JP6563644B2 - 調整可能な揚力修正翼端 - Google Patents
調整可能な揚力修正翼端 Download PDFInfo
- Publication number
- JP6563644B2 JP6563644B2 JP2014245937A JP2014245937A JP6563644B2 JP 6563644 B2 JP6563644 B2 JP 6563644B2 JP 2014245937 A JP2014245937 A JP 2014245937A JP 2014245937 A JP2014245937 A JP 2014245937A JP 6563644 B2 JP6563644 B2 JP 6563644B2
- Authority
- JP
- Japan
- Prior art keywords
- wing
- control surface
- aircraft
- vertical portion
- flight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000012937 correction Methods 0.000 title claims description 73
- 238000000034 method Methods 0.000 claims description 9
- 241000397426 Centroberyx lineatus Species 0.000 claims description 2
- 238000009826 distribution Methods 0.000 description 18
- 238000005452 bending Methods 0.000 description 6
- 230000008901 benefit Effects 0.000 description 4
- 230000009286 beneficial effect Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000002803 fossil fuel Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C23/00—Influencing air flow over aircraft surfaces, not otherwise provided for
- B64C23/06—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices
- B64C23/065—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices at the wing tips
- B64C23/069—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices at the wing tips using one or more wing tip airfoil devices, e.g. winglets, splines, wing tip fences or raked wingtips
- B64C23/072—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices at the wing tips using one or more wing tip airfoil devices, e.g. winglets, splines, wing tip fences or raked wingtips the wing tip airfoil devices being moveable in their entirety
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C13/00—Control systems or transmitting systems for actuating flying-control surfaces, lift-increasing flaps, air brakes, or spoilers
- B64C13/02—Initiating means
- B64C13/16—Initiating means actuated automatically, e.g. responsive to gust detectors
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C23/00—Influencing air flow over aircraft surfaces, not otherwise provided for
- B64C23/06—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices
- B64C23/065—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices at the wing tips
- B64C23/069—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices at the wing tips using one or more wing tip airfoil devices, e.g. winglets, splines, wing tip fences or raked wingtips
- B64C23/076—Influencing air flow over aircraft surfaces, not otherwise provided for by generating vortices at the wing tips using one or more wing tip airfoil devices, e.g. winglets, splines, wing tip fences or raked wingtips the wing tip airfoil devices comprising one or more separate moveable members thereon affecting the vortices, e.g. flaps
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C5/00—Stabilising surfaces
- B64C5/10—Stabilising surfaces adjustable
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02T—CLIMATE CHANGE MITIGATION TECHNOLOGIES RELATED TO TRANSPORTATION
- Y02T50/00—Aeronautics or air transport
- Y02T50/10—Drag reduction
Landscapes
- Engineering & Computer Science (AREA)
- Aviation & Aerospace Engineering (AREA)
- Automation & Control Theory (AREA)
- Toys (AREA)
- Aerodynamic Tests, Hydrodynamic Tests, Wind Tunnels, And Water Tanks (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14/097,122 US10562613B2 (en) | 2013-12-04 | 2013-12-04 | Adjustable lift modification wingtip |
| US14/097,122 | 2013-12-04 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2015155293A JP2015155293A (ja) | 2015-08-27 |
| JP2015155293A5 JP2015155293A5 (enExample) | 2018-01-25 |
| JP6563644B2 true JP6563644B2 (ja) | 2019-08-21 |
Family
ID=52015915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2014245937A Expired - Fee Related JP6563644B2 (ja) | 2013-12-04 | 2014-12-04 | 調整可能な揚力修正翼端 |
