IT1272879B - Composti dibenzoalchilenici - Google Patents
Composti dibenzoalchileniciInfo
- Publication number
- IT1272879B IT1272879B ITMI950031A ITMI950031A IT1272879B IT 1272879 B IT1272879 B IT 1272879B IT MI950031 A ITMI950031 A IT MI950031A IT MI950031 A ITMI950031 A IT MI950031A IT 1272879 B IT1272879 B IT 1272879B
- Authority
- IT
- Italy
- Prior art keywords
- alkyl
- substituted
- phenyl
- represent hydrogen
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 239000001257 hydrogen Substances 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 208000001132 Osteoporosis Diseases 0.000 abstract 1
- 125000003282 alkyl amino group Chemical group 0.000 abstract 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 abstract 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- -1 carbalkoxy Chemical group 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 1
- 125000003884 phenylalkyl group Chemical group 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000012453 solvate Substances 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ITMI950031A IT1272879B (it) | 1995-01-10 | 1995-01-10 | Composti dibenzoalchilenici |
| PCT/EP1996/000158 WO1996021638A1 (en) | 1995-01-10 | 1996-01-08 | Novel compounds |
| EP96901276A EP0802897A1 (en) | 1995-01-10 | 1996-01-08 | Novel compounds |
| JP8521451A JPH10512553A (ja) | 1995-01-10 | 1996-01-08 | 新規な化合物 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ITMI950031A IT1272879B (it) | 1995-01-10 | 1995-01-10 | Composti dibenzoalchilenici |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| ITMI950031A0 ITMI950031A0 (it) | 1995-01-10 |
| ITMI950031A1 ITMI950031A1 (it) | 1996-07-10 |
| IT1272879B true IT1272879B (it) | 1997-07-01 |
Family
ID=11370167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ITMI950031A IT1272879B (it) | 1995-01-10 | 1995-01-10 | Composti dibenzoalchilenici |
Country Status (1)
| Country | Link |
|---|---|
| IT (1) | IT1272879B (it) |
-
1995
- 1995-01-10 IT ITMI950031A patent/IT1272879B/it active IP Right Grant
Also Published As
| Publication number | Publication date |
|---|---|
| ITMI950031A1 (it) | 1996-07-10 |
| ITMI950031A0 (it) | 1995-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL318297A1 (en) | Dihydrobenzofuranes | |
| RS20050117A (en) | Novel benzonaphthyridines | |
| EA199900620A1 (ru) | Фталазиноны | |
| EP0938317A4 (en) | COMPOSITIONS AND METHODS FOR REDUCING RESPIRATORY DEPRESSION | |
| DK0766696T3 (da) | Thiazolidinderivater, fremstilling af disse forbindelser og lægemidler indeholdende disse forbindelser | |
| GR3007143T3 (it) | ||
| DE69626981D1 (de) | N-(2-oxo-2,3,4,5-tetrahydro-1h-1,5-benzodiazepin-3-yl)-3-amide | |
| PL341239A1 (en) | Dihydrobenzofuranes | |
| MX9709398A (es) | N-aril-1,2,4-triazolin-5-onas. | |
| GR3034602T3 (en) | Novel n-(2,4-dioxo-2,3,4,5-tetrahydro-1h-1,5-benzodiazepin-3y l)-3-amides | |
| SI1377574T1 (it) | ||
| DK0888379T3 (da) | Forbindelser tilhørende amidinium-familien, farmaceutiske præparater indeholdende disse forbindelser og anvendelsen deraf | |
| GR3024191T3 (en) | Fluoro-compounds and their use as aromatase inhibitors | |
| HK1041264A1 (en) | Imidazole compounds and their use as adenosine deaminase inhibitors | |
| EP0842156A4 (en) | N- (2,4-DIOXO-2,3,4,5-TETRAHYDRO-1H-1,5-BENZODIAZEPIN-3-YL) -3-AMIDE | |
| PL311279A1 (en) | Herbicidal substituted 1-phenyl or 1-pyridinyl benzotriazoles | |
| IT1272879B (it) | Composti dibenzoalchilenici | |
| MX9701569A (es) | Pirimidin(tio)onas substituidas. | |
| ES2156212T3 (es) | Derivados de azabicicloheptano n-substituidos como neurolepticos, etc. | |
| IT1272881B (it) | Composti arilalchilenici | |
| TWI263639B (en) | Novel tetrazole derivative | |
| IT1272880B (it) | Composti arilalchilenici | |
| PL373989A1 (en) | Novel benzonaphthyridines | |
| ES2097319T3 (es) | Derivados de isoxazol como agentes protectores de la luz. | |
| MX9800774A (es) | Uso de n-(pirrol-1-il)piridinaminas no sustituidas y sustituidas como agentes anticonvulsivos. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 0001 | Granted |