IL45936A - 7-(alpha-(3-guanyl-1-ureido)phenyl-acetamido)-3-cephem-4-carboxylic acid derivatives - Google Patents
7-(alpha-(3-guanyl-1-ureido)phenyl-acetamido)-3-cephem-4-carboxylic acid derivativesInfo
- Publication number
- IL45936A IL45936A IL45936A IL4593674A IL45936A IL 45936 A IL45936 A IL 45936A IL 45936 A IL45936 A IL 45936A IL 4593674 A IL4593674 A IL 4593674A IL 45936 A IL45936 A IL 45936A
- Authority
- IL
- Israel
- Prior art keywords
- cephem
- methyl
- guanyl
- ureido
- carboxylic acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- PMZBUASCJWNYKK-UHFFFAOYSA-N 1-amino-3-(diaminomethylidene)urea Chemical compound NNC(=O)N=C(N)N PMZBUASCJWNYKK-UHFFFAOYSA-N 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 230000003287 optical effect Effects 0.000 abstract 5
- 238000000605 extraction Methods 0.000 abstract 2
- 230000037431 insertion Effects 0.000 abstract 2
- 238000003780 insertion Methods 0.000 abstract 2
- 238000001000 micrograph Methods 0.000 abstract 1
- -1 cephalosporin compounds Chemical class 0.000 description 27
- 229930186147 Cephalosporin Natural products 0.000 description 24
- 229940124587 cephalosporin Drugs 0.000 description 24
- 150000001780 cephalosporins Chemical class 0.000 description 14
- 239000003242 anti bacterial agent Substances 0.000 description 13
- 229940088710 antibiotic agent Drugs 0.000 description 13
- 230000003115 biocidal effect Effects 0.000 description 13
- 150000002148 esters Chemical class 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 125000005042 acyloxymethyl group Chemical group 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 244000005700 microbiome Species 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical group S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241000589516 Pseudomonas Species 0.000 description 4
- 241000191940 Staphylococcus Species 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- ZZJNYZZMWBXNON-SSDOTTSWSA-N (6R)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O ZZJNYZZMWBXNON-SSDOTTSWSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 208000035473 Communicable disease Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HOBFSNNENNQQIU-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)C1=CC=CC=C1 HOBFSNNENNQQIU-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- NWWJFMCCTZLKNT-UHFFFAOYSA-N 3,4-dihydro-2h-thiazine Chemical group C1CC=CSN1 NWWJFMCCTZLKNT-UHFFFAOYSA-N 0.000 description 1
- 101100203566 Caenorhabditis elegans sod-3 gene Proteins 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 108010087702 Penicillinase Proteins 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 101100533820 Rattus norvegicus Sod3 gene Proteins 0.000 description 1
- 241000607726 Salmonella enterica subsp. enterica serovar Heidelberg Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000607758 Shigella sp. Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- ACBDNFPUXYGKPT-UHFFFAOYSA-N bromomethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCBr ACBDNFPUXYGKPT-UHFFFAOYSA-N 0.000 description 1
- ISLFGCNJHQHMFR-UHFFFAOYSA-N bromomethyl 2-phenylacetate Chemical compound BrCOC(=O)CC1=CC=CC=C1 ISLFGCNJHQHMFR-UHFFFAOYSA-N 0.000 description 1
- NHYXMAKLBXBVEO-UHFFFAOYSA-N bromomethyl acetate Chemical compound CC(=O)OCBr NHYXMAKLBXBVEO-UHFFFAOYSA-N 0.000 description 1
- YXASHNSJWVCWQQ-UHFFFAOYSA-N bromomethyl propanoate Chemical compound CCC(=O)OCBr YXASHNSJWVCWQQ-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 1
