JP2021101629A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2021101629A5 JP2021101629A5 JP2019233587A JP2019233587A JP2021101629A5 JP 2021101629 A5 JP2021101629 A5 JP 2021101629A5 JP 2019233587 A JP2019233587 A JP 2019233587A JP 2019233587 A JP2019233587 A JP 2019233587A JP 2021101629 A5 JP2021101629 A5 JP 2021101629A5
- Authority
- JP
- Japan
- Prior art keywords
- ancestry
- human
- nucleic acid
- genome
- sequence
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 claims description 121
- 150000007523 nucleic acids Chemical class 0.000 claims description 98
- 230000035772 mutation Effects 0.000 claims description 97
- 102000039446 nucleic acids Human genes 0.000 claims description 95
- 108020004707 nucleic acids Proteins 0.000 claims description 95
- 238000012360 testing method Methods 0.000 claims description 83
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 54
- 201000010099 disease Diseases 0.000 claims description 53
- 108700028369 Alleles Proteins 0.000 claims description 52
- 238000007481 next generation sequencing Methods 0.000 claims description 45
- 238000004458 analytical method Methods 0.000 claims description 34
- 238000013507 mapping Methods 0.000 claims description 33
- 108090000623 proteins and genes Proteins 0.000 claims description 29
- 238000012252 genetic analysis Methods 0.000 claims description 18
- 238000011331 genomic analysis Methods 0.000 claims description 18
- 238000004422 calculation algorithm Methods 0.000 claims description 14
- -1 KIT Proteins 0.000 claims description 13
- 210000001766 X chromosome Anatomy 0.000 claims description 13
- 210000002593 Y chromosome Anatomy 0.000 claims description 13
- 238000010801 machine learning Methods 0.000 claims description 8
- 238000007405 data analysis Methods 0.000 claims description 7
- 238000003860 storage Methods 0.000 claims description 7
- 230000001225 therapeutic effect Effects 0.000 claims description 7
- 238000007480 sanger sequencing Methods 0.000 claims description 5
- 238000003491 array Methods 0.000 claims description 4
- 102100026205 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Human genes 0.000 claims description 2
- 102100026802 72 kDa type IV collagenase Human genes 0.000 claims description 2
- 102100037991 85/88 kDa calcium-independent phospholipase A2 Human genes 0.000 claims description 2
- 102100033793 ALK tyrosine kinase receptor Human genes 0.000 claims description 2
- 102100023157 AT-rich interactive domain-containing protein 2 Human genes 0.000 claims description 2
- 102000000872 ATM Human genes 0.000 claims description 2
- 102100028161 ATP-binding cassette sub-family C member 2 Human genes 0.000 claims description 2
- 102100028187 ATP-binding cassette sub-family C member 6 Human genes 0.000 claims description 2
- 102100033350 ATP-dependent translocase ABCB1 Human genes 0.000 claims description 2
- 102100022089 Acyl-[acyl-carrier-protein] hydrolase Human genes 0.000 claims description 2
- 102100034540 Adenomatous polyposis coli protein Human genes 0.000 claims description 2
- 102100024439 Adhesion G protein-coupled receptor A2 Human genes 0.000 claims description 2
- 102100022014 Angiopoietin-1 receptor Human genes 0.000 claims description 2
- 102100034608 Angiopoietin-2 Human genes 0.000 claims description 2
- 102100030988 Angiotensin-converting enzyme Human genes 0.000 claims description 2
- 101710185050 Angiotensin-converting enzyme Proteins 0.000 claims description 2
- 101000798762 Anguilla anguilla Troponin C, skeletal muscle Proteins 0.000 claims description 2
- 102100029361 Aromatase Human genes 0.000 claims description 2
- 108010004586 Ataxia Telangiectasia Mutated Proteins Proteins 0.000 claims description 2
- 102100038080 B-cell receptor CD22 Human genes 0.000 claims description 2
- 101700002522 BARD1 Proteins 0.000 claims description 2
- 102100035080 BDNF/NT-3 growth factors receptor Human genes 0.000 claims description 2
- 108700020463 BRCA1 Proteins 0.000 claims description 2
- 101150072950 BRCA1 gene Proteins 0.000 claims description 2
- 102100028048 BRCA1-associated RING domain protein 1 Human genes 0.000 claims description 2
- 108700020462 BRCA2 Proteins 0.000 claims description 2
- 102100035631 Bloom syndrome protein Human genes 0.000 claims description 2
- 108091009167 Bloom syndrome protein Proteins 0.000 claims description 2
- 101000964894 Bos taurus 14-3-3 protein zeta/delta Proteins 0.000 claims description 2
- 101150008921 Brca2 gene Proteins 0.000 claims description 2
- 102100026008 Breakpoint cluster region protein Human genes 0.000 claims description 2
- 102100025401 Breast cancer type 1 susceptibility protein Human genes 0.000 claims description 2
- 102100025399 Breast cancer type 2 susceptibility protein Human genes 0.000 claims description 2
- 102100022595 Broad substrate specificity ATP-binding cassette transporter ABCG2 Human genes 0.000 claims description 2
- 102100037917 CD109 antigen Human genes 0.000 claims description 2
- 108010017009 CD11b Antigen Proteins 0.000 claims description 2
- 101150013553 CD40 gene Proteins 0.000 claims description 2
- 102100032912 CD44 antigen Human genes 0.000 claims description 2
- 102100021975 CREB-binding protein Human genes 0.000 claims description 2
- 102100036364 Cadherin-2 Human genes 0.000 claims description 2
- 102100038520 Calcitonin receptor Human genes 0.000 claims description 2
- 102100024423 Carbonic anhydrase 9 Human genes 0.000 claims description 2
- 102100035249 Carbonyl reductase [NADPH] 3 Human genes 0.000 claims description 2
- 102100025475 Carcinoembryonic antigen-related cell adhesion molecule 5 Human genes 0.000 claims description 2
- 102100024965 Caspase recruitment domain-containing protein 11 Human genes 0.000 claims description 2
- 102100026550 Caspase-9 Human genes 0.000 claims description 2
- 102100037182 Cation-independent mannose-6-phosphate receptor Human genes 0.000 claims description 2
- 102100025175 Cellular communication network factor 6 Human genes 0.000 claims description 2
- 102100025832 Centromere-associated protein E Human genes 0.000 claims description 2
- 102100035300 Cystine/glutamate transporter Human genes 0.000 claims description 2
- 108010009911 Cytochrome P-450 CYP11B2 Proteins 0.000 claims description 2
- 108010000561 Cytochrome P-450 CYP2C8 Proteins 0.000 claims description 2
- 108010000543 Cytochrome P-450 CYP2C9 Proteins 0.000 claims description 2
- 102100024332 Cytochrome P450 11B1, mitochondrial Human genes 0.000 claims description 2
- 102100024329 Cytochrome P450 11B2, mitochondrial Human genes 0.000 claims description 2
- 102100027417 Cytochrome P450 1B1 Human genes 0.000 claims description 2
- 102100029359 Cytochrome P450 2C8 Human genes 0.000 claims description 2
- 102100029358 Cytochrome P450 2C9 Human genes 0.000 claims description 2
- 102100024812 DNA (cytosine-5)-methyltransferase 3A Human genes 0.000 claims description 2
- 108010024491 DNA Methyltransferase 3A Proteins 0.000 claims description 2
- 102100031866 DNA excision repair protein ERCC-5 Human genes 0.000 claims description 2
- 108010035476 DNA excision repair protein ERCC-5 Proteins 0.000 claims description 2
- 102100037700 DNA mismatch repair protein Msh3 Human genes 0.000 claims description 2
- 102100021147 DNA mismatch repair protein Msh6 Human genes 0.000 claims description 2
- 102100024829 DNA polymerase delta catalytic subunit Human genes 0.000 claims description 2
