IL45476A - A mixture of chromium salts of elliptical carboxylic acids, stable solutions containing them and processes for their preparation - Google Patents
A mixture of chromium salts of elliptical carboxylic acids, stable solutions containing them and processes for their preparationInfo
- Publication number
- IL45476A IL45476A IL45476A IL4547674A IL45476A IL 45476 A IL45476 A IL 45476A IL 45476 A IL45476 A IL 45476A IL 4547674 A IL4547674 A IL 4547674A IL 45476 A IL45476 A IL 45476A
- Authority
- IL
- Israel
- Prior art keywords
- chromium
- acid
- process according
- mixture
- mol
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 73
- 150000001844 chromium Chemical class 0.000 title claims abstract description 44
- 238000000034 method Methods 0.000 title claims description 42
- 238000002360 preparation method Methods 0.000 title description 13
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 title description 2
- 229910052804 chromium Inorganic materials 0.000 claims abstract description 42
- 239000011651 chromium Substances 0.000 claims abstract description 42
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims abstract description 24
- 239000003960 organic solvent Substances 0.000 claims abstract description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- -1 aliphatic monocarboxylic acid Chemical class 0.000 claims abstract description 7
- 239000002253 acid Substances 0.000 claims description 57
- 239000000243 solution Substances 0.000 claims description 47
- 150000003839 salts Chemical class 0.000 claims description 32
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 25
- 125000001931 aliphatic group Chemical group 0.000 claims description 17
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 17
- 239000011707 mineral Substances 0.000 claims description 17
- 239000007864 aqueous solution Substances 0.000 claims description 13
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 claims description 9
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 claims description 9
- 235000015096 spirit Nutrition 0.000 claims description 9
- 239000003350 kerosene Substances 0.000 claims description 8
- 150000003863 ammonium salts Chemical class 0.000 claims description 7
- NPCUWXDZFXSRLT-UHFFFAOYSA-N chromium;2-ethylhexanoic acid Chemical compound [Cr].CCCCC(CC)C(O)=O NPCUWXDZFXSRLT-UHFFFAOYSA-N 0.000 claims description 5
- WOWYPHJOHOCYII-VOTSOKGWSA-N (e)-2-ethylhex-2-enoic acid Chemical compound CCC\C=C(/CC)C(O)=O WOWYPHJOHOCYII-VOTSOKGWSA-N 0.000 claims description 4
- AITAOEOXKILIIK-UHFFFAOYSA-K chromium(3+) hexanoate Chemical compound [Cr+3].CCCCCC([O-])=O.CCCCCC([O-])=O.CCCCCC([O-])=O AITAOEOXKILIIK-UHFFFAOYSA-K 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- OILUAKBAMVLXGF-UHFFFAOYSA-N 3,5,5-trimethyl-hexanoic acid Chemical compound OC(=O)CC(C)CC(C)(C)C OILUAKBAMVLXGF-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 2
- RXGPYPPCEXISOV-UHFFFAOYSA-N 2-propylheptanoic acid Chemical compound CCCCCC(C(O)=O)CCC RXGPYPPCEXISOV-UHFFFAOYSA-N 0.000 claims 1
- PHYCAHIHNZMQFS-UHFFFAOYSA-K C(C)C(C(=O)[O-])=CCCC.[Cr+3].C(C)C(C(=O)[O-])=CCCC.C(C)C(C(=O)[O-])=CCCC Chemical compound C(C)C(C(=O)[O-])=CCCC.[Cr+3].C(C)C(C(=O)[O-])=CCCC.C(C)C(C(=O)[O-])=CCCC PHYCAHIHNZMQFS-UHFFFAOYSA-K 0.000 claims 1
- JGFYAUCVQZTNGI-UHFFFAOYSA-K C(CC)C(C(=O)[O-])CCCCC.[Cr+3].C(CC)C(C(=O)[O-])CCCCC.C(CC)C(C(=O)[O-])CCCCC Chemical compound C(CC)C(C(=O)[O-])CCCCC.[Cr+3].C(CC)C(C(=O)[O-])CCCCC.C(CC)C(C(=O)[O-])CCCCC JGFYAUCVQZTNGI-UHFFFAOYSA-K 0.000 claims 1
