JP3973287B2 - トナーの調製方法 - Google Patents
トナーの調製方法 Download PDFInfo
- Publication number
- JP3973287B2 JP3973287B2 JP7443298A JP7443298A JP3973287B2 JP 3973287 B2 JP3973287 B2 JP 3973287B2 JP 7443298 A JP7443298 A JP 7443298A JP 7443298 A JP7443298 A JP 7443298A JP 3973287 B2 JP3973287 B2 JP 3973287B2
- Authority
- JP
- Japan
- Prior art keywords
- poly
- styrene
- toner
- isoprene
- butadiene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000002360 preparation method Methods 0.000 title claims description 14
- 229920000126 latex Polymers 0.000 claims description 60
- 239000004816 latex Substances 0.000 claims description 57
- 239000000049 pigment Substances 0.000 claims description 55
- 238000000034 method Methods 0.000 claims description 53
- 239000002245 particle Substances 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 46
- 229920000642 polymer Polymers 0.000 claims description 45
- 229920006037 cross link polymer Polymers 0.000 claims description 36
- 239000006185 dispersion Substances 0.000 claims description 24
- 239000002563 ionic surfactant Substances 0.000 claims description 17
- -1 poly (ethylene Acrylate-isoprene Chemical compound 0.000 claims description 16
- 239000004094 surface-active agent Substances 0.000 claims description 13
- 238000002156 mixing Methods 0.000 claims description 11
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 8
- 239000002174 Styrene-butadiene Substances 0.000 claims description 7
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 claims description 7
- 239000011115 styrene butadiene Substances 0.000 claims description 7
- 229920003048 styrene butadiene rubber Polymers 0.000 claims description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 6
- ROGIWVXWXZRRMZ-UHFFFAOYSA-N 2-methylbuta-1,3-diene;styrene Chemical compound CC(=C)C=C.C=CC1=CC=CC=C1 ROGIWVXWXZRRMZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 238000002844 melting Methods 0.000 claims description 5
- 230000008018 melting Effects 0.000 claims description 5
- 239000000725 suspension Substances 0.000 claims description 5
- DCUTVXHHLQVRRA-UHFFFAOYSA-N 2-methylbuta-1,3-diene;prop-2-enoic acid;styrene Chemical compound CC(=C)C=C.OC(=O)C=C.C=CC1=CC=CC=C1 DCUTVXHHLQVRRA-UHFFFAOYSA-N 0.000 claims description 3
- PLOYJEGLPVCRAJ-UHFFFAOYSA-N buta-1,3-diene;prop-2-enoic acid;styrene Chemical compound C=CC=C.OC(=O)C=C.C=CC1=CC=CC=C1 PLOYJEGLPVCRAJ-UHFFFAOYSA-N 0.000 claims description 3
- 239000003086 colorant Substances 0.000 claims description 3
- 230000009477 glass transition Effects 0.000 claims description 3
- LONCJFPVKZBTLG-UHFFFAOYSA-N 2-methylbuta-1,3-diene prop-1-enylbenzene Chemical compound CC(=C)C=C.CC=CC1=CC=CC=C1 LONCJFPVKZBTLG-UHFFFAOYSA-N 0.000 claims description 2
- KLWOORLBKQYYQC-UHFFFAOYSA-N 2-methylbuta-1,3-diene propyl prop-2-enoate Chemical compound CC(=C)C=C.CCCOC(=O)C=C KLWOORLBKQYYQC-UHFFFAOYSA-N 0.000 claims description 2
- NRDDLSFHZLETFD-UHFFFAOYSA-N 2-methylbuta-1,3-diene;methyl 2-methylprop-2-enoate Chemical compound CC(=C)C=C.COC(=O)C(C)=C NRDDLSFHZLETFD-UHFFFAOYSA-N 0.000 claims description 2
- XXEJNJYARCWPGC-UHFFFAOYSA-N 2-methylbuta-1,3-diene;propyl 2-methylprop-2-enoate Chemical compound CC(=C)C=C.CCCOC(=O)C(C)=C XXEJNJYARCWPGC-UHFFFAOYSA-N 0.000 claims description 2
- WOYXYXOSUAZDIA-UHFFFAOYSA-N buta-1,3-diene;butyl 2-methylprop-2-enoate Chemical compound C=CC=C.CCCCOC(=O)C(C)=C WOYXYXOSUAZDIA-UHFFFAOYSA-N 0.000 claims description 2
- YIEXROAWVNRRMJ-UHFFFAOYSA-N buta-1,3-diene;butyl prop-2-enoate Chemical compound C=CC=C.CCCCOC(=O)C=C YIEXROAWVNRRMJ-UHFFFAOYSA-N 0.000 claims description 2
- UWWYTVDAXIVRAJ-UHFFFAOYSA-N buta-1,3-diene;ethyl 2-methylprop-2-enoate Chemical compound C=CC=C.CCOC(=O)C(C)=C UWWYTVDAXIVRAJ-UHFFFAOYSA-N 0.000 claims description 2
- UCPLVEOTDDIMJD-UHFFFAOYSA-N buta-1,3-diene;ethyl prop-2-enoate Chemical compound C=CC=C.CCOC(=O)C=C UCPLVEOTDDIMJD-UHFFFAOYSA-N 0.000 claims description 2
- KLIYQWXIWMRMGR-UHFFFAOYSA-N buta-1,3-diene;methyl 2-methylprop-2-enoate Chemical compound C=CC=C.COC(=O)C(C)=C KLIYQWXIWMRMGR-UHFFFAOYSA-N 0.000 claims description 2
- LRTQWXGNPCHTFW-UHFFFAOYSA-N buta-1,3-diene;methyl prop-2-enoate Chemical compound C=CC=C.COC(=O)C=C LRTQWXGNPCHTFW-UHFFFAOYSA-N 0.000 claims description 2
- NACNINIZJRIDPK-UHFFFAOYSA-N buta-1,3-diene;propyl 2-methylprop-2-enoate Chemical compound C=CC=C.CCCOC(=O)C(C)=C NACNINIZJRIDPK-UHFFFAOYSA-N 0.000 claims description 2