- 102100022477 DNA repair protein complementing XP-C cells Human genes 0.000 claims description 2
- 102100022204 DNA-dependent protein kinase catalytic subunit Human genes 0.000 claims description 2
- 101100226017 Dictyostelium discoideum repD gene Proteins 0.000 claims description 2
- 102100022334 Dihydropyrimidine dehydrogenase [NADP(+)] Human genes 0.000 claims description 2
- 102100025012 Dipeptidyl peptidase 4 Human genes 0.000 claims description 2
- 102100031113 Disintegrin and metalloproteinase domain-containing protein 15 Human genes 0.000 claims description 2
- 102100026245 E3 ubiquitin-protein ligase RNF43 Human genes 0.000 claims description 2
- 101150115146 EEF2 gene Proteins 0.000 claims description 2
- 102000012804 EPCAM Human genes 0.000 claims description 2
- 101150084967 EPCAM gene Proteins 0.000 claims description 2
- 101150016325 EPHA3 gene Proteins 0.000 claims description 2
- 101150105460 ERCC2 gene Proteins 0.000 claims description 2
- 102100039563 ETS translocation variant 1 Human genes 0.000 claims description 2
- 102100027100 Echinoderm microtubule-associated protein-like 4 Human genes 0.000 claims description 2
- 102100031334 Elongation factor 2 Human genes 0.000 claims description 2
- 102100037241 Endoglin Human genes 0.000 claims description 2
- 102100038083 Endosialin Human genes 0.000 claims description 2
- 108010055323 EphB4 Receptor Proteins 0.000 claims description 2
- 101150025643 Epha5 gene Proteins 0.000 claims description 2
- 102100030324 Ephrin type-A receptor 3 Human genes 0.000 claims description 2
- 102100021605 Ephrin type-A receptor 5 Human genes 0.000 claims description 2
- 102100021604 Ephrin type-A receptor 6 Human genes 0.000 claims description 2
- 102100021606 Ephrin type-A receptor 7 Human genes 0.000 claims description 2
- 102100030779 Ephrin type-B receptor 1 Human genes 0.000 claims description 2
- 102100031983 Ephrin type-B receptor 4 Human genes 0.000 claims description 2
- 102100031984 Ephrin type-B receptor 6 Human genes 0.000 claims description 2
- 101001052004 Escherichia phage T5 L-shaped tail fiber protein pb1 Proteins 0.000 claims description 2
- 102100038595 Estrogen receptor Human genes 0.000 claims description 2
- 102100029951 Estrogen receptor beta Human genes 0.000 claims description 2
- 102000009095 Fanconi Anemia Complementation Group A protein Human genes 0.000 claims description 2
- 108010087740 Fanconi Anemia Complementation Group A protein Proteins 0.000 claims description 2
- 102000013601 Fanconi Anemia Complementation Group D2 protein Human genes 0.000 claims description 2
- 108010026653 Fanconi Anemia Complementation Group D2 protein Proteins 0.000 claims description 2
- 102000007122 Fanconi Anemia Complementation Group G protein Human genes 0.000 claims description 2
- 108010033305 Fanconi Anemia Complementation Group G protein Proteins 0.000 claims description 2
- 102000052930 Fanconi Anemia Complementation Group L protein Human genes 0.000 claims description 2
- 108700026162 Fanconi Anemia Complementation Group L protein Proteins 0.000 claims description 2
- 102100023600 Fibroblast growth factor receptor 2 Human genes 0.000 claims description 2
- 101710182389 Fibroblast growth factor receptor 2 Proteins 0.000 claims description 2
- 102100027842 Fibroblast growth factor receptor 3 Human genes 0.000 claims description 2
- 101710182396 Fibroblast growth factor receptor 3 Proteins 0.000 claims description 2
- 102100027844 Fibroblast growth factor receptor 4 Human genes 0.000 claims description 2
- 102100027579 Forkhead box protein P4 Human genes 0.000 claims description 2
- 101001077417 Gallus gallus Potassium voltage-gated channel subfamily H member 6 Proteins 0.000 claims description 2
- 102100035184 General transcription and DNA repair factor IIH helicase subunit XPD Human genes 0.000 claims description 2
- 108010024044 Glucagon-Like Peptide-2 Receptor Proteins 0.000 claims description 2
- 102100032879 Glucagon-like peptide 2 receptor Human genes 0.000 claims description 2
- 108090000369 Glutamate Carboxypeptidase II Proteins 0.000 claims description 2
- 102100041003 Glutamate carboxypeptidase 2 Human genes 0.000 claims description 2
- 102100038958 Glutamate receptor ionotropic, NMDA 3B Human genes 0.000 claims description 2
- 102100030943 Glutathione S-transferase P Human genes 0.000 claims description 2
- 102100035723 Group 3 secretory phospholipase A2 Human genes 0.000 claims description 2
- 102100032610 Guanine nucleotide-binding protein G(s) subunit alpha isoforms XLas Human genes 0.000 claims description 2
- 102100031561 Hamartin Human genes 0.000 claims description 2
- 102100034051 Heat shock protein HSP 90-alpha Human genes 0.000 claims description 2
- 102000048988 Hemochromatosis Human genes 0.000 claims description 2
- 108700022944 Hemochromatosis Proteins 0.000 claims description 2
- 102100024025 Heparanase Human genes 0.000 claims description 2
- 101150065637 Hfe gene Proteins 0.000 claims description 2
- 102100035108 High affinity nerve growth factor receptor Human genes 0.000 claims description 2
- 102100038885 Histone acetyltransferase p300 Human genes 0.000 claims description 2
- 102100022103 Histone-lysine N-methyltransferase 2A Human genes 0.000 claims description 2
- 102100027768 Histone-lysine N-methyltransferase 2D Human genes 0.000 claims description 2
- 102100038970 Histone-lysine N-methyltransferase EZH2 Human genes 0.000 claims description 2
- 102100032742 Histone-lysine N-methyltransferase SETD2 Human genes 0.000 claims description 2
- 102100039489 Histone-lysine N-methyltransferase, H3 lysine-79 specific Human genes 0.000 claims description 2
- 101000691599 Homo sapiens 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Proteins 0.000 claims description 2
- 101000627872 Homo sapiens 72 kDa type IV collagenase Proteins 0.000 claims description 2
- 101000779641 Homo sapiens ALK tyrosine kinase receptor Proteins 0.000 claims description 2
- 101000685261 Homo sapiens AT-rich interactive domain-containing protein 2 Proteins 0.000 claims description 2
- 101000986621 Homo sapiens ATP-binding cassette sub-family C member 6 Proteins 0.000 claims description 2
- 101000824278 Homo sapiens Acyl-[acyl-carrier-protein] hydrolase Proteins 0.000 claims description 2
- 101000924577 Homo sapiens Adenomatous polyposis coli protein Proteins 0.000 claims description 2
- 101000833358 Homo sapiens Adhesion G protein-coupled receptor A2 Proteins 0.000 claims description 2
- 101000753291 Homo sapiens Angiopoietin-1 receptor Proteins 0.000 claims description 2
- 101000924533 Homo sapiens Angiopoietin-2 Proteins 0.000 claims description 2
- 101000919395 Homo sapiens Aromatase Proteins 0.000 claims description 2
- 101000884399 Homo sapiens Arylamine N-acetyltransferase 2 Proteins 0.000 claims description 2
- 101000884305 Homo sapiens B-cell receptor CD22 Proteins 0.000 claims description 2
- 101000596896 Homo sapiens BDNF/NT-3 growth factors receptor Proteins 0.000 claims description 2
- 101000933320 Homo sapiens Breakpoint cluster region protein Proteins 0.000 claims description 2
- 101000738399 Homo sapiens CD109 antigen Proteins 0.000 claims description 2
- 101000868273 Homo sapiens CD44 antigen Proteins 0.000 claims description 2
- 101000896987 Homo sapiens CREB-binding protein Proteins 0.000 claims description 2
- 101000714537 Homo sapiens Cadherin-2 Proteins 0.000 claims description 2
- 101000899459 Homo sapiens Cadherin-20 Proteins 0.000 claims description 2