Country Status (4)
| Country | Link |
|---|---|
| US (3) | US10562613B2 (enExample) |
| EP (1) | EP2881322B1 (enExample) |
| JP (1) | JP6563644B2 (enExample) |
| AU (2) | AU2014271311B2 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20110127383A1 (en) * | 2009-12-01 | 2011-06-02 | Guida Associates Consulting, Inc. | Active winglet |
| US9162755B2 (en) | 2009-12-01 | 2015-10-20 | Tamarack Aerospace Group, Inc. | Multiple controllable airflow modification devices |
| GB201011843D0 (en) * | 2010-07-14 | 2010-09-01 | Airbus Operations Ltd | Wing tip device |
| ES2747639T3 (es) * | 2013-02-05 | 2020-03-11 | Tamarack Aerospace Group Inc | Control de carga periódica de dispositivo controlable de modificación de flujo de aire |
| US10562613B2 (en) * | 2013-12-04 | 2020-02-18 | Tamarack Aerospace Group, Inc. | Adjustable lift modification wingtip |
| US9873502B2 (en) * | 2016-01-05 | 2018-01-23 | The Boeing Company | Controlling airloads on aircraft folding wing tips |
| AT518606A1 (de) * | 2016-04-29 | 2017-11-15 | Facc Ag | Aerodynamischer Profilkörper für ein Flugzeug |
| GB2551554B (en) * | 2016-06-22 | 2018-08-15 | Airbus Operations Ltd | Methods of configuring a wing tip device on an aircraft |
| CN106516086A (zh) * | 2016-10-19 | 2017-03-22 | 戈晓宁 | 高隐身无平尾升力体布局飞机 |
| US10315752B2 (en) | 2016-12-19 | 2019-06-11 | The Boeing Company | Methods and apparatus to validate an aircraft control system command |
| US10293917B2 (en) | 2016-12-19 | 2019-05-21 | The Boeing Company | Methods and apparatus to control and monitor a folding wingtip actuation system |
| EP3396725B1 (en) * | 2017-04-25 | 2021-01-13 | Nichia Corporation | Light emitting device and method of manufacturing same |
| US11046434B2 (en) * | 2017-09-19 | 2021-06-29 | The Boeing Company | Methods and apparatus to align and secure aircraft |
| EP3492374A3 (en) * | 2017-11-29 | 2019-09-04 | Airbus Operations Limited | Retrofit flight control surface |
| EP3495258A1 (en) | 2017-12-06 | 2019-06-12 | Airbus Operations GmbH | Wing for an aircraft |
| GB2573281B (en) * | 2018-04-25 | 2020-12-30 | Airbus Operations Ltd | An aircraft wing and wing tip device |
| GB2576929A (en) * | 2018-09-07 | 2020-03-11 | Airbus Operations Ltd | A wing tip device |
| GB2621982A (en) * | 2022-08-24 | 2024-03-06 | Airbus Operations Ltd | Aircraft attitude controller and wing system |
| GB2628523B (en) * | 2022-11-16 | 2025-07-09 | Airbus Operations Ltd | Aircraft wing |
| US12365449B2 (en) * | 2023-12-01 | 2025-07-22 | Shiang Yu LEE | Wingtip shield |
Family Cites Families (180)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US857555A (en) | 1906-06-02 | 1907-06-18 | King Mfg Co | Water-heater. |
| US994968A (en) * | 1910-06-04 | 1911-06-13 | Georges Barbaudy | Supporting device for aviation. |
| US1050222A (en) * | 1911-03-16 | 1913-01-14 | Arthur Marshall Mcintosh | Aeroplane. |
| US1692081A (en) * | 1925-11-24 | 1928-11-20 | Cierva Juan De La | Aircraft with rotative wings |
| US1710673A (en) * | 1925-12-14 | 1929-04-23 | Bonney Flora Macdonald | Aeroplane wing or aerofoil structure |
| US1803498A (en) * | 1929-04-18 | 1931-05-05 | Aeromarine Plane & Motor Compa | Airplane control |
| US1841921A (en) * | 1929-12-04 | 1932-01-19 | Spiegel Jacob | Airplane construction |
| US2074201A (en) * | 1934-01-29 | 1937-03-16 | Avions Kellner Bechereau Soc | Airfoil used in aeronautics |
| US2123096A (en) * | 1935-03-22 | 1938-07-05 | Jean Frederic Georges Ma Charp | Aeroplane |
| US2418301A (en) * | 1942-07-24 | 1947-04-01 | Miles Aircraft Ltd | Aircraft supporting surface |
| US2565990A (en) * | 1945-10-31 | 1951-08-28 | Nat D Etudes & De Rech S Aeron | Wing-tip control surface for aircraft |
| US2576981A (en) * | 1949-02-08 | 1951-12-04 | Vogt Richard | Twisted wing tip fin for airplanes |
