JP2021075254A - Reduction in living cost and the like - Google Patents
Reduction in living cost and the like Download PDFInfo
- Publication number
- JP2021075254A JP2021075254A JP2019217470A JP2019217470A JP2021075254A JP 2021075254 A JP2021075254 A JP 2021075254A JP 2019217470 A JP2019217470 A JP 2019217470A JP 2019217470 A JP2019217470 A JP 2019217470A JP 2021075254 A JP2021075254 A JP 2021075254A
- Authority
- JP
- Japan
- Prior art keywords
- water
- space
- air
- energy
- underground
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 242
- 230000005611 electricity Effects 0.000 claims abstract 16
- 230000001133 acceleration Effects 0.000 claims abstract 3
- 239000000446 fuel Substances 0.000 claims description 16
- 238000010248 power generation Methods 0.000 claims description 10
- 239000003673 groundwater Substances 0.000 claims description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims 46
- 239000007789 gas Substances 0.000 claims 43
- 241000196324 Embryophyta Species 0.000 claims 32
- 239000002023 wood Substances 0.000 claims 27
- 238000001816 cooling Methods 0.000 claims 26
- 239000000463 material Substances 0.000 claims 20
- 235000011089 carbon dioxide Nutrition 0.000 claims 18
- 239000007788 liquid Substances 0.000 claims 16
- 241000251468 Actinopterygii Species 0.000 claims 14
- 241000282412 Homo Species 0.000 claims 14
- 229910002092 carbon dioxide Inorganic materials 0.000 claims 14
- 239000001569 carbon dioxide Substances 0.000 claims 14
- 238000000034 method Methods 0.000 claims 14
- 230000005484 gravity Effects 0.000 claims 13
- 230000033001 locomotion Effects 0.000 claims 13
- 239000000126 substance Substances 0.000 claims 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims 8
- 239000003337 fertilizer Substances 0.000 claims 8
- 238000009434 installation Methods 0.000 claims 8
- 239000013535 sea water Substances 0.000 claims 8
- 235000000760 Wasabia japonica Nutrition 0.000 claims 7
- 244000195452 Wasabia japonica Species 0.000 claims 7
- 230000007246 mechanism Effects 0.000 claims 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims 6
- 230000008859 change Effects 0.000 claims 6
- 238000007710 freezing Methods 0.000 claims 6
- 230000008014 freezing Effects 0.000 claims 6
- 238000005096 rolling process Methods 0.000 claims 6
- 239000002689 soil Substances 0.000 claims 6
- 238000003860 storage Methods 0.000 claims 6
- 241000218645 Cedrus Species 0.000 claims 5
- 150000003839 salts Chemical class 0.000 claims 5
- 238000004378 air conditioning Methods 0.000 claims 4
- 229910021529 ammonia Inorganic materials 0.000 claims 4
- 238000002485 combustion reaction Methods 0.000 claims 4
- 230000000694 effects Effects 0.000 claims 4
- 238000005516 engineering process Methods 0.000 claims 4
- 238000007667 floating Methods 0.000 claims 4
- 239000000203 mixture Substances 0.000 claims 4
- 239000004033 plastic Substances 0.000 claims 4
- 229920003023 plastic Polymers 0.000 claims 4
- 230000000630 rising effect Effects 0.000 claims 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 3
- 239000012141 concentrate Substances 0.000 claims 3
- 238000013461 design Methods 0.000 claims 3
- 235000013305 food Nutrition 0.000 claims 3
- 235000011389 fruit/vegetable juice Nutrition 0.000 claims 3
- 229910052742 iron Inorganic materials 0.000 claims 3
- 229910052751 metal Inorganic materials 0.000 claims 3
- 239000002184 metal Substances 0.000 claims 3
- 239000003921 oil Substances 0.000 claims 3
- 239000001301 oxygen Substances 0.000 claims 3
- 229910052760 oxygen Inorganic materials 0.000 claims 3
- 230000035939 shock Effects 0.000 claims 3
- 239000012780 transparent material Substances 0.000 claims 3
- 238000009423 ventilation Methods 0.000 claims 3
- 240000007594 Oryza sativa Species 0.000 claims 2
- 235000007164 Oryza sativa Nutrition 0.000 claims 2
- 239000006096 absorbing agent Substances 0.000 claims 2
- 230000004888 barrier function Effects 0.000 claims 2
- 239000003610 charcoal Substances 0.000 claims 2
- 238000006243 chemical reaction Methods 0.000 claims 2
- 238000010276 construction Methods 0.000 claims 2
- 238000005520 cutting process Methods 0.000 claims 2
- 238000007599 discharging Methods 0.000 claims 2
- 239000000428 dust Substances 0.000 claims 2
- 210000002969 egg yolk Anatomy 0.000 claims 2
- 239000010419 fine particle Substances 0.000 claims 2
- 239000011521 glass Substances 0.000 claims 2
- 210000003128 head Anatomy 0.000 claims 2
- 238000005339 levitation Methods 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 239000003595 mist Substances 0.000 claims 2
- 238000005192 partition Methods 0.000 claims 2
- 238000005381 potential energy Methods 0.000 claims 2
- 238000012545 processing Methods 0.000 claims 2
- 238000005086 pumping Methods 0.000 claims 2
- 235000009566 rice Nutrition 0.000 claims 2
- 239000004575 stone Substances 0.000 claims 2
- 238000012546 transfer Methods 0.000 claims 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims 1
- 235000015842 Hesperis Nutrition 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 235000012633 Iberis amara Nutrition 0.000 claims 1
- 235000010575 Pueraria lobata Nutrition 0.000 claims 1
- 244000046146 Pueraria lobata Species 0.000 claims 1
- 229920002472 Starch Polymers 0.000 claims 1
- 229910000831 Steel Inorganic materials 0.000 claims 1
- 229920006328 Styrofoam Polymers 0.000 claims 1
- 241000607479 Yersinia pestis Species 0.000 claims 1
- 230000009471 action Effects 0.000 claims 1
- 239000000853 adhesive Substances 0.000 claims 1
- 230000001070 adhesive effect Effects 0.000 claims 1
- -1 and if necessary Substances 0.000 claims 1
- 238000013459 approach Methods 0.000 claims 1
- 239000010426 asphalt Substances 0.000 claims 1
- 230000008952 bacterial invasion Effects 0.000 claims 1
- 230000008901 benefit Effects 0.000 claims 1
- 235000013361 beverage Nutrition 0.000 claims 1
- 230000005540 biological transmission Effects 0.000 claims 1
- 238000007664 blowing Methods 0.000 claims 1
- 238000009835 boiling Methods 0.000 claims 1
- 238000009395 breeding Methods 0.000 claims 1
- 230000001488 breeding effect Effects 0.000 claims 1
- 229910002091 carbon monoxide Inorganic materials 0.000 claims 1
- 239000004927 clay Substances 0.000 claims 1
- 238000004140 cleaning Methods 0.000 claims 1
- 230000009194 climbing Effects 0.000 claims 1
- 238000004891 communication Methods 0.000 claims 1
- 230000006835 compression Effects 0.000 claims 1
- 238000007906 compression Methods 0.000 claims 1
- 239000004035 construction material Substances 0.000 claims 1
- 238000010411 cooking Methods 0.000 claims 1
- 230000007797 corrosion Effects 0.000 claims 1
- 238000005260 corrosion Methods 0.000 claims 1
- 230000006837 decompression Effects 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 claims 1
- 239000002781 deodorant agent Substances 0.000 claims 1
- 230000006866 deterioration Effects 0.000 claims 1
- 230000002542 deteriorative effect Effects 0.000 claims 1
- 238000011161 development Methods 0.000 claims 1
- 238000009792 diffusion process Methods 0.000 claims 1
- 230000035622 drinking Effects 0.000 claims 1
- 238000001035 drying Methods 0.000 claims 1
- 235000013601 eggs Nutrition 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- 230000008020 evaporation Effects 0.000 claims 1
- 239000003292 glue Substances 0.000 claims 1
- 238000003306 harvesting Methods 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000003501 hydroponics Substances 0.000 claims 1
- 238000007689 inspection Methods 0.000 claims 1
- 239000011810 insulating material Substances 0.000 claims 1
- 238000009413 insulation Methods 0.000 claims 1
- 239000010985 leather Substances 0.000 claims 1
- 238000012423 maintenance Methods 0.000 claims 1
- 230000013011 mating Effects 0.000 claims 1
- 230000001404 mediated effect Effects 0.000 claims 1
- 239000008239 natural water Substances 0.000 claims 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 claims 1
- 239000013307 optical fiber Substances 0.000 claims 1
- 230000002093 peripheral effect Effects 0.000 claims 1
- 239000000575 pesticide Substances 0.000 claims 1
- 239000003755 preservative agent Substances 0.000 claims 1
- 230000002335 preservative effect Effects 0.000 claims 1
- 230000008569 process Effects 0.000 claims 1
- 238000000746 purification Methods 0.000 claims 1
- 239000002994 raw material Substances 0.000 claims 1
- 239000002990 reinforced plastic Substances 0.000 claims 1
- 230000002040 relaxant effect Effects 0.000 claims 1
- 238000012958 reprocessing Methods 0.000 claims 1
- 230000002441 reversible effect Effects 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 238000005507 spraying Methods 0.000 claims 1
- 230000007480 spreading Effects 0.000 claims 1
- 238000003892 spreading Methods 0.000 claims 1
- 235000019698 starch Nutrition 0.000 claims 1
- 239000008107 starch Substances 0.000 claims 1
- 239000010959 steel Substances 0.000 claims 1
- 239000008261 styrofoam Substances 0.000 claims 1
- 238000001356 surgical procedure Methods 0.000 claims 1
- 230000009182 swimming Effects 0.000 claims 1
- 239000008399 tap water Substances 0.000 claims 1
- 235000020679 tap water Nutrition 0.000 claims 1
- 238000012549 training Methods 0.000 claims 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims 1
- 229920002554 vinyl polymer Polymers 0.000 claims 1
- 238000005406 washing Methods 0.000 claims 1
- 235000020990 white meat Nutrition 0.000 claims 1
- 230000037303 wrinkles Effects 0.000 claims 1
- 238000009360 aquaculture Methods 0.000 description 1
- 244000144974 aquaculture Species 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Images
Abstract
Description
地球環境Global environment
陸上養殖Land aquaculture
エネルギー等のコスト等を改善すること等Improving costs such as energy, etc.
エネルギー等のコスト等を改善すること等。Improving costs such as energy.