- XPRLOFXIQNKWMK-UHFFFAOYSA-N buta-1,3-diene;propyl prop-2-enoate Chemical compound C=CC=C.CCCOC(=O)C=C XPRLOFXIQNKWMK-UHFFFAOYSA-N 0.000 claims description 2
- QQIMXPLXJVRMNX-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCCCOC(=O)C(C)=C QQIMXPLXJVRMNX-UHFFFAOYSA-N 0.000 claims description 2
- VMRHCZNACCBXEJ-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;butyl prop-2-enoate Chemical compound CCCCOC(=O)C=C.CCCCOC(=O)C(C)=C VMRHCZNACCBXEJ-UHFFFAOYSA-N 0.000 claims description 2
- KGVITRZHZPHLOI-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.CCCCOC(=O)C(C)=C KGVITRZHZPHLOI-UHFFFAOYSA-N 0.000 claims description 2
- PSJCFABZBPCBNQ-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;prop-2-enoic acid;styrene Chemical compound OC(=O)C=C.C=CC1=CC=CC=C1.CCCCOC(=O)C(C)=C PSJCFABZBPCBNQ-UHFFFAOYSA-N 0.000 claims description 2
- DFYKHEXCUQCPEB-UHFFFAOYSA-N butyl 2-methylprop-2-enoate;styrene Chemical compound C=CC1=CC=CC=C1.CCCCOC(=O)C(C)=C DFYKHEXCUQCPEB-UHFFFAOYSA-N 0.000 claims description 2
- HOIWWOKSBHULCU-UHFFFAOYSA-N butyl prop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCCCOC(=O)C=C HOIWWOKSBHULCU-UHFFFAOYSA-N 0.000 claims description 2
- IYCOKCJDXXJIIM-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enoic acid;styrene Chemical compound OC(=O)C=C.C=CC1=CC=CC=C1.CCCCOC(=O)C=C IYCOKCJDXXJIIM-UHFFFAOYSA-N 0.000 claims description 2
- TUZBYYLVVXPEMA-UHFFFAOYSA-N butyl prop-2-enoate;styrene Chemical compound C=CC1=CC=CC=C1.CCCCOC(=O)C=C TUZBYYLVVXPEMA-UHFFFAOYSA-N 0.000 claims description 2
- RXQXUXZUWNFWJV-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCOC(=O)C(C)=C RXQXUXZUWNFWJV-UHFFFAOYSA-N 0.000 claims description 2
- HNJKLOSHGNUTBM-UHFFFAOYSA-N 2-methylbuta-1,3-diene;methyl prop-2-enoate Chemical compound CC(=C)C=C.COC(=O)C=C HNJKLOSHGNUTBM-UHFFFAOYSA-N 0.000 claims 1
- QSMOHLASMMAGIB-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enenitrile Chemical compound C=CC#N.CCCCOC(=O)C=C QSMOHLASMMAGIB-UHFFFAOYSA-N 0.000 claims 1
- WWPXOMXUMORZKI-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1.CCCCOC(=O)C=C WWPXOMXUMORZKI-UHFFFAOYSA-N 0.000 claims 1
- 230000004927 fusion Effects 0.000 claims 1
- 239000000839 emulsion Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 14
- 239000003093 cationic surfactant Substances 0.000 description 11
- 239000002736 nonionic surfactant Substances 0.000 description 11
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 10
- 239000003945 anionic surfactant Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 9
- 239000000654 additive Substances 0.000 description 8
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 8
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 7
- 238000010008 shearing Methods 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical class O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 230000002776 aggregation Effects 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 4
- 238000004220 aggregation Methods 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 229960000686 benzalkonium chloride Drugs 0.000 description 3
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002952 polymeric resin Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NJVOHKFLBKQLIZ-UHFFFAOYSA-N (2-ethenylphenyl) prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1C=C NJVOHKFLBKQLIZ-UHFFFAOYSA-N 0.000 description 2
- PIKJWNAIKAKPQW-UHFFFAOYSA-N 1-dodecylnaphthalene;sulfuric acid Chemical compound OS(O)(=O)=O.C1=CC=C2C(CCCCCCCCCCCC)=CC=CC2=C1 PIKJWNAIKAKPQW-UHFFFAOYSA-N 0.000 description 2
- VEBJYBIQIYFEFN-UHFFFAOYSA-N 2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol Chemical compound CCCCCCCCC1=CC=C(OCCOCCOCCOCCOCCO)C=C1 VEBJYBIQIYFEFN-UHFFFAOYSA-N 0.000 description 2
- WIHIUFRJMOAJFO-UHFFFAOYSA-N 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol Chemical compound CCCCCCCCCC1=CC=C(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)C=C1 WIHIUFRJMOAJFO-UHFFFAOYSA-N 0.000 description 2
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 2
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- VVSMKOFFCAJOSC-UHFFFAOYSA-L disodium;dodecylbenzene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1 VVSMKOFFCAJOSC-UHFFFAOYSA-L 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000377 silicon dioxide Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 229910000859 α-Fe Inorganic materials 0.000 description 2