| US2775419A (en) * | 1952-01-26 | 1956-12-25 | Josef S J Hlobil | Fractional aspect ratio aircraft |
| US2805830A (en) * | 1952-07-01 | 1957-09-10 | Helmut P G A R Von Zborowski | Annular lift-producing wing |
| US3029018A (en) * | 1955-02-21 | 1962-04-10 | Dresser Ind | Two dimensional analog of a three dimensional phenomenon |
| US2846165A (en) * | 1956-06-25 | 1958-08-05 | John A Axelson | Aircraft control system |
| US3128371A (en) * | 1957-10-28 | 1964-04-07 | Gen Motors Corp | Method of predicting current distribution in an electroplating tank |
| US3218005A (en) * | 1961-12-06 | 1965-11-16 | Calderon Alberto Alvarez | High lift system for high speed aircraft |
| US3107882A (en) * | 1962-08-10 | 1963-10-22 | Electric Auto Lite Co | Yaw control system for vtol tilt wing aircraft |
| US3270988A (en) * | 1962-12-26 | 1966-09-06 | Jr Clarence D Cone | Minimum induced drag airfoil body |
| US3684217A (en) * | 1970-09-30 | 1972-08-15 | Aereon Corp | Aircraft |
| US3734432A (en) * | 1971-03-25 | 1973-05-22 | G Low | Suppression of flutter |
| US3840199A (en) * | 1972-05-09 | 1974-10-08 | R Tibbs | Aircraft |
| US3778926A (en) * | 1972-08-11 | 1973-12-18 | Gentle Toy Co Inc | Slow-flying aircraft |
| US3845918A (en) * | 1972-12-07 | 1974-11-05 | Rochester Applied Science Ass | Vortex dissipator |
| US4017041A (en) * | 1976-01-12 | 1977-04-12 | Nelson Wilbur C | Airfoil tip vortex control |
| US4172574A (en) * | 1976-06-16 | 1979-10-30 | National Research Development Corporation | Fluid stream deflecting members for aircraft bodies or the like |
| US4093160A (en) * | 1976-10-15 | 1978-06-06 | Reighart Ii Ray R | Free vortex aircraft |
| US4190219A (en) * | 1977-05-17 | 1980-02-26 | Lockheed Corporation | Vortex diffuser |
| US4108403A (en) * | 1977-08-05 | 1978-08-22 | Reginald Vernon Finch | Vortex reducing wing tip |
| DE2756107C2 (de) * | 1977-12-16 | 1980-02-28 | Messerschmitt-Boelkow-Blohm Gmbh, 8000 Muenchen | Hochwirksames Seitenleitwerk mit variabler Flügelgeometrie |
| US4245804B1 (en) * | 1977-12-19 | 1993-12-14 | K. Ishimitsu Kichio | Minimum drag wing configuration for aircraft operating at transonic speeds |
| US4205810A (en) * | 1977-12-19 | 1980-06-03 | The Boeing Company | Minimum drag wing configuration for aircraft operating at transonic speeds |
| USD259554S (en) * | 1978-07-05 | 1981-06-16 | Carl Parise | Aircraft |
| US4247063A (en) * | 1978-08-07 | 1981-01-27 | Lockheed Corporation | Flight control mechanism for airplanes |
| US4240597A (en) * | 1978-08-28 | 1980-12-23 | Gates Learjet Corporation | Wing with improved leading edge for aircraft |
| US4598885A (en) * | 1979-03-05 | 1986-07-08 | Waitzman Simon V | Airplane airframe |
| US4365773A (en) * | 1979-04-11 | 1982-12-28 | Julian Wolkovitch | Joined wing aircraft |
| US4382569A (en) * | 1979-12-26 | 1983-05-10 | Grumman Aerospace Corporation | Wing tip flow control |
| US4444365A (en) * | 1981-11-25 | 1984-04-24 | Omac, Inc. | Double cam mounting assembly for mounting an aircraft wing to a fuselage to provide an adjustable angle of attack |
| FR2521520A1 (fr) * | 1982-02-15 | 1983-08-19 | Daude Martine | Ailettes marginales a angles d'attaque variables |
| FR2523072A1 (fr) * | 1982-03-09 | 1983-09-16 | Cabrol Lucien | Aeronef pourvu d'une structure de sustentation a ailes superposees multiples |
| US4455004A (en) * | 1982-09-07 | 1984-06-19 | Lockheed Corporation | Flight control device for airplanes |
| US4429844A (en) * | 1982-09-29 | 1984-02-07 | The Boeing Company | Variable camber aircraft wing tip |
| DE3242584A1 (de) | 1982-11-18 | 1984-05-24 | Messerschmitt-Bölkow-Blohm GmbH, 8000 München | Anordnung von zusatzflaechen an den spitzen eines tragfluegels |
| GB8310224D0 (en) * | 1983-04-15 | 1983-05-18 | British Aerospace | Wing tip arrangement |
| US4595160A (en) * | 1983-05-18 | 1986-06-17 | Jonathan Santos | Wing tip airfoils |
