IT983653B - Braccio portante e di guida del nastro per contenitori di imma gazzinaggio di nastro per macchi ne da scrivere e similari - Google Patents
Braccio portante e di guida del nastro per contenitori di imma gazzinaggio di nastro per macchi ne da scrivere e similariInfo
- Publication number
- IT983653B IT983653B IT22570/73A IT2257073A IT983653B IT 983653 B IT983653 B IT 983653B IT 22570/73 A IT22570/73 A IT 22570/73A IT 2257073 A IT2257073 A IT 2257073A IT 983653 B IT983653 B IT 983653B
- Authority
- IT
- Italy
- Prior art keywords
- belt
- gazzinaggio
- imma
- containers
- writing
- Prior art date
Links
- BJSDNVVWJYDOLK-UHFFFAOYSA-N 2-[1-[(4-chlorophenyl)-oxomethyl]-5-methoxy-2-methyl-3-indolyl]-1-(4-morpholinyl)ethanone Chemical compound CC1=C(CC(=O)N2CCOCC2)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 BJSDNVVWJYDOLK-UHFFFAOYSA-N 0.000 title 1
- 241001580033 Imma Species 0.000 title 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41J—TYPEWRITERS; SELECTIVE PRINTING MECHANISMS, i.e. MECHANISMS PRINTING OTHERWISE THAN FROM A FORME; CORRECTION OF TYPOGRAPHICAL ERRORS
- B41J35/00—Other apparatus or arrangements associated with, or incorporated in, ink-ribbon mechanisms
- B41J35/04—Ink-ribbon guides
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24995472A | 1972-05-03 | 1972-05-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT983653B true IT983653B (it) | 1974-11-11 |
Family
ID=22945715
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT22570/73A IT983653B (it) | 1972-05-03 | 1973-04-04 | Braccio portante e di guida del nastro per contenitori di imma gazzinaggio di nastro per macchi ne da scrivere e similari |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3777871A (enExample) |
| JP (1) | JPS5228050B2 (enExample) |
| CA (1) | CA981617A (enExample) |
| DE (2) | DE2366192C2 (enExample) |
| FR (1) | FR2183491A5 (enExample) |
| GB (1) | GB1375356A (enExample) |
| IT (1) | IT983653B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2239116C3 (de) * | 1972-08-09 | 1979-04-19 | Triumph Werke Nuernberg Ag, 8500 Nuernberg | Farbbandhub- und Transportvorrichtung für Schreib- und ähnliche Büromaschinen |
| US3897866A (en) * | 1973-11-12 | 1975-08-05 | Scm Corp | Vertically insertable typewriter ribbon cartridge |
| US3897867A (en) * | 1973-11-12 | 1975-08-05 | Scm Corp | Ribbon feed mechanism for ink ribbon cartridges |
| US3994383A (en) * | 1975-02-05 | 1976-11-30 | Ncr Corporation | Stuffed ribbon cartridge |
| USRE31117E (en) * | 1976-10-12 | 1983-01-04 | Ncr Corporation | Ribbon cassette with bi-color capability |
| IT1097931B (it) * | 1978-08-03 | 1985-08-31 | Antolini Camillo | Cartuccia estraibile per nastro inchiostrato per macchine da scrivere e macchina relativa |
| US4243330A (en) * | 1979-01-15 | 1981-01-06 | Burroughs Corporation | Dot printer adjustable endless loop ribbon cartridge transport apparatus |
| IT1128031B (it) * | 1980-02-08 | 1986-05-28 | Olivetti Ing C Spa | Cartuccia per un nastro correttore di macchina per scrivere |
| US4350452A (en) * | 1980-03-31 | 1982-09-21 | International Business Machines Corporation | Ribbon loading system for a typewriter or the like using a sidemounted ribbon cartridge having a detachable ribbon guide |
| US7563838B2 (en) * | 2002-07-31 | 2009-07-21 | The Procter & Gamble Company | Phase change solvents for thermoplastic polymers |
