQVLAIMHVDZEL-UHFFFAOYSA-N 1-phenyl-1,2-propanedione Chemical compound CC(=O)C(=O)C1=CC=CC=C1 BVQVLAIMHVDZEL-UHFFFAOYSA-N 0.000 description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- DBNGNEQZXBWPTJ-UHFFFAOYSA-N CCCC[Mg]C(C)CC Chemical compound CCCC[Mg]C(C)CC DBNGNEQZXBWPTJ-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000002900 organolithium compounds Chemical class 0.000 description 2
- 150000002901 organomagnesium compounds Chemical class 0.000 description 2
- 125000002734 organomagnesium group Chemical group 0.000 description 2
- OJUGVDODNPJEEC-UHFFFAOYSA-N phenylglyoxal Chemical compound O=CC(=O)C1=CC=CC=C1 OJUGVDODNPJEEC-UHFFFAOYSA-N 0.000 description 2
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical compound CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 2
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical group CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- BOGRNZQRTNVZCZ-AATRIKPKSA-N (3e)-3-methylpenta-1,3-diene Chemical compound C\C=C(/C)C=C BOGRNZQRTNVZCZ-AATRIKPKSA-N 0.000 description 1
- OGQVROWWFUXRST-FNORWQNLSA-N (3e)-hepta-1,3-diene Chemical compound CCC\C=C\C=C OGQVROWWFUXRST-FNORWQNLSA-N 0.000 description 1
- AHAREKHAZNPPMI-AATRIKPKSA-N (3e)-hexa-1,3-diene Chemical compound CC\C=C\C=C AHAREKHAZNPPMI-AATRIKPKSA-N 0.000 description 1
- BOGRNZQRTNVZCZ-UHFFFAOYSA-N 1,2-dimethyl-butadiene Natural products CC=C(C)C=C BOGRNZQRTNVZCZ-UHFFFAOYSA-N 0.000 description 1
- CORMBJOFDGICKF-UHFFFAOYSA-N 1,3,5-trimethoxy 2-vinyl benzene Natural products COC1=CC(OC)=C(C=C)C(OC)=C1 CORMBJOFDGICKF-UHFFFAOYSA-N 0.000 description 1
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- VDNSZPNSUQRUMS-UHFFFAOYSA-N 1-cyclohexyl-4-ethenylbenzene Chemical compound C1=CC(C=C)=CC=C1C1CCCCC1 VDNSZPNSUQRUMS-UHFFFAOYSA-N 0.000 description 1
- WJNKJKGZKFOLOJ-UHFFFAOYSA-N 1-dodecyl-4-ethenylbenzene Chemical compound CCCCCCCCCCCCC1=CC=C(C=C)C=C1 WJNKJKGZKFOLOJ-UHFFFAOYSA-N 0.000 description 1
- KPLXLTQPPCAJHY-UHFFFAOYSA-N 1-ethenyl-2,4-di(propan-2-yl)naphthalene Chemical compound C1=CC=CC2=C(C=C)C(C(C)C)=CC(C(C)C)=C21 KPLXLTQPPCAJHY-UHFFFAOYSA-N 0.000 description 1
- HVOKBODBWQEEGI-UHFFFAOYSA-N 1-ethenyl-3,5-diethylbenzene Chemical compound CCC1=CC(CC)=CC(C=C)=C1 HVOKBODBWQEEGI-UHFFFAOYSA-N 0.000 description 1
- QDLUTRRUISEVDW-UHFFFAOYSA-N 1-ethenyl-3,5-diphenoxybenzene Chemical compound C=1C(OC=2C=CC=CC=2)=CC(C=C)=CC=1OC1=CC=CC=C1 QDLUTRRUISEVDW-UHFFFAOYSA-N 0.000 description 1
- ITZRCVCLPNYQNR-UHFFFAOYSA-N 1-ethenyl-3,6-bis(4-methylphenyl)naphthalene Chemical compound C1=CC(C)=CC=C1C1=CC=C(C(C=C)=CC(=C2)C=3C=CC(C)=CC=3)C2=C1 ITZRCVCLPNYQNR-UHFFFAOYSA-N 0.000 description 1
- SQOPXLQDBNQBOP-UHFFFAOYSA-N 1-ethenyl-3,6-dihexylnaphthalene Chemical compound C=CC1=CC(CCCCCC)=CC2=CC(CCCCCC)=CC=C21 SQOPXLQDBNQBOP-UHFFFAOYSA-N 0.000 description 1
- ACIJYLHNXMGEES-UHFFFAOYSA-N 1-ethenyl-3-(4-hexylphenyl)benzene Chemical compound C1=CC(CCCCCC)=CC=C1C1=CC=CC(C=C)=C1 ACIJYLHNXMGEES-UHFFFAOYSA-N 0.000 description 1