| US4674709A (en) * | 1983-06-20 | 1987-06-23 | Welles Stanley W | Airframe design |
| US4545552A (en) * | 1983-06-20 | 1985-10-08 | Welles Stanley W | Airframe design |
| US4605183A (en) * | 1984-03-22 | 1986-08-12 | Gabriel Albert L | Swing wing glider |
| US4671473A (en) * | 1984-11-08 | 1987-06-09 | Goodson Kenneth W | Airfoil |
| NL8500950A (nl) * | 1985-03-29 | 1986-10-16 | Fokker Bv | Rolroer van een vliegtuigvleugel. |
| US4667906A (en) * | 1985-04-02 | 1987-05-26 | Grumman Aerospace Corporation | Replaceable tip for aircraft leading edge |
| GB8522270D0 (en) * | 1985-09-09 | 1985-10-16 | Wajnikonis K J | Velocity hydrofoils |
| DE3634250C1 (de) * | 1986-10-08 | 1988-03-03 | Dornier Gmbh | Fluggeraetesteuerung |
| US4776542A (en) * | 1987-05-27 | 1988-10-11 | Vigyan Research Associates, Inc. | Aircraft stall-spin entry deterrent system |
| US5039032A (en) * | 1988-11-07 | 1991-08-13 | The Boeing Company | High taper wing tip extension |
| US5072894A (en) * | 1989-10-02 | 1991-12-17 | Rockwell International Corporation | Apparatus and method for increasing the angle of attack operating range of an aircraft |
| BR9106696A (pt) * | 1990-07-25 | 1993-06-08 | Sadleir Vtol Aircraft Co Pty L | Unidade de empuxo para aeronave do tipo vtol |
| IL101069A (en) * | 1991-02-25 | 1996-09-12 | Valsan Partners Purchase N Y | A system for increasing the fuel efficiency of an aircraft and a kit for changing aircraft wings |
| US5102068A (en) * | 1991-02-25 | 1992-04-07 | Gratzer Louis B | Spiroid-tipped wing |
| US5156358A (en) * | 1991-04-11 | 1992-10-20 | Northrop Corporation | Aircraft outboard control |
| US5275358A (en) * | 1991-08-02 | 1994-01-04 | The Boeing Company | Wing/winglet configurations and methods for aircraft |
| US5348253A (en) * | 1993-02-01 | 1994-09-20 | Gratzer Louis B | Blended winglet |
| GB9321510D0 (en) | 1993-10-19 | 1993-12-22 | Short Brothers Plc | Aircraft flight control system |
| US5634613A (en) * | 1994-07-18 | 1997-06-03 | Mccarthy; Peter T. | Tip vortex generation technology for creating a lift enhancing and drag reducing upwash effect |
| DE69430198T2 (de) * | 1994-12-16 | 2003-07-10 | Aldo Frediani | Grossraumflugzeug |
| GB9600123D0 (en) * | 1996-01-04 | 1996-03-06 | Westland Helicopters | Aerofoil |
| IL119392A (en) * | 1996-10-09 | 2004-01-04 | Rafael Armament Dev Authority | Device for reducing the drag at the base of a body |
| US6161797A (en) * | 1996-11-25 | 2000-12-19 | Dugan Air Technologies, Inc. | Method and apparatus for reducing airplane noise |
| US6042059A (en) * | 1997-02-20 | 2000-03-28 | Continuum Dynamics, Inc. | System and method of vortex wake control using vortex leveraging |
| CA2291275C (en) * | 1997-06-13 | 2007-11-06 | The Boeing Company | Blunt-leading-edge raked wingtips |
| US5961068A (en) * | 1997-10-23 | 1999-10-05 | Northrop Grumman Corporation | Aerodynamic control effector |
| US5988563A (en) * | 1997-12-30 | 1999-11-23 | Mcdonnell Douglas Corporation | Articulating winglets |
| US6474604B1 (en) * | 1999-04-12 | 2002-11-05 | Jerry E. Carlow | Mobius-like joining structure for fluid dynamic foils |
| US6227487B1 (en) * | 1999-05-05 | 2001-05-08 | Northrop Grumman Corporation | Augmented wing tip drag flap |
| DE19926832B4 (de) * | 1999-06-12 | 2005-09-15 | Airbus Deutschland Gmbh | Unterschallflugzeug vorzugsweise mit gepfeilten Tragflügeln |
| DE19950403C2 (de) * | 1999-10-20 | 2002-02-07 | Deutsch Zentr Luft & Raumfahrt | Flugzeug mit Mitteln zum Reduzieren der Wirbelstärke des Flügelhauptwirbelpaars |
| US6260809B1 (en) * | 2000-04-05 | 2001-07-17 | United Technologies Corporation | Ovate loop for rotary-wing blades |
| US6666406B2 (en) * | 2000-06-29 | 2003-12-23 | The Boeing Company | Blended wing and multiple-body airplane configuration |