| US7468411B2 (en) * | 2002-07-31 | 2008-12-23 | The Procter & Gamble Company | Thermoplastic elastomer compositions containing a phase change solvent and selected processing oils |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US623502A (en) * | 1899-04-18 | Type-writer | ||
| US809378A (en) * | 1905-04-17 | 1906-01-09 | William W Kay | Fare-register. |
| US2464042A (en) * | 1946-05-15 | 1949-03-08 | Claude E Inskeep | Ink ribbon carrier |
| US2883029A (en) * | 1957-02-25 | 1959-04-21 | Alessandra Gray | Typewriter ribbon attachment |
| US2869705A (en) * | 1957-07-05 | 1959-01-20 | Jr Eugene H Gates | Outboard ribbon supply apparatus for typewriters |
| US3590221A (en) * | 1967-05-15 | 1971-06-29 | Burroughs Corp | Tape-handling apparatus |
| US3643777A (en) * | 1970-07-23 | 1972-02-22 | Scm Corp | Typewriter ribbon cartridge |
| US3643778A (en) * | 1970-09-25 | 1972-02-22 | Scm Corp | Typewriter ribbon cartridge guide support |
| US3643779A (en) * | 1970-12-14 | 1972-02-22 | Scm Corp | Ribbon mechanism for cartridge supported ribbons |
-
1972
- 1972-05-03 US US00249954A patent/US3777871A/en not_active Expired - Lifetime
-
1973
- 1973-04-04 IT IT22570/73A patent/IT983653B/it active
- 1973-04-09 CA CA168,226A patent/CA981617A/en not_active Expired
- 1973-04-28 DE DE2366192A patent/DE2366192C2/de not_active Expired
- 1973-04-28 DE DE2321652A patent/DE2321652C3/de not_active Expired
- 1973-05-02 JP JP48049609A patent/JPS5228050B2/ja not_active Expired
- 1973-05-02 FR FR7315652A patent/FR2183491A5/fr not_active Expired
- 1973-05-03 GB GB2111273A patent/GB1375356A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3777871A (en) | 1973-12-11 |
| GB1375356A (enExample) | 1974-11-27 |
| DE2366192B1 (de) | 1980-04-24 |
| DE2321652A1 (de) | 1973-11-15 |
| CA981617A (en) | 1976-01-13 |
| DE2321652B2 (de) | 1979-03-01 |
| JPS5228050B2 (enExample) | 1977-07-23 |
| FR2183491A5 (enExample) | 1973-12-14 |
| DE2366192C2 (de) | 1980-12-18 |
| DE2321652C3 (de) | 1979-12-13 |
| JPS4955413A (enExample) | 1974-05-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE797047A (fr) | Porte-articles | |
| BE798606A (fr) | Porte-articles | |
| IT985718B (it) | Struttura per contenitore | |
| IT967080B (it) | Dispositivo di inversione automa tica del movimento longitudinale del nastro inchiostrato in macchi ne da scrivere e similari | |
| SE384778B (sv) | Potatisupptagningsmaskin | |
| IT983653B (it) | Braccio portante e di guida del nastro per contenitori di imma gazzinaggio di nastro per macchi ne da scrivere e similari | |
| SE399223B (sv) | Lastningsarm for vetskor | |
| SE392600B (sv) | Flaskhallare | |
| IT972861B (it) | Portacontenitori | |
| CH552365A (it) | Braccio laterale con tavoletta scrittoio per sedie. | |
| SE399230B (sv) | Stodforpackning for flata artiklar | |
| IT973214B (it) | Portabottiglie | |
| BE790988A (fr) | Porte-articles | |
| IT978540B (it) | Macchina snocciolatrice | |
| IT972856B (it) | Portacontenitori | |
| IT974181B (it) | Macchina di prova di durezza | |
| SE383292B (sv) | Skrivapparat | |
| IT988877B (it) | Apparecchio trasportatore | |
| IT949861B (it) | Dispositivo di impostazione per macchine da scrivere o simili | |
| IT947233B (it) | Combinazione di valigetta di tra sporto e custodia per macchina da cucire | |
| SU471480A2 (ru) | Опора дл качательного движени | |
| CH543791A (de) | Werbetafelhalteeinrichtung | |
| NL7106088A (nl) | Geleidingsorgaan voor continu papier | |
| ES168522Y (es) | Envase-bandeja portahuevos. | |
| ES174714Y (es) | Porta-medallas. |