IL44859A - 4-hydroxy-3-(1,2,3,4-tetrahydronaphth-1-yl)-coumarin derivatives - Google Patents
4-hydroxy-3-(1,2,3,4-tetrahydronaphth-1-yl)-coumarin derivativesInfo
- Publication number
- IL44859A IL44859A IL44859A IL4485974A IL44859A IL 44859 A IL44859 A IL 44859A IL 44859 A IL44859 A IL 44859A IL 4485974 A IL4485974 A IL 4485974A IL 44859 A IL44859 A IL 44859A
- Authority
- IL
- Israel
- Prior art keywords
- group
- general formula
- compounds
- hydroxycoumarin
- compound
- Prior art date
Links
- ULSLJYXHZDTLQK-UHFFFAOYSA-N Coumatetralyl Chemical class C1=CC=CC2=C1OC(=O)C(C1C3=CC=CC=C3CCC1)=C2O ULSLJYXHZDTLQK-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 44
- 239000000203 mixture Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 14
- -1 phenoxy phenyl group Chemical group 0.000 claims description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical group ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 2
- 241000283984 Rodentia Species 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 230000002140 halogenating effect Effects 0.000 claims 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000006267 biphenyl group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- 230000001119 rodenticidal effect Effects 0.000 claims 1
- ORHBXUUXSCNDEV-UHFFFAOYSA-N umbelliferone Chemical compound C1=CC(=O)OC2=CC(O)=CC=C21 ORHBXUUXSCNDEV-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical group CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 25
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- 239000003208 petroleum Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 239000000377 silicon dioxide Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 150000002576 ketones Chemical class 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 102100027378 Prothrombin Human genes 0.000 description 4
- 108010094028 Prothrombin Proteins 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 4
- 229940039716 prothrombin Drugs 0.000 description 4
- 229940083542 sodium Drugs 0.000 description 4
- 235000015424 sodium Nutrition 0.000 description 4
- 239000001117 sulphuric acid Substances 0.000 description 4
- 235000011149 sulphuric acid Nutrition 0.000 description 4
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001722 carbon compounds Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- OTKCEEWUXHVZQI-UHFFFAOYSA-N 1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CC=C1 OTKCEEWUXHVZQI-UHFFFAOYSA-N 0.000 description 1
- XWIAHIXALOBXNK-UHFFFAOYSA-N 1-phenylpropane-1-sulfonic acid Chemical compound CCC(S(O)(=O)=O)C1=CC=CC=C1 XWIAHIXALOBXNK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- GJQZKBVGMRTLJN-UHFFFAOYSA-N [P].P(Cl)(Cl)Cl Chemical compound [P].P(Cl)(Cl)Cl GJQZKBVGMRTLJN-UHFFFAOYSA-N 0.000 description 1
- WRVRNZNDLRUXSW-UHFFFAOYSA-N acetic acid;prop-2-enoic acid Chemical compound CC(O)=O.OC(=O)C=C WRVRNZNDLRUXSW-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- RCTFHBWTYQOVGJ-UHFFFAOYSA-N chloroform;dichloromethane Chemical compound ClCCl.ClC(Cl)Cl RCTFHBWTYQOVGJ-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- RYPWQHONZWFXBN-UHFFFAOYSA-N dichloromethyl(methylidene)-$l^{3}-chlorane Chemical compound ClC(Cl)Cl=C RYPWQHONZWFXBN-UHFFFAOYSA-N 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000014508 negative regulation of coagulation Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/42—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4
- C07D311/44—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3
- C07D311/46—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3 unsubstituted in the carbocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/143—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of ketones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/48—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation involving decarboxylation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/657—Unsaturated compounds containing a keto groups being part of a ring containing six-membered aromatic rings