- LFZRKMOWVSTEMD-UHFFFAOYSA-N 1-ethenyl-3-ethylnaphthalene Chemical compound C1=CC=CC2=CC(CC)=CC(C=C)=C21 LFZRKMOWVSTEMD-UHFFFAOYSA-N 0.000 description 1
- XTUJFEHBYGQMFD-UHFFFAOYSA-N 1-ethenyl-3-hexyl-5-methylbenzene Chemical compound CCCCCCC1=CC(C)=CC(C=C)=C1 XTUJFEHBYGQMFD-UHFFFAOYSA-N 0.000 description 1
- SLTFHEGNHNSPTC-UHFFFAOYSA-N 1-ethenyl-4,5-diethyl-8-octylnaphthalene Chemical compound C1=CC(C=C)=C2C(CCCCCCCC)=CC=C(CC)C2=C1CC SLTFHEGNHNSPTC-UHFFFAOYSA-N 0.000 description 1
- FWNGRKSQEBCGAX-UHFFFAOYSA-N 1-ethenyl-4,5-dimethylnaphthalene Chemical compound C1=CC(C)=C2C(C)=CC=CC2=C1C=C FWNGRKSQEBCGAX-UHFFFAOYSA-N 0.000 description 1
- RRRXUCMQOPNVAT-UHFFFAOYSA-N 1-ethenyl-4-(4-methylphenyl)benzene Chemical compound C1=CC(C)=CC=C1C1=CC=C(C=C)C=C1 RRRXUCMQOPNVAT-UHFFFAOYSA-N 0.000 description 1
- JHTICDZLXFNVKL-UHFFFAOYSA-N 1-ethenyl-4-(4-phenylbutyl)benzene Chemical compound C1=CC(C=C)=CC=C1CCCCC1=CC=CC=C1 JHTICDZLXFNVKL-UHFFFAOYSA-N 0.000 description 1
- UAJRSHJHFRVGMG-UHFFFAOYSA-N 1-ethenyl-4-methoxybenzene Chemical compound COC1=CC=C(C=C)C=C1 UAJRSHJHFRVGMG-UHFFFAOYSA-N 0.000 description 1
- UDBOTPBQDGDMHZ-UHFFFAOYSA-N 1-ethenyl-4-methoxynaphthalene Chemical compound C1=CC=C2C(OC)=CC=C(C=C)C2=C1 UDBOTPBQDGDMHZ-UHFFFAOYSA-N 0.000 description 1
- VVTGQMLRTKFKAM-UHFFFAOYSA-N 1-ethenyl-4-propylbenzene Chemical compound CCCC1=CC=C(C=C)C=C1 VVTGQMLRTKFKAM-UHFFFAOYSA-N 0.000 description 1
- UVRJZDWOXMDOLE-UHFFFAOYSA-N 1-ethenyl-5-(2,4,6-trimethylphenyl)naphthalene Chemical compound CC1=CC(C)=CC(C)=C1C1=CC=CC2=C(C=C)C=CC=C12 UVRJZDWOXMDOLE-UHFFFAOYSA-N 0.000 description 1
- KXHFPILRDXTWCG-UHFFFAOYSA-N 1-ethenyl-6-phenoxynaphthalene Chemical compound C=1C=C2C(C=C)=CC=CC2=CC=1OC1=CC=CC=C1 KXHFPILRDXTWCG-UHFFFAOYSA-N 0.000 description 1
- ZUJBNWMWGTYWMW-UHFFFAOYSA-N 1-ethenyl-6-propan-2-ylnaphthalene Chemical compound C=CC1=CC=CC2=CC(C(C)C)=CC=C21 ZUJBNWMWGTYWMW-UHFFFAOYSA-N 0.000 description 1
- HGJHLJMJLXNPCN-UHFFFAOYSA-N 1-ethenyl-8-phenylnaphthalene Chemical compound C=12C(C=C)=CC=CC2=CC=CC=1C1=CC=CC=C1 HGJHLJMJLXNPCN-UHFFFAOYSA-N 0.000 description 1
- LLVWLCAZSOLOTF-UHFFFAOYSA-N 1-methyl-4-[1,4,4-tris(4-methylphenyl)buta-1,3-dienyl]benzene Chemical compound C1=CC(C)=CC=C1C(C=1C=CC(C)=CC=1)=CC=C(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 LLVWLCAZSOLOTF-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- HMWCQCYUKQZPRA-UHFFFAOYSA-N 2,4-dimethyl-3-methylidenepent-1-ene Chemical compound CC(C)C(=C)C(C)=C HMWCQCYUKQZPRA-UHFFFAOYSA-N 0.000 description 1
- CKHZIQSIFVVOPV-UHFFFAOYSA-N 2-benzyl-6-ethenylnaphthalene Chemical compound C1=CC2=CC(C=C)=CC=C2C=C1CC1=CC=CC=C1 CKHZIQSIFVVOPV-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- ABERXULXRGIGTD-UHFFFAOYSA-N 2-dodecyl-7-ethenylnaphthalene Chemical compound C1=CC(C=C)=CC2=CC(CCCCCCCCCCCC)=CC=C21 ABERXULXRGIGTD-UHFFFAOYSA-N 0.000 description 1