- 101000741435 Homo sapiens Calcitonin receptor Proteins 0.000 claims description 2
- 101000910338 Homo sapiens Carbonic anhydrase 9 Proteins 0.000 claims description 2
- 101000737274 Homo sapiens Carbonyl reductase [NADPH] 3 Proteins 0.000 claims description 2
- 101000914324 Homo sapiens Carcinoembryonic antigen-related cell adhesion molecule 5 Proteins 0.000 claims description 2
- 101000761179 Homo sapiens Caspase recruitment domain-containing protein 11 Proteins 0.000 claims description 2
- 101000983523 Homo sapiens Caspase-9 Proteins 0.000 claims description 2
- 101001028831 Homo sapiens Cation-independent mannose-6-phosphate receptor Proteins 0.000 claims description 2
- 101000934310 Homo sapiens Cellular communication network factor 6 Proteins 0.000 claims description 2
- 101000914247 Homo sapiens Centromere-associated protein E Proteins 0.000 claims description 2
- 101000725164 Homo sapiens Cytochrome P450 1B1 Proteins 0.000 claims description 2
- 101001027762 Homo sapiens DNA mismatch repair protein Msh3 Proteins 0.000 claims description 2
- 101000968658 Homo sapiens DNA mismatch repair protein Msh6 Proteins 0.000 claims description 2
- 101000909198 Homo sapiens DNA polymerase delta catalytic subunit Proteins 0.000 claims description 2
- 101000618535 Homo sapiens DNA repair protein complementing XP-C cells Proteins 0.000 claims description 2
- 101000619536 Homo sapiens DNA-dependent protein kinase catalytic subunit Proteins 0.000 claims description 2
- 101000902632 Homo sapiens Dihydropyrimidine dehydrogenase [NADP(+)] Proteins 0.000 claims description 2
- 101000908391 Homo sapiens Dipeptidyl peptidase 4 Proteins 0.000 claims description 2
- 101000777455 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 15 Proteins 0.000 claims description 2
- 101000692702 Homo sapiens E3 ubiquitin-protein ligase RNF43 Proteins 0.000 claims description 2
- 101000813729 Homo sapiens ETS translocation variant 1 Proteins 0.000 claims description 2
- 101001057929 Homo sapiens Echinoderm microtubule-associated protein-like 4 Proteins 0.000 claims description 2
- 101000881679 Homo sapiens Endoglin Proteins 0.000 claims description 2
- 101000884275 Homo sapiens Endosialin Proteins 0.000 claims description 2
- 101000898696 Homo sapiens Ephrin type-A receptor 6 Proteins 0.000 claims description 2
- 101000898708 Homo sapiens Ephrin type-A receptor 7 Proteins 0.000 claims description 2
- 101001064150 Homo sapiens Ephrin type-B receptor 1 Proteins 0.000 claims description 2
- 101001064451 Homo sapiens Ephrin type-B receptor 6 Proteins 0.000 claims description 2
- 101000882584 Homo sapiens Estrogen receptor Proteins 0.000 claims description 2
- 101001010910 Homo sapiens Estrogen receptor beta Proteins 0.000 claims description 2
- 101100119754 Homo sapiens FANCL gene Proteins 0.000 claims description 2
- 101000917134 Homo sapiens Fibroblast growth factor receptor 4 Proteins 0.000 claims description 2
- 101000861403 Homo sapiens Forkhead box protein P4 Proteins 0.000 claims description 2
- 101000603185 Homo sapiens Glutamate receptor ionotropic, NMDA 3B Proteins 0.000 claims description 2
- 101001010139 Homo sapiens Glutathione S-transferase P Proteins 0.000 claims description 2
- 101000735510 Homo sapiens Group 3 secretory phospholipase A2 Proteins 0.000 claims description 2
- 101001014590 Homo sapiens Guanine nucleotide-binding protein G(s) subunit alpha isoforms XLas Proteins 0.000 claims description 2
- 101001014594 Homo sapiens Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Proteins 0.000 claims description 2
- 101000795643 Homo sapiens Hamartin Proteins 0.000 claims description 2
- 101001016865 Homo sapiens Heat shock protein HSP 90-alpha Proteins 0.000 claims description 2
- 101001047819 Homo sapiens Heparanase Proteins 0.000 claims description 2
- 101000596894 Homo sapiens High affinity nerve growth factor receptor Proteins 0.000 claims description 2
- 101000882390 Homo sapiens Histone acetyltransferase p300 Proteins 0.000 claims description 2
- 101001045846 Homo sapiens Histone-lysine N-methyltransferase 2A Proteins 0.000 claims description 2
- 101001045848 Homo sapiens Histone-lysine N-methyltransferase 2B Proteins 0.000 claims description 2
- 101001008894 Homo sapiens Histone-lysine N-methyltransferase 2D Proteins 0.000 claims description 2
- 101000882127 Homo sapiens Histone-lysine N-methyltransferase EZH2 Proteins 0.000 claims description 2
- 101000654725 Homo sapiens Histone-lysine N-methyltransferase SETD2 Proteins 0.000 claims description 2
- 101000963360 Homo sapiens Histone-lysine N-methyltransferase, H3 lysine-79 specific Proteins 0.000 claims description 2
- 101100508538 Homo sapiens IKBKE gene Proteins 0.000 claims description 2
- 101000852815 Homo sapiens Insulin receptor Proteins 0.000 claims description 2
- 101001077600 Homo sapiens Insulin receptor substrate 2 Proteins 0.000 claims description 2
- 101001034652 Homo sapiens Insulin-like growth factor 1 receptor Proteins 0.000 claims description 2
- 101001078158 Homo sapiens Integrin alpha-1 Proteins 0.000 claims description 2
- 101000994369 Homo sapiens Integrin alpha-5 Proteins 0.000 claims description 2
- 101001046677 Homo sapiens Integrin alpha-V Proteins 0.000 claims description 2
- 101000935043 Homo sapiens Integrin beta-1 Proteins 0.000 claims description 2
- 101000935040 Homo sapiens Integrin beta-2 Proteins 0.000 claims description 2
- 101001015004 Homo sapiens Integrin beta-3 Proteins 0.000 claims description 2
- 101001015059 Homo sapiens Integrin beta-5 Proteins 0.000 claims description 2
- 101001015064 Homo sapiens Integrin beta-6 Proteins 0.000 claims description 2
- 101001003147 Homo sapiens Interleukin-11 receptor subunit alpha Proteins 0.000 claims description 2
- 101001055144 Homo sapiens Interleukin-2 receptor subunit alpha Proteins 0.000 claims description 2
- 101001033312 Homo sapiens Interleukin-4 receptor subunit alpha Proteins 0.000 claims description 2
- 101001043809 Homo sapiens Interleukin-7 receptor subunit alpha Proteins 0.000 claims description 2
- 101001008854 Homo sapiens Kelch-like protein 6 Proteins 0.000 claims description 2
- 101001008857 Homo sapiens Kelch-like protein 7 Proteins 0.000 claims description 2
- 101001008953 Homo sapiens Kinesin-like protein KIF11 Proteins 0.000 claims description 2
- 101000798114 Homo sapiens Lactotransferrin Proteins 0.000 claims description 2
- 101000984620 Homo sapiens Low-density lipoprotein receptor-related protein 1B Proteins 0.000 claims description 2
- 101001043562 Homo sapiens Low-density lipoprotein receptor-related protein 2 Proteins 0.000 claims description 2
- 101001039199 Homo sapiens Low-density lipoprotein receptor-related protein 6 Proteins 0.000 claims description 2
- 101001039035 Homo sapiens Lutropin-choriogonadotropic hormone receptor Proteins 0.000 claims description 2
- 101001088892 Homo sapiens Lysine-specific demethylase 5A Proteins 0.000 claims description 2
- 101001043352 Homo sapiens Lysyl oxidase homolog 2 Proteins 0.000 claims description 2
- 101000916644 Homo sapiens Macrophage colony-stimulating factor 1 receptor Proteins 0.000 claims description 2
- 101001106413 Homo sapiens Macrophage-stimulating protein receptor Proteins 0.000 claims description 2
- 101001013648 Homo sapiens Methionine synthase Proteins 0.000 claims description 2
- 101000653360 Homo sapiens Methylcytosine dioxygenase TET1 Proteins 0.000 claims description 2