- 229940068911 chloride hexahydrate Drugs 0.000 claims 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- VOAPTKOANCCNFV-UHFFFAOYSA-N hexahydrate;hydrochloride Chemical compound O.O.O.O.O.O.Cl VOAPTKOANCCNFV-UHFFFAOYSA-N 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 150000007513 acids Chemical class 0.000 description 17
- 235000010755 mineral Nutrition 0.000 description 15
- 239000012074 organic phase Substances 0.000 description 13
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 10
- 229960000359 chromic chloride Drugs 0.000 description 10
- LJAOOBNHPFKCDR-UHFFFAOYSA-K chromium(3+) trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] LJAOOBNHPFKCDR-UHFFFAOYSA-K 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- 238000013019 agitation Methods 0.000 description 8
- 238000011084 recovery Methods 0.000 description 8
- 239000012266 salt solution Substances 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000011636 chromium(III) chloride Substances 0.000 description 3
- 235000007831 chromium(III) chloride Nutrition 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000000446 fuel Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 2
- JOTRMYCCALXLNJ-UHFFFAOYSA-N 3-ethyl-4-methylpentanoic acid Chemical compound CCC(C(C)C)CC(O)=O JOTRMYCCALXLNJ-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical class CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- FGKJLKRYENPLQH-UHFFFAOYSA-N isocaproic acid Chemical compound CC(C)CCC(O)=O FGKJLKRYENPLQH-UHFFFAOYSA-N 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- UDILKAAYNUPREE-UHFFFAOYSA-N 2,2,4,4-tetramethylpentanoic acid Chemical compound CC(C)(C)CC(C)(C)C(O)=O UDILKAAYNUPREE-UHFFFAOYSA-N 0.000 description 1
- VUAXHMVRKOTJKP-UHFFFAOYSA-N 2,2-dimethylbutyric acid Chemical compound CCC(C)(C)C(O)=O VUAXHMVRKOTJKP-UHFFFAOYSA-N 0.000 description 1
- XFOASZQZPWEJAA-UHFFFAOYSA-N 2,3-dimethylbutyric acid Chemical compound CC(C)C(C)C(O)=O XFOASZQZPWEJAA-UHFFFAOYSA-N 0.000 description 1
- LBUDVZDSWKZABS-UHFFFAOYSA-N 2,3-dimethylpentanoic acid Chemical compound CCC(C)C(C)C(O)=O LBUDVZDSWKZABS-UHFFFAOYSA-N 0.000 description 1
- OHHDBSVXENZHSY-UHFFFAOYSA-N 2,4,5-trimethylhex-3-enoic acid Chemical compound CC(C)C(C)=CC(C)C(O)=O OHHDBSVXENZHSY-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-BYPYZUCNSA-N 2-Methylbutanoic acid Natural products CC[C@H](C)C(O)=O WLAMNBDJUVNPJU-BYPYZUCNSA-N 0.000 description 1
- LCZVSXRMYJUNFX-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol Chemical compound CC(O)COC(C)COC(C)CO LCZVSXRMYJUNFX-UHFFFAOYSA-N 0.000 description 1
- XJCPTWKSNPIJRN-UHFFFAOYSA-N 2-ethyl-3-methylbutanoic acid Chemical compound CCC(C(C)C)C(O)=O XJCPTWKSNPIJRN-UHFFFAOYSA-N 0.000 description 1
- XTCNGAJYWUIFFB-UHFFFAOYSA-N 2-ethyl-4-methylpentanoic acid Chemical compound CCC(C(O)=O)CC(C)C XTCNGAJYWUIFFB-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- MLMQPDHYNJCQAO-UHFFFAOYSA-N 3,3-dimethylbutyric acid Chemical compound CC(C)(C)CC(O)=O MLMQPDHYNJCQAO-UHFFFAOYSA-N 0.000 description 1
- DFXIEQPEDLPPFF-UHFFFAOYSA-N 3-ethyl-3-methylheptanoic acid Chemical compound CCCCC(C)(CC)CC(O)=O DFXIEQPEDLPPFF-UHFFFAOYSA-N 0.000 description 1
- GBBXAKWLJDVDQY-UHFFFAOYSA-N 3-methylhex-3-enoic acid Chemical compound CCC=C(C)CC(O)=O GBBXAKWLJDVDQY-UHFFFAOYSA-N 0.000 description 1
- ZNTOJVABYRHABR-UHFFFAOYSA-N 3-propan-2-ylhex-2-enoic acid Chemical compound CCCC(C(C)C)=CC(O)=O ZNTOJVABYRHABR-UHFFFAOYSA-N 0.000 description 1
- GTZIRUJXPHARLG-UHFFFAOYSA-N 3-propylheptanoic acid Chemical compound CCCCC(CCC)CC(O)=O GTZIRUJXPHARLG-UHFFFAOYSA-N 0.000 description 1