- PDELBHCVXBSVPJ-UHFFFAOYSA-N 2-ethenyl-1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=C(C=C)C(C)=C1 PDELBHCVXBSVPJ-UHFFFAOYSA-N 0.000 description 1
- SRMZYEFPTMKJKC-UHFFFAOYSA-N 2-ethenyl-3,6-diethylnaphthalene Chemical compound C1=C(C=C)C(CC)=CC2=CC(CC)=CC=C21 SRMZYEFPTMKJKC-UHFFFAOYSA-N 0.000 description 1
- AZGSYWLMNASAIP-UHFFFAOYSA-N 2-ethenyl-5-hexoxy-1,3-dimethylbenzene Chemical compound CCCCCCOC1=CC(C)=C(C=C)C(C)=C1 AZGSYWLMNASAIP-UHFFFAOYSA-N 0.000 description 1
- NXQCTTGTKAKPIJ-UHFFFAOYSA-N 2-ethenyl-5-methoxy-n,n-dipropylaniline Chemical compound CCCN(CCC)C1=CC(OC)=CC=C1C=C NXQCTTGTKAKPIJ-UHFFFAOYSA-N 0.000 description 1
- QKZQFURPHHQMCN-UHFFFAOYSA-N 2-ethoxy-3-methylhexa-1,3-diene Chemical compound CCOC(=C)C(C)=CCC QKZQFURPHHQMCN-UHFFFAOYSA-N 0.000 description 1
- UNBLCMHLEQHORH-UHFFFAOYSA-N 2-ethoxy-3-methylidenepent-1-ene Chemical compound CCOC(=C)C(=C)CC UNBLCMHLEQHORH-UHFFFAOYSA-N 0.000 description 1
- PJXJBPMWCKMWLS-UHFFFAOYSA-N 2-methyl-3-methylidenepent-1-ene Chemical compound CCC(=C)C(C)=C PJXJBPMWCKMWLS-UHFFFAOYSA-N 0.000 description 1
- KUFLEYZWYCAZCC-UHFFFAOYSA-N 2-methylhexa-1,3-diene Chemical compound CCC=CC(C)=C KUFLEYZWYCAZCC-UHFFFAOYSA-N 0.000 description 1
- SPXWGAHNKXLXAP-UHFFFAOYSA-N 2-methylpentane-1,3-diol Chemical compound CCC(O)C(C)CO SPXWGAHNKXLXAP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- IKEHOXWJQXIQAG-UHFFFAOYSA-N 2-tert-butyl-4-methylphenol Chemical compound CC1=CC=C(O)C(C(C)(C)C)=C1 IKEHOXWJQXIQAG-UHFFFAOYSA-N 0.000 description 1
- KXYAVSFOJVUIHT-UHFFFAOYSA-N 2-vinylnaphthalene Chemical compound C1=CC=CC2=CC(C=C)=CC=C21 KXYAVSFOJVUIHT-UHFFFAOYSA-N 0.000 description 1
- QTTAWIGVQMSWMV-UHFFFAOYSA-N 3,4-dimethylhexa-1,3-diene Chemical compound CCC(C)=C(C)C=C QTTAWIGVQMSWMV-UHFFFAOYSA-N 0.000 description 1
- OAOZZYBUAWEDRA-UHFFFAOYSA-N 3,4-dimethylidenehexane Chemical compound CCC(=C)C(=C)CC OAOZZYBUAWEDRA-UHFFFAOYSA-N 0.000 description 1
- NKNFAANDGREMJT-UHFFFAOYSA-N 3-ethenyl-1-(4-methylphenyl)naphthalene Chemical compound C1=CC(C)=CC=C1C1=CC(C=C)=CC2=CC=CC=C12 NKNFAANDGREMJT-UHFFFAOYSA-N 0.000 description 1
- QXNYNMNRJMHGHH-UHFFFAOYSA-N 3-ethyl-2-methylpenta-1,3-diene Chemical compound CCC(=CC)C(C)=C QXNYNMNRJMHGHH-UHFFFAOYSA-N 0.000 description 1
- CTNXNQQXFSVMIY-UHFFFAOYSA-N 3-ethylidenehex-1-ene Chemical compound CCCC(=CC)C=C CTNXNQQXFSVMIY-UHFFFAOYSA-N 0.000 description 1
- GITIYCQMJWQMKC-UHFFFAOYSA-N 3-methylhepta-1,3-diene Chemical compound CCCC=C(C)C=C GITIYCQMJWQMKC-UHFFFAOYSA-N 0.000 description 1
- OCTVDLUSQOJZEK-UHFFFAOYSA-N 4,5-diethylocta-1,3-diene Chemical compound CCCC(CC)C(CC)=CC=C OCTVDLUSQOJZEK-UHFFFAOYSA-N 0.000 description 1
- SALPZWUZFRNPQX-UHFFFAOYSA-N 4,5-dimethylideneoctane Chemical compound CCCC(=C)C(=C)CCC SALPZWUZFRNPQX-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- DXFURPHVJQITAC-UHFFFAOYSA-N 4-benzyl-1-ethenyl-2-ethylbenzene Chemical compound C1=C(C=C)C(CC)=CC(CC=2C=CC=CC=2)=C1 DXFURPHVJQITAC-UHFFFAOYSA-N 0.000 description 1