- 229950004030 cefaloglycin Drugs 0.000 description 1
- 229960003866 cefaloridine Drugs 0.000 description 1
- CZTQZXZIADLWOZ-CRAIPNDOSA-N cefaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 description 1
- 150000001782 cephems Chemical group 0.000 description 1
- 239000007806 chemical reaction intermediate Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- KFYXXCWHKINEIC-UHFFFAOYSA-N chloromethyl 2-phenylacetate Chemical compound ClCOC(=O)CC1=CC=CC=C1 KFYXXCWHKINEIC-UHFFFAOYSA-N 0.000 description 1
- BOXZXICVMMSYPE-UHFFFAOYSA-N chloromethyl benzoate Chemical compound ClCOC(=O)C1=CC=CC=C1 BOXZXICVMMSYPE-UHFFFAOYSA-N 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000010952 in-situ formation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 229950009506 penicillinase Drugs 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 150000005331 phenylglycines Chemical class 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Microscoopes, Condenser (AREA)
- Automatic Focus Adjustment (AREA)
- Focusing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42302773A | 1973-12-10 | 1973-12-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL45936A0 IL45936A0 (en) | 1974-12-31 |
| IL45936A true IL45936A (en) | 1977-11-30 |
Family
ID=23677403
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL45936A IL45936A (en) | 1973-12-10 | 1974-10-24 | 7-(alpha-(3-guanyl-1-ureido)phenyl-acetamido)-3-cephem-4-carboxylic acid derivatives |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS5088091A (cs) |
| AT (1) | AT333958B (cs) |
| BE (1) | BE823151A (cs) |
| BG (1) | BG26200A3 (cs) |
| CA (1) | CA1025437A (cs) |
| CH (1) | CH606003A5 (cs) |
| CS (1) | CS182823B2 (cs) |
| DD (1) | DD116834A5 (cs) |
| DE (1) | DE2457851A1 (cs) |
| DK (1) | DK638574A (cs) |
| ES (1) | ES432775A1 (cs) |
| FR (1) | FR2253524B1 (cs) |
| GB (1) | GB1487956A (cs) |
| HU (1) | HU171431B (cs) |
| IE (1) | IE40408B1 (cs) |
| IL (1) | IL45936A (cs) |
| NL (1) | NL7416088A (cs) |
| PH (1) | PH14462A (cs) |
| PL (1) | PL94410B1 (cs) |
| RO (1) | RO64569A (cs) |
| SE (1) | SE399266B (cs) |
| SU (1) | SU568371A3 (cs) |
| ZA (1) | ZA746743B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55160783A (en) * | 1979-06-01 | 1980-12-13 | Dai Ichi Seiyaku Co Ltd | Cephalosporin derivative |
-
1974
- 1974-10-22 IE IE2171/74A patent/IE40408B1/xx unknown
- 1974-10-23 ZA ZA00746743A patent/ZA746743B/xx unknown
- 1974-10-24 IL IL45936A patent/IL45936A/en unknown
- 1974-10-31 PH PH16473A patent/PH14462A/en unknown
- 1974-11-22 SE SE7414717A patent/SE399266B/xx unknown
- 1974-12-03 BG BG028349A patent/BG26200A3/xx unknown
- 1974-12-06 DE DE19742457851 patent/DE2457851A1/de not_active Withdrawn
- 1974-12-09 GB GB53053/74A patent/GB1487956A/en not_active Expired
- 1974-12-09 RO RO7480735A patent/RO64569A/ro unknown
- 1974-12-09 SU SU7402083839A patent/SU568371A3/ru active
- 1974-12-09 PL PL1974176286A patent/PL94410B1/pl unknown
- 1974-12-09 DK DK638574A patent/DK638574A/da unknown
- 1974-12-09 HU HU74EI00000582A patent/HU171431B/hu unknown
- 1974-12-09 CA CA215,678A patent/CA1025437A/en not_active Expired
- 1974-12-10 CS CS7400008421A patent/CS182823B2/cs unknown
- 1974-12-10 DD DD182895A patent/DD116834A5/xx unknown
- 1974-12-10 JP JP49142422A patent/JPS5088091A/ja active Pending
- 1974-12-10 CH CH1638674A patent/CH606003A5/xx not_active IP Right Cessation
- 1974-12-10 BE BE151327A patent/BE823151A/xx unknown