- WQUHPLQCUQJSQW-VOTSOKGWSA-N 4-[(e)-2-phenylethenyl]benzonitrile Chemical compound C1=CC(C#N)=CC=C1\C=C\C1=CC=CC=C1 WQUHPLQCUQJSQW-VOTSOKGWSA-N 0.000 description 1
- OHWAWCCJNMDSHS-UHFFFAOYSA-N 5-ethyl-2-methylheptanoic acid Chemical compound CCC(CC)CCC(C)C(O)=O OHWAWCCJNMDSHS-UHFFFAOYSA-N 0.000 description 1
- DHODJQDPMFRMDA-UHFFFAOYSA-N 5-methyl-2-propylhexanoic acid Chemical compound CCCC(C(O)=O)CCC(C)C DHODJQDPMFRMDA-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- NNBFNNNWANBMTI-UHFFFAOYSA-M brilliant green Chemical compound OS([O-])(=O)=O.C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 NNBFNNNWANBMTI-UHFFFAOYSA-M 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 1
- 229940055042 chromic sulfate Drugs 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- PHFQLYPOURZARY-UHFFFAOYSA-N chromium trinitrate Chemical compound [Cr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PHFQLYPOURZARY-UHFFFAOYSA-N 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 229910000356 chromium(III) sulfate Inorganic materials 0.000 description 1
- 239000011696 chromium(III) sulphate Substances 0.000 description 1
- 235000015217 chromium(III) sulphate Nutrition 0.000 description 1
- UZDWIWGMKWZEPE-UHFFFAOYSA-K chromium(iii) bromide Chemical compound [Cr+3].[Br-].[Br-].[Br-] UZDWIWGMKWZEPE-UHFFFAOYSA-K 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Chemical class CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C53/00—Saturated compounds having only one carboxyl group bound to an acyclic carbon atom or hydrogen
- C07C53/126—Acids containing more than four carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F11/00—Compounds containing elements of Groups 6 or 16 of the Periodic Table
- C07F11/005—Compounds containing elements of Groups 6 or 16 of the Periodic Table compounds without a metal-carbon linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/403,319 US3932285A (en) | 1973-10-03 | 1973-10-03 | Chromium salt compositions and a process for their production |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL45476A0 IL45476A0 (en) | 1974-11-29 |
| IL45476A true IL45476A (en) | 1977-05-31 |
Family
ID=23595355
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL45476A IL45476A (en) | 1973-10-03 | 1974-08-14 | A mixture of chromium salts of elliptical carboxylic acids, stable solutions containing them and processes for their preparation |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3932285A (en:Method) |
| JP (1) | JPS5059314A (en:Method) |
| BE (1) | BE819245A (en:Method) |
| CH (1) | CH605546A5 (en:Method) |
| DD (1) | DD113887A5 (en:Method) |
| DE (1) | DE2447080A1 (en:Method) |
| DK (1) | DK519374A (en:Method) |
| FR (1) | FR2246531B1 (en:Method) |
| GB (1) | GB1469986A (en:Method) |
| IL (1) | IL45476A (en:Method) |
| IT (1) | IT1029599B (en:Method) |
| NL (1) | NL7412409A (en:Method) |
| NO (1) | NO743160L (en:Method) |
| SE (1) | SE400293B (en:Method) |
| ZA (1) | ZA745050B (en:Method) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4104293A (en) * | 1976-05-05 | 1978-08-01 | Petrolite Corporation | Oil-soluble chromium compositions |
| US4177162A (en) * | 1977-12-05 | 1979-12-04 | Phillips Petroleum Company | Sulfiding and reoxidation of chromium catalyst |
| US4263151A (en) * | 1979-08-03 | 1981-04-21 | Petrolite Corporation | Oil solutions and/or dispersions of hydrated chromium oxides |
| US4440574A (en) * | 1983-02-22 | 1984-04-03 | E. I. Du Pont De Nemours & Company | Nonsludging complexes of chromium and stearic acid |