- NZGZIYSKIDVYSM-UHFFFAOYSA-N 4-ethenyl-1,2,7,8-tetramethylnaphthalene Chemical compound C=CC1=CC(C)=C(C)C2=C(C)C(C)=CC=C21 NZGZIYSKIDVYSM-UHFFFAOYSA-N 0.000 description 1
- XUMATWBCBIETCP-UHFFFAOYSA-N 4-ethenyl-2-n,7-n-dimethylnaphthalene-2,7-diamine Chemical compound C=CC1=CC(NC)=CC2=CC(NC)=CC=C21 XUMATWBCBIETCP-UHFFFAOYSA-N 0.000 description 1
- GQWAOUOHRMHSHL-UHFFFAOYSA-N 4-ethenyl-n,n-dimethylaniline Chemical compound CN(C)C1=CC=C(C=C)C=C1 GQWAOUOHRMHSHL-UHFFFAOYSA-N 0.000 description 1
- ZSNRMRKAYAJYRZ-UHFFFAOYSA-N 4-methylidenehex-2-ene Chemical compound CCC(=C)C=CC ZSNRMRKAYAJYRZ-UHFFFAOYSA-N 0.000 description 1
- ISOZCELAVOWCBX-UHFFFAOYSA-N 5-ethenyl-1-n,3-n-diethylbenzene-1,3-diamine Chemical compound CCNC1=CC(NCC)=CC(C=C)=C1 ISOZCELAVOWCBX-UHFFFAOYSA-N 0.000 description 1
- UGWOAPBVIGCNOV-UHFFFAOYSA-N 5-ethenyldec-5-ene Chemical compound CCCCC=C(C=C)CCCC UGWOAPBVIGCNOV-UHFFFAOYSA-N 0.000 description 1
- GYLGGODPGFTNRX-UHFFFAOYSA-N 6-cyclohexyl-1-ethenylnaphthalene Chemical compound C=1C=C2C(C=C)=CC=CC2=CC=1C1CCCCC1 GYLGGODPGFTNRX-UHFFFAOYSA-N 0.000 description 1
- CVLVQJAXBADOOC-UHFFFAOYSA-N 6-ethenyl-1,2-diethyl-7-methyl-4-propylnaphthalene Chemical compound CC1=C(C=C)C=C2C(CCC)=CC(CC)=C(CC)C2=C1 CVLVQJAXBADOOC-UHFFFAOYSA-N 0.000 description 1
- DHNDHEGZRUFPAN-UHFFFAOYSA-N 6-ethenyl-1-(3-phenylpropyl)naphthalene Chemical compound C=1C=CC2=CC(C=C)=CC=C2C=1CCCC1=CC=CC=C1 DHNDHEGZRUFPAN-UHFFFAOYSA-N 0.000 description 1
- RRGRCBYNXFIHGR-UHFFFAOYSA-N 8-butyl-3-ethenyl-1-propylnaphthalene Chemical compound C=CC1=CC(CCC)=C2C(CCCC)=CC=CC2=C1 RRGRCBYNXFIHGR-UHFFFAOYSA-N 0.000 description 1
- YMTKZUROOGUACT-UHFFFAOYSA-N CC(C)CC[Mg]CCC(C)C Chemical compound CC(C)CC[Mg]CCC(C)C YMTKZUROOGUACT-UHFFFAOYSA-N 0.000 description 1
- IHOGIGROCOUFES-UHFFFAOYSA-N CC(C)C[Mg]C(C)C Chemical compound CC(C)C[Mg]C(C)C IHOGIGROCOUFES-UHFFFAOYSA-N 0.000 description 1
- SPXDYPYJHCSREL-UHFFFAOYSA-N CCC(C)[Mg]C(C)CC Chemical compound CCC(C)[Mg]C(C)CC SPXDYPYJHCSREL-UHFFFAOYSA-N 0.000 description 1
- KCMZYCFSSYXEQR-UHFFFAOYSA-N CCCC[K] Chemical compound CCCC[K] KCMZYCFSSYXEQR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- SLPLCLDJTNLWPW-UHFFFAOYSA-N barium(2+);2-methylpropan-2-olate Chemical compound [Ba+2].CC(C)(C)[O-].CC(C)(C)[O-] SLPLCLDJTNLWPW-UHFFFAOYSA-N 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- XZKRXPZXQLARHH-UHFFFAOYSA-N buta-1,3-dienylbenzene Chemical compound C=CC=CC1=CC=CC=C1 XZKRXPZXQLARHH-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- UWJQRYVWXZGVQT-UHFFFAOYSA-N butane-2,3-dione Chemical compound CC(=O)C(C)=O.CC(=O)C(C)=O UWJQRYVWXZGVQT-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- DIOQZVSQGTUSAI-NJFSPNSNSA-N decane Chemical compound CCCCCCCCC[14CH3] DIOQZVSQGTUSAI-NJFSPNSNSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 150000004985 diamines Chemical group 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- CCZVEWRRAVASGL-UHFFFAOYSA-N lithium;2-methanidylpropane Chemical compound [Li+].CC(C)[CH2-] CCZVEWRRAVASGL-UHFFFAOYSA-N 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- XBEREOHJDYAKDA-UHFFFAOYSA-N lithium;propane Chemical compound [Li+].CC[CH2-] XBEREOHJDYAKDA-UHFFFAOYSA-N 0.000 description 1