- 101000653374 Homo sapiens Methylcytosine dioxygenase TET2 Proteins 0.000 claims description 2
- 101000587058 Homo sapiens Methylenetetrahydrofolate reductase Proteins 0.000 claims description 2
- 101000573451 Homo sapiens Msx2-interacting protein Proteins 0.000 claims description 2
- 101000969812 Homo sapiens Multidrug resistance-associated protein 1 Proteins 0.000 claims description 2
- 101001000104 Homo sapiens Myosin-11 Proteins 0.000 claims description 2
- 101001014610 Homo sapiens Neuroendocrine secretory protein 55 Proteins 0.000 claims description 2
- 101001112224 Homo sapiens Neutrophil cytosol factor 2 Proteins 0.000 claims description 2
- 101000979342 Homo sapiens Nuclear factor NF-kappa-B p105 subunit Proteins 0.000 claims description 2
- 101001007909 Homo sapiens Nuclear pore complex protein Nup93 Proteins 0.000 claims description 2
- 101001109700 Homo sapiens Nuclear receptor subfamily 4 group A member 1 Proteins 0.000 claims description 2
- 101001125026 Homo sapiens Nucleotide-binding oligomerization domain-containing protein 2 Proteins 0.000 claims description 2
- 101000622137 Homo sapiens P-selectin Proteins 0.000 claims description 2
- 101001098175 Homo sapiens P2X purinoceptor 7 Proteins 0.000 claims description 2
- 101001129705 Homo sapiens PH domain leucine-rich repeat-containing protein phosphatase 2 Proteins 0.000 claims description 2
- 101000629361 Homo sapiens Paraplegin Proteins 0.000 claims description 2
- 101001120056 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit alpha Proteins 0.000 claims description 2
- 101000595746 Homo sapiens Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Proteins 0.000 claims description 2
- 101001091365 Homo sapiens Plasma kallikrein Proteins 0.000 claims description 2
- 101001126417 Homo sapiens Platelet-derived growth factor receptor alpha Proteins 0.000 claims description 2
- 101001113440 Homo sapiens Poly [ADP-ribose] polymerase 2 Proteins 0.000 claims description 2
- 101000663006 Homo sapiens Poly [ADP-ribose] polymerase tankyrase-1 Proteins 0.000 claims description 2
- 101000728236 Homo sapiens Polycomb group protein ASXL1 Proteins 0.000 claims description 2
- 101000605534 Homo sapiens Prostate-specific antigen Proteins 0.000 claims description 2
- 101001001272 Homo sapiens Prostatic acid phosphatase Proteins 0.000 claims description 2
- 101000797903 Homo sapiens Protein ALEX Proteins 0.000 claims description 2
- 101000883014 Homo sapiens Protein capicua homolog Proteins 0.000 claims description 2
- 101001051767 Homo sapiens Protein kinase C beta type Proteins 0.000 claims description 2
- 101000735466 Homo sapiens Protein mono-ADP-ribosyltransferase PARP8 Proteins 0.000 claims description 2
- 101000601770 Homo sapiens Protein polybromo-1 Proteins 0.000 claims description 2
- 101000666171 Homo sapiens Protein-glutamine gamma-glutamyltransferase 2 Proteins 0.000 claims description 2
- 101000878540 Homo sapiens Protein-tyrosine kinase 2-beta Proteins 0.000 claims description 2
- 101000686031 Homo sapiens Proto-oncogene tyrosine-protein kinase ROS Proteins 0.000 claims description 2
- 101000579425 Homo sapiens Proto-oncogene tyrosine-protein kinase receptor Ret Proteins 0.000 claims description 2
- 101000602015 Homo sapiens Protocadherin gamma-B4 Proteins 0.000 claims description 2
- 101000779418 Homo sapiens RAC-alpha serine/threonine-protein kinase Proteins 0.000 claims description 2
- 101100087590 Homo sapiens RICTOR gene Proteins 0.000 claims description 2
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims description 2
- 101000932478 Homo sapiens Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 claims description 2
- 101000738771 Homo sapiens Receptor-type tyrosine-protein phosphatase C Proteins 0.000 claims description 2
- 101000606537 Homo sapiens Receptor-type tyrosine-protein phosphatase delta Proteins 0.000 claims description 2
- 101000742859 Homo sapiens Retinoblastoma-associated protein Proteins 0.000 claims description 2
- 101000729271 Homo sapiens Retinoid isomerohydrolase Proteins 0.000 claims description 2
- 101000669921 Homo sapiens Rho-associated protein kinase 2 Proteins 0.000 claims description 2
- 101000799194 Homo sapiens Serine/threonine-protein kinase receptor R3 Proteins 0.000 claims description 2
- 101000783404 Homo sapiens Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Proteins 0.000 claims description 2
- 101000713305 Homo sapiens Sodium-coupled neutral amino acid transporter 1 Proteins 0.000 claims description 2
- 101000753178 Homo sapiens Sodium/potassium-transporting ATPase subunit alpha-3 Proteins 0.000 claims description 2
- 101000829153 Homo sapiens Somatostatin receptor type 5 Proteins 0.000 claims description 2
- 101000707567 Homo sapiens Splicing factor 3B subunit 1 Proteins 0.000 claims description 2
- 101000825726 Homo sapiens Structural maintenance of chromosomes protein 4 Proteins 0.000 claims description 2
- 101000716102 Homo sapiens T-cell surface glycoprotein CD4 Proteins 0.000 claims description 2
- 101000666340 Homo sapiens Tenascin Proteins 0.000 claims description 2
- 101000772267 Homo sapiens Thyrotropin receptor Proteins 0.000 claims description 2
- 101000831496 Homo sapiens Toll-like receptor 3 Proteins 0.000 claims description 2
- 101000702545 Homo sapiens Transcription activator BRG1 Proteins 0.000 claims description 2
- 101001010792 Homo sapiens Transcriptional regulator ERG Proteins 0.000 claims description 2
- 101000638154 Homo sapiens Transmembrane protease serine 2 Proteins 0.000 claims description 2
- 101000795659 Homo sapiens Tuberin Proteins 0.000 claims description 2
- 101000611023 Homo sapiens Tumor necrosis factor receptor superfamily member 6 Proteins 0.000 claims description 2
- 101000851376 Homo sapiens Tumor necrosis factor receptor superfamily member 8 Proteins 0.000 claims description 2
- 101000823316 Homo sapiens Tyrosine-protein kinase ABL1 Proteins 0.000 claims description 2
- 101000823271 Homo sapiens Tyrosine-protein kinase ABL2 Proteins 0.000 claims description 2
- 101001050476 Homo sapiens Tyrosine-protein kinase ITK/TSK Proteins 0.000 claims description 2
- 101000997835 Homo sapiens Tyrosine-protein kinase JAK1 Proteins 0.000 claims description 2
- 101000934996 Homo sapiens Tyrosine-protein kinase JAK3 Proteins 0.000 claims description 2
- 101000604583 Homo sapiens Tyrosine-protein kinase SYK Proteins 0.000 claims description 2
- 101000889732 Homo sapiens Tyrosine-protein kinase Tec Proteins 0.000 claims description 2
- 101000807561 Homo sapiens Tyrosine-protein kinase receptor UFO Proteins 0.000 claims description 2
- 101000638886 Homo sapiens Urokinase-type plasminogen activator Proteins 0.000 claims description 2
- 101000622304 Homo sapiens Vascular cell adhesion protein 1 Proteins 0.000 claims description 2
- 101000742579 Homo sapiens Vascular endothelial growth factor B Proteins 0.000 claims description 2
- 101000851018 Homo sapiens Vascular endothelial growth factor receptor 1 Proteins 0.000 claims description 2
- 101000782132 Homo sapiens Zinc finger protein 217 Proteins 0.000 claims description 2
- 102100021857 Inhibitor of nuclear factor kappa-B kinase subunit epsilon Human genes 0.000 claims description 2
- 102100036721 Insulin receptor Human genes 0.000 claims description 2
- 102100025092 Insulin receptor substrate 2 Human genes 0.000 claims description 2
- 102100039688 Insulin-like growth factor 1 receptor Human genes 0.000 claims description 2