そりなどを使うなどする。水などを適切に配置する構造を作るなどする。Use a sled, etc. Create a structure to properly arrange water.
過疎地域でも自立した産業ができる。 Independent industry can be established even in depopulated areas.
Claims (1)
車などの移動物のタイヤの設置面やその周囲や車両の設置面付近や側面等に磁石(電磁石、超電導磁石等でもよい)を取り付け地面等や側面レーン等にコイルを取り付けておいてそこを通った時などに発電することもできる。車等にコイル地面に磁石、電磁石、超電導磁石等の組み合わせもできる。コイルにつないだバッテリー等に充電したり送電したり直接その場で使用したりできる。Replace the wheels of a train or the like with a sled or the like with an object that carries an object such as an object. Then, instead of a railroad track, provide a width that allows a sled to pass through, place water, etc. in that part, cool it by using electricity, etc., and freeze it to reduce friction and reduce energy loss as much as possible. .. It is used when accelerating or decelerating by bringing wheels etc. into contact with the parts between the rails. In order to reduce the resistance of the wheels and the like when the speed is increased, it is possible to adopt a structure in which the wheels and the like can be pulled into the vehicle body by using electricity or the like so as not to come into contact with the outside or the like. The sled part has a rail structure, etc., which has a protruding shape so that it slides on a frozen road surface but does not derail sideways. Tires or the like that come into contact with the side surface of the rail may be attached to a sled or the like in order to reduce impact or the like on a curve or the like, or a bank angle or the like may be attached to the rail body. It is also possible to attach another wheel etc. to the car body etc. in the place of the Mini 4WD like a course and respond with it when it is a curve. Considering air resistance etc., it is usually stored inside the vehicle and installed on the side wall of the vehicle by attaching tires etc. to the pillars etc. of the structure that can be instantly deployed by gas pressure or spring force when necessary such as in an emergency It is also possible to make it easier to turn corners etc. by contacting it with a wall etc. (a structure that continues for a long time like a mini 4WD course, or a method of installing it only at a curve etc.). A wing that looks parallel to the side wall, etc. is provided at a certain position from the side surface of the vehicle (a structure that keeps it out all the time, and it goes out mechanically only when necessary in consideration of air resistance, etc. When it is not necessary, the structure can be such that it is stored in the floor, sides, etc. of the vehicle.) If you drive in a fashion that keeps a slight distance between it and the side walls, etc., there will be a ground effect due to air resistance. Is generated and the repulsive force acts on the left and right walls to counter the force that the vehicle receives outward, and the vehicle can turn the curve stably. Design the route so that it descends little by little, and use gravitational energy to make it an acceleration force. It is possible to design the line without height difference, but even if the construction cost is calculated and it becomes an up line, friction is reduced by the sled, so it is used as an energy source to move the object to the high altitude using the energy of inertia. be able to. Even if the vehicle is slightly downhill, the resistance of the contact part of the vehicle body etc. is extremely low, so the vehicle etc. can accelerate steadily just by giving a small amount of energy from the tires etc. that are in contact with it. The same can be said even when the linear motor car is not in contact with the ground. In addition, the generation of air resistance is prevented by creating a vacuum state as much as possible in the tunnel such as the tube surrounding the vehicle. When you arrive at the stop, you can open the hatch attached to the vehicle, etc. to provide a connecting passage to the outside, or install a door that opens and closes up and down, such as a partition hatch, etc. in the tunnel, so that air can be partially introduced in the section such as the stop. Therefore, a method that allows the occupants to come and go can be considered. A hollow hole party is provided at the end of the lane so that if rainwater etc. enters the structure on the lane that is cooled and the ice etc. at the contact part is kept at a temperature with low resistance etc. The structure on the passage allows rainwater to flow out. Using the temperature of a tank installed about 5 meters underground to maintain the temperature of the lane in a cooled and frozen state, circulate it around the lane using a pipe made of PET bottles etc. It is also possible to reduce the energy used to control the temperature of the. The liquefied carbon dioxide or the like can be flowed by a pipe or the like in the vicinity thereof in order to freeze the water or the like in the cooling lane, or can be cooled. A roof should be attached to the upper part to prevent rainwater, etc., and to shield everything around it. A place where a PET bottle originally contained juice in a structure that is covered with a transparent and light-transmitting substance, strong plastic, or connected with a PET bottle (may be a special one) when shielding. From an underground tank installed in a place where water, etc. is kept at about 15 degrees (depending on latitude, etc.) throughout the year, about 5 meters underground, pumps, etc. (if it is underground in a mountainous area, it naturally falls under the pressure of gravity. If the space through which the car or the like passes is close to 15 ° C. and the flow rate of the liquid is adjusted, the cost of the air conditioner of the car or the like can be saved. When depressurizing the space in which a car or the like travels to reduce air resistance and bring it closer to a vacuum state, install pressure-resistant reinforced plastic, glass, etc. on the outer periphery of the space through which the car or the like passes to reinforce it. You can also. Even when water or the like is circulated by a pump, liquids such as water do not suddenly boil even when exposed to sunlight or the like from the outside, so that the pump does not have to be operated frequently, so the energy cost is low. When energy is obtained from solar panels, etc., install solar panels, etc. on the roof of this equipment or in vacant spaces such as the sides and lanes. In order to cool the solar panel etc., water etc. kept at a constant temperature in the above-mentioned circulating underground tank flows over the panel, or a pipe-shaped structure made of a material that allows light to pass through is nearby. The temperature of the solar panel can be controlled by flowing water of about 15 ° C from an underground tank, etc., or the solar panel can be made waterproof to improve airtightness, and shallow water can be collected in the panel. It is attached to a tub, etc., and water, etc. at about 15 ° C, which is installed about 5 meters underground, is poured there and collected in an underground tank, etc. If the positional relationship is such that natural groundwater flows naturally, it may be flushed and the temperature of the panel is controlled. Using a PET bottle or the like, for example, a structure is constructed in which the drinking spout is cut out and a plurality of rectangular cubes are adhered to each other to fill the underground tank with water or the like. Using a substance such as a PET bottle that allows light to pass through but does not allow water to pass through, a structure containing water or the like is created with a hollow inside. Then, a solar panel or the like whose temperature is to be controlled can be put in the hollow part or the like. This will increase the amount of power generation by installing similar devices in solar panels and the like installed in homes. If the temperature of the solar panel becomes too high, the amount of power generated will decrease. Further, in order to efficiently air-condition the space, water or the like of about 15 degrees in the underground tank is used. Since the ground temperature around the underground tank differs depending on the depth, it is possible to install multiple tanks at different depths and mix the water and the like. If necessary, the structure made of PET bottles can be moved by draining water, etc. Since the material is light, it can be done manually, but the ceiling part should be constructed in advance so that it can be opened and closed by motor drive etc. You can also. In the underground tank, a pipe of about 5 cm in length and width (the standard scale can be changed freely) is installed in the underground tank, and a passage is installed around it to allow water to flow. The above-mentioned underground tank water or the like is provided there, and a fan or the like is attached to the end of the pipe to send the wind. When air or the like moves in the pipe by the force of a fan or the like, it exchanges heat with the surrounding water or the like (for example, if it is a thin material such as a PET bottle, heat is easily conducted) and is gradually cooled in the summer. If the length of the pipe is increased to some extent, the temperature from the outlet of the pipe becomes close to the temperature of water or the like from the underground tank. It is cold in the summer and warm when the air is below about 15 ° C. For example, a structure can be made by connecting PET bottles and the like. Fans such as electric fans consume less power, which saves energy. The tube does not have to be straight and may be curved for distance. It is also possible to make it easier to exchange heat when a cold or the like hits by passing water or the like through a thinner pipe through the pipe. To increase the area of contact with the temperature of water, etc. around 15 ° C and the flowing air by passing it between the passage and the pipe where water, etc., which circulates a rod of metal, etc. with high thermal conductivity is flowing. You can also. A fan or the like can be attached not only to the entrance of the pipe but also to the other outlet or in the middle to improve heat exchange efficiency. This device can be installed indoors, but it can also be installed at a constant ground temperature of about 5 meters underground. Air is taken in and out with a pipe. If air is sent into the pipe through a pipe so that the ground temperature around 5 meters underground is about 15 ° C, the temperature will be the same when the air sucked above the ground goes around the underground and exits from the pipe outlet in the summer. It is the same regardless of the season even in winter when the ground temperature is close to 15 ° C. Water etc. is flowing on all sides of the pipe or a specific part, but in the case of a two-tiered structure The lower part is maintained by gravity even if the ceiling part is not blocked, so it is not necessary to attach the ceiling part Because of this, water etc. comes into direct contact with air etc. and heat exchange efficiency increases. When the ground temperature of most of the installation locations around the pipe is about 15 ° C, the temperature of the original air etc. approaches 15 ° C. Compressed air is used when hot water such as hot springs or hot water artificially boiled in a boiler is used for air conditioning of each home or facility. First, hot water is poured into a space made of PET bottles, etc., and in the above method, heat is exchanged using the temperature of about 15 degrees underground to bring the temperature of air etc. closer to 15 degrees. If you put hot water etc. instead of the degree, it will reach that temperature and keep it warm when you send it, so put it in a connected kudzu such as a PET bottle and compress it into the space surrounded by it ( Or, change it depending on the situation such as the degree of ventilation). The above space for blowing warm air etc. is installed underground or above ground, but considering the cost of digging underground such as when the ground is very cold, use water from a tank of about 5 meters underground at about 15 degrees Celsius. You may use the heat insulation system. Since the underground tank or the like has a depth that varies depending on the time according to the depth, it is possible to prepare a plurality of tanks and mix water or the like. If necessary, the outer circumference of the device that sends air, etc. made from this PET bottle or the like is covered with a heat insulating material (such as styrofoam that has a heat insulating effect) to improve efficiency. It is also possible to send cold air or the like. A space such as a certain rectangle is created by connecting PET bottles and the like, and a structure and the like are formed by connecting PET bottles and the like in the space. Then, as described above, a liquid or the like is allowed to flow in, and in the above case, a substance to be dried or a substance to be moistened is put in a place where air is being sent. At this time, the air or the like can be tightly packed so as not to be delayed, or there is a certain gap so that warm air or the like can flow there. For example, when seawater is evaporated to take out salt, etc., a space for seawater, a space for warm air to flow over it, and a plate-shaped passage made using PET bottles, etc. (may be slightly inclined). Create a space on which water can flow. The outer circumference can be surrounded by a PET bottle or the like, and the entire inside can be pressurized with a compressor or the like. By using the power of sunlight or flowing hot water, the evaporation of seawater is accelerated and warm air is sent to accelerate it. When the humidity becomes high, the inside pressurized by the compressor is returned to the normal atmospheric pressure and cold water from the underground tank