IT996392B - Apparecchio di combustione per una turbina a gas - Google Patents
Apparecchio di combustione per una turbina a gasInfo
- Publication number
- IT996392B IT996392B IT53532/73A IT5353273A IT996392B IT 996392 B IT996392 B IT 996392B IT 53532/73 A IT53532/73 A IT 53532/73A IT 5353273 A IT5353273 A IT 5353273A IT 996392 B IT996392 B IT 996392B
- Authority
- IT
- Italy
- Prior art keywords
- gas turbine
- combustion apparatus
- combustion
- turbine
- gas
- Prior art date
Links
- 238000002485 combustion reaction Methods 0.000 title 1
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23R—GENERATING COMBUSTION PRODUCTS OF HIGH PRESSURE OR HIGH VELOCITY, e.g. GAS-TURBINE COMBUSTION CHAMBERS
- F23R3/00—Continuous combustion chambers using liquid or gaseous fuel
- F23R3/02—Continuous combustion chambers using liquid or gaseous fuel characterised by the air-flow or gas-flow configuration
- F23R3/04—Air inlet arrangements
- F23R3/10—Air inlet arrangements for primary air
- F23R3/12—Air inlet arrangements for primary air inducing a vortex
- F23R3/14—Air inlet arrangements for primary air inducing a vortex by using swirl vanes
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Spray-Type Burners (AREA)
- Pressure-Spray And Ultrasonic-Wave- Spray Burners (AREA)
- Combustion Of Fluid Fuel (AREA)
- Air Supply (AREA)
- Pre-Mixing And Non-Premixing Gas Burner (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11161972A JPS5342897B2 (enExample) | 1972-11-09 | 1972-11-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT996392B true IT996392B (it) | 1975-12-10 |
Family
ID=14565900
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT53532/73A IT996392B (it) | 1972-11-09 | 1973-11-06 | Apparecchio di combustione per una turbina a gas |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3886736A (enExample) |
| JP (1) | JPS5342897B2 (enExample) |
| CA (1) | CA985514A (enExample) |
| CH (1) | CH560356A5 (enExample) |
| DE (1) | DE2355127C2 (enExample) |
| FR (1) | FR2206441B1 (enExample) |
| GB (1) | GB1450190A (enExample) |
| IT (1) | IT996392B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4105163A (en) * | 1976-10-27 | 1978-08-08 | General Electric Company | Fuel nozzle for gas turbines |
| JPS5412607U (enExample) * | 1977-06-29 | 1979-01-26 | ||
| DE3026832A1 (de) * | 1980-07-16 | 1982-02-11 | Klöckner-Humboldt-Deutz AG, 5000 Köln | Zerstaeuberduese fuer kontinuierliche brennstoffeinspritzung |
| US4395874A (en) * | 1980-12-02 | 1983-08-02 | United Technologies Corporation | Fuel nozzles with water injection for gas turbine engines |
| DE3147564A1 (de) * | 1980-12-02 | 1982-08-19 | United Technologies Corp., 06101 Hartford, Conn. | Doppelmuendungsbrennstoffduese |
| CA1259197A (en) * | 1985-02-13 | 1989-09-12 | Alan D. Bennett | High reliability fuel oil nozzle for a gas turbine |
| US4996837A (en) * | 1987-12-28 | 1991-03-05 | Sundstrand Corporation | Gas turbine with forced vortex fuel injection |
| US5040371A (en) * | 1988-12-12 | 1991-08-20 | Sundstrand Corporation | Fuel injectors for use with combustors |
| US5115634A (en) * | 1990-03-13 | 1992-05-26 | Delavan Inc. | Simplex airblade fuel injection method |
| US5224333A (en) * | 1990-03-13 | 1993-07-06 | Delavan Inc | Simplex airblast fuel injection |
| US5309709A (en) * | 1992-06-25 | 1994-05-10 | Solar Turbines Incorporated | Low emission combustion system for a gas turbine engine |