| US6394397B1 (en) * | 2000-12-06 | 2002-05-28 | The Boeing Company | Lifting surface with active variable tip member and method for influencing lifting surface behavior therewith |
| US6484968B2 (en) * | 2000-12-11 | 2002-11-26 | Fort F. Felker | Aircraft with elliptical winglets |
| DE10117721B4 (de) * | 2001-04-09 | 2007-09-27 | Gerd Heller | Flügelspitzenverlängerung für einen Flügel |
| GB0115130D0 (en) | 2001-06-21 | 2001-08-15 | Bae Systems Plc | A winglet |
| DE10160315A1 (de) * | 2001-12-07 | 2003-11-13 | Airbus Gmbh | Einrichtung zur Landeanflug-Steuerung eines Flugszeuges |
| US6578798B1 (en) * | 2002-04-08 | 2003-06-17 | Faruk Dizdarevic | Airlifting surface division |
| US6547181B1 (en) * | 2002-05-29 | 2003-04-15 | The Boeing Company | Ground effect wing having a variable sweep winglet |
| US6726149B2 (en) * | 2002-05-31 | 2004-04-27 | The Boeing Company | Derivative aircraft and methods for their manufacture |
| AU2003280422A1 (en) | 2002-06-26 | 2004-01-19 | Peter T. Mccarthy | High efficiency tip vortex reversal and induced drag reduction |
| FR2841532B1 (fr) * | 2002-06-27 | 2004-12-17 | Airbus France | Avion a controle actif du vrillage de ses ailes |
| US6926345B2 (en) * | 2002-09-20 | 2005-08-09 | The Regents Of The University Of California | Apparatus and method for reducing drag of a bluff body in ground effect using counter-rotating vortex pairs |
| US7048228B2 (en) * | 2002-10-09 | 2006-05-23 | The Boeing Company | Slotted aircraft wing |
| US6766981B2 (en) * | 2002-10-25 | 2004-07-27 | Northrop Grumman Corporation | Control system for alleviating a gust load on an aircraft wing |
| EP1583904B1 (de) * | 2003-01-02 | 2013-10-02 | Wobben Properties GmbH | Windturbinenrotorblatt mit verringerter schallemission |
| US6923404B1 (en) * | 2003-01-10 | 2005-08-02 | Zona Technology, Inc. | Apparatus and methods for variable sweep body conformal wing with application to projectiles, missiles, and unmanned air vehicles |
| DE10302514B4 (de) * | 2003-01-23 | 2008-12-18 | Eads Deutschland Gmbh | Strömungsmechanisch wirksame Fläche eines sich in einem Fluid bewegenden Geräts, insbesondere eines Fluggeräts, insbesondere Tragfläche eines Fluggeräts |
| US6886778B2 (en) * | 2003-06-30 | 2005-05-03 | The Boeing Company | Efficient wing tip devices and methods for incorporating such devices into existing wing designs |
| IL158215A0 (en) * | 2003-10-02 | 2004-09-27 | Israel Aircraft Ind Ltd | Aircraft arrangement for micro and mini unmanned aircraft vehicle |
| GB0326228D0 (en) * | 2003-11-10 | 2003-12-17 | Airbus Uk Ltd | Wing tip device |
| US7475848B2 (en) * | 2003-11-11 | 2009-01-13 | Morgenstern John M | Wing employing leading edge flaps and winglets to achieve improved aerodynamic performance |
| US7100867B2 (en) * | 2004-02-09 | 2006-09-05 | Houck Ii Ronald G | Lifting foil |
| US7100875B2 (en) * | 2004-02-20 | 2006-09-05 | The Boeing Company | Apparatus and method for the control of trailing wake flows |
| US8016244B2 (en) * | 2004-02-20 | 2011-09-13 | The Boeing Company | Active systems and methods for controlling an airfoil vortex |
| US7264200B2 (en) * | 2004-07-23 | 2007-09-04 | The Boeing Company | System and method for improved rotor tip performance |
| GB0420601D0 (en) * | 2004-09-16 | 2004-10-20 | Qinetiq Ltd | Wing tip devices |
| EP1690788A1 (en) * | 2005-02-15 | 2006-08-16 | C.R.F. Società Consortile per Azioni | An aircraft of compact dimensions |
| DE602006007118D1 (de) | 2005-04-18 | 2009-07-16 | Airbus Gmbh | System und verfahren zur reduzierung von tragflächenwirbeln |
| DE102005017825A1 (de) * | 2005-04-18 | 2006-10-26 | Airbus Deutschland Gmbh | System und Verfahren zum Reduzieren von Randwirbeln |
| DE102005028688A1 (de) * | 2005-05-19 | 2006-11-30 | Airbus Deutschland Gmbh | Konzept eines variablen Winglets zur lateralen Lastenreduktion zur kombinierten lateralen und vertikalen Lastenreduktion und zur Performanceverbesserung von Fortbewegungsmitteln |