etc. is poured into the pipe. Due to the decrease in humidity and the cooling of the nearby temperature, water droplets from the air flow through the installed plate and move to the lowest position. By adopting such a structure, the speed at which seawater etc. evaporates can be increased. If necessary, cover the outer circumference constructed of PET bottles with a transparent film or plastic so that it can withstand pressure. When the air inside this device is taken out, a filter or the like for salt damage countermeasures can be installed at a fan or the like for taking in or discharging outside air. The cause of salt damage is that the fine particles generated when the waves break are blown up by the wind and carried, so this device does not generate fine particles in the first place, so it is only installed just in case. Where there is ventilation, make sure that it can withstand the pressure inside with a hatch. By making this device out of transparent materials such as PET bottles, the power of sunlight can be transmitted efficiently. By laying a black material (black sheet, etc.) on the bottom of the device, energy such as sunlight can be used more efficiently. It is also possible to install this device in a space such as a solar panel that requires sunlight or the like to obtain salt or the like while preventing the temperature of the solar panel from rising. For the lower part, adjust the angle of the device by making a pedestal etc. with a transparent material such as a PET bottle according to the installation angle of the solar panel. Water or the like can also be used to clean dust or the like attached to the upper part of such a structure. And if you install a filter or the like that collects dust when you come to a specific point with water etc., you can reduce the trouble of cleaning. It is possible to circulate or temporarily hold water, etc. that uses the ground temperature, such as about 5 meters underground, through a thin pipe near an object, etc., whose efficiency increases when the temperature is close to a certain level, such as a solar panel. In addition, after placing it in such a state, connect a PET bottle etc. to the outer peripheral part etc. in order to control the temperature etc. by eliminating the influence of the outside air etc. It is installed in a structure that can control the temperature inside the structure by pouring water etc. that uses the ground temperature such as 5 meters underground into the structure made of the material that was made. It is also possible to prevent the solar panel and the like from becoming excessively hot. Water can circulate or stand still in a structure made by connecting PET bottles, etc., and the flow rate of water, etc. can be changed by adjusting the pump. Water, etc. that has passed through PET bottles, etc. is also underground. Returning to the tank, the temperature is controlled by the ground temperature. Multiple underground tanks may be installed depending on the depth. Circulating water or the like to control the temperature of the solar panel or the like can be passed through a finer pipe, or such a pipe may be installed in a device such as a solar panel in advance. Water from an underground tank or the like is poured into a pipe or the like made of a material that allows thin light to pass through, and is placed around a solar panel or the like to be used for temperature control. Take waterproof measures for pipes, solar panels, etc. to prevent water from entering the electrical machinery. It is possible to make water etc. flow through it with a thinner material made exclusively from the beginning instead of a PET bottle. For example, the temperature of a solar panel or the like is controlled by applying the outer circumference of the solar panel or the like with a wall of thin water or the like having a heat of about 2 cm. When water in the underground tank is raised to a certain height using a pump or the like, it flows around the solar panel through a pipe by the force of gravity and returns to the underground tank. It is also possible to lower the temperature by spraying water such as mist (not necessarily mist) on the upper part of the solar panel etc. At this time as well, the water is collected and circulated using the water in the underground tank. You can also do it. Space created by connecting PET bottles, etc. (not necessarily PET bottles but dedicated ones) For example, PET bottles, etc. are lined up in an area of 20 meters in length and 10-meters in width, and are lined up side by side on the ceiling. In the same way, put soil etc. in the space between them to make the part a rice-producing area. By doing this, the fertilizer, etc. that has been sown can be reused without missing it into the ground. If you sprinkle water on the soil, the fertilizer will come to the bottom of the PET bottle, so make some holes in that part and put it inside the PET bottle from there. It becomes succulent and is pumped out from the end of the connected PET bottles, etc., stored in an underground tank, reused or processed to make fertilizer, etc. from there. Make multiple PET bottles below, or fill them with water at first to increase their strength, and then remove the water contained in the PET bottles, etc. in the lower part to receive fertilizer, etc. to some extent after adding soil. You can also say that. Considering the influence of the ecosystem, etc., the bottom part of the structure made of PET bottles, etc. (Assuming that the floor surface, etc. made of the lower PET bottles, etc. is a three-tiered PET bottles, the bottom PET bottles Water, oxygen, etc. can be circulated in (such as), and by making holes in the lower part of the structure such as PET bottles that pass through it, it soaks into the soil. A structure such as another PET bottle is constructed so that it is divided into multiple layers such as a function to flow fertilizer into the space constructed with PET bottles and collect it, and a layer to soak water, oxygen, etc. underground. You can also do it. If the upper part is covered with a similar structure to create a sealed state, fertilizers, pesticides, etc. will not be scattered to the outside. Costs can be reduced by reusing fertilizers. When taking in outside air, you can open it with a door on the top, or you can use a fan to let in the wind, or you can make a door for people to enter. With such a shield, it is possible to prevent the diffusion of fertilizer used for agriculture and the like to the outside of the shield. For example, when a stream or the like around a house is made of concrete, it is conceivable that almost no water flows or no water flows in the dry season. If the above-mentioned structure made by using a PET bottle or the like is buried underground in such a place so that water or the like can flow between them, the ground or the like can be effectively used. In the case of river water management etc. in the case of a country or municipality, there are many cases where gutters are made with concrete, but if you do that, if water etc. hardly flows, ground space etc. will be wasted. Also, if the boundary of the land is a river, the river is originally thin and only a large amount of water passes temporarily for a short time, but the land is fixedly occupied throughout the year and unfairly occupied by the landowner. There is a possibility that it may lead to such a state. Moreover, in the design of gutters and the like, it is irrational that the width is extremely large or the gutters are made shallow even though water or the like does not flow in almost normal times. When making a gutter with a width of 1.5 meters and a depth of 50 cm, etc. If the width is 50 cm and the depth is 1.5 meters, the above-ground part can be used effectively as much as 1 meter, and the land next to the river is registered. It can be said that the land that can be used by the landowner is close to the size of the landowner. Although the registered river does not exist as a ground, it is often the case that it is not necessary to pass anything at present because it is an existence for which an administrator has been set. If a gutter, etc. with a width of 1.5 meters is created for a river, etc., which is normally only about 10 cm wide, the landowner notices the problem and grants the original right to use the land. This underground water conveyance mechanism can also be used to hide. In the above space constructed using PET bottles, etc., a tunnel-shaped space is provided so that humans can barely pass through it, and rails and tires are used to pull in trolley-shaped objects. In hydroponics, the solution can be poured inside the space, and in the case of plant cultivation, a vat or the like that can hold water of the size prepared according to the growth of the roots is placed on the trolley and the space It can also be moved inside. Plants can be moved by placing them on pallets using rails, etc., so they can be moved to any location by laying rails in a sunny place or rolling them with tires. When the plant is hydroponically cultivated, the part above the root of the plant can be moved by the upper trolley or the like, so that the pulling force is small. Similarly, a PET bottle or the like can be used to create a space for a car or the like, and the temperature of the internal space can be controlled by using circulating water or the like. The vehicle can be parked and a break can be taken inside. On top of that, it is also possible to cultivate crops by placing a structure made using PET bottles for growing crops. It is also possible to make a structure made of such a PET bottle or the like, provide a shield with the outside, and put a bed or the like on which a human can sleep. In the case of elderly people, it is possible to attach a device that gives a shower on the spot, or to make a toilet etc. in the shielded space. It is also possible to periodically put water or the like in the shielded interior to wash it cleanly, or to remove harmful substances contained in the air through an air filter on a daily basis. If it is installed in a hospital, the airspace in the hospital can be cleaned from ammonia. It is especially effective when a large number of people who cannot move due to their physical condition cannot take a shower or the like by walking on their own, and the medical provider can come into contact with the inpatient through the shielded space. If you add shower equipment to the space shielded by PET bottles, you can shower there, which also cleans the space and saves you the trouble of moving to the bathroom. It is also possible to collect futons and the like during the shower and replace them with new ones. In short, avoiding the situation where the ammonia concentration is likely to rise, shield that part with a PET bottle etc. like the inside of a spaceship. You can attach fitness equipment to this device, or you can attach my patent-pending body-washing device. Wheels can also be attached to this device to allow it to move. It is also possible to connect the space between the surgery space and the sleeping space with a space made of PET bottles or the like in a shielded form with the outside. Ammonia is a substance that causes such a small amount of odor, so its impact on ecology should be considered to be enormous, and it is socially important to consider it. It can also be used as a filter by using coffee grounds or the like to remove ammonia or the like inside the space. When breeding fish, etc., the space shall have a loop-like structure so that the fish, etc. will not collide with the wall, etc. of the space in which water, etc. is filled by accelerating in a direction close to the vertical direction. Make a space, etc. using a PET bottle, etc., and fill it with water, etc. The upper part may also be made of a material such as a PET bottle. Then, a pump is used to suck out the water or the like in it and apply pressure to eject it, or to send compressed air or the like in one direction to give the water or the like rotation in a certain direction. The width of the loop-shaped structure where the fish are swimming should be about 50 cm to 100 cm (as a guide only). The water flow can also be stopped. An object with buoyancy with bait (which can float or move the bottom part by buoyancy) is rotated like the hands of a clock, and its movement is controlled by the behavior of a fish or the like chasing it. The flow of water can be turned clockwise or counterclockwise, and the direction of movement of food can be changed freely. If the flow of water and the flow of bait are the same and the speed of movement of the bait is made a little faster, fish etc. can eat the bait etc. with a little movement, and the speed of the water flow is slowed down to eliminate the movement of the bait a little. If you move it in the opposite direction of the water flow or put the food in and out of the water, the fish etc. will concentrate on it and stay in almost the same place for a long time. The above method is especially applicable to fish that cannot breathe unless they move. It is also possible to put a net or the like in a place where there is water or the like and control the movement of the fish or the like in combination with the water flow and the bait. If you use power to move the bait attached to any place in the space where fish etc. are (the bait is pulled by power along the rails arbitrarily attached to the upper or lower part of the aquarium etc. or powered by a belt etc. You can also make a circular motion (such as sticking food etc. to it by giving it), or you can make it go straight depending on the shape of the water tank etc. It is also possible to move fish, etc. from a circularly looped aquarium to another aquarium space by using a wall or the