- 102100025323 Integrin alpha-1 Human genes 0.000 claims description 2
- 102100032817 Integrin alpha-5 Human genes 0.000 claims description 2
- 102100022338 Integrin alpha-M Human genes 0.000 claims description 2
- 102100022337 Integrin alpha-V Human genes 0.000 claims description 2
- 102100025304 Integrin beta-1 Human genes 0.000 claims description 2
- 102100025390 Integrin beta-2 Human genes 0.000 claims description 2
- 102100032999 Integrin beta-3 Human genes 0.000 claims description 2
- 102100033010 Integrin beta-5 Human genes 0.000 claims description 2
- 102100033011 Integrin beta-6 Human genes 0.000 claims description 2
- 102100020787 Interleukin-11 receptor subunit alpha Human genes 0.000 claims description 2
- 102100026878 Interleukin-2 receptor subunit alpha Human genes 0.000 claims description 2
- 102100039078 Interleukin-4 receptor subunit alpha Human genes 0.000 claims description 2
- 102100021593 Interleukin-7 receptor subunit alpha Human genes 0.000 claims description 2
- 102100027789 Kelch-like protein 7 Human genes 0.000 claims description 2
- 102100027629 Kinesin-like protein KIF11 Human genes 0.000 claims description 2
- 102100032241 Lactotransferrin Human genes 0.000 claims description 2
- 102000057248 Lipoprotein(a) Human genes 0.000 claims description 2
- 108010033266 Lipoprotein(a) Proteins 0.000 claims description 2
- 102100027121 Low-density lipoprotein receptor-related protein 1B Human genes 0.000 claims description 2
- 102100021922 Low-density lipoprotein receptor-related protein 2 Human genes 0.000 claims description 2
- 102100040704 Low-density lipoprotein receptor-related protein 6 Human genes 0.000 claims description 2
- 102100040788 Lutropin-choriogonadotropic hormone receptor Human genes 0.000 claims description 2
- 102100033246 Lysine-specific demethylase 5A Human genes 0.000 claims description 2
- 102100021948 Lysyl oxidase homolog 2 Human genes 0.000 claims description 2
- 108010075654 MAP Kinase Kinase Kinase 1 Proteins 0.000 claims description 2
- 102000017274 MDM4 Human genes 0.000 claims description 2
- 108050005300 MDM4 Proteins 0.000 claims description 2
- 102000046961 MRE11 Homologue Human genes 0.000 claims description 2
- 108700019589 MRE11 Homologue Proteins 0.000 claims description 2
- 102100028198 Macrophage colony-stimulating factor 1 receptor Human genes 0.000 claims description 2
- 102100021435 Macrophage-stimulating protein receptor Human genes 0.000 claims description 2
- 108010047230 Member 1 Subfamily B ATP Binding Cassette Transporter Proteins 0.000 claims description 2
- 108010090306 Member 2 Subfamily G ATP Binding Cassette Transporter Proteins 0.000 claims description 2
- 102100031551 Methionine synthase Human genes 0.000 claims description 2
- 102100030819 Methylcytosine dioxygenase TET1 Human genes 0.000 claims description 2
- 102100030803 Methylcytosine dioxygenase TET2 Human genes 0.000 claims description 2
- 102100029684 Methylenetetrahydrofolate reductase Human genes 0.000 claims description 2
- 102100033115 Mitogen-activated protein kinase kinase kinase 1 Human genes 0.000 claims description 2
- 102100026285 Msx2-interacting protein Human genes 0.000 claims description 2
- 101150097381 Mtor gene Proteins 0.000 claims description 2
- 108010066419 Multidrug Resistance-Associated Protein 2 Proteins 0.000 claims description 2
- 102100021339 Multidrug resistance-associated protein 1 Human genes 0.000 claims description 2
- 102000013609 MutL Protein Homolog 1 Human genes 0.000 claims description 2
- 108010026664 MutL Protein Homolog 1 Proteins 0.000 claims description 2
- 102100036639 Myosin-11 Human genes 0.000 claims description 2
- 102100026783 N-alpha-acetyltransferase 16, NatA auxiliary subunit Human genes 0.000 claims description 2
- 102000007530 Neurofibromin 1 Human genes 0.000 claims description 2
- 108010085793 Neurofibromin 1 Proteins 0.000 claims description 2
- 108090000770 Neuropilin-2 Proteins 0.000 claims description 2
- 102100023618 Neutrophil cytosol factor 2 Human genes 0.000 claims description 2
- 108010049586 Norepinephrine Plasma Membrane Transport Proteins Proteins 0.000 claims description 2
- 102000001759 Notch1 Receptor Human genes 0.000 claims description 2
- 108010029755 Notch1 Receptor Proteins 0.000 claims description 2
- 102000001756 Notch2 Receptor Human genes 0.000 claims description 2
- 108010029751 Notch2 Receptor Proteins 0.000 claims description 2
- 102000001760 Notch3 Receptor Human genes 0.000 claims description 2
- 108010029756 Notch3 Receptor Proteins 0.000 claims description 2
- 102100023050 Nuclear factor NF-kappa-B p105 subunit Human genes 0.000 claims description 2
- 102100027585 Nuclear pore complex protein Nup93 Human genes 0.000 claims description 2
- 102100022679 Nuclear receptor subfamily 4 group A member 1 Human genes 0.000 claims description 2
- 102100022673 Nuclear receptor subfamily 4 group A member 3 Human genes 0.000 claims description 2
- 102100029441 Nucleotide-binding oligomerization domain-containing protein 2 Human genes 0.000 claims description 2
- 102100023472 P-selectin Human genes 0.000 claims description 2
- 102100037602 P2X purinoceptor 7 Human genes 0.000 claims description 2
- 102100031136 PH domain leucine-rich repeat-containing protein phosphatase 2 Human genes 0.000 claims description 2
- 101710125553 PLA2G6 Proteins 0.000 claims description 2
- 102000036673 PRAME Human genes 0.000 claims description 2
- 108060006580 PRAME Proteins 0.000 claims description 2
- 102100027006 Paraplegin Human genes 0.000 claims description 2
- 108010065129 Patched-1 Receptor Proteins 0.000 claims description 2
- 108010071083 Patched-2 Receptor Proteins 0.000 claims description 2
- 102100026169 Phosphatidylinositol 3-kinase regulatory subunit alpha Human genes 0.000 claims description 2
- 102100036056 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Human genes 0.000 claims description 2
- 102100034869 Plasma kallikrein Human genes 0.000 claims description 2
- 108010022233 Plasminogen Activator Inhibitor 1 Proteins 0.000 claims description 2
- 102100039418 Plasminogen activator inhibitor 1 Human genes 0.000 claims description 2
- 108010051742 Platelet-Derived Growth Factor beta Receptor Proteins 0.000 claims description 2
- 102100030485 Platelet-derived growth factor receptor alpha Human genes 0.000 claims description 2
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 claims description 2
- 102100040990 Platelet-derived growth factor subunit B Human genes 0.000 claims description 2
- 108010064218 Poly (ADP-Ribose) Polymerase-1 Proteins 0.000 claims description 2
- 102100023712 Poly [ADP-ribose] polymerase 1 Human genes 0.000 claims description 2
- 102100023652 Poly [ADP-ribose] polymerase 2 Human genes 0.000 claims description 2
- 102100037664 Poly [ADP-ribose] polymerase tankyrase-1 Human genes 0.000 claims description 2
- 102100029799 Polycomb group protein ASXL1 Human genes 0.000 claims description 2
- 102100022807 Potassium voltage-gated channel subfamily H member 2 Human genes 0.000 claims description 2
- 102100035703 Prostatic acid phosphatase Human genes 0.000 claims description 2
- 102100038777 Protein capicua homolog Human genes 0.000 claims description 2
- 102100024923 Protein kinase C beta type Human genes 0.000 claims description 2
- 102100034433 Protein kinase C-binding protein NELL2 Human genes 0.000 claims description 2
- 102100034933 Protein mono-ADP-ribosyltransferase PARP8 Human genes 0.000 claims description 2