- FFJCNSLCJOQHKM-CLFAGFIQSA-N (z)-1-[(z)-octadec-9-enoxy]octadec-9-ene Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCCCCCCC\C=C/CCCCCCCC FFJCNSLCJOQHKM-CLFAGFIQSA-N 0.000 description 1
- HNTGIJLWHDPAFN-UHFFFAOYSA-N 1-bromohexadecane Chemical compound CCCCCCCCCCCCCCCCBr HNTGIJLWHDPAFN-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- RXXPAEGIPXPLPB-UHFFFAOYSA-N 2-[2-[4-(7-methyloctyl)phenoxy]ethoxy]ethanol Chemical compound CC(C)CCCCCCC1=CC=C(OCCOCCO)C=C1 RXXPAEGIPXPLPB-UHFFFAOYSA-N 0.000 description 1
- JQXYBDVZAUEPDL-UHFFFAOYSA-N 2-methylidene-5-phenylpent-4-enoic acid Chemical compound OC(=O)C(=C)CC=CC1=CC=CC=C1 JQXYBDVZAUEPDL-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 229920002449 FKM Polymers 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical compound NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000004931 aggregating effect Effects 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WMLFGKCFDKMAKB-UHFFFAOYSA-M benzyl-diethyl-tetradecylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCC[N+](CC)(CC)CC1=CC=CC=C1 WMLFGKCFDKMAKB-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- UPMATSCYHGMGSE-UHFFFAOYSA-N butyl prop-2-enoate;prop-2-enenitrile;prop-2-enoic acid;styrene Chemical compound C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1.CCCCOC(=O)C=C UPMATSCYHGMGSE-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000008119 colloidal silica Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- FWDBOZPQNFPOLF-UHFFFAOYSA-N ethenyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C=C FWDBOZPQNFPOLF-UHFFFAOYSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- REYZQLSIADJXGD-UHFFFAOYSA-N ethyl prop-2-enoate;2-methylbuta-1,3-diene Chemical compound CC(=C)C=C.CCOC(=O)C=C REYZQLSIADJXGD-UHFFFAOYSA-N 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 150000005165 hydroxybenzoic acids Chemical class 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 238000010191 image analysis Methods 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920002114 octoxynol-9 Polymers 0.000 description 1
- ULDDEWDFUNBUCM-UHFFFAOYSA-N pentyl prop-2-enoate Chemical compound CCCCCOC(=O)C=C ULDDEWDFUNBUCM-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- NHARPDSAXCBDDR-UHFFFAOYSA-N propyl 2-methylprop-2-enoate Chemical compound CCCOC(=O)C(C)=C NHARPDSAXCBDDR-UHFFFAOYSA-N 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 229940043267 rhodamine b Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- AISMNBXOJRHCIA-UHFFFAOYSA-N trimethylazanium;bromide Chemical compound Br.CN(C)C AISMNBXOJRHCIA-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000037303 wrinkles Effects 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08784—Macromolecular material not specially provided for in a single one of groups G03G9/08702 - G03G9/08775
- G03G9/08793—Crosslinked polymers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/0802—Preparation methods
- G03G9/0804—Preparation methods whereby the components are brought together in a liquid dispersing medium
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08706—Polymers of alkenyl-aromatic compounds
- G03G9/08708—Copolymers of styrene
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08706—Polymers of alkenyl-aromatic compounds
- G03G9/08708—Copolymers of styrene
- G03G9/08711—Copolymers of styrene with esters of acrylic or methacrylic acid
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08726—Polymers of unsaturated acids or derivatives thereof
- G03G9/08728—Polymers of esters
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08726—Polymers of unsaturated acids or derivatives thereof
- G03G9/08731—Polymers of nitriles
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08726—Polymers of unsaturated acids or derivatives thereof
- G03G9/08733—Polymers of unsaturated polycarboxylic acids
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Developing Agents For Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/825,451 US5763133A (en) | 1997-03-28 | 1997-03-28 | Toner compositions and processes |
| US825451 | 2001-04-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JPH10282717A JPH10282717A (ja) | 1998-10-23 |
| JPH10282717A5 JPH10282717A5 (https=) | 2005-09-02 |
| JP3973287B2 true JP3973287B2 (ja) | 2007-09-12 |
Family
ID=25244031
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP7443298A Expired - Fee Related JP3973287B2 (ja) | 1997-03-28 | 1998-03-23 | トナーの調製方法 |