- C07C49/665—Unsaturated compounds containing a keto groups being part of a ring containing six-membered aromatic rings a keto group being part of a condensed ring system
- C07C49/67—Unsaturated compounds containing a keto groups being part of a ring containing six-membered aromatic rings a keto group being part of a condensed ring system having two rings, e.g. tetralones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C57/38—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/10—One of the condensed rings being a six-membered aromatic ring the other ring being six-membered, e.g. tetraline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2468573 | 1973-05-23 | ||
| GB2526473 | 1973-05-25 | ||
| GB945074*[A GB1458670A (en) | 1973-05-23 | 1974-03-01 | Anti coagulant 3-tetrahydronaphthyl-4-hydroxy-coumarin deri vatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL44859A0 IL44859A0 (en) | 1974-07-31 |
| IL44859A true IL44859A (en) | 1977-10-31 |
Family
ID=27255368
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL44859A IL44859A (en) | 1973-05-23 | 1974-05-20 | 4-hydroxy-3-(1,2,3,4-tetrahydronaphth-1-yl)-coumarin derivatives |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3957824A (member.php) |
| JP (1) | JPS5231928B2 (member.php) |
| CA (1) | CA1034954A (member.php) |
| CH (1) | CH600774A5 (member.php) |
| CY (1) | CY1048A (member.php) |
| DE (1) | DE2424806C3 (member.php) |
| DK (1) | DK140407B (member.php) |
| FR (1) | FR2230633B1 (member.php) |
| GB (1) | GB1458670A (member.php) |
| HK (1) | HK17580A (member.php) |
| IE (1) | IE39265B1 (member.php) |
| IL (1) | IL44859A (member.php) |
| KE (1) | KE2849A (member.php) |
| MY (1) | MY7800313A (member.php) |
| NL (1) | NL178597C (member.php) |
| PH (1) | PH10769A (member.php) |
| SE (1) | SE410602B (member.php) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4271122A (en) * | 1978-04-27 | 1981-06-02 | Hoffmann-La Roche Inc. | Control plasma |
| US4380649A (en) * | 1981-11-23 | 1983-04-19 | The Dow Chemical Company | Isophorone derivatives |
| EP0098629B1 (en) * | 1982-06-14 | 1987-08-26 | Shell Internationale Researchmaatschappij B.V. | Anti-coagulants of the 4-hydroxycoumarin type, the preparation thereof, and rodenticidal compositions (baits) comprising such anti-coagulants |
| ZM3983A1 (en) * | 1982-06-14 | 1984-02-21 | Shell Res Ltd | Anti-coagulants of the 4-hydroxycoumarin type,the preparation thereof,and rodenticidal compositions(baits)comprising such anti-coagulants |
| GB8423782D0 (en) * | 1984-09-20 | 1984-10-24 | Ici Plc | Separation of isomers |
| GB8424317D0 (en) * | 1984-09-26 | 1984-10-31 | Shell Int Research | 4-hydroxycourmarin derivatives |
| US4868206A (en) * | 1985-12-06 | 1989-09-19 | Ici Americas Inc. | Composition for rodent control |
| GB8531388D0 (en) * | 1985-12-20 | 1986-02-05 | Shell Int Research | 4-hydroxycoumarin derivatives |
| US5225436A (en) * | 1987-05-15 | 1993-07-06 | Schering Corporation | Aryl substituted naphthalene derivatives |
| GB8729557D0 (en) | 1987-12-18 | 1988-02-03 | Shell Int Research | Rodenticidal composition |
| GB9324517D0 (en) * | 1993-11-30 | 1994-01-19 | Octel Chem Ltd | Process for the preparation of substituted 4-hydroxycoumarins |
| GB0211016D0 (en) * | 2002-05-14 | 2002-06-26 | Syngenta Ltd | Novel compounds |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2872457A (en) * | 1956-04-19 | 1959-02-03 | Wisconsin Alumni Res Found | Process for the preparation of 4-hydroxycoumarin derivatives |
| BE556754A (member.php) * | 1956-07-20 |
-
1974
- 1974-03-01 GB GB945074*[A patent/GB1458670A/en not_active Expired
- 1974-05-13 IE IE1014/74A patent/IE39265B1/xx unknown
- 1974-05-17 PH PH15845A patent/PH10769A/en unknown
- 1974-05-20 IL IL44859A patent/IL44859A/en unknown
- 1974-05-21 FR FR7417563A patent/FR2230633B1/fr not_active Expired
