IL45031A - Phosphonic acid derivatives and compositions for regulating plant growth containing them - Google Patents
Phosphonic acid derivatives and compositions for regulating plant growth containing themInfo
- Publication number
- IL45031A IL45031A IL45031A IL4503174A IL45031A IL 45031 A IL45031 A IL 45031A IL 45031 A IL45031 A IL 45031A IL 4503174 A IL4503174 A IL 4503174A IL 45031 A IL45031 A IL 45031A
- Authority
- IL
- Israel
- Prior art keywords
- admixture
- compound
- growth
- carrier
- formula
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 24
- 230000008635 plant growth Effects 0.000 title claims description 5
- 230000001105 regulatory effect Effects 0.000 title claims description 5
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 title description 2
- 150000003007 phosphonic acid derivatives Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 60
- MGRVRXRGTBOSHW-UHFFFAOYSA-N (aminomethyl)phosphonic acid Chemical class NCP(O)(O)=O MGRVRXRGTBOSHW-UHFFFAOYSA-N 0.000 claims description 29
- 239000003085 diluting agent Substances 0.000 claims description 21
- 230000012010 growth Effects 0.000 claims description 18
- -1 alkaline earth metal cation Chemical class 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 239000007788 liquid Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000007787 solid Substances 0.000 claims description 10
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 9
- 239000004480 active ingredient Substances 0.000 claims description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000004094 surface-active agent Substances 0.000 claims description 8
- 150000001450 anions Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000005864 Sulphur Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 229910017604 nitric acid Inorganic materials 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229940096405 magnesium cation Drugs 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 239000012433 hydrogen halide Substances 0.000 claims 1
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 241000196324 Embryophyta Species 0.000 description 12
- 230000017066 negative regulation of growth Effects 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 241000209219 Hordeum Species 0.000 description 8
- 239000012153 distilled water Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 235000007340 Hordeum vulgare Nutrition 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 230000009105 vegetative growth Effects 0.000 description 6
- 241000209140 Triticum Species 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000005648 plant growth regulator Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003630 growth substance Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229940035044 sorbitan monolaurate Drugs 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- VFCAUIASFOLMEI-UHFFFAOYSA-L disodium;phosphonatomethanamine Chemical compound [Na+].[Na+].NCP([O-])([O-])=O VFCAUIASFOLMEI-UHFFFAOYSA-L 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000002332 glycine derivatives Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- XUZXFRDYTGCDPV-UHFFFAOYSA-L magnesium;phosphonatomethanamine Chemical compound [Mg+2].NCP([O-])([O-])=O XUZXFRDYTGCDPV-UHFFFAOYSA-L 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- VMCXSEZUMNXTPU-UHFFFAOYSA-N phosphonomethylazanium;sulfate Chemical compound [O-]S([O-])(=O)=O.[NH3+]CP(O)(O)=O.[NH3+]CP(O)(O)=O VMCXSEZUMNXTPU-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- MSHHYMYBKLOKAJ-UHFFFAOYSA-N 2,2-dichloroacetate;phosphonomethylazanium Chemical compound [NH3+]CP(O)(O)=O.[O-]C(=O)C(Cl)Cl MSHHYMYBKLOKAJ-UHFFFAOYSA-N 0.000 description 1