- RVOYYLUVELMWJF-UHFFFAOYSA-N magnesium;hexane Chemical compound [Mg+2].CCCCC[CH2-].CCCCC[CH2-] RVOYYLUVELMWJF-UHFFFAOYSA-N 0.000 description 1
- WCFJMDWWJOCLSJ-UHFFFAOYSA-N magnesium;methanidylbenzene Chemical compound [Mg+2].[CH2-]C1=CC=CC=C1.[CH2-]C1=CC=CC=C1 WCFJMDWWJOCLSJ-UHFFFAOYSA-N 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- DIOQZVSQGTUSAI-UHFFFAOYSA-N n-butylhexane Natural products CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002899 organoaluminium compounds Chemical class 0.000 description 1
- 125000001979 organolithium group Chemical group 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- HDBWAWNLGGMZRQ-UHFFFAOYSA-N p-Vinylbiphenyl Chemical compound C1=CC(C=C)=CC=C1C1=CC=CC=C1 HDBWAWNLGGMZRQ-UHFFFAOYSA-N 0.000 description 1
- GTCCGKPBSJZVRZ-UHFFFAOYSA-N pentane-2,4-diol Chemical compound CC(O)CC(C)O GTCCGKPBSJZVRZ-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004351 phenylcyclohexyl group Chemical group C1(=CC=CC=C1)C1(CCCCC1)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- GGFBICGBDXVAGX-UHFFFAOYSA-N propylaluminum Chemical compound [Al].[CH2]CC GGFBICGBDXVAGX-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010058 rubber compounding Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F36/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F36/02—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F36/04—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/627,246 US4520123A (en) | 1984-07-02 | 1984-07-02 | Catalyst system and process for polymerizing conjugated dienes |
| US627246 | 1984-07-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6119610A JPS6119610A (ja) | 1986-01-28 |
| JPH0215563B2 true JPH0215563B2 (enFirst) | 1990-04-12 |
Family
ID=24513849
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP60098175A Granted JPS6119610A (ja) | 1984-07-02 | 1985-05-10 | 重合方法 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4520123A (enFirst) |
| EP (1) | EP0171497B1 (enFirst) |
| JP (1) | JPS6119610A (enFirst) |
| CA (1) | CA1236824A (enFirst) |
| DE (1) | DE3567882D1 (enFirst) |
| ES (1) | ES8604269A1 (enFirst) |
| ZA (1) | ZA851662B (enFirst) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4696986A (en) * | 1986-08-12 | 1987-09-29 | The Goodyear Tire & Rubber Company | Modifier for lithium catalysts |
| US5112929A (en) * | 1991-04-05 | 1992-05-12 | Bridgestone Corporation | Oxolanyl cyclic acetals as anionic polymerization modifiers |
| GB9112419D0 (en) * | 1991-06-10 | 1991-07-31 | Shell Int Research | Process for polymer preparation |