| DE602006012036D1 (de) | 2005-05-19 | 2010-03-18 | Airbus Gmbh | Konzept für ein variables winglet zur seitenlastverringerung für die kombinierte seiten- und vertikallastverringerung und zur leistungssteigerung durch fortbewegung |
| US8544800B2 (en) * | 2005-07-21 | 2013-10-01 | The Boeing Company | Integrated wingtip extensions for jet transport aircraft and other types of aircraft |
| GB0518755D0 (en) * | 2005-09-14 | 2005-10-19 | Airbus Uk Ltd | Wing tip device |
| US20070114327A1 (en) * | 2005-11-18 | 2007-05-24 | The Boeing Company | Wing load alleviation apparatus and method |
| FR2894558A1 (fr) * | 2005-12-12 | 2007-06-15 | Dassault Avions | Aile a ailette d'extremite de voilure et aeronef comportant une telle aile |
| US7922115B2 (en) * | 2006-04-21 | 2011-04-12 | Colgren Richard D | Modular unmanned air-vehicle |
| US7644892B1 (en) * | 2006-07-06 | 2010-01-12 | Alford Jr Lionel D | Blended winglet |
| US20090302167A1 (en) * | 2006-08-23 | 2009-12-10 | Desroche Robert J | Apparatus and method for use on aircraft with spanwise flow inhibitors |
| WO2008022428A1 (en) * | 2006-08-25 | 2008-02-28 | A Partnership Of Jim Langley And Courtney Hunter | Aircraft wing modification and related methods |
| BRPI0716819A2 (pt) * | 2006-09-15 | 2013-11-05 | Airbus Gmbh | Elemento aerodinâmico e asa com elemento aerodinâmico, módulo atuador de ativação, computador, programa de computador e método para influenciar contracorrentes de rastro |
| DE102006055090A1 (de) * | 2006-11-21 | 2008-05-29 | Airbus Deutschland Gmbh | Flügelendform für einen Flügel, insbesondere von Luftfahrzeugen |
| FR2909359B1 (fr) * | 2006-11-30 | 2009-09-25 | Airbus France Sas | Avion a reacteurs disposes a l'arriere |
| US9545993B2 (en) * | 2007-01-12 | 2017-01-17 | John William McGinnis | Aircraft stability and efficient control through induced drag reduction |
| FR2917379B1 (fr) | 2007-06-12 | 2010-02-26 | Airbus France | Mat de fixation d'un moteur a une aile d'aeronef. |
| US7744038B2 (en) | 2007-06-15 | 2010-06-29 | The Boeing Company | Controllable winglets |
| GB0711942D0 (en) * | 2007-06-21 | 2007-08-01 | Airbus Uk Ltd | Winglet |
| US7900876B2 (en) * | 2007-08-09 | 2011-03-08 | The Boeing Company | Wingtip feathers, including forward swept feathers, and associated aircraft systems and methods |
| US8408490B2 (en) * | 2007-08-29 | 2013-04-02 | Advanced Product Development, Llc | Oblique blended wing body aircraft |
| US20090084904A1 (en) * | 2007-10-02 | 2009-04-02 | The Boeing Company | Wingtip Feathers, Including Paired, Fixed Feathers, and Associated Systems and Methods |
| US8083185B2 (en) * | 2007-11-07 | 2011-12-27 | The Boeing Company | Aircraft wing tip having a variable incidence angle |
| US7750491B2 (en) * | 2007-11-21 | 2010-07-06 | Ric Enterprises | Fluid-dynamic renewable energy harvesting system |
| US20090224107A1 (en) * | 2008-03-04 | 2009-09-10 | The Boeing Company | Reduced Span Wings with Wing Tip Devices, and Associated Systems and Methods |
| USD595211S1 (en) * | 2008-04-09 | 2009-06-30 | Airbus France Sas | Aircraft tail |
| US8128035B2 (en) * | 2008-04-15 | 2012-03-06 | The Boeing Company | Winglets with recessed surfaces, and associated systems and methods |
| US8651427B1 (en) * | 2008-04-15 | 2014-02-18 | The Boeing Company | Wing tip device with recess in surface |
| US8024079B2 (en) * | 2008-05-20 | 2011-09-20 | The Boeing Company | Wing-body load alleviation for aircraft |
| ES2561982T3 (es) * | 2008-06-20 | 2016-03-01 | Aviation Partners, Inc. | Punta de ala curvada |
| US9302766B2 (en) * | 2008-06-20 | 2016-04-05 | Aviation Partners, Inc. | Split blended winglet |
| US8336830B2 (en) * | 2008-10-03 | 2012-12-25 | The Boeing Company | Retractable aircraft wing tip |