| US4863892A (en) * | 1983-08-16 | 1989-09-05 | Phillips Petroleum Company | Antifoulants comprising tin, antimony and aluminum for thermal cracking processes |
| US4636572A (en) * | 1985-03-11 | 1987-01-13 | Phillips Petroleum Company | Permeability contrast correction employing propionate-sequestered chromium(III) prepared by nitrite/dichromate redox |
| US4644073A (en) * | 1985-03-11 | 1987-02-17 | Phillips Petroleum Company | Permeability contrast correction employing a sulfate-free propionate-sequestered chromium (III) solution |
| DK0632008T3 (da) * | 1993-06-01 | 1998-09-23 | Ono Pharmaceutical Co | Pentansyrederivater |
| US5672746A (en) | 1994-08-30 | 1997-09-30 | American Biogenetic Sciences, Inc. | Antiproliferative and neurotrophic molecules |
| US6300373B1 (en) | 1993-09-10 | 2001-10-09 | American Biogenetic Sciences, Inc. | Antiproliferative and neurotrophic molecules |
| US5591878A (en) * | 1995-09-19 | 1997-01-07 | Kemin Industries, Inc. | Catalyzed process for producing metal carboxylates for use as animal feed supplements |
| US6268396B1 (en) | 1998-06-22 | 2001-07-31 | American Biogenetic Sciences, Inc. | Use of valproic acid analog for the treatment and prevention of migraine and affective illness |
| RU2190058C2 (ru) * | 2000-12-13 | 2002-09-27 | Хабаровский государственный технический университет | Каток на пневматических шинах |
| US20050187418A1 (en) * | 2004-02-19 | 2005-08-25 | Small Brooke L. | Olefin oligomerization |
| US9550841B2 (en) | 2004-02-20 | 2017-01-24 | Chevron Phillips Chemical Company Lp | Methods of preparation of an olefin oligomerization catalyst |
| US7384886B2 (en) * | 2004-02-20 | 2008-06-10 | Chevron Phillips Chemical Company Lp | Methods of preparation of an olefin oligomerization catalyst |
| US20070043181A1 (en) * | 2005-08-19 | 2007-02-22 | Knudsen Ronald D | Methods of preparation of an olefin oligomerization catalyst |
| US20050187098A1 (en) * | 2004-02-20 | 2005-08-25 | Knudsen Ronald D. | Methods of preparation of an olefin oligomerization catalyst |
| WO2006109194A2 (en) * | 2005-01-27 | 2006-10-19 | Ocean Nutrition Canada Ltd. | Chromium-fatty acid compounds and methods of making and using thereof |
| US7902415B2 (en) * | 2007-12-21 | 2011-03-08 | Chevron Phillips Chemical Company Lp | Processes for dimerizing or isomerizing olefins |
| CA2740217C (en) * | 2008-10-31 | 2017-03-28 | Chevron Phillips Chemical Company Lp | System and method for deactivating and quenching an oligomerization catalyst |
| US8471085B2 (en) | 2008-10-31 | 2013-06-25 | Chevron Phillips Chemical Company Lp | Oligomerization catalyst system and process for oligomerizing olefins |
| US8957235B2 (en) | 2011-12-12 | 2015-02-17 | Chevron Phillips Chemical Company Lp | Preparation of transition metal carboxylates |
| US9956548B2 (en) | 2011-12-12 | 2018-05-01 | Chevron Phillips Chemical Company Lp | Preparation of an olefin oligomerization catalyst |
| US9586872B2 (en) | 2011-12-30 | 2017-03-07 | Chevron Phillips Chemical Company Lp | Olefin oligomerization methods |
| CN114790136A (zh) * | 2022-03-08 | 2022-07-26 | 中国石油天然气股份有限公司 | 活性三价有机铬化合物的制备方法及应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3136796A (en) * | 1961-06-08 | 1964-06-09 | Du Pont | Werner complex compounds of chromium and polycarboxylic acids |
-
1973
- 1973-10-03 US US05/403,319 patent/US3932285A/en not_active Expired - Lifetime
-
1974
- 1974-08-07 ZA ZA00745050A patent/ZA745050B/xx unknown
- 1974-08-14 IL IL45476A patent/IL45476A/en unknown