| US5288021A (en) * | 1992-08-03 | 1994-02-22 | Solar Turbines Incorporated | Injection nozzle tip cooling |
| US5467926A (en) * | 1994-02-10 | 1995-11-21 | Solar Turbines Incorporated | Injector having low tip temperature |
| US5813232A (en) * | 1995-06-05 | 1998-09-29 | Allison Engine Company, Inc. | Dry low emission combustor for gas turbine engines |
| US5873237A (en) * | 1997-01-24 | 1999-02-23 | Westinghouse Electric Corporation | Atomizing dual fuel nozzle for a combustion turbine |
| US6082113A (en) * | 1998-05-22 | 2000-07-04 | Pratt & Whitney Canada Corp. | Gas turbine fuel injector |
| US6289676B1 (en) | 1998-06-26 | 2001-09-18 | Pratt & Whitney Canada Corp. | Simplex and duplex injector having primary and secondary annular lud channels and primary and secondary lud nozzles |
| US6533954B2 (en) * | 2000-02-28 | 2003-03-18 | Parker-Hannifin Corporation | Integrated fluid injection air mixing system |
| US6550696B2 (en) | 2000-02-28 | 2003-04-22 | Adel B. Mansour | Integrated fuel injection and mixing system with impingement cooling face |
| US7117678B2 (en) * | 2004-04-02 | 2006-10-10 | Pratt & Whitney Canada Corp. | Fuel injector head |
| US8146365B2 (en) * | 2007-06-14 | 2012-04-03 | Pratt & Whitney Canada Corp. | Fuel nozzle providing shaped fuel spray |
| DE102008026459A1 (de) * | 2008-06-03 | 2009-12-10 | E.On Ruhrgas Ag | Brenner, insbesondere für eine Verbrennungseinrichtung in einer Gasturbinenanlage |
| US8505304B2 (en) * | 2008-12-01 | 2013-08-13 | General Electric Company | Fuel nozzle detachable burner tube with baffle plate assembly |
| US8893500B2 (en) | 2011-05-18 | 2014-11-25 | Solar Turbines Inc. | Lean direct fuel injector |
| US8919132B2 (en) | 2011-05-18 | 2014-12-30 | Solar Turbines Inc. | Method of operating a gas turbine engine |
| US9182124B2 (en) | 2011-12-15 | 2015-11-10 | Solar Turbines Incorporated | Gas turbine and fuel injector for the same |
| KR101371291B1 (ko) * | 2012-05-04 | 2014-03-07 | 고등기술연구원연구조합 | 비 용융 및 부분 용융형 분류층 가스화기 |
| US10619855B2 (en) * | 2012-09-06 | 2020-04-14 | United Technologies Corporation | Fuel delivery system with a cavity coupled fuel injector |
| US9284933B2 (en) * | 2013-03-01 | 2016-03-15 | Delavan Inc | Fuel nozzle with discrete jet inner air swirler |
| US11421883B2 (en) | 2020-09-11 | 2022-08-23 | Raytheon Technologies Corporation | Fuel injector assembly with a helical swirler passage for a turbine engine |
| US11754287B2 (en) | 2020-09-11 | 2023-09-12 | Raytheon Technologies Corporation | Fuel injector assembly for a turbine engine |
| US11649964B2 (en) | 2020-12-01 | 2023-05-16 | Raytheon Technologies Corporation | Fuel injector assembly for a turbine engine |
| US11808455B2 (en) | 2021-11-24 | 2023-11-07 | Rtx Corporation | Gas turbine engine combustor with integral fuel conduit(s) |
| US11846249B1 (en) | 2022-09-02 | 2023-12-19 | Rtx Corporation | Gas turbine engine with integral bypass duct |
| US12116934B2 (en) | 2023-02-10 | 2024-10-15 | Rtx Corporation | Turbine engine fuel injector with oxygen circuit |
| US12535214B2 (en) | 2024-04-19 | 2026-01-27 | Rtx Corporation | Attaching powerplant structures together using fuel injector bolts |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2305265A (en) * | 1942-05-01 | 1942-12-15 | Letourneau Inc | Sealing boot assembly |
| US2968925A (en) * | 1959-11-25 | 1961-01-24 | William E Blevans | Fuel nozzle head for anti-coking |
| DE1625948A1 (de) * | 1967-12-23 | 1970-12-03 | Bizerba Werke Kraut Kg Wilh | Daempfer fuer ein in einem Gehaeuse pulsierendes Steuerorgan |