like that automatically moves in the space where fish or the like is bred. Then, in order to return the fish etc. from that space to the circular loop-shaped water tank etc., install the above door etc. and put the flow of water from the circular loop into the isolated space without water flow and use that pressure to another outlet. How to return to the water tank of the circular loop from the above, or raise the wall around the water tank without water flow higher than that of the circular loop, incorporate water etc. into it with a pump etc. so that fish etc. can rise to a slightly higher place and feed It was in a specific place by guiding fish by automatically moving etc. and flowing water etc. by the force of gravity using a water channel etc. designed to flow the door of the water tank etc. toward the circular loop Fish etc. move toward the circular loop on the water stream. Normally, when air is compressed industrially, an electric compressor etc. is used, but it is used as the power of the compressor by using the energy of gears that move by hydraulic power for the power of the compressor or by transmitting the rotational energy of the wind turbine with gears. To do. Then, a tank that stores compressed air is installed in a place with a constant ground temperature of about 5 meters underground, or it is blown into the water in a tank installed 5 meters underground to raise the temperature to 15 ° C. I'll give it a try. By using natural energy such as hydraulic power as the power of an air compression compressor and storing it in a cylinder installed underground, it is possible to take it out at any time like a battery and use it to move gears. When compressing air etc. with a compressor etc., once cooled in an underground tank etc. is compressed to adjust the humidity, or air etc. is stored underground to lower the humidity. It is also possible to lower the temperature of a tank containing compressed air, etc. underground. Even if it is a large tank, if it is underground, there is no problem with the installation location. It is highly efficient if the compressed air is adjusted in temperature, humidity, etc. by using the above mechanism, and the air or the like is flown from the facility to a general household or the like through an underground pipe or the like. Instead of storing electricity, it is stored as compressed air or the like (it may be in the form of gas or in a state like dry ice). It is also possible to install a water wheel-shaped object beside a river or the like. If the sea wave is a ria coast, the tsunami will rush to a high place, so such a structure is artificially created and the seawater is brought to a place 10 meters or more higher than the coastline by the power of the sea wave. Then, by accumulating it, this time, it is used as a power source for turning a hydroelectric turbine that uses gravity to generate electricity or for turning a compressor such as air. It is useful for human life by obtaining a large amount of potential energy of seawater semi-permanently by using the energy of sea waves. A method of storing compressed air in a cylinder or the like by such a method and moving the cylinder to a place such as 20 meters underground or deferring the cylinder with a diameter of 20 meters is also conceivable. Then, prepare a water tank or the like installed underground or the like and filled with water or the like. If a rotating wheel or the like is installed there and compressed air is emitted from below, the wheel will rotate due to the energy at the time of ascent. The deeper this water tank is, the more wheels and the like can be installed, and the buoyancy provides energy for the water turbine and wheels to rotate. It is very efficient because it can use the rotational energy of the turbine and wheels to move the compressor to create compressed air and move the generator. Set compressed air (gas), dry ice, and Daisei gas (Omasa gas, HHO, GAS, etc.) at a deep point where the water pressure of a vertically long tank filled with liquid water, etc. is applied. Then, heat from the chemical reaction of electricity or chemical substances is applied to ignite Daisei gas (a mixture of hydrogen and oxygen may be used separately), and the heat causes dry ice to be expected and expands, and compressed air also Similarly, an upward kinetic energy is generated with respect to water pressure (gravity), and this is applied to a water wheel or the like to rotate the water wheel or the like. It recovers that energy and runs a generator. In order to improve the efficiency when the water turbine rotates, the wings of the water turbine will be movable and can be opened and closed. Then, when it is pushed by gas, it opens and receives the kinetic energy, and it is possible to prevent the wing of the water wheel from hitting the liquid and becoming resistance and slowing down the rotation speed as much as possible. A structure is also conceivable in which the wing part opens and closes but does not close completely and opens slightly, or an object that has buoyancy even when completely closed is attached to a part of the wing and opens slightly due to buoyancy in a specific direction. The water flow and the air flow may be controlled by allowing air or the like to enter and spread the air, or by attaching a plate or the like to a specific part of the tank so that the air on the blades of the water wheel of the tank can easily collect. The shape of this wing is such that when a water wheel of this shape is installed in a tunnel or the like where there is no energy for gas to rise such as air and water pressure is applied, the wing opens where it is pushed by the water flow and closes when the pressure such as the water flow weakens. Will be. Some hydroelectric power plants such as large-scale dams have a head of 100 meters or pipes of hundreds of meters, but if the propeller for hydroelectric power generation is attached to the downstream part, the energy of the water flow can be sufficiently recovered and the turbine of the generator can be used. Because it is not possible to turn and a loss occurs, the head is about 10 meters and it is dispersed in thinner pipe-shaped tunnels and tubes, and even in the section where there was only a water flow until now, a water wheel or a propeller for hydroelectric power generation Etc. are installed. By doing so, the potential energy of the water stream can be efficiently recovered. Also, when compressed air is ejected from a deep place with high water pressure, when the water turbine is rotated by the force of the air climbing up, the water turbine is rotated clockwise by devising and designing this water tank and tank. When compressed gas or the like is ejected to a portion near 1 o'clock, deceleration of the propeller, water turbine, etc. due to water pressure can be suppressed. Since the compressed gas or the like is ejected from the direction of 6 o'clock or the like, the force of rotating clockwise is always continuously changed, and the energy of the compressed air, the gas or the like, the buoyancy force due to the difference in density, etc. are converted into the rotational energy of the water wheel or the like. When injecting compressed gas, etc. into the shaft of a water turbine or the like by making it hollow, a stuffing that is caught at the position of temporary or 6 o'clock is installed, and the hole of the shaft is caught by it and the door opens and the gas When the door that spouts out comes to a position where it does not get caught, it can be closed by force such as a spring, or gas etc. can be passed through the hollow part in the shaft and the cover can be covered with a cap made of metal etc. A structure can be created in which gas can be ejected when the gas outlet of the rotating shaft comes to a specific position when a specific part of the cap has a hole, and the ejection of compressed gas is linked to the position of the water turbine. It is also conceivable to control the valve so that the compressed gas is emitted only when the vehicle comes to a specific position. The shaft part that transmits energy such as a water wheel can be extended sideways as it is to increase the airtightness so that water does not come out from the water tank or tank, and it can be passed to the part where there is no water such as the tank, or once inside the tank using gears etc. When the rotation is transmitted to the shaft that changes direction and extends upward to reach a height such that it can come into contact with the outside air at the upper part of the tank, the energy can also be transmitted to the gear or the like to be used as a power source or the like. A number of water turbines, etc. can be connected and installed in the vertical direction. There are various ways to extend the tank deep underground and to raise it above ground. It is connected by a belt or the like to transmit the rising energy and buoyancy in water such as air, and is supported at some place (the angle changes depending on the resistance to receive the buoyancy by something like a bicycle chain). It is also possible to use a plate or the like (although the angle of the plate does not necessarily change due to resistance or the like due to the installation cost). Further, the energy obtained by the buoyancy by this method is connected by a shaft and used as upward kinetic energy to lift water or the like and be used for pumping or the like. It is also possible to divide these by 10 meters or the like, adjust the water pressure or the like, and connect a number of them in the vertical direction. It is also possible to efficiently utilize the rising energy of the injected air or the like by reusing the air or the like by using a structure in which the air or the like flows from the lower structure to the upper structure again by a pipe or the like. The energy or the like associated with the rise of air or the like in each structure can be converted into driving energy or the like by a shaft or the like. As for water, etc., since the air, etc. of this device comes up and the water, etc. is in a place where it comes into contact with the standby on the ground, etc., it is possible to pump them up. It is possible to carry water or the like upward along the rotation by using a similar structure such as a bicycle chain. By stacking such devices in a number of stages in the vertical direction, it is possible to efficiently utilize the rising energy of air or the like (which may be carbon dioxide or the like) and convert it into energy to control the water pressure. Instead of releasing air to the outside, it is collected in a tank and reused. After putting compressed air etc. once, it is possible to attach a cover etc. to the contact surface with the atmosphere so that it does not leak to the outside, and if necessary, install a pipe etc. to let the compressed air escape to the atmosphere etc. it can. A sensor or the like that detects pressure can be provided on the path connecting the compressed air or the like, and a valve or the like that opens and closes in conjunction with the sensor or the like can be provided to optimally control the pressure at each part where the air or the like flows. The valve that opens and closes may be an electronically controlled valve or an analog valve that opens and closes according to pressure with a spring or the like. The devices can be connected horizontally instead of vertically, or they can be made smaller. Of course, such a device can be attached to a ship or the like to provide propulsion. In order to use energy efficiently, move water, etc. to a high position such as 60 meters above the ground by using the above-mentioned buoyancy-mediated method such as a pump, elevator, vehicle, etc., and then turn the pipes, etc. downward. Water is dropped and the kinetic energy is used to power the propellers for power generation. Of course, this energy can be used in various ways as power. If such a device is loaded on a ship, it can generate electricity or directly reduce propulsion energy. Even if you don't use pipes, a certain amount will fall to a limited point. It can be pumped up using the principle of this device. Since the kinetic energy increases in proportion to the square of the moving speed of the object, energy can be obtained efficiently. At a height of about 60M, the kinetic energy is about 625 times that of a speed of 1M / S. A considerable amount of power can be generated even at 40 L / s. Energy is efficiently increased by vertically falling water and the like. Efficiently increase the energy at which substances move and use it as power for generators and the like. (For example, a turbine for hydroelectric power generation is turned.) A baseball ball containing iron may be used. When transferring energy from a large number of balls to a turbine for power generation, for example, the balls roll on the rails so that the balls fall on the pipes for regular fall at the upper position, and the flow is further flowed with a stopper such as an open / close type. You can also control it. By making it into a ball shape and providing a slight inclination, it can be easily moved by gravity without power. Prepare multiple pipes on which balls, etc. fall to receive energy, for example, make it possible to transmit energy such as balls independently to turbines, etc. For example, each of them does not have wings such as water wheels in a horizontal row. By slightly shifting the position, energy such as a ball can be efficiently transmitted to wheels, a water wheel, a turbine, and the like. The return commission device, etc. that can be collected at the upper position is mechanically adjusted and controlled so that the movement of the ball controlled at the upper drop position and the