Country Status (2)
| Country | Link |
|---|---|
| US (2) | US5763133A (https=) |
| JP (1) | JP3973287B2 (https=) |
Families Citing this family (147)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5955235A (en) * | 1998-02-09 | 1999-09-21 | Xerox Corporation | Toner compositions with compatibilizers |
| US5858601A (en) * | 1998-08-03 | 1999-01-12 | Xerox Corporation | Toner processes |
| US6352810B1 (en) | 2001-02-16 | 2002-03-05 | Xerox Corporation | Toner coagulant processes |
| US6416920B1 (en) | 2001-03-19 | 2002-07-09 | Xerox Corporation | Toner coagulant processes |
| US6495302B1 (en) | 2001-06-11 | 2002-12-17 | Xerox Corporation | Toner coagulant processes |
| US6979504B2 (en) * | 2001-07-25 | 2005-12-27 | Ballard Power Systems Inc. | Fuel cell system automatic power switching method and apparatus |
| US6500597B1 (en) | 2001-08-06 | 2002-12-31 | Xerox Corporation | Toner coagulant processes |
| US6562541B2 (en) | 2001-09-24 | 2003-05-13 | Xerox Corporation | Toner processes |
| US7250238B2 (en) * | 2003-12-23 | 2007-07-31 | Xerox Corporation | Toners and processes thereof |
| US7052818B2 (en) * | 2003-12-23 | 2006-05-30 | Xerox Corporation | Toners and processes thereof |
| US7041420B2 (en) * | 2003-12-23 | 2006-05-09 | Xerox Corporation | Emulsion aggregation toner having novel surface morphology properties |
| US20050136352A1 (en) * | 2003-12-23 | 2005-06-23 | Xerox Corporation | Emulsion aggregation toner having novel rheolgical and flow properties |
| US20050255254A1 (en) * | 2004-05-13 | 2005-11-17 | Guido Desie | Method to improve the quality of dispersion formulations |
| US7208257B2 (en) * | 2004-06-25 | 2007-04-24 | Xerox Corporation | Electron beam curable toners and processes thereof |
| US7160661B2 (en) * | 2004-06-28 | 2007-01-09 | Xerox Corporation | Emulsion aggregation toner having gloss enhancement and toner release |
| US7179575B2 (en) * | 2004-06-28 | 2007-02-20 | Xerox Corporation | Emulsion aggregation toner having gloss enhancement and toner release |
| US7166402B2 (en) * | 2004-06-28 | 2007-01-23 | Xerox Corporation | Emulsion aggregation toner having gloss enhancement and toner release with stable xerographic charging |
| US7288347B2 (en) * | 2004-08-31 | 2007-10-30 | Xerox Corporation | Method of applying spot varnish to xerographic image and emulsion aggregation toners for use therein |
| US7652128B2 (en) * | 2004-11-05 | 2010-01-26 | Xerox Corporation | Toner composition |
| US20060105263A1 (en) * | 2004-11-16 | 2006-05-18 | Xerox Corporation | Toner composition |
| US7615327B2 (en) * | 2004-11-17 | 2009-11-10 | Xerox Corporation | Toner process |
| US20060121387A1 (en) * | 2004-12-03 | 2006-06-08 | Xerox Corporation | Toner processes |
| US7645552B2 (en) * | 2004-12-03 | 2010-01-12 | Xerox Corporation | Toner compositions |
| US7514195B2 (en) * | 2004-12-03 | 2009-04-07 | Xerox Corporation | Toner compositions |
| US20060121380A1 (en) * | 2004-12-03 | 2006-06-08 | Xerox Corporation | Toner compositions |
| US7279261B2 (en) * | 2005-01-13 | 2007-10-09 | Xerox Corporation | Emulsion aggregation toner compositions |
| US7276320B2 (en) * | 2005-01-19 | 2007-10-02 | Xerox Corporation | Surface particle attachment process, and particles made therefrom |
| US20060199094A1 (en) | 2005-03-07 | 2006-09-07 | Xerox Corporation | Carrier and developer compositions |
| US7799502B2 (en) * | 2005-03-31 | 2010-09-21 | Xerox Corporation | Toner processes |
| US7432324B2 (en) * | 2005-03-31 | 2008-10-07 | Xerox Corporation | Preparing aqueous dispersion of crystalline and amorphous polyesters |
| US7622234B2 (en) * | 2005-03-31 | 2009-11-24 | Xerox Corporation | Emulsion/aggregation based toners containing a novel latex resin |
| US7468232B2 (en) | 2005-04-27 | 2008-12-23 | Xerox Corporation | Processes for forming latexes and toners, and latexes and toner formed thereby |
| US8475985B2 (en) * | 2005-04-28 | 2013-07-02 | Xerox Corporation | Magnetic compositions |
| US20060269858A1 (en) * | 2005-05-31 | 2006-11-30 | Xerox Corporation | Toner compositions including styrene containing external additives |
| US7459258B2 (en) * | 2005-06-17 | 2008-12-02 | Xerox Corporation | Toner processes |
| US7524602B2 (en) * | 2005-06-20 | 2009-04-28 | Xerox Corporation | Low molecular weight latex and toner compositions comprising the same |
| US7759039B2 (en) * | 2005-07-01 | 2010-07-20 | Xerox Corporation | Toner containing silicate clay particles for improved relative humidity sensitivity |