| US20100123047A1 (en) * | 2008-11-14 | 2010-05-20 | Williams Aerospace, Inc. | Blended Wing Body Unmanned Aerial Vehicle |
| US20100163669A1 (en) * | 2008-12-29 | 2010-07-01 | Im Sunstar | Super aircraft structrue |
| US7793884B2 (en) * | 2008-12-31 | 2010-09-14 | Faruk Dizdarevic | Deltoid main wing aerodynamic configurations |
| DE102009019542A1 (de) * | 2009-04-30 | 2010-11-11 | Airbus Deutschland Gmbh | Nicht-planares Flügelendstück für Tragflügel von Flugzeugen sowie Tragflügel mit einem solchen Flügelendstück |
| US9120562B2 (en) * | 2009-05-05 | 2015-09-01 | Aerostar Aircraft Corporation | Aircraft winglet design having a compound curve profile |
| US20110024573A1 (en) * | 2009-05-06 | 2011-02-03 | Quiet Wing Technologies, Inc. | Extended winglet with load balancing characteristics |
| FR2948628B1 (fr) * | 2009-08-03 | 2012-02-03 | Airbus Operations Sas | Avion a controle en lacet par trainee differentielle |
| US20110042508A1 (en) * | 2009-08-24 | 2011-02-24 | Bevirt Joeben | Controlled take-off and flight system using thrust differentials |
| US20110127383A1 (en) | 2009-12-01 | 2011-06-02 | Guida Associates Consulting, Inc. | Active winglet |
| US9162755B2 (en) | 2009-12-01 | 2015-10-20 | Tamarack Aerospace Group, Inc. | Multiple controllable airflow modification devices |
| WO2011070532A1 (en) | 2009-12-10 | 2011-06-16 | University Of The Witwatersrand, Johannesburg | Aircraft wingtip arrangement |
| AU2010350897B2 (en) * | 2010-04-12 | 2015-05-14 | Airbus Operations Gmbh | Fixed wing of an aircraft |
| GB201011843D0 (en) * | 2010-07-14 | 2010-09-01 | Airbus Operations Ltd | Wing tip device |
| US8382041B1 (en) * | 2010-08-04 | 2013-02-26 | The United States Of America As Represented By The Secretary Of The Air Force | Rakelet |
| US8439313B2 (en) * | 2010-10-15 | 2013-05-14 | The Boeing Company | Forward swept winglet |
| GB201018185D0 (en) * | 2010-10-28 | 2010-12-08 | Airbus Operations Ltd | Wing tip device attachment apparatus and method |
| US7997875B2 (en) * | 2010-11-16 | 2011-08-16 | General Electric Company | Winglet for wind turbine rotor blade |
| FR2970699B1 (fr) * | 2011-01-25 | 2014-11-28 | Lisa Airplanes | Avion motorise a structure mixte hydrodynamique et aerodynamique pour le decollage et l'atterrissage sur l'eau, le sol ou la neige |
| WO2012171034A1 (en) * | 2011-06-09 | 2012-12-13 | Aviation Partners, Inc. | The split spiroid |
| DE102011107251A1 (de) * | 2011-07-14 | 2013-01-17 | Airbus Operations Gmbh | Flügelendstück eines Tragflügels sowie ein Tragflügel mit einem solchen Flügelendstück |
| ES2543633T3 (es) * | 2011-07-28 | 2015-08-20 | Airbus Defence and Space GmbH | Método y aparato para minimizar las cargas estructurales dinámicas de un avión |
| US8651431B1 (en) * | 2011-08-09 | 2014-02-18 | The Boeing Company | Aircraft with movable winglets and method of control |
| GB201120862D0 (en) * | 2011-12-05 | 2012-01-18 | Airbus Operations Ltd | A wingtip fin of an aircraft |
| US8936219B2 (en) * | 2012-03-30 | 2015-01-20 | The Boeing Company | Performance-enhancing winglet system and method |
| US10384796B2 (en) * | 2012-04-04 | 2019-08-20 | Commercial Aerospace Plane Pty Limited | Aerospace plane system |
| US8788122B1 (en) * | 2012-08-24 | 2014-07-22 | The Boeing Company | Wing load alleviation methods and apparatus |
| ES2747639T3 (es) * | 2013-02-05 | 2020-03-11 | Tamarack Aerospace Group Inc | Control de carga periódica de dispositivo controlable de modificación de flujo de aire |
| US9845159B2 (en) * | 2013-03-07 | 2017-12-19 | United Technologies Corporation | Conjoined reverse core flow engine arrangement |
| ITRM20130473A1 (it) * | 2013-08-12 | 2013-11-11 | Unit 1 Srl | Convertiplano con nuove soluzionitecniche ed aerodinamiche atte a rendere sicuro e fruibile il mezzo anche in soluzioni di velivolo ultraleggero |
| US10239606B2 (en) * | 2013-12-04 | 2019-03-26 | Tamarack Aerospace Group, Inc. | Airflow interrupting devices |