- XQOYAUMFGBDKQO-UHFFFAOYSA-N 2-aminoacetic acid;aminomethylphosphonic acid Chemical compound NCC(O)=O.NCP(O)(O)=O XQOYAUMFGBDKQO-UHFFFAOYSA-N 0.000 description 1
- PFCBZRDUOATQHY-UHFFFAOYSA-N 2-aminoethanol;aminomethylphosphonic acid Chemical compound NCCO.NCP(O)(O)=O PFCBZRDUOATQHY-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- YXNNSWYDFRWCBQ-UHFFFAOYSA-N C(C)(=O)O.P(O)(O)=O Chemical compound C(C)(=O)O.P(O)(O)=O YXNNSWYDFRWCBQ-UHFFFAOYSA-N 0.000 description 1
- SSNWJPKFADJGKT-UHFFFAOYSA-N CC(C)COP(CN)(O)=O Chemical compound CC(C)COP(CN)(O)=O SSNWJPKFADJGKT-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- GRZBFWAXIWQROL-UHFFFAOYSA-N NCP(Br)(Br)=O Chemical compound NCP(Br)(Br)=O GRZBFWAXIWQROL-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 102400000830 Saposin-B Human genes 0.000 description 1
- 101800001697 Saposin-B Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- ZFXCOTGRBNXIHR-UHFFFAOYSA-N [(z)-diazomethyl]phosphonic acid Chemical class OP(O)(=O)C=[N+]=[N-] ZFXCOTGRBNXIHR-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- BOSHKZATINDUKX-UHFFFAOYSA-N aminomethyl(butoxy)phosphinic acid Chemical compound CCCCOP(O)(=O)CN BOSHKZATINDUKX-UHFFFAOYSA-N 0.000 description 1
- YZJRTQAXQYMDCP-UHFFFAOYSA-N aminomethyl(methoxy)phosphinic acid Chemical compound COP(O)(=O)CN YZJRTQAXQYMDCP-UHFFFAOYSA-N 0.000 description 1
- GYCMWEPPLCZQID-UHFFFAOYSA-N aminomethyl(propan-2-yloxy)phosphinic acid Chemical compound CC(C)OP(O)(=O)CN GYCMWEPPLCZQID-UHFFFAOYSA-N 0.000 description 1
- DFUOZLREVKEIDI-UHFFFAOYSA-N aminomethyl(propoxy)phosphinic acid Chemical compound CCCOP(O)(=O)CN DFUOZLREVKEIDI-UHFFFAOYSA-N 0.000 description 1
- KEDFWVIHHYMZTJ-UHFFFAOYSA-N aminomethylphosphonic acid;1h-imidazole Chemical compound C1=CNC=N1.NCP(O)(O)=O KEDFWVIHHYMZTJ-UHFFFAOYSA-N 0.000 description 1
- HAKWWFYKDNEIEL-UHFFFAOYSA-N aminomethylphosphonic acid;ethanamine Chemical compound CCN.NCP(O)(O)=O HAKWWFYKDNEIEL-UHFFFAOYSA-N 0.000 description 1
- UPBPZQOYRYEONF-UHFFFAOYSA-N aminomethylphosphonic acid;methanamine Chemical compound NC.NCP(O)(O)=O UPBPZQOYRYEONF-UHFFFAOYSA-N 0.000 description 1
- QRYOLUCCPLTYNH-UHFFFAOYSA-N aminomethylphosphonic acid;morpholine Chemical compound C1COCCN1.NCP(O)(O)=O QRYOLUCCPLTYNH-UHFFFAOYSA-N 0.000 description 1
- QOSLCZCYICFTEJ-UHFFFAOYSA-N aminomethylphosphonic acid;n,n-diethylethanamine Chemical compound NCP(O)(O)=O.CCN(CC)CC QOSLCZCYICFTEJ-UHFFFAOYSA-N 0.000 description 1
- WNROOMQSCDBXRC-UHFFFAOYSA-N aminomethylphosphonic acid;n-ethylethanamine Chemical compound CCNCC.NCP(O)(O)=O WNROOMQSCDBXRC-UHFFFAOYSA-N 0.000 description 1
- XWJYACUKXMJZHB-UHFFFAOYSA-N aminomethylphosphonic acid;piperidine Chemical compound C1CCNCC1.NCP(O)(O)=O XWJYACUKXMJZHB-UHFFFAOYSA-N 0.000 description 1
- YBWBLALBJCVAII-UHFFFAOYSA-N aminomethylphosphonic acid;pyrrolidine Chemical compound C1CCNC1.NCP(O)(O)=O YBWBLALBJCVAII-UHFFFAOYSA-N 0.000 description 1
- 229960001040 ammonium chloride Drugs 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- BCYUISRXDZBFKQ-UHFFFAOYSA-L calcium;phosphonatomethanamine Chemical compound [Ca+2].NCP([O-])([O-])=O BCYUISRXDZBFKQ-UHFFFAOYSA-L 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- XAOPUVDJKZQBMH-UHFFFAOYSA-N diazanium;phosphonatomethanamine Chemical compound [NH4+].[NH4+].NCP([O-])([O-])=O XAOPUVDJKZQBMH-UHFFFAOYSA-N 0.000 description 1