| IT1265048B1 (it) * | 1993-08-06 | 1996-10-28 | Eniricerche Spa | Complessi metallorganici dei lantanidi e loro uso nella polimerizzazione di monomeri insaturi |
| US5610227A (en) * | 1995-06-07 | 1997-03-11 | Bridgestone/Firestone, Inc. | Lithium amino magnesiate polymerization initiators and elastomers having reduced hysteresis |
| US5700888A (en) * | 1996-11-07 | 1997-12-23 | Bridgestone Corporation | Synthesis of macrocyclic polymers having low hysteresis compounded properties |
| US5728782A (en) * | 1996-12-06 | 1998-03-17 | Union Carbide Chemicals & Plastics Technology Corporation | Gas phase anionic polymerization of dienes and vinyl-substituted aromatic compounds |
| US6136914A (en) * | 1998-03-13 | 2000-10-24 | Bridgestone Corporation | Anionic polymerization initiators for preparing macro-branched diene rubbers |
| US6071847A (en) | 1998-03-13 | 2000-06-06 | Bridgestone Corporation | Gas phase anionic polymerization of diene elastomers |
| US6140444A (en) * | 1999-01-19 | 2000-10-31 | Loctite Corporation | Catalyst system, process, and silicone compositions |
| US6391981B1 (en) | 1999-04-23 | 2002-05-21 | Kraton Polymers Us Llc | Increased throughput in the manufacture of anionic polymers by reduction in polymer cement viscosity through the addition of metal alkyls |
| US6455651B1 (en) | 1999-04-23 | 2002-09-24 | Kraton Polymers U.S. Llc | Uniform initiation of anionic polymerization using organo-substituted alkali metal initiators |
| US6906147B2 (en) * | 2002-03-20 | 2005-06-14 | Cyclics Corporation | Catalytic systems |
| US7256241B2 (en) * | 2000-01-21 | 2007-08-14 | Cyclics Corporation | Methods for polymerizing macrocyclic polyester oligomers using catalyst promoters |
| US20020198343A1 (en) * | 2000-03-14 | 2002-12-26 | Willis Carl Lesley | Uniform initiation of anionic polymerization using organo-substituted alkali metal initiators |
| US7750109B2 (en) | 2000-09-01 | 2010-07-06 | Cyclics Corporation | Use of a residual oligomer recyclate in the production of macrocyclic polyester oligomer |
| US7767781B2 (en) | 2000-09-01 | 2010-08-03 | Cyclics Corporation | Preparation of low-acid polyalkylene terephthalate and preparation of macrocyclic polyester oligomer therefrom |
| US6525164B2 (en) * | 2000-09-01 | 2003-02-25 | Cyclics Corporation | Methods for converting linear polyesters to macrocyclic oligoester compositions and macrocyclic oligoesters |
| US7304123B2 (en) * | 2001-06-27 | 2007-12-04 | Cyclics Corporation | Processes for shaping macrocyclic oligoesters |
| DE60226789D1 (de) * | 2001-06-27 | 2008-07-03 | Cyclics Corp | Formgebende Verarbeitung von makrozyklischen Oligoestern |
| US6787632B2 (en) * | 2001-10-09 | 2004-09-07 | Cyclics Corporation | Organo-titanate catalysts for preparing pure macrocyclic oligoesters |
| DE60321467D1 (de) * | 2002-07-11 | 2008-07-17 | Kraton Polymers Res Bv | Gekoppelte styrolblockcopolymere und herstellungsverfahren dafür |