rotation of the lower turbine, etc. are most efficient. If it is water at the lower position, make sure that the water collects in a certain place, and if the bucket or the like that moves mechanically from there moves upward, the water or the like moves upward. A ball-shaped object also moves to a certain place by gravity or the like, or if the direction is controlled by a lane or the like, the ball or the like moves upward according to the movement of the machine like a batting machine. The ball or the like can be covered with an impact-resistant material such as rubber or leather to maintain its strength. When installing, for example, using natural terrain such as mountains and valleys, if there is spring water, it is possible to reduce the cost of building a large-scale facility from scratch. It is also possible to use an existing building or modify a part of the edge. When a certain amount of spring water is boiling from the vicinity of the mountaintop, it is possible to use a pipe or the like to pull the water to a specific point while maintaining the altitude. If the amount of water is small, it can be pumped up using power, etc., and the water can be carried from below and reused. Even if the difference between the top of the mountain and the lowlands in the vicinity is 50 meters, the original altitude of the mountain is high, so only keeping that part at about 50 meters may require less scaffolding. There are also cases where it is easy to install pipes, etc. in the mountains, etc., where people do not usually enter. It is also possible to make a stand or the like that supports pipes or the like by using scaffolding such as wood or concrete. Hydroelectric power generation such as dams collects water that has once flowed down from the surrounding mountains, etc., and uses the height of the water channel below it to obtain energy, etc. It is possible to obtain high energy while keeping costs down. If the lowland part is dug down and a generator or the like is placed underground, noise or the like can be avoided and the height difference can be widened. When dropping water etc. downward for power generation etc. with a pipe etc. Connect a pipe etc. that can send compressed air etc. to the upper part of the pipe etc. The inner pipe bundled into a structure in which multiple thin pipes are bundled is made with a number of holes for ventilation, and compressed air is sent from the high part of the pipe to water, etc. in the pipe. You can also make it fall smoothly when it falls. If there is no spring water, you can use it by carrying a certain amount of water or collecting rainwater. It is also possible to move the vehicle efficiently using the above-mentioned structure that slides on the cooled ice, etc., and the rails, etc. so as to move upward after accelerating using gravitational energy, engine, etc. to some extent. If you make it, you can get the energy required to move water etc. to a high position by accelerating with gravity, so you can suppress the energy cost required for propulsion power. Of course, such a device can be attached to a ship or the like to provide propulsion. The energy required for cooling can be saved by grounding a tubular tunnel there using the natural providence that the temperature around 5 meters underground in the mainland of Japan is maintained at about 15 degrees throughout the year. Alternatively, when this structure is grounded on the ground and cooled, it is possible to cover the outer circumference of the tube with liquid water, etc., and if the outer circumference of the tube is made of plastic, glass, etc. that allows light to pass through, the scenery can be seen from inside the vehicle. You can also see it. It is also possible to run a ship, etc. that is sealed inside the ship by putting water in a similar tunnel, etc., and increase the energy efficiency during movement by creating a vacuum inside the tunnel (anything that can run inside the tunnel, etc. can be applied. ). Energy costs can be reduced by adopting the same structure for cars, etc., even if they are not large ones such as trains. Increase the certainty of automatic driving of cars. By connecting an automobile or the like to a trolley or the like installed on the same platform, the weight of the automobile or the like is mainly received by a sled to reduce rolling resistance or the like. A motor or the like for transmitting power by contacting the road surface or the like may be incorporated in the trolley or the like, or the engine of the automobile or the like, or the tire, engine or motor of the automobile with the power of the motor on the trolley or the like. There are various methods such as connecting to a power unit of a trolley or the like, or providing the trolley or the like with a device for transmitting the rotational force of wheels of an automobile or the like to the road surface or the like as needed. Also, even if you do not use an existing car etc., if it is a four-wheeled vehicle, add about two wheels to the center part of the car body etc. in advance and that part does not come into contact with the ground etc. during normal driving However, the angle etc. can be changed by flood control etc. By adopting a structure that makes contact with the ground if the tires are changed, the four wheels are used to ride on a dolly, etc., and the remaining two wheels, etc. (rubber, iron, etc. wheels, etc.) are used for the upper part of the cooling rail using flood control, etc. A method of contacting parts, etc. as necessary, and a bogie that has a function of a hydraulic jack so that the car on the bogie can be raised and lowered by hydraulic pressure after the car, etc., has been put on the bogie, so that the tires of the car, etc. It is possible to change the height so that it does not come into contact with the ground or the like. It is also possible to install a motor etc. to obtain the driving force during running on this trolley, or to make a part of the trolley powered and pull or push it to connect it with other trolleys like a train or to connect a powered trolley It is also possible to reduce the installation cost by arranging it appropriately. It is also possible to monitor the movement of the dolly (unit) with a sensor or install a camera or the like around the cooling lane so that the dolly can be automatically controlled unattended. A solar panel or the like is installed near the space where such a cooling lane or the like is installed, and the electric power from the solar panel or the like is guided from the metal part of the lane to the motor of the trolley or the like, or the lane and the electric receiving part of the trolley come into direct contact with each other. It is also possible to use non-contact power transmission or the like so that it is not necessary. Tires, etc. (made of iron) that can be installed on the side surface of tires of automobiles, etc. to prevent their rotation from being installed on the road surface installed on trolleys, etc., or on the upper part of cooling rails without ice, etc. The method of converting the energy of the engine, motor, etc. of the car into running energy, etc. by connecting to the wheels of the car, or rotating the engine, etc. on the spot without changing the position of the passing car at the time of vehicle inspection, and turning the tires, etc. If you do, you can attach a roller part device, etc. that rotates accordingly to the trolley, etc., and connect it to a wheel, etc. with a mechanism that can change the rotational energy of the roller part so that the wheels of the trolley do not come into contact with the road surface. There are multiple. In order to prevent the road surface part that transmits running energy from freezing, water that has reached about 15 degrees due to geothermal heat stored 5 meters underground is guided to the vicinity of the road surface with a pipe to prevent this. It is collected by the motor pump in the tank part so that it can be circulated. For emergency stop, etc., stakes, etc. will be installed at the rear of the dolly, etc., and if necessary, they will be lowered to the road surface, etc. to stop them promptly. Even when energy is obtained in the direction of travel with technology such as a linear motor car, a part of the magnetic field of the line of the linear motor car is cooled to cover it with ice, etc. It is efficient because it is possible to save the force of floating vertically by the power of electricity and to concentrate the electric energy etc. on the energy in the traveling direction by installing something that can reduce the resistance at times. The levitation energy when the linear motor car is running and the energy that accelerates in the direction of travel are applied. In order to adjust the direction of the magnetic energy to save electrical energy as much as possible, the levitation energy is small and the power consumption and speed during movement are maximized. Adjust for an efficient balance. Even if it is not actually floating, there is a warp etc., so resistance can be reduced and it is possible to run. From the point of view of ride quality, it is possible to sprinkle a little water on the frozen person. The linear motor car may be equipped with a sled and the above-mentioned power wheels. It is also possible to make the inside of the tunnel close to a vacuum state to eliminate loss due to wind and reduce noise and the like. An energy transfer part using magnetic force in a linear motor car and a sled device may be installed separately. By attaching wings to the upper part of the vehicle to obtain lift and controlling air resistance, the friction with the freezing lane can be reduced or adjusted to reduce or adjust the friction between the vehicle and the cooling lane. It can be reduced or, conversely, the vehicle pushed down towards the cooling lane. It is also possible to insert the sled into the cooling lane so that the sled or the like does not derail from the cooling lane so that the cooling lane is shaped like a fastener so that the sled or the like does not come off and the sled is fitted therein. By changing the direction of the wings and adjusting the lift balance on the left and right, it is easier to bend when making a curve. The flap can be adjusted so that the air resistance increases when decelerating. It is also possible to keep the parachute out of the vehicle at the time of emergency stop. To prevent the parachute from getting entangled, if the device with the parachute is separated from the rear of the vehicle and moved along the lane, the effect of the parachute can be obtained. You can stop safely. The parachute device is connected by a wire or the like through a device that moves on the cooling lane, and the device and the vehicle are also connected by a wire or the like. As the kinetic energy of such a vehicle, it is conceivable that a wheel drive or the like, a jet engine or the like, or a propeller is attached to the side surface or the rear part of the vehicle. After accelerating considerably, it jumps out as it is in the direction of travel, gliding from there, moving at high speed using rockets such as jet engines attached to moving objects as power, lift by wings, etc., and launching artificial satellites etc. It can also be put on track while saving fuel. There is a method of accelerating sufficiently with a cooling rail and injecting upward, and then disconnecting only the satellite or the like (such as disconnecting by the pressure of compressed gas or the like) and further accelerating using a jet engine or the like. A jet engine or the like may be used from the beginning to accelerate on the cooling rail. In order to cool the part where the sled part is in contact, the heat absorbing plate of the freezer is elongated and installed there, or a dedicated heat absorbing device is used, or a large compressor or water with a constant temperature underground is used. Efficient temperature control is conceivable. It is conceivable that the exhaust heat of the compressor or the like is secondarily used to operate the Stirling engine or the like. Water drawn from the compressor 5 meters underground is circulated around it using pipes, etc., and heat exchange is performed at the required location to take measures against exhaust heat. In order to cool the water in the cooling lane, install a pipe near it and put gas without humidity in it. Then, cold air such as dry ice can be flowed using a fan or the like, or a tank filled with carbon dioxide in a low atmospheric pressure state can be used to suck in the outlet of a pipe or the like. After recovering carbon dioxide at the end, it is possible to save storage space for carbon dioxide and the like by using another pipe or the like and flowing a gas for cooling or the like in the same reverse direction. The fan can be installed in the middle of the pipe if necessary. The carbon dioxide recovered through the pipe can be reused as dry ice or the like. It is also possible to obtain carbon dioxide gas by applying heat to dry ice in a vacuum state and introduce it into a pipe or the like. When sending to a pipe etc., increase the speed by compressing etc. Even on the current road, asphalt of the road using pipes etc. to put water etc. in a tank installed 5 meters underground at the bottom of the road or passage to prevent freezing and lower the temperature of the road surface in summer. By circulating it 10 cm below (as a guide), the road surface, etc. will not freeze or generate excessive heat. It is also possible to improve the cooling efficiency in summer by allowing circulating water or the like to flow around the sled part with a pipe or the like. Create a futon-sized space (the size can be changed to be larger or smaller) using a PET