IL49717A - 7-( -amino- -(3,4-methylenedioxyphenyl)-acylamido)cephalosporanic acid derivatives - Google Patents
7-( -amino- -(3,4-methylenedioxyphenyl)-acylamido)cephalosporanic acid derivativesInfo
- Publication number
- IL49717A IL49717A IL49717A IL4971776A IL49717A IL 49717 A IL49717 A IL 49717A IL 49717 A IL49717 A IL 49717A IL 4971776 A IL4971776 A IL 4971776A IL 49717 A IL49717 A IL 49717A
- Authority
- IL
- Israel
- Prior art keywords
- acylamido
- methylenedioxyphenyl
- amino
- acid derivatives
- cephalosporanic acid
- Prior art date
Links
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/598,152 US4020060A (en) | 1975-07-22 | 1975-07-22 | 7-[α-Amino-ω-(3,4-methylenedioxyphenyl)acylamido]cephalosporanic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL49717A0 IL49717A0 (en) | 1976-08-31 |
| IL49717A true IL49717A (en) | 1979-10-31 |
Family
ID=24394448
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL49717A IL49717A (en) | 1975-07-22 | 1976-06-03 | 7-( -amino- -(3,4-methylenedioxyphenyl)-acylamido)cephalosporanic acid derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4020060A (OSRAM) |
| JP (1) | JPS5214794A (OSRAM) |
| BE (1) | BE844402A (OSRAM) |
| CA (1) | CA1054144A (OSRAM) |
| CH (1) | CH625529A5 (OSRAM) |
| DE (1) | DE2632006A1 (OSRAM) |
| DK (1) | DK296576A (OSRAM) |
| ES (1) | ES449688A1 (OSRAM) |
| FR (1) | FR2318641A1 (OSRAM) |
| IE (1) | IE43376B1 (OSRAM) |
| IL (1) | IL49717A (OSRAM) |
| NL (1) | NL7607100A (OSRAM) |
| NO (1) | NO762545L (OSRAM) |
| SE (1) | SE7608160L (OSRAM) |
| ZA (1) | ZA763248B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS496254A (OSRAM) * | 1972-04-13 | 1974-01-19 | ||
| US4229575A (en) * | 1978-02-27 | 1980-10-21 | Richardson-Merrell Inc. | 7-(2,3-Dihydrobenzo-5-furanyl)-acetamido cephalosporin derivatives |
| US4219648A (en) * | 1978-03-06 | 1980-08-26 | Richardson-Merrell Inc. | 7-[[Amino(1,3-dihydrobenzo[c]thienyl)acetyl]amino]cephalosporin derivatives |
| US4228303A (en) * | 1979-06-25 | 1980-10-14 | Morton-Norwich Products, Inc. | 3-(3,4-Dihydroxyphenyl)-N-(4-nitrobenzyl)alanine hydrobromide |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3489750A (en) * | 1967-09-05 | 1970-01-13 | Bristol Myers Co | 7-amino-cephalosporanic and decephalosporanic acid derivatives |
| US3814754A (en) * | 1969-03-10 | 1974-06-04 | Lilly Co Eli | Cleavage of 7-acylamino cephalosporins |
| US3531481A (en) * | 1969-04-21 | 1970-09-29 | Lilly Co Eli | Method for manufacture of crystalline cephalosporin |
| US3673183A (en) * | 1969-11-17 | 1972-06-27 | Squibb & Sons Inc | {60 -ureidocephalosporanic acid compounds |
| US3757014A (en) * | 1971-05-07 | 1973-09-04 | Bristol Myers Co | Ts 1,3,4 - oxadiazol-2-yl)thiomethyl)-3-cephem-4-carboxylic acid and sal7-(d-(alpha-amino-alpha-pheyle-acetamido)) - 3-(s-(5-hydroxymethyl - |
| US3850916A (en) * | 1971-07-29 | 1974-11-26 | Bristol Myers Co | 7-amino-3-(s-(1,2,3-triazole-5-yl)-thiomethyl)-3-cephem-4-carboxylic acid and salts thereof |
| US3796801A (en) * | 1971-11-04 | 1974-03-12 | Smithkline Corp | Method of combating enterobacter infections |
| BE793191A (fr) * | 1971-12-28 | 1973-06-22 | Toyama Chemical Co Ltd | Procede pour produire des acides 7-acylamido-3-cephem-4- carboxyliques |
| US3821198A (en) * | 1972-05-03 | 1974-06-28 | Squibb & Sons Inc | Derivatives of 6-amino penicillanic acid |
| US3884914A (en) * | 1973-07-05 | 1975-05-20 | Smithkline Corp | Mandelamidocephalosporins with improved properties |
-
1975
- 1975-07-22 US US05/598,152 patent/US4020060A/en not_active Expired - Lifetime
-
1976