| US8080360B2 (en) * | 2005-07-22 | 2011-12-20 | Xerox Corporation | Toner preparation processes |
| US20070020542A1 (en) * | 2005-07-22 | 2007-01-25 | Xerox Corporation | Emulsion aggregation, developer, and method of making the same |
| US7413842B2 (en) * | 2005-08-22 | 2008-08-19 | Xerox Corporation | Toner processes |
| US7402370B2 (en) * | 2005-08-30 | 2008-07-22 | Xerox Corporation | Single component developer of emulsion aggregation toner |
| US7713674B2 (en) * | 2005-09-09 | 2010-05-11 | Xerox Corporation | Emulsion polymerization process |
| US7662531B2 (en) * | 2005-09-19 | 2010-02-16 | Xerox Corporation | Toner having bumpy surface morphology |
| US7455943B2 (en) * | 2005-10-17 | 2008-11-25 | Xerox Corporation | High gloss emulsion aggregation toner incorporating aluminized silica as a coagulating agent |
| US7390606B2 (en) * | 2005-10-17 | 2008-06-24 | Xerox Corporation | Emulsion aggregation toner incorporating aluminized silica as a coagulating agent |
| US7553596B2 (en) * | 2005-11-14 | 2009-06-30 | Xerox Corporation | Toner having crystalline wax |
| US7686939B2 (en) * | 2005-11-14 | 2010-03-30 | Xerox Corporation | Crystalline wax |
| US7749670B2 (en) * | 2005-11-14 | 2010-07-06 | Xerox Corporation | Toner having crystalline wax |
| US7910275B2 (en) * | 2005-11-14 | 2011-03-22 | Xerox Corporation | Toner having crystalline wax |
| US7662272B2 (en) | 2005-11-14 | 2010-02-16 | Xerox Corporation | Crystalline wax |
| US20070111129A1 (en) * | 2005-11-15 | 2007-05-17 | Xerox Corporation | Toner compositions |
| US20070111130A1 (en) * | 2005-11-15 | 2007-05-17 | Xerox Corporation | Toner compositions |
| US7419753B2 (en) * | 2005-12-20 | 2008-09-02 | Xerox Corporation | Toner compositions having resin substantially free of crosslinking, crosslinked resin, polyester resin, and wax |
| US7521165B2 (en) * | 2006-04-05 | 2009-04-21 | Xerox Corporation | Varnish |
| US7939176B2 (en) | 2005-12-23 | 2011-05-10 | Xerox Corporation | Coated substrates and method of coating |
| US7524599B2 (en) * | 2006-03-22 | 2009-04-28 | Xerox Corporation | Toner compositions |
| US7485400B2 (en) * | 2006-04-05 | 2009-02-03 | Xerox Corporation | Developer |
| US7553595B2 (en) * | 2006-04-26 | 2009-06-30 | Xerox Corporation | Toner compositions and processes |
| US7622233B2 (en) * | 2006-04-28 | 2009-11-24 | Xerox Corporation | Styrene-based toner compositions with multiple waxes |
| US20070254230A1 (en) * | 2006-04-28 | 2007-11-01 | Xerox Corporation | External additive composition and process |
| US7736831B2 (en) * | 2006-09-08 | 2010-06-15 | Xerox Corporation | Emulsion/aggregation process using coalescent aid agents |
| US20090123865A1 (en) * | 2006-09-19 | 2009-05-14 | Xerox Corporation | Toner composition having fluorinated polymer additive |
| US7785763B2 (en) * | 2006-10-13 | 2010-08-31 | Xerox Corporation | Emulsion aggregation processes |
| US7851116B2 (en) * | 2006-10-30 | 2010-12-14 | Xerox Corporation | Emulsion aggregation high-gloss toner with calcium addition |
| US7858285B2 (en) * | 2006-11-06 | 2010-12-28 | Xerox Corporation | Emulsion aggregation polyester toners |
| US20080131800A1 (en) * | 2006-12-02 | 2008-06-05 | Xerox Corporation | Toners and toner methods |
| US7851519B2 (en) * | 2007-01-25 | 2010-12-14 | Xerox Corporation | Polyester emulsion containing crosslinked polyester resin, process, and toner |
| US20080197283A1 (en) * | 2007-02-16 | 2008-08-21 | Xerox Corporation | Emulsion aggregation toner compositions and developers |
| US8039187B2 (en) | 2007-02-16 | 2011-10-18 | Xerox Corporation | Curable toner compositions and processes |
| US8278018B2 (en) * | 2007-03-14 | 2012-10-02 | Xerox Corporation | Process for producing dry ink colorants that will reduce metamerism |
| US7901859B2 (en) | 2007-04-10 | 2011-03-08 | Xerox Corporation | Chemical toner with covalently bonded release agent |
| US7781135B2 (en) * | 2007-11-16 | 2010-08-24 | Xerox Corporation | Emulsion aggregation toner having zinc salicylic acid charge control agent |
| US8137884B2 (en) | 2007-12-14 | 2012-03-20 | Xerox Corporation | Toner compositions and processes |
| US8178274B2 (en) * | 2008-07-21 | 2012-05-15 | Xerox Corporation | Toner process |
| US7970333B2 (en) * | 2008-07-24 | 2011-06-28 | Xerox Corporation | System and method for protecting an image on a substrate |