bottle, etc., and keep the temperature in the space so that it will be cool in the summer and will not freeze even in the winter. Water from a tank or the like installed about 5 meters underground is put into the inside of a PET bottle or the like through a pipe, and the PET bottle or the like is connected so that the water circulates and returns to the tank. Pumping water using a motor, installing it in the ground of a high mountain, or sending a large underground tank linked to a large-scale facility such as a water purification plant with a temperature close to 15 ° C even in the summer to each household, only the water pressure You can pump water with. A cover such as a closed structure is attached to the upper part of the cooling rail (lane), etc., and water of about 15 degrees of underground tank water is circulated there to reduce the cost of the cooling tower. The upper cover of the cooling rails, lanes, etc. is closed by electric power, etc., especially in summer so that heat is not exchanged as much as possible. Leave it to. Add functions to cooking utensils, etc. to prevent the white part from being burnt when baking fried eggs. Provide a space for water etc. in the upper part of the lid, etc. Remove it moderately from the hole around the lid. The size of the hole should be adjustable with a screw type or the like. Make a streak in the lower part of the frying pan to allow the water that has fallen down to flow there. It is also possible to make it easier to move to the center by making the center yolk and inserting 12 streaks like the hands of a clock so that the center is deep. When the flame of the stove goes to the white meat and you want to concentrate the heat on the yolk part, the gas in the center of the stove is the most gas and the surroundings are almost nonexistent or not at all. Prepare a good shape. Switch the gas pipe etc. with a lever etc. so that it can be divided into normal and the heat power goes almost in the middle, and the heat power goes only in the middle. When cutting wood, etc., HHO gas, Omasa gas, etc. are used to cut at high speed in order to increase efficiency. Apply gas etc. locally at high speed. After cutting, sprinkle some nearby water on it to cool it completely. It is also possible to provide a nozzle for discharging water or the like at the gas outlet or the like so that the water or the like ejected from the nozzle does not heat the surroundings more than necessary. It is also possible to make the shape of the nozzle elongated so that water can be applied only to a small area. In order to increase efficiency, it is possible to cut a plurality of gases and the like in a short time. You can make it into a circle and set it around a tree, or cut about 70% of the tree in the shape of a crescent moon. In order to prevent humans from supporting the chainsaw, etc., put out a strong rod-shaped object that can be fixed to the tree, etc. near the handle of the chainsaw, and use bolts, etc. to attach the tree, etc. Fix it, etc. Then, pressure is applied by flood control or the like between the part supporting the rotary blade of the chainsaw or the like and the rod or the like fixing the wood or the chain saw body so that the blade of the chainsaw is pressed in a certain direction. Can be done. The parts that support the flood control can be changed as needed to improve efficiency. In order to make an emergency stop of a train or the like, a pipe or the like is provided at the lower part of the train running line, and oil or the like (or a gas or the like that has been considered as clay) is poured into the pipe or the like. Then, a hole is made in the upper part of the pipe, and something like a stake is dropped from the train or the like and hooked there. In places where piles etc. have fallen, it is possible to slow down the speed of trains etc. while increasing the pressure inside the pipes by contacting with round plates etc. made at the very limit of the pipes etc. so that the pressure does not escape like an air gun. .. If you have multiple pipes installed and there are multiple stakes for trains, etc., first stake one stake (a rod-shaped object for hooking the vehicle etc. to the outside) and then the second and third trains. The braking force applied to the train can be adjusted. It is possible to make holes in the pipe to release the pressure, and when the pressure reaches a certain level, the stopper or the like will come off and the pressure will be suddenly applied too much to prevent the pipe from breaking. In order to reduce the air resistance of the train, the train door is flipped up and the train gets on and off to lower the vehicle height. When the pressure of a pipe containing a liquid such as oil or gas used for braking etc. exceeds a certain level, it will come off (or a structure that mechanically removes the plug (remotely removes liquid, gas, etc. inside the pipe) A device that can open and close the door, etc. provided for passing through) or by providing a hole, etc. in another pipe, connecting a pipe, etc. that allows liquid, gas, etc. to pass through, and transmitting the pressure of the adjacent section, etc. If pressure is applied by providing a decompression plug or the like in a section with a plate or the like or another dedicated hole in the adjacent section and connecting it to that section, liquid or gas may move to that section. This makes it possible to further increase the braking force. There is an appropriate proportion of liquid, gas, etc. in the pipe at normal times, and it is possible to prevent a sudden shock from being given to the vehicle, etc. Also, if necessary. It is also possible to prepare a dedicated device (hydraulic pump, etc.) that can send liquid, gas, etc. to the pipe so that oil, liquid, solid, etc. can be quickly sent to the required section when necessary. Something like a pile When connecting a vehicle and a pressure pipe, etc., in order to mitigate the impact on the vehicle, etc., it looks like a shock absorber such as a spring or hydraulic type between the vehicle etc. and something like a pile (hooking structure). It is also possible to install a shock absorber, etc. When freezing a liquid such as water in the cooling lane, a gas such as carbon dioxide is filled in a pipe or the like and compressed or blown there. It is also possible to pressurize and send in something like vaporized dry ice, and then collect it at the end of the pipe and make it into dry ice again to make it in a very low temperature state before it hardens. When using a material such as a PET bottle and planting seedlings such as cedar on a mountain, etc., the cedar etc. is laid on the ground around it and reused. It can also serve as a role to protect from plants that become a barrier when growing. At that time, it is also possible to process a PET bottle etc. to make it close to a single plate and fix it with a pile etc. (wooden etc.). By making the required number of holes in the pipe, water etc. can be passed through the soil etc. It is also possible to save time and effort later by using a material such as a PET bottle that changes naturally. Even if it is not a PET bottle, a special vinyl sheet or the like may be used as long as it can be installed around it to prevent the surrounding plants from growing to prevent the growth of seedlings such as cedar. However, it is possible that the cost is different. When fixing a bottle, you can make it as close as possible to the ground, but you can also create a space between it and the ground, so you can stretch the surrounding plants a little and have a plate-shaped object such as a PET bottle. It can also be adjusted by adjusting the amount of space. For example, when carrying wood etc. (it does not have to be wood separately or it may be a special material) from a forest etc. that slopes downward from the forest road, connect a PET bottle etc. to water etc. It is also possible to construct a certain pipe-like structure that can withstand pressure and prevent water leakage, and put wood or the like in it. You can put wood etc. in the net and connect it, or you can pass a big net from the entrance to the end of the pipe in advance and there is a hole only in the necessary part and tie it after putting wood etc. Can also be closed. Then, water or the like is poured into the pipe and the wood or the like inside is pulled from the upper part by a winch or human power by using buoyancy or the like. After carrying up the wood, etc., the water can be returned to the tank or the like with a pump, etc., or the spring water in the mountainous area, which can be used to give buoyancy to the wood, etc. by using the pump, etc., is used. Or you can store rainwater in a tank. Of course, when moving wood or the like in the downward direction on the mountain, the pipe structure is used to move the wood or the like with lower energy by using buoyancy or the like. Buoyancy can be used when pulling even in a flat place, and if pipes in a place sloping from the top of the mountain are connected, the water pressure from the top can be used to move wood etc. more efficiently. Water can be stored and reused in tanks, etc. (wood, etc. can be stored together with water, etc., such as a waiting place for transportation means, etc. using these pipes, etc.). It is also possible to provide a break in the tank or the like using a net or the like to facilitate the reuse of water or the like. It is made by shaving fuel such as wood or charcoal near a rolling sphere, compressing it, crushing it, and reprocessing it into a sphere. When processing fuel, put the necessary items in a spherical mold, etc. (you can put the processed material in a hollow, etc. in the shape of a broken ball and return the mold to a spherical shape). You can also press it. In order to prevent the fuel or the like from absorbing moisture or deteriorating, it is possible to put an air through a hole inside the fuel, mix a hygroscopic preservative, a deodorant or the like, or coat the outside. In addition to being able to easily move a certain number to the place where it rolls and burns due to gravity, it is also effective as an interior. It is possible to heat a certain space by using the heat of the combustion device. For example, a structure such as a combination of PET bottles (although a special material may be used) creates a certain space inside and blows warm air into it. You can also heat the liquid etc. with heat and circulate it in the structure made of PET bottle etc. or pour it into the place where juice etc. was originally contained such as PET bottle etc. and the internal space surrounded by it You can also control the temperature of. For example, put combustibles such as wood and charcoal processed into golf balls in a container higher than the combustion place, connect it with a pipe, etc. so that rolling things can be stopped or passed on the way. It is also possible to control the movement of fuel to the combustion chamber or the like by attaching various devices (for example, a stopper that raises and lowers electrically). By automating the time and effort required to add firewood, forest energy can be used efficiently. If the fuel rolls to save space by gravity and moves automatically, refueling will be easier and it will be easier to use. Unlike conventional air conditioners, it can be handled with a single switch and refueling does not have to be done so often, which saves time and effort. There is also an interior element by making it spiral when the fuel etc. rolls and passing through the loop-shaped wrinkles. After processing the fuel on the sphere, it is naturally derived or harmful gas at the time of combustion, such as adhesive glue (such as starch made from rice paste) to make the surface slippery and easy to store. (Preferably one that does not easily emit harmful gas) or plastic (naturally-derived raw material that does not easily emit harmful gas when burned, etc.). For safety, attach a stopper or the like to block the flow at the fuel supply passage. A device for measuring the concentration of carbon monoxide in the space is also attached, and in conjunction with it, the stopper is automatically activated in an emergency to improve safety. A seismograph can also be attached to automatically activate the stopper and the like. In order to maintain the airtightness so that the place where the fuel is stored and the path through which the fuel rolls, etc. do not come into contact with the outside air as much as possible, the fuel stock should be airtight, and if a vent is provided, a moisture barrier, etc. Isolate the outside air from the fuel, etc. It can be opened when the stopper etc. passes, but it can be closed otherwise to prevent outside air from entering. In order to secure a living space and use it more efficiently, for example, next to a cedar tree (it does not have to be next to a cedar), a space for a person with a diameter of 4 meters can be put in wood, concrete, etc. Make something like a small tower by making it up to 20 meters in height. If the height is about 2 meters, you can secure a space of about 40 square meters. At the end of the space, attach an elevator used for people to go up and down. Use a pump or the like to adjust the temperature of water, etc., which is about 5 meters underground, or use the height of nature (in the case of mountainous areas, the water naturally rises to a high position due to gravity). ) Use it to keep the living space at an appropriate temperature by pouring it into a pipe that looks like it was made from a PET bottle (a special material can be used instead of a PET bottle). Try to control the outside temperature and the temperature of the living space efficiently while attaching the pipes as much as possible. The