- 102100028680 Protein patched homolog 1 Human genes 0.000 claims description 2
- 102100036894 Protein patched homolog 2 Human genes 0.000 claims description 2
- 102100037516 Protein polybromo-1 Human genes 0.000 claims description 2
- 102100038095 Protein-glutamine gamma-glutamyltransferase 2 Human genes 0.000 claims description 2
- 102100037787 Protein-tyrosine kinase 2-beta Human genes 0.000 claims description 2
- 108010019674 Proto-Oncogene Proteins c-sis Proteins 0.000 claims description 2
- 102100023347 Proto-oncogene tyrosine-protein kinase ROS Human genes 0.000 claims description 2
- 102100028286 Proto-oncogene tyrosine-protein kinase receptor Ret Human genes 0.000 claims description 2
- 102100037554 Protocadherin gamma-B4 Human genes 0.000 claims description 2
- 108010059278 Pyrin Proteins 0.000 claims description 2
- 102100039233 Pyrin Human genes 0.000 claims description 2
- 102100033810 RAC-alpha serine/threonine-protein kinase Human genes 0.000 claims description 2
- 102000004229 RNA-binding protein EWS Human genes 0.000 claims description 2
- 108090000740 RNA-binding protein EWS Proteins 0.000 claims description 2
- 102000046941 Rapamycin-Insensitive Companion of mTOR Human genes 0.000 claims description 2
- 108700019586 Rapamycin-Insensitive Companion of mTOR Proteins 0.000 claims description 2
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims description 2
- 101710100969 Receptor tyrosine-protein kinase erbB-3 Proteins 0.000 claims description 2
- 102100029986 Receptor tyrosine-protein kinase erbB-3 Human genes 0.000 claims description 2
- 102100029981 Receptor tyrosine-protein kinase erbB-4 Human genes 0.000 claims description 2
- 101710100963 Receptor tyrosine-protein kinase erbB-4 Proteins 0.000 claims description 2
- 102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 claims description 2
- 102100037422 Receptor-type tyrosine-protein phosphatase C Human genes 0.000 claims description 2
- 102100039666 Receptor-type tyrosine-protein phosphatase delta Human genes 0.000 claims description 2
- 108010029031 Regulatory-Associated Protein of mTOR Proteins 0.000 claims description 2
- 102100040969 Regulatory-associated protein of mTOR Human genes 0.000 claims description 2
- 102100038042 Retinoblastoma-associated protein Human genes 0.000 claims description 2
- 102100031176 Retinoid isomerohydrolase Human genes 0.000 claims description 2
- 101001030849 Rhinella marina Mesotocin receptor Proteins 0.000 claims description 2
- 102100039314 Rho-associated protein kinase 2 Human genes 0.000 claims description 2
- 108091006273 SLC5A5 Proteins 0.000 claims description 2
- 102000005030 SLC6A2 Human genes 0.000 claims description 2
- 108091006241 SLC7A11 Proteins 0.000 claims description 2
- 108091006731 SLCO1B1 Proteins 0.000 claims description 2
- 108010017324 STAT3 Transcription Factor Proteins 0.000 claims description 2
- 102100031463 Serine/threonine-protein kinase PLK1 Human genes 0.000 claims description 2
- 102100023085 Serine/threonine-protein kinase mTOR Human genes 0.000 claims description 2
- 102100034136 Serine/threonine-protein kinase receptor R3 Human genes 0.000 claims description 2
- 102100036122 Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Human genes 0.000 claims description 2
- 102100024040 Signal transducer and activator of transcription 3 Human genes 0.000 claims description 2
- 101000873420 Simian virus 40 SV40 early leader protein Proteins 0.000 claims description 2
- 102100020886 Sodium/iodide cotransporter Human genes 0.000 claims description 2
- 102100021952 Sodium/potassium-transporting ATPase subunit alpha-3 Human genes 0.000 claims description 2
- 102100027233 Solute carrier organic anion transporter family member 1B1 Human genes 0.000 claims description 2
- 102100023806 Somatostatin receptor type 5 Human genes 0.000 claims description 2
- 102100031711 Splicing factor 3B subunit 1 Human genes 0.000 claims description 2
- 108010049356 Steroid 11-beta-Hydroxylase Proteins 0.000 claims description 2
- 102100022842 Structural maintenance of chromosomes protein 4 Human genes 0.000 claims description 2
- 102100036011 T-cell surface glycoprotein CD4 Human genes 0.000 claims description 2
- 101150057140 TACSTD1 gene Proteins 0.000 claims description 2
- 102000003610 TRPM8 Human genes 0.000 claims description 2
- 102100038126 Tenascin Human genes 0.000 claims description 2
- 102100029337 Thyrotropin receptor Human genes 0.000 claims description 2
- 102100024324 Toll-like receptor 3 Human genes 0.000 claims description 2
- 102100031027 Transcription activator BRG1 Human genes 0.000 claims description 2
- 102100031989 Transmembrane protease serine 2 Human genes 0.000 claims description 2
- 101150111302 Trpm8 gene Proteins 0.000 claims description 2
- 102100031638 Tuberin Human genes 0.000 claims description 2
- 108010091356 Tumor Protein p73 Proteins 0.000 claims description 2
- 102100040245 Tumor necrosis factor receptor superfamily member 5 Human genes 0.000 claims description 2
- 102100036857 Tumor necrosis factor receptor superfamily member 8 Human genes 0.000 claims description 2
- 102100030018 Tumor protein p73 Human genes 0.000 claims description 2
- 102100022596 Tyrosine-protein kinase ABL1 Human genes 0.000 claims description 2
- 102100022651 Tyrosine-protein kinase ABL2 Human genes 0.000 claims description 2
- 102100023345 Tyrosine-protein kinase ITK/TSK Human genes 0.000 claims description 2
- 102100033438 Tyrosine-protein kinase JAK1 Human genes 0.000 claims description 2
- 102100025387 Tyrosine-protein kinase JAK3 Human genes 0.000 claims description 2
- 102100038183 Tyrosine-protein kinase SYK Human genes 0.000 claims description 2
- 102100037236 Tyrosine-protein kinase receptor UFO Human genes 0.000 claims description 2
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 claims description 2
- 108010053099 Vascular Endothelial Growth Factor Receptor-2 Proteins 0.000 claims description 2
- 108010053100 Vascular Endothelial Growth Factor Receptor-3 Proteins 0.000 claims description 2
- 102100023543 Vascular cell adhesion protein 1 Human genes 0.000 claims description 2
- 102100038217 Vascular endothelial growth factor B Human genes 0.000 claims description 2
- 102100033178 Vascular endothelial growth factor receptor 1 Human genes 0.000 claims description 2
- 102100033177 Vascular endothelial growth factor receptor 2 Human genes 0.000 claims description 2
- 102100033179 Vascular endothelial growth factor receptor 3 Human genes 0.000 claims description 2
- 102000040856 WT1 Human genes 0.000 claims description 2
- 108700020467 WT1 Proteins 0.000 claims description 2
- 101150084041 WT1 gene Proteins 0.000 claims description 2
- 102000002258 X-ray Repair Cross Complementing Protein 1 Human genes 0.000 claims description 2
- 108010000443 X-ray Repair Cross Complementing Protein 1 Proteins 0.000 claims description 2
- 108700031763 Xeroderma Pigmentosum Group D Proteins 0.000 claims description 2
- 102100036595 Zinc finger protein 217 Human genes 0.000 claims description 2
- 238000004590 computer program Methods 0.000 claims description 2
- 230000002559 cytogenic effect Effects 0.000 claims description 2
- 229940090124 dipeptidyl peptidase 4 (dpp-4) inhibitors for blood glucose lowering Drugs 0.000 claims description 2
- 102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 claims description 2
- 108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 claims description 2
