IT1091215B - Lampadina nana - Google Patents
Lampadina nanaInfo
- Publication number
- IT1091215B IT1091215B IT6972977A IT6972977A IT1091215B IT 1091215 B IT1091215 B IT 1091215B IT 6972977 A IT6972977 A IT 6972977A IT 6972977 A IT6972977 A IT 6972977A IT 1091215 B IT1091215 B IT 1091215B
- Authority
- IT
- Italy
- Prior art keywords
- nana
- bulb
- nana bulb
- Prior art date
Links
- SQVRNKJHWKZAKO-PFQGKNLYSA-N N-acetyl-beta-neuraminic acid Chemical compound CC(=O)N[C@@H]1[C@@H](O)C[C@@](O)(C(O)=O)O[C@H]1[C@H](O)[C@H](O)CO SQVRNKJHWKZAKO-PFQGKNLYSA-N 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/42—Means forming part of the lamp for the purpose of providing electrical connection, or support for, the lamp
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19767638137 DE7638137U1 (de) | 1976-12-06 | 1976-12-06 | Zwerggluehlampe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT1091215B true IT1091215B (it) | 1985-07-06 |
Family
ID=6671923
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT6972977A IT1091215B (it) | 1976-12-06 | 1977-12-05 | Lampadina nana |
Country Status (4)
| Country | Link |
|---|---|
| DE (1) | DE7638137U1 (enrdf_load_html_response) |
| FR (1) | FR2373158A1 (enrdf_load_html_response) |
| GB (1) | GB1538839A (enrdf_load_html_response) |
| IT (1) | IT1091215B (enrdf_load_html_response) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2019200936A (ja) * | 2018-05-17 | 2019-11-21 | スタンレー電気株式会社 | 白熱電球 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3256507A (en) * | 1964-05-01 | 1966-06-14 | Gen Electric | Base end structure for electric lamps or similar devices |
| US3979627A (en) * | 1975-04-28 | 1976-09-07 | Gte Sylvania Incorporated | Electric lamp with insulating base |
-
1976
- 1976-12-06 DE DE19767638137 patent/DE7638137U1/de not_active Expired
-
1977
- 1977-11-29 GB GB4957277A patent/GB1538839A/en not_active Expired
- 1977-12-05 FR FR7736532A patent/FR2373158A1/fr active Granted
- 1977-12-05 IT IT6972977A patent/IT1091215B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| DE7638137U1 (de) | 1977-12-15 |
| FR2373158A1 (fr) | 1978-06-30 |
| FR2373158B1 (enrdf_load_html_response) | 1981-04-30 |
| GB1538839A (en) | 1979-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7803235L (sv) | Glodlampa | |
| FI773000A7 (fi) | Givare | |
| PL202248A1 (pl) | Oprawa oswietleniowa | |
| BR7704722A (pt) | Conjunto de lampada | |
| AT351727B (de) | Glasbauelement | |
| SE425619B (sv) | Ljusledande element | |
| PT66442A (pt) | Basisch substituierte xanthinderivate | |
| BE852003R (fr) | Anker | |
| AT350660B (de) | Beleuchtungskoerper | |
| AT353351B (de) | Leuchte | |
| SE7702249L (sv) | Blixtljuslampa | |
| IT1091215B (it) | Lampadina nana | |
| SE7611908L (sv) | Lyskropp | |
| ATA668676A (de) | Beleuchtungseinrichtung | |
| DD131059A5 (de) | Kardiodid-schallstrahler | |
| AT346102B (de) | Pankratisches objektiv | |
| IT1089650B (it) | Portalampadina | |
| DK39377A (da) | Belysningsarmatur | |
| AT354136B (de) | Beleuchtungseinrichtung | |
| DK527676A (da) | Lampeholder | |
| ATA785476A (de) | Kerze | |
| BR7603848A (pt) | Acendedor piezoeletrico | |
| AR206577A1 (es) | Portalamparas mejorado | |
| PL194834A1 (pl) | Szyba zespolona | |
| BR5600906U (pt) | Luminoso |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| TA | Fee payment date (situation as of event date), data collected since 19931001 |
Effective date: 19961220 |