- 1976-06-02 ZA ZA763248A patent/ZA763248B/xx unknown
- 1976-06-02 IE IE1177/76A patent/IE43376B1/en unknown
- 1976-06-03 IL IL49717A patent/IL49717A/xx unknown
- 1976-06-23 CA CA255,510A patent/CA1054144A/en not_active Expired
- 1976-06-29 NL NL7607100A patent/NL7607100A/xx not_active Application Discontinuation
- 1976-06-30 JP JP51076624A patent/JPS5214794A/ja active Pending
- 1976-07-01 DK DK296576A patent/DK296576A/da not_active Application Discontinuation
- 1976-07-08 ES ES449688A patent/ES449688A1/es not_active Expired
- 1976-07-12 CH CH891376A patent/CH625529A5/de not_active IP Right Cessation
- 1976-07-16 DE DE19762632006 patent/DE2632006A1/de not_active Withdrawn
- 1976-07-16 SE SE7608160A patent/SE7608160L/xx not_active Application Discontinuation
- 1976-07-20 FR FR7622150A patent/FR2318641A1/fr active Granted
- 1976-07-21 NO NO762545A patent/NO762545L/no unknown
- 1976-07-22 BE BE169140A patent/BE844402A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4020060A (en) | 1977-04-26 |
| AU1463176A (en) | 1977-12-08 |
| ZA763248B (en) | 1977-05-25 |
| IL49717A0 (en) | 1976-08-31 |
| NL7607100A (nl) | 1977-01-25 |
| DK296576A (da) | 1977-01-23 |
| IE43376L (en) | 1977-01-22 |
| ES449688A1 (es) | 1977-11-16 |
| JPS5214794A (en) | 1977-02-03 |
| FR2318641A1 (fr) | 1977-02-18 |
| IE43376B1 (en) | 1981-02-11 |
| FR2318641B1 (OSRAM) | 1979-09-21 |
| NO762545L (OSRAM) | 1977-01-25 |
| CH625529A5 (OSRAM) | 1981-09-30 |
| BE844402A (fr) | 1976-11-16 |
| CA1054144A (en) | 1979-05-08 |
| DE2632006A1 (de) | 1977-02-10 |
| SE7608160L (sv) | 1977-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA762285B (en) | New phenyl-alkane-carboxylic acid derivatives | |
| AU1934876A (en) | Hydroxybenzylmalonic acid derivatives | |
| AU505135B2 (en) | 2, 3-dihydrobenzofuran-2-carboxylic acid derivatives | |
| NZ182908A (en) | 2-tertiaryaminoindol-3-ylcarboxylic acid derivatives | |
| AU2241677A (en) | 4,5-dichloroimidazole-2-carboxylic acid derivatives | |
| SE7806711L (sv) | 7alfa-metoxi-7beta-(1,3-ditietan-2-karboxamido)-cefalosporansyraderivat | |
| MY8100161A (en) | Hydroxybenzylmalonic acid derivatives | |
| ZA766183B (en) | New phenoxyalkylcarboxylic acid derivatives | |
| ZA765531B (en) | New phenoxyalkylcarboxylic acid derivatives | |
| ZA774388B (en) | Novel phenoxy-phenoxy-alkanecarboxylic acid derivatives | |
| IL49717A (en) | 7-( -amino- -(3,4-methylenedioxyphenyl)-acylamido)cephalosporanic acid derivatives | |
| IL49718A (en) | 7-( -amino- -(2,3-methyenedioxy-phenyl)-acylamido)cephalosporanic acid derivatives | |
| IL49798A (en) | 6-( -amino - (3,4-methylenedioxy-phenyl)-acylamido) penicilanic acid derivatives | |
| IE43457L (en) | 1-deoxyribofuranuronic acid derivatives | |
| JPS5212177A (en) | Azanaphthaleneacetic acid derivatives | |
| GB1535373A (en) | Prostenoic acid derivatives | |
| KE3489A (en) | 7alpha-methoxy-7beta-(1,3-dithietane-2-carboxamido)cephalosporanic acid derivatives | |
| AU503922B2 (en) | 1, 3-benzodioxan-prostanoic acid derivatives | |
| AU1337876A (en) | Novel 8-azaprostanoic acid derivatives | |
| GB1523813A (en) | Diocamic acid derivatives | |
| GB1551409A (en) | 3,5-diphenylpyridazine derivatives | |
| IL49720A (en) | 6-( -amino- -(2,3-methylenedioxyphenyl)-acylamido)penicillanic acid derivatives | |
| AU491967B2 (en) | 6- [ -amino-w-(3,4-methylenedioxyphenyl) acylamido] - penicillanic acid derivatives | |
| ZA766641B (en) | New hydroxybenzylmalonic acid derivatives | |
| AU492122B2 (en) | 7-[-amino -w-(2,3-methylene-dioxyphenyl)-acylamido]cephalosporanic acid derivatives |