| US3498055A (en) * | 1968-10-16 | 1970-03-03 | United Aircraft Corp | Smoke reduction combustion chamber |
| AT308474B (de) * | 1969-03-20 | 1973-07-10 | List Hans | Körperschallhemmender Verschalungsbauteil zur schallisolierenden Verkleidung von Maschinen, insbesondere Brennkraftmaschinen |
| US3684186A (en) * | 1970-06-26 | 1972-08-15 | Ex Cell O Corp | Aerating fuel nozzle |
| JPS4931059Y1 (enExample) * | 1970-11-30 | 1974-08-22 | ||
| DE2160675C3 (de) * | 1970-12-15 | 1978-04-20 | Mitsubishi Jukogyo K.K., Tokio | Brennereinrichtung für eine Gasturbinenbrennkammer |
| US3700173A (en) * | 1970-12-30 | 1972-10-24 | Combustion Eng | Diffuser |
| AT328229B (de) * | 1971-09-03 | 1976-03-10 | List Hans | Brennkraftmaschine mit schalldammender verschalung |
| US3777983A (en) * | 1971-12-16 | 1973-12-11 | Gen Electric | Gas cooled dual fuel air atomized fuel nozzle |
| US3733169A (en) * | 1972-02-22 | 1973-05-15 | D Lefebvre | Flame retention head assembly |
-
1972
- 1972-11-09 JP JP11161972A patent/JPS5342897B2/ja not_active Expired
-
1973
- 1973-10-31 US US411497A patent/US3886736A/en not_active Expired - Lifetime
- 1973-11-01 DE DE2355127A patent/DE2355127C2/de not_active Expired
- 1973-11-01 GB GB5085673A patent/GB1450190A/en not_active Expired
- 1973-11-02 CH CH1548273A patent/CH560356A5/xx not_active IP Right Cessation
- 1973-11-06 IT IT53532/73A patent/IT996392B/it active
- 1973-11-08 CA CA185,381A patent/CA985514A/en not_active Expired
- 1973-11-09 FR FR7340018A patent/FR2206441B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2206441B1 (enExample) | 1976-06-25 |
| FR2206441A1 (enExample) | 1974-06-07 |
| US3886736A (en) | 1975-06-03 |
| CA985514A (en) | 1976-03-16 |
| JPS4968929A (enExample) | 1974-07-04 |
| JPS5342897B2 (enExample) | 1978-11-15 |
| CH560356A5 (enExample) | 1975-03-27 |
| DE2355127C2 (de) | 1983-11-03 |
| GB1450190A (en) | 1976-09-22 |
| DE2355127A1 (de) | 1974-05-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT996392B (it) | Apparecchio di combustione per una turbina a gas | |
| IT997686B (it) | Motore a turbina a gas | |
| IT977988B (it) | Turbina a gas | |
| IT998522B (it) | Apparato di combustione per motori a turbina a gas | |
| SU520028A3 (ru) | Твердое газогенерирующее топливо | |
| IT999255B (it) | Turbina a gas | |
| BE802514A (fr) | Compositions engendrant un gaz | |
| IT989904B (it) | Metodo per deolforare un gas di scarico | |
| IT978244B (it) | Paletta mobile raffreddata per turbine a gas | |
| IT1000742B (it) | Impianto di turbina a gas | |
| IT994411B (it) | Laser a gas | |
| SE391222B (sv) | Regleringsanordning for en gasturbinmotor | |
| IT977029B (it) | Lasep a gas | |
| IT973079B (it) | Carcassa di turbina per un motore a turbina a gas | |
| IT993256B (it) | Apparato accenditore per turbomoto re a gas | |
| IT987189B (it) | Impianto di regolazione del com bustibile per una turbina a gas policarburante | |
| SE389230B (sv) | Gaslaser | |
| IT1021037B (it) | Generatore laser a gas | |
| BE798439A (fr) | Generateur laser a flux gazeux | |
| IT1009685B (it) | Dispositivo laser a gas | |
| BE796842R (fr) | Laser a gaz | |
| IT977086B (it) | Dispositivo di alimentazione di combustibile per turbine a gas | |
| IT976787B (it) | Turbina a gas | |
| AR199933A1 (es) | Encendedor a gas | |
| IT1002533B (it) | Dispositivo di alimentazione di combustibile per un motore a turbina a gas |