- 1974-08-27 BE BE147949A patent/BE819245A/xx unknown
- 1974-08-27 FR FR7429267A patent/FR2246531B1/fr not_active Expired
- 1974-09-02 CH CH1190574A patent/CH605546A5/xx not_active IP Right Cessation
- 1974-09-03 NO NO743160A patent/NO743160L/no unknown
- 1974-09-18 GB GB4075274A patent/GB1469986A/en not_active Expired
- 1974-09-19 NL NL7412409A patent/NL7412409A/xx not_active Application Discontinuation
- 1974-10-01 JP JP49112374A patent/JPS5059314A/ja active Pending
- 1974-10-01 DD DD181438A patent/DD113887A5/xx unknown
- 1974-10-01 IT IT53317/74A patent/IT1029599B/it active
- 1974-10-02 DE DE19742447080 patent/DE2447080A1/de not_active Withdrawn
- 1974-10-02 SE SE7412407A patent/SE400293B/xx unknown
- 1974-10-02 DK DK519374A patent/DK519374A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2447080A1 (de) | 1975-04-10 |
| JPS5059314A (en:Method) | 1975-05-22 |
| IT1029599B (it) | 1979-03-20 |
| GB1469986A (en) | 1977-04-14 |
| NO743160L (en:Method) | 1975-04-28 |
| BE819245A (fr) | 1974-12-16 |
| SE400293B (sv) | 1978-03-20 |
| FR2246531A1 (en:Method) | 1975-05-02 |
| IL45476A0 (en) | 1974-11-29 |
| AU7383074A (en) | 1976-04-08 |
| FR2246531B1 (en:Method) | 1979-01-05 |
| ZA745050B (en) | 1975-08-27 |
| US3932285A (en) | 1976-01-13 |
| CH605546A5 (en:Method) | 1978-09-29 |
| NL7412409A (nl) | 1975-04-07 |
| SE7412407L (en:Method) | 1975-04-04 |
| DK519374A (en:Method) | 1975-06-09 |
| DD113887A5 (en:Method) | 1975-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3932285A (en) | Chromium salt compositions and a process for their production | |
| US2621193A (en) | Polymeric titanium compounds | |
| US2916454A (en) | Preparation of complex carbonated metal salts of alkyl phenol sulfides and mineral oil fractions containing the same | |
| US2518677A (en) | Separation of hydrocarbons using | |
| US3031284A (en) | Fuel oil compositions containing high barium content complex salts of sulfonic acids | |
| US2681922A (en) | Polymeric zirconium compounds and method of preparing same | |
| US4347062A (en) | Complexes of high iron content soluble in organic media and usable as combustion additives in liquid fuels | |
| US4257913A (en) | Stable manganese salt solutions and a process for their production | |
| US2345061A (en) | Organic compound and process for producing the same | |
| US1993259A (en) | Separation of formic acid from other fatty acids | |
| EP0151931B1 (de) | Wasserlösliche Zirkonsäureester | |
| US3362801A (en) | Hydrocarbon oil stabilization | |
| US3773675A (en) | Agents for inhibiting the corrosion of iron in acid solution | |
| US4123231A (en) | Clear, bright oil-soluble aluminum-containing compositions | |
| EP0058330B1 (fr) | Solutions organiques de complexes ferro-magnésiens à forte teneur en métal et leurs applications | |
| US2300291A (en) | Petroleum products | |
| US2102654A (en) | Methods for producing decomposition products from olefine-so complexes | |
| US2289316A (en) | Metallic soap solution | |
| RU2750251C1 (ru) | Способ получения растворов карбоксилатов циркония | |
| US2223299A (en) | Acid inhibitor | |
| JP4253755B2 (ja) | アルミニウムアルキルアセトアセテート化合物及びその製法と印刷インキ付加剤としての使用 | |
| US2622092A (en) | Oil-soluble polyvalent metal salts of acids from oxidized hydrocarbons and process of making same | |
| SU1167191A1 (ru) | Способ получени смазочной добавки к буровым растворам | |
| US3652623A (en) | Organic aluminum compounds | |
| US2673196A (en) | Method of treating phosphorus sulfide-organic compound-metal derivative lubricant additives |