- 238000004949 mass spectrometry Methods 0.000 claims description 2
- 101150071637 mre11 gene Proteins 0.000 claims description 2
- YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 claims description 2
- 108010056274 polo-like kinase 1 Proteins 0.000 claims description 2
- 102000003998 progesterone receptors Human genes 0.000 claims description 2
- 108090000468 progesterone receptors Proteins 0.000 claims description 2
- 102000009310 vitamin D receptors Human genes 0.000 claims description 2
- 108050000156 vitamin D receptors Proteins 0.000 claims description 2
- 102100036537 von Willebrand factor Human genes 0.000 claims description 2
- 108010001237 Cytochrome P-450 CYP2D6 Proteins 0.000 claims 1
- 102100021704 Cytochrome P450 2D6 Human genes 0.000 claims 1
- 108091007178 TNFRSF10A Proteins 0.000 claims 1
- 102100040113 Tumor necrosis factor receptor superfamily member 10A Human genes 0.000 claims 1
- 101150045640 VWF gene Proteins 0.000 claims 1
- 239000000523 sample Substances 0.000 description 65
- 108020004414 DNA Proteins 0.000 description 38
- 238000012163 sequencing technique Methods 0.000 description 30
- 239000002773 nucleotide Substances 0.000 description 29
- 125000003729 nucleotide group Chemical group 0.000 description 29
- 238000011282 treatment Methods 0.000 description 26
- 238000012545 processing Methods 0.000 description 22
- 239000000090 biomarker Substances 0.000 description 20
- 230000008569 process Effects 0.000 description 20
- 208000024891 symptom Diseases 0.000 description 18
- 230000002068 genetic effect Effects 0.000 description 17
- 238000002560 therapeutic procedure Methods 0.000 description 16
- 206010028980 Neoplasm Diseases 0.000 description 14
- 230000008901 benefit Effects 0.000 description 13
- 238000005516 engineering process Methods 0.000 description 13
- 201000011510 cancer Diseases 0.000 description 11
- 210000000349 chromosome Anatomy 0.000 description 11
- 230000036541 health Effects 0.000 description 10
- 238000004891 communication Methods 0.000 description 9
- 238000011160 research Methods 0.000 description 9
- 238000012217 deletion Methods 0.000 description 8
- 230000037430 deletion Effects 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 238000003780 insertion Methods 0.000 description 8
- 230000037431 insertion Effects 0.000 description 8
- 210000001519 tissue Anatomy 0.000 description 7
- 238000012070 whole genome sequencing analysis Methods 0.000 description 7
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 6
- 238000013459 approach Methods 0.000 description 6
- 238000004364 calculation method Methods 0.000 description 6
- 238000012805 post-processing Methods 0.000 description 6
- 238000007482 whole exome sequencing Methods 0.000 description 6
- 108091028043 Nucleic acid sequence Proteins 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 238000012937 correction Methods 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 239000012634 fragment Substances 0.000 description 5
- 102000054766 genetic haplotypes Human genes 0.000 description 5
- 238000012268 genome sequencing Methods 0.000 description 5
- 238000007477 logistic regression Methods 0.000 description 5
- 241000282412 Homo Species 0.000 description 4
- 208000026350 Inborn Genetic disease Diseases 0.000 description 4
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 4
- 230000005856 abnormality Effects 0.000 description 4
- 230000002759 chromosomal effect Effects 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 208000016361 genetic disease Diseases 0.000 description 4
- 238000003205 genotyping method Methods 0.000 description 4
- 102000053602 DNA Human genes 0.000 description 3
- 238000001712 DNA sequencing Methods 0.000 description 3
- 108700024394 Exon Proteins 0.000 description 3
- 108700019961 Neoplasm Genes Proteins 0.000 description 3
- 102000048850 Neoplasm Genes Human genes 0.000 description 3
- 102100022661 Pro-neuregulin-1, membrane-bound isoform Human genes 0.000 description 3
- 238000000429 assembly Methods 0.000 description 3
- 230000000712 assembly Effects 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 238000001514 detection method Methods 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- 230000007614 genetic variation Effects 0.000 description 3
- 108010044853 histidine-rich proteins Proteins 0.000 description 3
- 210000003917 human chromosome Anatomy 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 102000054765 polymorphisms of proteins Human genes 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000003908 quality control method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 206010069754 Acquired gene mutation Diseases 0.000 description 2
- 241001503987 Clematis vitalba Species 0.000 description 2
- 206010010356 Congenital anomaly Diseases 0.000 description 2
- 208000034951 Genetic Translocation Diseases 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 108091034117 Oligonucleotide Proteins 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 108091008109 Pseudogenes Proteins 0.000 description 2
- 102000057361 Pseudogenes Human genes 0.000 description 2
- 238000003559 RNA-seq method Methods 0.000 description 2
- 238000012300 Sequence Analysis Methods 0.000 description 2
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 2
- 230000004075 alteration Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 2
- 239000002299 complementary DNA Substances 0.000 description 2
- 238000002790 cross-validation Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000037433 frameshift Effects 0.000 description 2
- 210000004602 germ cell Anatomy 0.000 description 2
- 238000009396 hybridization Methods 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000013074 reference sample Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 210000003765 sex chromosome Anatomy 0.000 description 2
- 230000000392 somatic effect Effects 0.000 description 2
- 230000037439 somatic mutation Effects 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000013517 stratification Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000008685 targeting Effects 0.000 description 2
- 238000012549 training Methods 0.000 description 2
- 208000010507 Adenocarcinoma of Lung Diseases 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- 101100285680 Caenorhabditis elegans hrg-1 gene Proteins 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- 108020004705 Codon Proteins 0.000 description 1
- 241001605679 Colotis Species 0.000 description 1
- 102100027419 Cytochrome P450 4B1 Human genes 0.000 description 1
- 108010067770 Endopeptidase K Proteins 0.000 description 1
- 206010064571 Gene mutation Diseases 0.000 description 1
- 108700039691 Genetic Promoter Regions Proteins 0.000 description 1
- 101000603877 Homo sapiens Nuclear receptor subfamily 1 group I member 2 Proteins 0.000 description 1
- 101001098529 Homo sapiens Proteinase-activated receptor 1 Proteins 0.000 description 1
- 101001098560 Homo sapiens Proteinase-activated receptor 2 Proteins 0.000 description 1
- 101000713170 Homo sapiens Solute carrier family 52, riboflavin transporter, member 1 Proteins 0.000 description 1
- 101000713169 Homo sapiens Solute carrier family 52, riboflavin transporter, member 2 Proteins 0.000 description 1
- 101000610557 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp31 Proteins 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 108091092724 Noncoding DNA Proteins 0.000 description 1