installation of pipes is also energy efficient because once water is raised, it flows downward. If you set up a room on the top floor that looks like a PET bottle, you can see the stars at night, and if you take a bath there, you can relax very much. In addition, water, etc. in the structure made of PET bottles, etc. attached to the surrounding part of the roof, which tends to get hot, is stopped at the roof part, etc. so that the temperature reaches a certain level due to sunlight, and it is used for conventional air conditioning, etc. It can also be isolated from the circulation route of water, etc., stored, and used in a shower or the like. Since each space is subdivided, it is only necessary to perform auxiliary air conditioning for the necessary parts, and the cost is reduced. A perfect interior is provided for each space in each room, and humans or the like simply move there with an elevator or the like as needed, so the space may not be cluttered. In terms of security, the entrance is limited, so it can be said that it will be higher by that amount. From the entrance of the site to the structure made of PET bottles on this tower, it is connected with a tunnel etc. made of PET bottles etc. Security can be further improved by attaching a remote surveillance camera, etc., and the entrances of multiple towers, etc. can be connected by such a tunnel-shaped (ground or underground, etc.) isolated space to give the entrance a locking function. It also has the effect of limiting intruders. It is also possible to use water kept at about 15 degrees Celsius by using the ground temperature of about 5 meters underground in the space constructed so that there is space inside by connecting PET bottles etc. to grow wasabi etc. It is also possible to cut out the mouth of a 2-liter PET bottle for beverages and arrange eight of them to make one space in the middle. (Because it is transparent, it allows light to pass through. You can use a special material instead of a PET bottle.) If necessary, pass an air intake hole or a pipe that discharges water through the space. In addition, water or the like is also poured into a space where such plants or the like can be grown to heat or cool the temperature of the liquid or the like flowing in the surrounding PET bottles or the like depending on the temperature of the water or the like. It is also possible to control the temperature inside the space, and the temperature of the space can be adjusted even if heating or cooling is blown into the space where such plants or the like enter. It is also possible to use the water or the like that has been poured into a space where the plants or the like can be put, and to use a smaller PET bottle or the like like a ship. It is also possible to move a large number by connecting it with a rope or the like and pulling it, or by attaching a propeller for propulsion to the floating object. It is also possible to put a hydroponic cultivation device, soil, stones, etc. in an object that can float in the water so that plants can grow. In order to efficiently cultivate wasabi and the like, it is possible to create a small space for cultivation using a PET bottle or the like and connect it as described above. It is also possible to provide a partition inside with an object such as a PET bottle laid on its side, and put a transparent material such as marbles on the upper part so that it will not be deteriorated by water or the like to make a wasabi medium. The lower part is open so that water etc. can enter and flow easily. Marbles and the like may be specially processed so that the inside is hollow. The size of the marbles, from large to small, can be selected according to the positional relationship with the wasabi. Lay a PET bottle on its side and compare it to a ship. Make a cut hole in the upper part so that wasabi can grow. Do not make more holes than necessary and use it to prevent pests. By connecting a number of these ships, a waterway made of PET bottles, etc. is made around the ship so that the ship floats, and PET bottles, etc. are connected again. Make spring water flow through the connected PET bottles by using the height difference. At the time of harvesting or maintenance, it is also possible to lift and pull the connected ship that cultivates this wasabi etc. by the buoyancy of water and carry it to the target place so that it can work there. Since it is possible to stack devices that can grow such wasabi vertically, it is possible to increase the yield. It is also possible to put wood etc. in it in the same way as to take out the salt etc. by drying the seawater and dry it to reduce the water content of the wood, thereby improving the utilization efficiency of the wood etc. as fuel. In order to dry more efficiently, it is possible to provide a vent in the structure constructed by using this PET bottle or the like and blow air or the like from there with a blower to dry it, or it is possible to close it and install a dehumidifier. A rail (lane) etc. is laid at the point where you want to fly while limiting the range of action by attaching a string etc. to the drone so that radio waves for identification etc. can be transmitted and received there and the drone etc. is a certain rail as a mark Allows you to fly fine. Ensuring accurate flight and safety of drones, etc. in forest areas where GPS does not reach. Use radio waves emitted from the drone, etc. to grasp the exact positional relationship with the lane, etc., and prevent the drone from coming off from a certain lane. The distance, altitude, speed, etc. from the drone lane can be calculated from the reflected radio waves. When carrying out trees in the mountains, use a bicycle that can run entirely with the power of the motor, not with human power. Attach training wheels to a fully electric bicycle to prevent it from tipping over. Then, make rails etc. so that tires etc. can run there. Like the above drone, the position of this bicycle or the like can be determined using a sensor or the like, and based on this, it can be operated remotely using a computer or the like, or automatic driving can be performed. Arrange the required number of terminals, etc. that can transmit information by wireless signals instead of lanes, etc. to the destination, and based on that, the moving object reads its own position speed, inclination angle of the land, etc. and operates the handle. You can also use that information. It does not have to be a fully electric bicycle, but a dedicated car may be used. Anything with horsepower such as a buggy can carry a lot of luggage. Brake operation can also be performed automatically. In the case of motor drive on a slope, you can apply a force to turn the motor in the direction of burning so that you can descend slowly. By arranging such structures on the roof of a house in a way that cools solar panels, etc. by connecting PET bottles, etc., and letting water etc. flow into it or storing it there, the inside of the house building, etc. You can also control the temperature of the. For water, etc., install a tank, etc. at a ground temperature of about 15 degrees Celsius throughout the year, about 5 meters underground, and circulate the water. The flow of water, etc. can be stopped for a certain period of time, such as while the temperature changes on the roof, etc. Structures made of PET bottles, etc. (not necessarily PET bottles) are embedded under roof tiles, etc. It can also be designed as. You can prepare multiple underground tanks and connect them to different depths to finely adjust the temperature, or if you can use natural cold spring water or hot spring water, use a pump etc. as it is. It can also be flushed. In winter, it is possible to prevent snow from accumulating on the roof. Further, if water is poured over the structure, the outer surface of the structure can be cleaned. In order to control the temperature of the space where humans are, such as a car, a structure is created in which water or the like circulates or stays around by connecting PET bottles or the like, and the temperature of the space in the structure is controlled. You can also prepare water and pour it into a structure made of PET bottles, etc., and put ice etc. made in the freezer to lower the temperature. Tap water or the like is put into the freezer through an elongated pipe as described above to freeze it. The air inside the car is made to flow in and out by using a fan or the like, and cold air or the like is sent into the car. It is also possible to put dry ice etc. in the freezer or put it in a place where water etc. is contained in a structure made of PET bottles with a hollow inside that humans can enter. (It is also possible to put only dry ice without putting water etc.) The freezer etc. can be driven by a battery or solar, even if the engine etc. of the car etc. is turned off. A pressure valve, a fan, or the like can be provided to release carbon dioxide or the like into the atmosphere, and the freezer can also be provided with a mechanism to release carbon dioxide or the like into the atmosphere by the same mechanism. By using this mechanism for transportation trucks and the like, it is possible to control the temperature inside the vehicle or container. Create a space where humans can live by using wood and other materials that store carbon dioxide. Since wood and the like immobilize carbon dioxide in the atmosphere, they are used as space construction materials without burning. This wood is used to fill the space like building blocks in places where water is accumulated, such as large dams, and to create a space in which humans can work. Like the three major pyramids in Egypt, it is possible to construct wooden pillars, etc., and provide an appropriate space inside. (It is possible to create a larger space than Central Park in New York. You can also create a runway for airplanes there.) A vast space can be obtained by utilizing places such as dams in the mountains in this way. It is also possible to coat the wood with a substance that does not allow water to pass through, such as a PET bottle, so that it does not rot. If a large dam such as Kurobe Dam is replaced with a space where humans can live with this technology, people in about one city can live, so the purchase price of timber that accompanies it may be commensurate with the fare. it can. Dam water can be put in by providing a space below the structure, by providing a space in the upper part of the structure or around the inside, or by making a small dam at the end of the dam. it can. It can also be used to control the room temperature inside by creating a space created by using PET bottles etc. on the upper part of such a structure, and by shielding it from the outside air, the lower part can be used. It is possible to prevent the temperature from becoming excessively hot due to solar heat, or being cooled by the atmosphere in winter and lowering the temperature. In order to prevent deterioration of timber and the like, chemicals and materials for moisture proofing and corrosion can be appropriately arranged. Urban functions can be integrated in a structure with a height of 50 meters or 100 meters (the scale can be freely selected), a vast space can be created in a place with clean air, and carbon dioxide etc. can be stored semi-permanently. You can also do it. If carbon dioxide and other substances emitted by humankind are stored in this way, new clean housing and work spaces can be cultivated, and both climate change and energy problems will be solved. It is a much stronger structure and there is almost no risk of collapse because it can take a structure such as the surroundings that are in contact with the mountain surface even in the event of an earthquake. In housework, the air is controlled by pipes from the outside, so there is no danger of burning and spreading by shutting off the air. It can be used not only for air conditioning but also for extinguishing fires by appropriately circulating water from underground tanks to the space. While a space is provided inside with a structure that combines wood etc. like a pyramid stone, water etc. is circulated from the underground tank using materials such as PET bottles in the space etc. inside it. It can be useful for temperature control inside and around the space. Of course, wood and the like can also be sawn into cubes and assembled. We also use column bonding technology that does not use nails, etc., which can be combined with steel frames to reinforce (such as making columns uneven and fitting them). By creating a vast flat space at the top, it is possible to create a relaxing space for sports and recreation. It is possible to store timber etc. in a large land (without sawing) and to build a space where humans can live. In Antarctica and the Arctic, the land is large and climatically resistant to corruption. (You can store it for a long time by taking it with you. You may or may not use lumber, etc.) Utilizing the fact that it is kept at about 15 ° C all year round at about 5 meters underground, the temperature changes according to the depth of the underground. Take advantage of that. On slopes of mountains, etc., determine the depth according to the required ground temperature such as about 5 meters underground or a little shallower depth, and put water etc. in advance in a tank composed of PET bottles etc. and make it with the PET bottles etc. shown above A structure for controlling the temperature of air and the like is constructed. We will build a PET bottle, etc. that can control the temperature of the air by providing a space inside that allows air to pass through. Then, the air or the like is connected to a space where plants or the like composed of PET bottles or the like installed on the ground or