- 1974-12-10 FR FR7440548A patent/FR2253524B1/fr not_active Expired
- 1974-12-10 ES ES432775A patent/ES432775A1/es not_active Expired
- 1974-12-10 AT AT985474A patent/AT333958B/de not_active IP Right Cessation
- 1974-12-10 NL NL7416088A patent/NL7416088A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IL45936A0 (en) | 1974-12-31 |
| SU568371A3 (ru) | 1977-08-05 |
| ATA985474A (de) | 1976-04-15 |
| PL94410B1 (pl) | 1977-08-31 |
| IE40408B1 (en) | 1979-05-23 |
| JPS5088091A (cs) | 1975-07-15 |
| CH606003A5 (cs) | 1978-10-13 |
| ZA746743B (en) | 1976-05-26 |
| DE2457851A1 (de) | 1975-06-12 |
| SE399266B (sv) | 1978-02-06 |
| AT333958B (de) | 1976-12-27 |
| FR2253524B1 (cs) | 1978-07-28 |
| PH14462A (en) | 1981-07-29 |
| BG26200A3 (bg) | 1979-02-15 |
| CS182823B2 (en) | 1978-05-31 |
| GB1487956A (en) | 1977-10-05 |
| BE823151A (fr) | 1975-06-10 |
| FR2253524A1 (cs) | 1975-07-04 |
| ES432775A1 (es) | 1976-12-01 |
| HU171431B (hu) | 1978-01-28 |
| SE7414717L (cs) | 1975-06-11 |
| RO64569A (fr) | 1979-02-15 |
| DD116834A5 (cs) | 1975-12-12 |
| CA1025437A (en) | 1978-01-31 |
| IE40408L (en) | 1975-06-10 |
| DK638574A (cs) | 1975-08-18 |
| NL7416088A (nl) | 1975-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3828037A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| CA1039270A (en) | 3-thio-substituted cephalosporin antibiotics | |
| US3994885A (en) | Process for etherifying β-lactam antibiotics | |
| EP0197409A1 (en) | Cephalosporin derivatives | |
| US3865819A (en) | Substituted sulfonylacetamido cephalosporins | |
| US4175125A (en) | Method for treating methicillin resistant staphylococcus aureus | |
| US4131672A (en) | Method for treating methicillin resistant Staphylococcus aureus | |
| DK149282B (da) | Analogifremgangsmaade til fremstilling af et cephemderivat | |
| US3929779A (en) | Aminopyridinium acetyl cephalosporanes | |
| US4061748A (en) | 7-(α-(4-Hydroxy-1,5-naphthyridine-3-carbonamido)-α-phenylacetamido) cephalosporin derivatives | |
| US3956292A (en) | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS | |
| US4880798A (en) | Cephalosporin derivatives | |
| Takaya et al. | Studies on β-Lactam Antibiotics. III Synthesis and Enzymatic Stability of 3-Acyloxymethyl-7β-[(Z)-2-(2-Amino-4-Thiazolyl)-2-(Methoxyimino) Acetamido]-3-Cephem-4-Carboxylic Acids | |
| US4059578A (en) | 7-Substituted mercaptoacetamido cephamycins | |
| US4117126A (en) | 7-(α-(4-Hydroxy-1,5-naphthyridine-3-carbonamido)-α-phenylacetamido) cephalosporin derivatives | |
| US4104469A (en) | 7-(Syn-α-alkoxy-iminofuryl)acetamido-3-(2-methyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| US4103008A (en) | 7[2(2,3 Dioxopiperazin-1-yl-carbonylamino)substituted 2 phenylacetamido]-3-2'-thiadiazolyl cephalosporanic acid derivatives | |
| US4061861A (en) | 7-[α-(2,3-DIHYDRO-2-OXO-1H-benzimidazol-1-ylcarbonyl-amino)arylacetamido]cephalosporins | |
| US4044000A (en) | Substituted β-lactam antibiotics | |
| US3222362A (en) | Arylaminoalkyl cephalosporins | |
| IL45936A (en) | 7-(alpha-(3-guanyl-1-ureido)phenyl-acetamido)-3-cephem-4-carboxylic acid derivatives | |
| US4039535A (en) | 7-[α-(GUANYL-1-UREIDO)PHENYLACETAMIDO]-3-SUBSTITUTED CEPHALOSPORIN ANTIBIOTICS | |
| US3926984A (en) | 7-{8 2-(2-Thioxo-4-thiazolin-3-yl)-acetamido{9 {0 cephalosporanic acid derivatives | |
| US4056676A (en) | Halogenated phenylthioacetamido cephalosporins | |
| US4179502A (en) | 7[2-Hydroxyiminoacetamido]cephalosporins |