- 108091093105 Nuclear DNA Proteins 0.000 description 1
- 108700026244 Open Reading Frames Proteins 0.000 description 1
- 238000012408 PCR amplification Methods 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 108091028664 Ribonucleotide Proteins 0.000 description 1
- 101001109965 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L7-A Proteins 0.000 description 1
- 101001109960 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L7-B Proteins 0.000 description 1
- 101100495925 Schizosaccharomyces pombe (strain 972 / ATCC 24843) chr3 gene Proteins 0.000 description 1
- 102100036863 Solute carrier family 52, riboflavin transporter, member 1 Human genes 0.000 description 1
- 102100036862 Solute carrier family 52, riboflavin transporter, member 2 Human genes 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- 102100040118 U4/U6 small nuclear ribonucleoprotein Prp31 Human genes 0.000 description 1
- 108020004417 Untranslated RNA Proteins 0.000 description 1
- 102000039634 Untranslated RNA Human genes 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 238000001574 biopsy Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 238000005251 capillar electrophoresis Methods 0.000 description 1
- 230000006037 cell lysis Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- YTRQFSDWAXHJCC-UHFFFAOYSA-N chloroform;phenol Chemical compound ClC(Cl)Cl.OC1=CC=CC=C1 YTRQFSDWAXHJCC-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000000205 computational method Methods 0.000 description 1
- 108010018719 cytochrome P-450 CYP4B1 Proteins 0.000 description 1
- 230000002380 cytological effect Effects 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 239000005547 deoxyribonucleotide Substances 0.000 description 1
- 125000002637 deoxyribonucleotide group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000013467 fragmentation Methods 0.000 description 1
- 238000006062 fragmentation reaction Methods 0.000 description 1
- 231100000221 frame shift mutation induction Toxicity 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 238000002825 functional assay Methods 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 230000004077 genetic alteration Effects 0.000 description 1
- 231100000118 genetic alteration Toxicity 0.000 description 1
- 230000008826 genomic mutation Effects 0.000 description 1
- 238000012165 high-throughput sequencing Methods 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 230000002998 immunogenetic effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000007901 in situ hybridization Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000003426 interchromosomal effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000004807 localization Effects 0.000 description 1
- 201000005249 lung adenocarcinoma Diseases 0.000 description 1
- 201000005243 lung squamous cell carcinoma Diseases 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 210000003470 mitochondria Anatomy 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000008447 perception Effects 0.000 description 1
- 238000002205 phenol-chloroform extraction Methods 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000001124 posttranscriptional effect Effects 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000513 principal component analysis Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 239000002336 ribonucleotide Substances 0.000 description 1
- 125000002652 ribonucleotide group Chemical group 0.000 description 1
- 108020004418 ribosomal RNA Proteins 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000036301 sexual development Effects 0.000 description 1
- 230000037432 silent mutation Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 210000001082 somatic cell Anatomy 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 229940126585 therapeutic drug Drugs 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 201000005112 urinary bladder cancer Diseases 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000012795 verification Methods 0.000 description 1
Images
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2019233587A JP2021101629A (ja) | 2019-12-24 | 2019-12-24 | ゲノム解析および遺伝子解析用のシステム並びに方法 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2019233587A JP2021101629A (ja) | 2019-12-24 | 2019-12-24 | ゲノム解析および遺伝子解析用のシステム並びに方法 |
Publications (2)
Publication Number | Publication Date |
---|---|
JP2021101629A JP2021101629A (ja) | 2021-07-15 |
JP2021101629A5 true JP2021101629A5 (ru) | 2022-08-23 |
Family
ID=76754409
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2019233587A Ceased JP2021101629A (ja) | 2019-12-24 | 2019-12-24 | ゲノム解析および遺伝子解析用のシステム並びに方法 |
Country Status (1)
Country | Link |
---|---|
JP (1) | JP2021101629A (ru) |
Families Citing this family (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN112662645B (zh) * | 2021-01-19 | 2022-04-22 | 华南理工大学 | 一种鞘磷脂酶d突变体及其应用 |
JP2023043981A (ja) | 2021-09-17 | 2023-03-30 | A・Tコミュニケーションズ株式会社 | 暗号化装置及び暗号化方法 |
CN113793641B (zh) * | 2021-09-29 | 2023-11-28 | 苏州赛美科基因科技有限公司 | 一种从fastq文件中快速判断样本性别的方法 |
Family Cites Families (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2013112528A1 (en) * | 2012-01-23 | 2013-08-01 | West Chester University Of Pennsylvania | Methods and compositions relating to proliferative disorders of the prostate |
US9449143B2 (en) * | 2012-08-28 | 2016-09-20 | Inova Health System | Ancestral-specific reference genomes and uses thereof |
KR20160118391A (ko) * | 2013-12-07 | 2016-10-11 | 시퀀싱닷컴 | 개인의 유전체 데이터를 이용하는 실-시간 개인화를 위한 시스템 및 방법 |
BR112017025577A2 (pt) * | 2015-05-29 | 2018-08-07 | Altergon Sa | métodos, suportes e kits para análise de cgh reforçada |
-
2019
- 2019-12-24 JP JP2019233587A patent/JP2021101629A/ja not_active Ceased
Similar Documents
Publication | Publication Date | Title |
---|---|---|
JP6854272B2 (ja) | 遺伝子の変異の非侵襲的な評価のための方法および処理 | |
US10975445B2 (en) | Integrated machine-learning framework to estimate homologous recombination deficiency | |
US11164655B2 (en) | Systems and methods for predicting homologous recombination deficiency status of a specimen | |
US20200270707A1 (en) | Methylation pattern analysis of haplotypes in tissues in a dna mixture | |
US11475981B2 (en) | Methods and systems for dynamic variant thresholding in a liquid biopsy assay | |
US11211144B2 (en) | Methods and systems for refining copy number variation in a liquid biopsy assay | |
WO2021022225A1 (en) | Methods and systems for detecting microsatellite instability of a cancer in a liquid biopsy assay | |
AU2016293025A1 (en) | System and methodology for the analysis of genomic data obtained from a subject | |
CA3167253A1 (en) | Methods and systems for a liquid biopsy assay | |
JP2021101629A5 (ru) | ||
US11211147B2 (en) | Estimation of circulating tumor fraction using off-target reads of targeted-panel sequencing | |
JP2021101629A (ja) | ゲノム解析および遺伝子解析用のシステム並びに方法 | |
Hsu et al. | A general calculus of fitness landscapes finds genes under selection in cancers | |
EP3588506B1 (en) | Systems and methods for genomic and genetic analysis | |
US20210202037A1 (en) | Systems and methods for genomic and genetic analysis | |
CN113053460A (zh) | 用于基因组和基因分析的系统和方法 | |
Gu et al. | MD-ALL: an integrative platform for molecular diagnosis of B-cell acute lymphoblastic leukemia | |
WO2019156591A1 (en) | Methods and systems for prediction of frailty background | |
Hassouneh | Is Next-Generation Sequencing Appropriate for the Clinic? |