- RECSWJCWPKPOPW-UHFFFAOYSA-N dichlorophosphorylmethanamine Chemical compound NCP(Cl)(Cl)=O RECSWJCWPKPOPW-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- ZRSSTUOIPWPWLZ-UHFFFAOYSA-L dipotassium;phosphonatomethanamine Chemical compound [K+].[K+].NCP([O-])([O-])=O ZRSSTUOIPWPWLZ-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 229940031098 ethanolamine Drugs 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000003966 growth inhibitor Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- WTPRYNSDJMJSRR-UHFFFAOYSA-N methanesulfonate;phosphonomethylazanium Chemical compound CS([O-])(=O)=O.[NH3+]CP(O)(O)=O WTPRYNSDJMJSRR-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- XNQULTQRGBXLIA-UHFFFAOYSA-O phosphonic anhydride Chemical compound O[P+](O)=O XNQULTQRGBXLIA-UHFFFAOYSA-O 0.000 description 1
- OMISJJWGEYCTET-UHFFFAOYSA-N phosphonomethylazanium;2,2,2-trichloroacetate Chemical compound [NH3+]CP(O)(O)=O.[O-]C(=O)C(Cl)(Cl)Cl OMISJJWGEYCTET-UHFFFAOYSA-N 0.000 description 1
- PLCBXJBROJULHZ-UHFFFAOYSA-O phosphonomethylazanium;nitrate Chemical compound [O-][N+]([O-])=O.[NH3+]CP(O)(O)=O PLCBXJBROJULHZ-UHFFFAOYSA-O 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3808—Acyclic saturated acids which can have further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2331187A DE2331187A1 (de) | 1973-06-19 | 1973-06-19 | Mittel zur regulierung des pflanzenwachstums |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL45031A0 IL45031A0 (en) | 1974-09-10 |
| IL45031A true IL45031A (en) | 1977-05-31 |
Family
ID=5884451
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL45031A IL45031A (en) | 1973-06-19 | 1974-06-14 | Phosphonic acid derivatives and compositions for regulating plant growth containing them |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5035343A (pl) |
| AT (1) | AT334680B (pl) |
| BE (1) | BE816438A (pl) |
| BR (1) | BR7404980D0 (pl) |
| CH (1) | CH588813A5 (pl) |
| DD (1) | DD115839A5 (pl) |
| DE (1) | DE2331187A1 (pl) |
| DK (1) | DK326074A (pl) |
| EG (1) | EG11373A (pl) |
| ES (1) | ES427399A1 (pl) |
| FR (1) | FR2233936B1 (pl) |
| GB (1) | GB1471754A (pl) |
| HU (1) | HU167995B (pl) |
| IE (1) | IE39511B1 (pl) |
| IL (1) | IL45031A (pl) |
| LU (1) | LU70346A1 (pl) |
| NL (1) | NL7408076A (pl) |
| PL (1) | PL90368B1 (pl) |
| SU (1) | SU580796A3 (pl) |
| TR (1) | TR18282A (pl) |
| ZA (1) | ZA743874B (pl) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0002031B1 (en) * | 1977-11-19 | 1982-02-03 | Ciba-Geigy Ag | Methods of inhibiting plant and combating weeds using alpha-aminoalkanephosphonous acids |
| US4339443A (en) * | 1978-09-22 | 1982-07-13 | Fbc Limited | Compounds and compositions |
| US4331591A (en) * | 1978-10-05 | 1982-05-25 | Ciba-Geigy Corporation | Chemical process for the production of α-aminophosphonic acids and peptide derivatives |
| JPS6050899U (ja) * | 1983-09-16 | 1985-04-10 | 株式会社イナックス | 揺れ止め防止便座 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2328358A (en) * | 1941-01-23 | 1943-08-31 | Du Pont | Organic compound and process for preparing the same |
-
1973
- 1973-06-19 DE DE2331187A patent/DE2331187A1/de active Pending
-
1974
- 1974-06-14 IL IL45031A patent/IL45031A/en unknown
- 1974-06-17 NL NL7408076A patent/NL7408076A/xx not_active Application Discontinuation
- 1974-06-17 JP JP49068240A patent/JPS5035343A/ja active Pending
- 1974-06-17 PL PL1974171972A patent/PL90368B1/zh unknown
- 1974-06-17 BE BE145514A patent/BE816438A/xx unknown
- 1974-06-17 CH CH826574A patent/CH588813A5/xx not_active IP Right Cessation
- 1974-06-17 TR TR18282A patent/TR18282A/xx unknown
- 1974-06-17 DD DD179213A patent/DD115839A5/xx unknown
- 1974-06-17 AT AT498374A patent/AT334680B/de active
- 1974-06-17 EG EG230/74A patent/EG11373A/xx active
- 1974-06-18 ZA ZA00743874A patent/ZA743874B/xx unknown