- 1974-05-22 JP JP49058337A patent/JPS5231928B2/ja not_active Expired
- 1974-05-22 CH CH707474A patent/CH600774A5/xx not_active IP Right Cessation
- 1974-05-22 US US05/473,161 patent/US3957824A/en not_active Expired - Lifetime
- 1974-05-22 SE SE7406879A patent/SE410602B/xx not_active IP Right Cessation
- 1974-05-22 CA CA200,500A patent/CA1034954A/en not_active Expired
- 1974-05-22 DK DK282274AA patent/DK140407B/da not_active IP Right Cessation
- 1974-05-22 DE DE2424806A patent/DE2424806C3/de not_active Expired
- 1974-05-23 CY CY1048A patent/CY1048A/xx unknown
- 1974-05-24 NL NLAANVRAGE7406982,A patent/NL178597C/xx not_active IP Right Cessation
-
1978
- 1978-06-20 KE KE2849A patent/KE2849A/xx unknown
- 1978-12-31 MY MY1978313A patent/MY7800313A/xx unknown
-
1980
- 1980-04-03 HK HK175/80A patent/HK17580A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2424806C3 (de) | 1980-11-20 |
| IE39265B1 (en) | 1978-08-30 |
| US3957824A (en) | 1976-05-18 |
| JPS5029743A (member.php) | 1975-03-25 |
| DE2424806A1 (de) | 1975-02-27 |
| CH600774A5 (member.php) | 1978-06-30 |
| IE39265L (en) | 1974-11-23 |
| CY1048A (en) | 1980-08-01 |
| JPS5231928B2 (member.php) | 1977-08-18 |
| HK17580A (en) | 1980-04-11 |
| PH10769A (en) | 1977-09-05 |
| FR2230633A1 (member.php) | 1974-12-20 |
| NL178597C (nl) | 1986-04-16 |
| AU6897774A (en) | 1975-11-20 |
| KE2849A (en) | 1978-08-04 |
| SE410602B (sv) | 1979-10-22 |
| CA1034954A (en) | 1978-07-18 |
| DK140407C (member.php) | 1980-01-21 |
| DE2424806B2 (member.php) | 1980-03-27 |
| FR2230633B1 (member.php) | 1978-09-15 |
| IL44859A0 (en) | 1974-07-31 |
| GB1458670A (en) | 1976-12-15 |
| DK140407B (da) | 1979-08-20 |
| MY7800313A (en) | 1978-12-31 |
| NL178597B (nl) | 1985-11-18 |
| NL7406982A (member.php) | 1974-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL44859A (en) | 4-hydroxy-3-(1,2,3,4-tetrahydronaphth-1-yl)-coumarin derivatives | |
| Newman et al. | The Synthesis and Optical Resolution of 4, 5, 8-Trimethyl-1-phenanthrylacetic Acid1 | |
| US4767882A (en) | Tetrahydronaphthalene derivatives and their production | |
| Higa et al. | Oxidations by thionyl chloride. 8. A convenient synthesis of benzo [b] thiophenes from carboxylic acids and ketones | |
| US3509184A (en) | Anthracyclidine-acetic acid derivatives | |
| US3829453A (en) | Octahydroanthracene-2-aminoacetic acids and esters and mixed anhydrides thereof | |
| JPS60243042A (ja) | シクロプロパンカルボン酸誘導体 | |
| US3772363A (en) | 3,4,10-trioxo octahydroanthracene-2-aminoacetic acids and derivatives thereof | |
| Newman et al. | Synthesis of a series of substituted phenylpropiolic acids | |
| US3362988A (en) | Alkanoylnaphthyloxy-carboxylic acids | |
| English et al. | The synthesis of some 1-cyclopentenealdehydes | |
| DK163056B (da) | Analogifremgangsmaade til fremstilling af alfa-sulfonyloxyketonacetaler | |
| US4035505A (en) | 4-Hydroxycoumarin compounds useful as anticoagulant rodenticides | |
| Messina et al. | The Friedel—Crafts Alkylation of 2, 5-Dimethylthiophene | |
| US4102896A (en) | Preparation of a 5-(2,2-dihalovinyl)-4,4-dimethyl-2-oxotetrahydrofuran | |
| Fuson et al. | Extension of the reformatsky reaction to new types of compounds | |
| US4663465A (en) | Preparation of 2,2-dimethyl-3-aryl-cyclopropanecarboxylic acid and esters and new intermediates therefor | |
| US3317591A (en) | Preparation of[4-(2-alkylidenealkanoyl)phenoxy]-alkanoic acid by oxidation | |
| CA1077059A (en) | Process for preparing 11-tetradecenal insect pheromone | |
| Zyl et al. | The course of ring opening of glycidyl ethers with nucleophilic reagents | |
| Fieser et al. | Synthetic experiments in the chrysene series | |
| Tarbell et al. | A Rearrangement Involving Aromatization. The Condensation of Δ4-Tetrahydrophthalaldehyde with Diethyl Acetonedicarboxylate1 | |
| US3103519A (en) | I-benzoxacycloalkanecarboxyoc acids | |
| BROWN et al. | The synthesis of some substituted 5-bromopentylamine hydrobromides | |
| Solodar et al. | 4'-Nitro-2-stibenol |