| SG159473A1 (en) * | 2008-08-27 | 2010-03-30 | Sumitomo Chemical Co | Conjugated diene polymer, conjugated diene polymer composition, and method for producing conjugated diene polymer |
| KR101762461B1 (ko) | 2009-10-14 | 2017-07-27 | 가부시키가이샤 브리지스톤 | 환식 비환식 디엔 공중합체의 제조 방법 및 고무 조성물 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3157604A (en) * | 1960-10-24 | 1964-11-17 | Phillips Petroleum Co | Polymerization initiators |
| US3091606A (en) * | 1960-11-21 | 1963-05-28 | Phillips Petroleum Co | Organolithium polymerization initiator prepared in the presence of a small amount of sodium |
| US3207742A (en) * | 1962-03-26 | 1965-09-21 | Exxon Research Engineering Co | Polymerization of 1, 3-dienes in the presence of hexamethylphosphoramide |
| US3301824A (en) * | 1963-09-26 | 1967-01-31 | Union Carbide Corp | Polymers of cyclic carbonates |
| US3451988A (en) * | 1966-10-25 | 1969-06-24 | Exxon Research Engineering Co | Polymerization catalyst and uses thereof |
| US3585168A (en) * | 1968-09-21 | 1971-06-15 | Shohei Inoue | Process for producing copolymer of epoxide and carbon dioxide |
| US3646321A (en) * | 1970-06-22 | 1972-02-29 | Gen Motors Corp | Infrared surface heating unit |
| US3822219A (en) * | 1970-07-23 | 1974-07-02 | Gulf Resources & Chem Corp | Catalyst composition |
| US3847883A (en) * | 1970-07-23 | 1974-11-12 | Gulf Research Development Co | Method of preparing polymers utilizing as catalysts hydrocarbon-soluble complexes of an organomagnesium compound with a group i organometallic compound |
| US3817955A (en) * | 1970-08-24 | 1974-06-18 | Gulf Resources & Chem Corp | Preparation of polymers using complexes of organomagnesiums with certain hydrides as catalysts |
| US3846385A (en) * | 1973-07-16 | 1974-11-05 | Gen Tire & Rubber Co | Preparation of solution polymers using a barium di-tert alkoxide and a di-butyl magnesium catalyst complex |
| US4139490A (en) * | 1977-11-07 | 1979-02-13 | The Firestone Tire & Rubber Company | Dehydrocarbyl magnesium and an alkali metal compound catalyst composition for polymerizing conjugated dienes |
| US4264753A (en) * | 1979-10-18 | 1981-04-28 | The Firestone Tire & Rubber Company | Process for polymerizing conjugated dienes |
| US4429091A (en) * | 1983-03-09 | 1984-01-31 | The Firestone Tire & Rubber Company | Oligomeric oxolanyl alkanes as modifiers for polymerization of dienes using lithium-based initiators |
| US4429090A (en) * | 1983-03-09 | 1984-01-31 | The Firestone Tire & Rubber Company | Catalyst containing oligomeric oxolanyl alkane modifiers and process for the production of polymers having increased 1,2-microstructure |
-
1984
- 1984-07-02 US US06/627,246 patent/US4520123A/en not_active Expired - Lifetime
-
1985
- 1985-03-05 ZA ZA851662A patent/ZA851662B/xx unknown
- 1985-03-13 DE DE8585102889T patent/DE3567882D1/de not_active Expired
- 1985-03-13 EP EP85102889A patent/EP0171497B1/en not_active Expired