the like grow through a pipe or the like made by using a PET bottle or the like. The outside air is taken in from a specific intake and circulated to the underground space and the space for growing plants. It is possible to shut off the outside air and circulate a dedicated gas, or to purify the air by using an air filter or the like in the outside air intake part. It is also possible to prepare a plurality of underground tanks, one at a high position and one at a low position when viewed from a structure for plant cultivation, etc., by utilizing the difference in altitude of the mountain. By doing so, it is possible to reduce the cost related to air circulation by naturally causing convection by using the temperature difference with the outside air, and if necessary, install a fan driven by a motor etc. to cultivate the air etc. in plants etc. Pour into the space. The plant cultivation space can be designed so thin that it is impossible for humans to stand and pass through, so that the space can be maximized. It is also possible to put a pallet on which plants and the like are set on a trolley and put it in and out of the cultivation space using tires and rails. Instead of sunlight, LEDs or other elements that convert heat into light (announced by Kyoto University, etc.) can be used, or sunlight can be drawn into spaces such as plants by using mirrors or optical fibers. If the heat applied to the conversion element affects the plants, etc., a pipe-shaped device, etc. can be set between them to circulate water there to cool the plant cultivation space. Since the area around the building is made of PET bottles or the like, it is possible to prevent excessive temperature fluctuations by circulating water or the like having a constant temperature such as 5 meters underground. In a system that uses the underground temperature, the air adjusted by the underground temperature is circulated from the underground space to the space for plant cultivation, etc., and the water stored about 5 meters underground is also circulated because it is about 15 degrees. You can let it. The plant cultivation space can be sized to accommodate humans and can be used for purposes other than plant cultivation. The plant cultivation space is separated from the outside world by a structure made of PET bottles, etc., and in order to control the temperature, humidity, etc. in it, the air etc. adjusted by the ground temperature is cultivated from the underground structure using the ground temperature. You can move it to the space through a pipe etc., but at that time you can move only the air, or if you move the water with the air and pour the water into the place where the juice of the PET bottle enters all the time, plant cultivation by that It is also possible to control the temperature of such spaces. In some cases, only water can be circulated and only air can be circulated. If the cultivation space for plants is designed to be long and slender so that humans cannot enter it, the space can be effectively used and the cultivation space for multiple plants can be stacked on the upper part. From the plant cultivation space to the work place for humans to care for plants, set a long and narrow tunnel made of similar PET bottles underground or above ground on a rail or something with plants on a trolley. Sometimes pull it with an electric tow truck or pull it with a winch to move it. If the workplace is also sealed so that the work can be performed while being shielded from the outside world, it is possible to prevent bacterial invasion from the outside and events such as seed mating. Since the size of the space for plant cultivation etc. can be changed, make it a size that humans can enter and work there, or if you install a solar power generation system in that space, you can control the temperature of the solar panel and generate power etc. Can also be done efficiently. Based on these inventions, it will be useful for a society where services can be exchanged in a form that allows communication. A person who agrees with the inventor to operate the service network for the continuation of the service while mutually accommodating the services in order to use the invention technology as basic collateral for rational social construction is entrusted to the inventor by contract. Have them manage it. Water that is maintained at about 15 degrees Celsius in underground tanks in large tankers before and after the occurrence of typhoons and hurricanes in order to suppress the occurrence of typhoons and hurricanes or change the course. Artificially cooled water, etc. is carried to the desired point and discharged. Then, the seawater temperature on the sea surface is lowered to prevent the development of typhoons and hurricanes, the expansion of power is prevented, and the course of typhoons and hurricanes is changed. A large tanker can be dispatched by multiple units to release a large amount at the same point, or a number of long straight lines or circles can be released. You can also use dry ice or ice instead of water. Ice and dry ice can be prepared on board or in a facility and stored in a tanker equipped with a freezing facility, or a large transportation means such as a tanker can be provided with equipment for freezing, cold storage, manufacturing and storage of dry ice, and the like. For ice and dry ice, for example, if you slice a block of 10 cubic meters horizontally into 10 equal parts and put them in order from a tanker etc., even about 300,000 tons of ice will cover a considerable range. It is possible to prevent a large amount of high-temperature water from being absorbed by typhoons and hurricane eyes on the ice cubes. By adjusting the ballast of the transport ship to the left and right, you can slide ice etc. sequentially using the slope and drop it outboard, or lift it with a hydraulic jack and tilt it to slide it offboard speedily. I can work. In order to shorten the time it takes for a transport ship to arrive at its destination, a large facility that can manufacture and store dedicated floating ice and dry ice on the sea is prepared in advance, and typhoons, hurricanes, etc. If it starts to occur, you can use a transport ship such as ice or dry ice to carry it to the destination. You can also use a tugboat-like ship to adjust the position of ice on the sea and hovercraft to carry ice to your destination at high speed. You can also fix the surroundings with ropes to keep ice and dry ice together at sea. It is also possible to notify the presence of ice etc. around by using GPS or the like. As the typhoon progresses, you can continue to adjust by pulling ice etc. to the position of the eye of the typhoon using the power of the ship, and move the ice etc. in advance to the point where a typhoon or hurricane is likely to occur. You can also set it. It is also possible to put an ice pack or the like between the outer wall of the hull and the storage place such as ice in a transportation means such as a tanker so that the cold storage and storage can be efficiently performed. The principle of using ice, dry ice, cold water, etc. can also be used to deal with general rainfall fronts and rainfall phenomena. The lanes, etc. are coated with a rough material, the wheels are covered with rubber, etc., and the rubber tires, etc. are covered so that the wheels, etc. that transmit power when sliding the vehicle etc. using a cooling rail etc. are surely gripped. It can also be used. It is also possible to install a superconducting magnet or the like on the side surface or the lower surface of the vehicle, or install a coil or the like on the side surface or the central part of the lane to generate electricity. It is also possible to install a magnet or the like on the lane such as a coil on the vehicle side. You can also install a battery in the vehicle to drive the drive motor or charge the generated electricity. In addition, it is possible to balance with the side by using electromagnetic force like a linear motor car. Using this cooling lane etc. A vehicle and a linear motor car are operated as a set to generate electricity in a vehicle using the cooling lane. It is also possible to drive a linear motor car using the generated power. As an application of the above method of dropping water vertically to power the generator below, a coil is installed around the path such as a lane where magnets processed to roll instead of water are dropped. The lane is used to generate electricity and roll to a certain location based on gravitational energy, and the gears, shafts, etc. are moved by the power using the compressed air shown above. It can also be returned to the upper position. When you reach the upper position, you can use gravitational energy to roll over the upper part of the lane, go to the lane that connects downward, and then fall again. A certain amount of space is provided in the upper part or near the drop point to store the magnets of the rolling mechanism, etc., and if it is controlled by a stopper that opens and closes with electricity etc. and released, gravity etc. It is also possible to keep going on the rolling rail. This can be done in the same way with a device that drops the water, etc. shown above vertically and transfers the energy to the wings of the generator below to generate electricity, etc., and provide tanks at the top, bottom, etc. It is possible to store water, etc. in the water, and if necessary, drop the stored water, etc. to use it as energy, store natural water, etc. there, or use spring water, etc. A pump can be used for various purposes such as raising water to the upper part.
Attach magnets (electromagnets, superconducting magnets, etc.) to the tire installation surface of moving objects such as cars, their surroundings, and near or to the side of the vehicle installation surface, and attach coils to the ground, side lanes, etc. It can also generate electricity when it passes. It is possible to combine a magnet, an electromagnet, a superconducting magnet, etc. on the coil ground of a car or the like. The battery connected to the coil can be charged, transmitted, or used directly on the spot.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2019217470A JP2021075254A (en) | 2019-11-11 | 2019-11-11 | Reduction in living cost and the like |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2019217470A JP2021075254A (en) | 2019-11-11 | 2019-11-11 | Reduction in living cost and the like |
Publications (1)
Publication Number | Publication Date |
---|---|
JP2021075254A true JP2021075254A (en) | 2021-05-20 |
Family
ID=75899221
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2019217470A Pending JP2021075254A (en) | 2019-11-11 | 2019-11-11 | Reduction in living cost and the like |
Country Status (1)
Country | Link |
---|---|
JP (1) | JP2021075254A (en) |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2022254641A1 (en) * | 2021-06-02 | 2022-12-08 | 竜也 新谷 | Living cost reduction, etc. |
CN116976569A (en) * | 2023-09-25 | 2023-10-31 | 丰电科技集团股份有限公司 | Compressed air energy supply data management method, electronic device and storage medium |
-
2019
- 2019-11-11 JP JP2019217470A patent/JP2021075254A/en active Pending
Cited By (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2022254641A1 (en) * | 2021-06-02 | 2022-12-08 | 竜也 新谷 | Living cost reduction, etc. |
CN116976569A (en) * | 2023-09-25 | 2023-10-31 | 丰电科技集团股份有限公司 | Compressed air energy supply data management method, electronic device and storage medium |
CN116976569B (en) * | 2023-09-25 | 2024-01-02 | 丰电科技集团股份有限公司 | Compressed air energy supply data management method, electronic device and storage medium |
CN116976569B9 (en) * | 2023-09-25 | 2024-04-05 | 丰电科技集团股份有限公司 | Compressed air energy supply data management method, electronic device and storage medium |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US6237284B1 (en) | Method for recycling carbon dioxide for enhancing plant growth | |
CN104295448A (en) | All-weather clean energy comprehensive electricity generating and energy saving method and facility manufacturing method thereof | |
JP2010007047A (en) | Method of generating artificial rainmaking or the like | |
CN102027869A (en) | Method and equipment for carrying out air conditioning on natural environment by applying chimney type air guide tower | |
JP2021075254A (en) | Reduction in living cost and the like | |
CN113273399A (en) | Desert rice field with unmanned aerial vehicle connected with air pipe and rice box | |
JP2022106306A (en) | Method for reducing costs in life | |
JP2022095506A (en) | Lifestyle improvement, etc. | |
JP2022105241A (en) | Method for devising living environment | |
JP2021091093A (en) | Life cost reduction and the like | |
JP2021091092A (en) | Method for living efficient life | |
WO2022130669A1 (en) | Invention that brings advancements to daily life | |
JP2022106305A (en) | Reduction of costs etc. in life | |
JP2021030710A (en) | Reduction in cost of living | |
JP2021024264A (en) | Reduction in cost of living | |
JP2021020442A (en) | Reduction in cost of living | |
JP2022125947A (en) | Effective use method of space | |
JP2021014249A (en) | Living cost reduction or the like | |
JP2022102987A (en) | Invention for making life convenient | |
JP2022100174A (en) | Invention for making life convenient | |
JP2022102988A (en) | Invention for making life convenient | |
JP2021011099A (en) | Reduction in cost of living | |
WO2022254641A1 (en) | Living cost reduction, etc. | |
JP2021085651A (en) | Living cost reduction and the like | |
JP2021008099A (en) | Reduction in cost of living |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20200326 |
|
A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20240116 |
|
A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20240318 |