- 1974-06-18 GB GB2694574A patent/GB1471754A/en not_active Expired
- 1974-06-18 LU LU70346A patent/LU70346A1/xx unknown
- 1974-06-18 DK DK326074A patent/DK326074A/da unknown
- 1974-06-18 ES ES427399A patent/ES427399A1/es not_active Expired
- 1974-06-18 IE IE1272/74A patent/IE39511B1/xx unknown
- 1974-06-18 SU SU7402035679A patent/SU580796A3/ru active
- 1974-06-18 HU HUBA3086A patent/HU167995B/hu unknown
- 1974-06-18 BR BR4980/74A patent/BR7404980D0/pt unknown
- 1974-06-19 FR FR7421240A patent/FR2233936B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE816438A (fr) | 1974-12-17 |
| DD115839A5 (pl) | 1975-10-20 |
| ES427399A1 (es) | 1976-07-16 |
| IE39511B1 (en) | 1978-10-25 |
| PL90368B1 (pl) | 1977-01-31 |
| AU7015874A (en) | 1975-12-18 |
| ZA743874B (en) | 1975-06-25 |
| BR7404980D0 (pt) | 1975-01-07 |
| IL45031A0 (en) | 1974-09-10 |
| NL7408076A (pl) | 1974-12-23 |
| IE39511L (en) | 1974-12-19 |
| GB1471754A (en) | 1977-04-27 |
| CH588813A5 (pl) | 1977-06-15 |
| DK326074A (pl) | 1975-02-10 |
| AT334680B (de) | 1976-01-25 |
| TR18282A (tr) | 1976-11-22 |
| DE2331187A1 (de) | 1975-01-09 |
| FR2233936A1 (pl) | 1975-01-17 |
| SU580796A3 (ru) | 1977-11-15 |
| HU167995B (pl) | 1976-02-28 |
| JPS5035343A (pl) | 1975-04-04 |
| FR2233936B1 (pl) | 1978-02-17 |
| LU70346A1 (pl) | 1975-03-27 |
| EG11373A (en) | 1977-08-15 |
| ATA498374A (de) | 1976-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1072359A (en) | Method for controlling the growth of plants | |
| IL44710A (en) | 1-phenyl-2-azolyl-formamidines their preparation and their use as herbicides | |
| US3542538A (en) | Method of retarding plant growth with heterocyclic quaternary ammonium salts | |
| EP0382463B1 (en) | Maleimide compounds and fungicides containing them | |
| IL45031A (en) | Phosphonic acid derivatives and compositions for regulating plant growth containing them | |
| PL124388B1 (en) | Fungicide and process for manufacturing derivatives of triazolyl-alkenes | |
| US4127401A (en) | Aminomethanephosphonic acid compounds containing plant-growth regulant compositions | |
| US3862833A (en) | Haloaniline derivatives as plant growth modifiers | |
| US4047923A (en) | Heterocyclic sulfonium salt containing plant-growth regulant compositions | |
| US3754001A (en) | 9-imidazolyl-fluorene-9-carboxylic acid compounds | |
| US3963749A (en) | 1-Methyl-2,3-dihydro-1,4-dithiinium methosulfate | |
| US4245101A (en) | Method of preparation and use of N-phenyl-N'-1,2,3-thiadiazole-5-yl-thiourea | |
| RU2100346C1 (ru) | Производные глиоксил-циклогексендиона, способ их получения, гербицидная композиция, способ подавления нежелательного роста растений | |
| US3856501A (en) | Agent for controlling the growth of plants | |
| US4502881A (en) | Weed-killing furazan compounds | |
| US3895933A (en) | Plant growth regulants comprising 2-hydroxyethyl-1-pyridinium-(1) salts | |
| US4053296A (en) | Ferrocene derivative for supplying plants with iron | |
| US3915962A (en) | Procedure for the preparation of aromatic 2-imino-1,3-dithietanes | |
| US3989525A (en) | H-isopropyl-2-chloroethane-(thiono)-phosphonic acid ester amide compounds and herbicidal compositions | |
| US3981714A (en) | Cyclic N-thiadiazolyl-(2)-carboxylic acid compounds and herbicidal compositions | |
| US3940391A (en) | 3,4-Dihydro-1,2,4-triazine compounds | |
| US4350520A (en) | Plant growth regulant compositions | |
| EP0264978B1 (en) | Heterocyclic herbicides | |
| CA1050980A (en) | 1-alkylideneaminouracils, process for their preparation and their use as herbicides | |
| IL45030A (en) | Plant growth regulating compositions containing dithiane derivatives |