- 1985-03-15 CA CA000476620A patent/CA1236824A/en not_active Expired
- 1985-05-10 JP JP60098175A patent/JPS6119610A/ja active Granted
- 1985-07-01 ES ES544742A patent/ES8604269A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1236824A (en) | 1988-05-17 |
| ES8604269A1 (es) | 1986-01-16 |
| EP0171497A1 (en) | 1986-02-19 |
| US4520123A (en) | 1985-05-28 |
| ZA851662B (en) | 1985-10-30 |
| JPS6119610A (ja) | 1986-01-28 |
| EP0171497B1 (en) | 1989-01-25 |
| ES544742A0 (es) | 1986-01-16 |
| DE3567882D1 (en) | 1989-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0215563B2 (enFirst) | ||
| US4591624A (en) | Catalyst system and process for polymerizing conjugated dienes | |
| US5605872A (en) | Functionalized amine initiators for anionic polymerization | |
| JP3828340B2 (ja) | 単分子カルボン酸ネオジム化合物及びこの化合物を含むジエン重合用触媒 | |
| US3294768A (en) | Preparation of conjugated diene polymers | |
| EP0098977B1 (en) | Catalyst system containing an anionic initiator and a phosphine oxide modifier and process for production of polymers having increased 1,2 microstructure | |
| CA2065103C (en) | Oxolanyl cyclic acetals as anionic polymerization modifiers | |
| US6455651B1 (en) | Uniform initiation of anionic polymerization using organo-substituted alkali metal initiators | |
| US4429090A (en) | Catalyst containing oligomeric oxolanyl alkane modifiers and process for the production of polymers having increased 1,2-microstructure | |
| US7470760B2 (en) | Diene elastomers with cyclic vinyl units and processes for obtaining same | |
| EP0098408B1 (en) | Catalyst containing a phosphine oxide modifier and process for production of polymers having increased 1,2-microstructure | |
| US20020022704A1 (en) | Process for producing di-or trifunctional initiator systems based on lithium and their use | |
| US3652456A (en) | Multifunctional polymerization initiators from allyl-substituted tertiary amines | |
| US4401800A (en) | Lithium alkoxide diamines as modifiers for polymerization of dienes using lithium-based initiators | |
| US4530984A (en) | Process for production of polymers having increased 1,2-microstructure | |
| US3944528A (en) | Solution diene elastomers by alkyl lithium catalysis | |
| EP0649861B1 (en) | 2,5-Substituted tetrahydrofurans as anionic initiator modifiers | |
| US3767632A (en) | Process for copolymerizing conjugated dienes | |
| JPH04252204A (ja) | 共役ジエンの単重合体又は共重合体の製造方法 | |
| US3384629A (en) | Method of shortstopping conjugated diene polymerizations | |
| JPH0359083B2 (enFirst) | ||
| US20020198343A1 (en) | Uniform initiation of anionic polymerization using organo-substituted alkali metal initiators | |
| JPH0235767B2 (enFirst) | ||
| US20030114592A1 (en) | Processes for improving stability of living polymer chain ends | |
| JP2759812B2 (ja) | 共役ジエン系重合体の製造方法および共役ジエン重合用触媒 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Cancellation because of no payment of annual fees |