| US8541154B2 (en) * | 2008-10-06 | 2013-09-24 | Xerox Corporation | Toner containing fluorescent nanoparticles |
| US8147714B2 (en) * | 2008-10-06 | 2012-04-03 | Xerox Corporation | Fluorescent organic nanoparticles and a process for producing fluorescent organic nanoparticles |
| US8586141B2 (en) * | 2008-10-06 | 2013-11-19 | Xerox Corporation | Fluorescent solid ink made with fluorescent nanoparticles |
| US8236198B2 (en) * | 2008-10-06 | 2012-08-07 | Xerox Corporation | Fluorescent nanoscale particles |
| US8222313B2 (en) * | 2008-10-06 | 2012-07-17 | Xerox Corporation | Radiation curable ink containing fluorescent nanoparticles |
| US20100092215A1 (en) | 2008-10-10 | 2010-04-15 | Xerox Corporation | Printing system with toner blend |
| US8187780B2 (en) | 2008-10-21 | 2012-05-29 | Xerox Corporation | Toner compositions and processes |
| US20100124713A1 (en) | 2008-11-17 | 2010-05-20 | Xerox Corporation | Toners including carbon nanotubes dispersed in a polymer matrix |
| US20100122642A1 (en) * | 2008-11-17 | 2010-05-20 | Xerox Corporation | Inks including carbon nanotubes dispersed in a polymer matrix |
| US8084177B2 (en) * | 2008-12-18 | 2011-12-27 | Xerox Corporation | Toners containing polyhedral oligomeric silsesquioxanes |
| US7985523B2 (en) | 2008-12-18 | 2011-07-26 | Xerox Corporation | Toners containing polyhedral oligomeric silsesquioxanes |
| US8318398B2 (en) * | 2009-02-06 | 2012-11-27 | Xerox Corporation | Toner compositions and processes |
| US8221948B2 (en) * | 2009-02-06 | 2012-07-17 | Xerox Corporation | Toner compositions and processes |
| US8076048B2 (en) * | 2009-03-17 | 2011-12-13 | Xerox Corporation | Toner having polyester resin |
| US8124307B2 (en) | 2009-03-30 | 2012-02-28 | Xerox Corporation | Toner having polyester resin |
| US8073376B2 (en) | 2009-05-08 | 2011-12-06 | Xerox Corporation | Curable toner compositions and processes |
| US8192912B2 (en) | 2009-05-08 | 2012-06-05 | Xerox Corporation | Curable toner compositions and processes |
| US8313884B2 (en) * | 2009-06-05 | 2012-11-20 | Xerox Corporation | Toner processes utilizing a defoamer as a coalescence aid for continuous and batch emulsion aggregation |
| US8741534B2 (en) * | 2009-06-08 | 2014-06-03 | Xerox Corporation | Efficient solvent-based phase inversion emulsification process with defoamer |
| US8211604B2 (en) * | 2009-06-16 | 2012-07-03 | Xerox Corporation | Self emulsifying granules and solvent free process for the preparation of emulsions therefrom |
| US8293444B2 (en) | 2009-06-24 | 2012-10-23 | Xerox Corporation | Purified polyester resins for toner performance improvement |
| US7943687B2 (en) * | 2009-07-14 | 2011-05-17 | Xerox Corporation | Continuous microreactor process for the production of polyester emulsions |
| US8207246B2 (en) * | 2009-07-30 | 2012-06-26 | Xerox Corporation | Processes for producing polyester latexes via solvent-free emulsification |
| US20110028570A1 (en) * | 2009-07-30 | 2011-02-03 | Xerox Corporation | Self emulsifying granules and process for the preparation of emulsions therefrom |
| US8563627B2 (en) * | 2009-07-30 | 2013-10-22 | Xerox Corporation | Self emulsifying granules and process for the preparation of emulsions therefrom |
| US8323865B2 (en) | 2009-08-04 | 2012-12-04 | Xerox Corporation | Toner processes |
| US7985526B2 (en) * | 2009-08-25 | 2011-07-26 | Xerox Corporation | Supercritical fluid microencapsulation of dye into latex for improved emulsion aggregation toner |
| US9594319B2 (en) * | 2009-09-03 | 2017-03-14 | Xerox Corporation | Curable toner compositions and processes |
| US8722299B2 (en) | 2009-09-15 | 2014-05-13 | Xerox Corporation | Curable toner compositions and processes |
| US8383311B2 (en) * | 2009-10-08 | 2013-02-26 | Xerox Corporation | Emulsion aggregation toner composition |
| US20110086302A1 (en) * | 2009-10-09 | 2011-04-14 | Xerox Corporation | Toner compositions and processes |
| US8257895B2 (en) * | 2009-10-09 | 2012-09-04 | Xerox Corporation | Toner compositions and processes |
| US8168361B2 (en) * | 2009-10-15 | 2012-05-01 | Xerox Corporation | Curable toner compositions and processes |
| US8486602B2 (en) * | 2009-10-22 | 2013-07-16 | Xerox Corporation | Toner particles and cold homogenization method |
| US8450040B2 (en) * | 2009-10-22 | 2013-05-28 | Xerox Corporation | Method for controlling a toner preparation process |
| US8383309B2 (en) * | 2009-11-03 | 2013-02-26 | Xerox Corporation | Preparation of sublimation colorant dispersion |