| US10562613B2 (en) * | 2013-12-04 | 2020-02-18 | Tamarack Aerospace Group, Inc. | Adjustable lift modification wingtip |
| EP3077281A4 (en) * | 2013-12-05 | 2017-07-26 | Tamarack Aerospace Group, Inc. | Wingtip device |
| AT515456B1 (de) * | 2014-02-18 | 2018-04-15 | Iat 21 Innovative Aeronautics Tech Gmbh | Fluggerät |
| USD732657S1 (en) * | 2014-02-27 | 2015-06-23 | Delta T Corporation | Winglet |
| US10059461B2 (en) * | 2014-10-17 | 2018-08-28 | Saf-T-Glo Limited | Aircraft marking system |
| GB2533413A (en) * | 2014-12-19 | 2016-06-22 | Airbus Operations Ltd | Lifting Surfaces |
| GB2535580A (en) * | 2015-02-17 | 2016-08-24 | Airbus Operations Ltd | Actuation assembly for moving a wing tip device on an aircraft wing |
| US10501197B2 (en) * | 2015-09-02 | 2019-12-10 | Jetoptera, Inc. | Fluidic propulsive system |
| GB201520290D0 (en) * | 2015-11-18 | 2015-12-30 | Airbus Operations Ltd | An articulation mechanism for forming a lock to hold a wing tip device in a ground configuration |
| GB201520289D0 (en) * | 2015-11-18 | 2015-12-30 | Airbus Operations Ltd | An actuation assembly with a track and follower for use in moving a wing tip device on an aircraft wing |
| US10710702B2 (en) * | 2016-08-12 | 2020-07-14 | Aviation Partners, Inc. | Shape adaptive airfoil |
| USD858421S1 (en) * | 2017-09-28 | 2019-09-03 | Tesla, Inc. | Winglet |
-
2013
- 2013-12-04 US US14/097,122 patent/US10562613B2/en active Active
-
2014
- 2014-12-04 JP JP2014245937A patent/JP6563644B2/ja not_active Expired - Fee Related
- 2014-12-04 EP EP14196292.8A patent/EP2881322B1/en active Active
- 2014-12-04 AU AU2014271311A patent/AU2014271311B2/en not_active Ceased
-
2019
- 2019-03-20 AU AU2019201916A patent/AU2019201916A1/en not_active Abandoned
-
2020
- 2020-02-14 US US16/792,033 patent/US11440645B2/en active Active
-
2022
- 2022-09-12 US US17/943,060 patent/US12351298B2/en active Active
Also Published As
| Publication number | Publication date |
|---|---|
| US20230227149A1 (en) | 2023-07-20 |
| AU2019201916A1 (en) | 2019-04-11 |
| US10562613B2 (en) | 2020-02-18 |
| AU2014271311B2 (en) | 2018-12-20 |
| AU2014271311A1 (en) | 2015-06-18 |
| HK1211271A1 (en) | 2016-05-20 |
| EP2881322B1 (en) | 2017-06-14 |
| JP2015155293A (ja) | 2015-08-27 |
| US20200298963A1 (en) | 2020-09-24 |
| EP2881322A1 (en) | 2015-06-10 |
| US20160009378A1 (en) | 2016-01-14 |
| US12351298B2 (en) | 2025-07-08 |
| US11440645B2 (en) | 2022-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6563644B2 (ja) | 調整可能な揚力修正翼端 | |
| US11912398B2 (en) | Multiple controllable airflow modification devices | |
| US20250153843A1 (en) | Controllable airflow modification device periodic load control | |
| US9764825B2 (en) | Active winglet | |
| EP2834146B1 (en) | Multiple controllable airflow modification devices | |
| AU2013200686B2 (en) | Active winglet | |
| HK1211271B (en) | Adjustable lift modification wingtip | |
| HK40015726A (en) | Controllable airflow modification device periodic load control | |
| HK1219933B (en) | Controllable airflow modification device periodic load control |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20171204 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20171204 |
|
| A977 | Report on retrieval |
Free format text: JAPANESE INTERMEDIATE CODE: A971007 Effective date: 20181011 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20181023 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20190122 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20190625 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20190725 |
|
| R150 | Certificate of patent or registration of utility model |
Ref document number: 6563644 Country of ref document: JP Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| LAPS | Cancellation because of no payment of annual fees |