| US20110129774A1 (en) * | 2009-12-02 | 2011-06-02 | Xerox Corporation | Incorporation of an oil component into phase inversion emulsion process |
| US7977025B2 (en) * | 2009-12-03 | 2011-07-12 | Xerox Corporation | Emulsion aggregation methods |
| US9201324B2 (en) * | 2010-02-18 | 2015-12-01 | Xerox Corporation | Processes for producing polyester latexes via solvent-based and solvent-free emulsification |
| US8603720B2 (en) * | 2010-02-24 | 2013-12-10 | Xerox Corporation | Toner compositions and processes |
| US8163459B2 (en) | 2010-03-01 | 2012-04-24 | Xerox Corporation | Bio-based amorphous polyester resins for emulsion aggregation toners |
| US9012118B2 (en) * | 2010-03-04 | 2015-04-21 | Xerox Corporation | Toner compositions and processes |
| US8178269B2 (en) | 2010-03-05 | 2012-05-15 | Xerox Corporation | Toner compositions and methods |
| US8221951B2 (en) | 2010-03-05 | 2012-07-17 | Xerox Corporation | Toner compositions and methods |
| US8431306B2 (en) | 2010-03-09 | 2013-04-30 | Xerox Corporation | Polyester resin containing toner |
| US8252494B2 (en) | 2010-05-03 | 2012-08-28 | Xerox Corporation | Fluorescent toner compositions and fluorescent pigments |
| US8192913B2 (en) | 2010-05-12 | 2012-06-05 | Xerox Corporation | Processes for producing polyester latexes via solvent-based emulsification |
| US8338071B2 (en) | 2010-05-12 | 2012-12-25 | Xerox Corporation | Processes for producing polyester latexes via single-solvent-based emulsification |
| US8221953B2 (en) | 2010-05-21 | 2012-07-17 | Xerox Corporation | Emulsion aggregation process |
| US8142975B2 (en) | 2010-06-29 | 2012-03-27 | Xerox Corporation | Method for controlling a toner preparation process |
| US8574804B2 (en) | 2010-08-26 | 2013-11-05 | Xerox Corporation | Toner compositions and processes |
| US8247156B2 (en) | 2010-09-09 | 2012-08-21 | Xerox Corporation | Processes for producing polyester latexes with improved hydrolytic stability |
| US8394566B2 (en) | 2010-11-24 | 2013-03-12 | Xerox Corporation | Non-magnetic single component emulsion/aggregation toner composition |
| US8592115B2 (en) | 2010-11-24 | 2013-11-26 | Xerox Corporation | Toner compositions and developers containing such toners |
| US8652723B2 (en) | 2011-03-09 | 2014-02-18 | Xerox Corporation | Toner particles comprising colorant-polyesters |
| US9354530B2 (en) | 2011-12-12 | 2016-05-31 | Xerox Corporation | Carboxylic acid or acid salt functionalized polyester polymers |
| US9822217B2 (en) | 2012-03-19 | 2017-11-21 | Xerox Corporation | Robust resin for solvent-free emulsification |
| US8697323B2 (en) | 2012-04-03 | 2014-04-15 | Xerox Corporation | Low gloss monochrome SCD toner for reduced energy toner usage |
| US8841055B2 (en) | 2012-04-04 | 2014-09-23 | Xerox Corporation | Super low melt emulsion aggregation toners comprising a trans-cinnamic di-ester |
| US9026013B2 (en) | 2012-12-21 | 2015-05-05 | Xerox Corporation | System and apparatus for toner charging using charge/metering blade having an adjustable nip |
| US9329508B2 (en) | 2013-03-26 | 2016-05-03 | Xerox Corporation | Emulsion aggregation process |
| US8951708B2 (en) | 2013-06-05 | 2015-02-10 | Xerox Corporation | Method of making toners |
| US9023574B2 (en) | 2013-06-28 | 2015-05-05 | Xerox Corporation | Toner processes for hyper-pigmented toners |
| US9195155B2 (en) | 2013-10-07 | 2015-11-24 | Xerox Corporation | Toner processes |
| US20150104742A1 (en) | 2013-10-11 | 2015-04-16 | Xerox Corporation | Emulsion aggregation toners |
| US9134635B1 (en) | 2014-04-14 | 2015-09-15 | Xerox Corporation | Method for continuous aggregation of pre-toner particles |
| US9285699B2 (en) | 2014-05-01 | 2016-03-15 | Xerox Corporation | Carrier and developer |
| US9188890B1 (en) | 2014-09-17 | 2015-11-17 | Xerox Corporation | Method for managing triboelectric charge in two-component developer |
| US9383666B1 (en) | 2015-04-01 | 2016-07-05 | Xerox Corporation | Toner particles comprising both polyester and styrene acrylate polymers having a polyester shell |
| US10315409B2 (en) | 2016-07-20 | 2019-06-11 | Xerox Corporation | Method of selective laser sintering |
| US10649355B2 (en) | 2016-07-20 | 2020-05-12 | Xerox Corporation | Method of making a polymer composite |
| US11048184B2 (en) | 2019-01-14 | 2021-06-29 | Xerox Corporation | Toner process employing dual chelating agents |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3571355D1 (en) * | 1984-04-17 | 1989-08-10 | Hitachi Chemical Co Ltd | Process for producing toner for electrophotography |
| JPH0740142B2 (ja) * | 1985-11-05 | 1995-05-01 | 日本カーバイド工業株式会社 | 静電荷像現像用トナ− |
| WO1988005930A1 (fr) * | 1987-01-29 | 1988-08-11 | Nippon Carbide Kogyo Kabushiki Kaisha | Toner pour developpement electrostatique d'une image chargee |
| US5290654A (en) * | 1992-07-29 | 1994-03-01 | Xerox Corporation | Microsuspension processes for toner compositions |
| US5278020A (en) * | 1992-08-28 | 1994-01-11 | Xerox Corporation | Toner composition and processes thereof |
| US5308734A (en) * | 1992-12-14 | 1994-05-03 | Xerox Corporation | Toner processes |
| US5346797A (en) * | 1993-02-25 | 1994-09-13 | Xerox Corporation | Toner processes |
| US5364729A (en) * | 1993-06-25 | 1994-11-15 | Xerox Corporation | Toner aggregation processes |
| US5370963A (en) * | 1993-06-25 | 1994-12-06 | Xerox Corporation | Toner emulsion aggregation processes |
| US5344738A (en) * | 1993-06-25 | 1994-09-06 | Xerox Corporation | Process of making toner compositions |
| US5418108A (en) * | 1993-06-25 | 1995-05-23 | Xerox Corporation | Toner emulsion aggregation process |
| US5403693A (en) * | 1993-06-25 | 1995-04-04 | Xerox Corporation | Toner aggregation and coalescence processes |
| US5585215A (en) * | 1996-06-13 | 1996-12-17 | Xerox Corporation | Toner compositions |
| US5650252A (en) * | 1996-06-24 | 1997-07-22 | Xerox Corporation | Toner grafting processes |
| US5650256A (en) * | 1996-10-02 | 1997-07-22 | Xerox Corporation | Toner processes |
| US5645968A (en) * | 1996-10-07 | 1997-07-08 | Xerox Corporation | Cationic Toner processes |
-
1997
- 1997-03-28 US US08/825,451 patent/US5763133A/en not_active Expired - Lifetime
- 1997-04-29 US US08/841,300 patent/US5747215A/en not_active Expired - Lifetime
-
1998
- 1998-03-23 JP JP7443298A patent/JP3973287B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US5747215A (en) | 1998-05-05 |
| US5763133A (en) | 1998-06-09 |
| JPH10282717A (ja) | 1998-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3973287B2 (ja) | トナーの調製方法 | |
| US5346797A (en) | Toner processes | |
| US5405728A (en) | Toner aggregation processes | |
| US5869215A (en) | Toner compositions and processes thereof | |
| US5910387A (en) | Toner compositions with acrylonitrile and processes | |
| US5482812A (en) | Wax Containing toner aggregation processes | |
| US5683848A (en) | Acrylonitrile-modified toner composition and processes | |
| US5858601A (en) | Toner processes | |
| US5364729A (en) | Toner aggregation processes | |
| US5527658A (en) | Toner aggregation processes using water insoluble transition metal containing powder | |
| US5585215A (en) | Toner compositions | |
| US5403693A (en) | Toner aggregation and coalescence processes | |
| US5827633A (en) | Toner processes | |
| US5501935A (en) | Toner aggregation processes | |
| US6130021A (en) | Toner processes | |
| US6576389B2 (en) | Toner coagulant processes | |
| US5366841A (en) | Toner aggregation processes | |
| US6268102B1 (en) | Toner coagulant processes | |
| US5994020A (en) | Wax containing colorants | |
| US5650256A (en) | Toner processes | |
| US6500597B1 (en) | Toner coagulant processes | |
| US6416920B1 (en) | Toner coagulant processes | |
| US5869216A (en) | Toner processes | |
| US20080044754A1 (en) | Toner composition | |
| US5962178A (en) | Sediment free toner processes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Written amendment |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20050309 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20050309 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20070213 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20070605 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20070612 |
|
| R150 | Certificate of patent or registration of utility model |
Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20100622 Year of fee payment: 3 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20110622 Year of fee payment: 4 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20110622 Year of fee payment: 4 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20120622 Year of fee payment: 5 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20130622 Year of fee payment: 6 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| LAPS | Cancellation because of no payment of annual fees |