IL44792A - Penicillin and cephalosporin cleavage process and compounds useful therein - Google Patents
Penicillin and cephalosporin cleavage process and compounds useful thereinInfo
- Publication number
- IL44792A IL44792A IL44792A IL4479274A IL44792A IL 44792 A IL44792 A IL 44792A IL 44792 A IL44792 A IL 44792A IL 4479274 A IL4479274 A IL 4479274A IL 44792 A IL44792 A IL 44792A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- acid
- methyl
- hydrogen
- isoimide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 68
- 229930182555 Penicillin Natural products 0.000 title claims description 51
- 229940124587 cephalosporin Drugs 0.000 title claims description 50
- 229940049954 penicillin Drugs 0.000 title claims description 49
- 229930186147 Cephalosporin Natural products 0.000 title claims description 48
- 150000001875 compounds Chemical class 0.000 title claims description 41
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title claims description 33
- 150000001780 cephalosporins Chemical class 0.000 title claims description 28
- 238000003776 cleavage reaction Methods 0.000 title description 19
- 230000007017 scission Effects 0.000 title description 18
- -1 acetoxy, methoxy, methylthio Chemical group 0.000 claims description 115
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 87
- 239000002253 acid Substances 0.000 claims description 83
- 239000000203 mixture Substances 0.000 claims description 71
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- 239000001257 hydrogen Substances 0.000 claims description 38
- VZUHQRBBQSLSHS-SSZFMOIBSA-N Isoimide Chemical compound C1=CC(Br)=CC=C1\N=C/1C(CCCC2)=C2C(=O)O\1 VZUHQRBBQSLSHS-SSZFMOIBSA-N 0.000 claims description 35
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 claims description 32
- 239000011541 reaction mixture Substances 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 29
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 17
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- 150000001266 acyl halides Chemical class 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000003512 tertiary amines Chemical class 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 230000032050 esterification Effects 0.000 claims description 6
- 238000005886 esterification reaction Methods 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 3
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 150000002081 enamines Chemical class 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 238000010792 warming Methods 0.000 claims description 3
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 3
- 239000012442 inert solvent Substances 0.000 claims 2
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 141
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 72
- 239000000243 solution Substances 0.000 description 58
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 44
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 39
- 239000000047 product Substances 0.000 description 38
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 36
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 22
- 239000012267 brine Substances 0.000 description 20
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- 239000010410 layer Substances 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 239000005457 ice water Substances 0.000 description 14
- 229940086542 triethylamine Drugs 0.000 description 13
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- 239000006260 foam Substances 0.000 description 9
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 8
- 150000002148 esters Chemical group 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 7
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 7
- 150000003949 imides Chemical group 0.000 description 7
- 239000000523 sample Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 238000001228 spectrum Methods 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- PYEJPVLWBLJEPJ-JOPIAHFSSA-N (6r)-7-(1,3-dioxoisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C1=O)[C@@H]2N1C(C(O)=O)=C(C)CS2 PYEJPVLWBLJEPJ-JOPIAHFSSA-N 0.000 description 5
- GVTLFGJNTIRUEG-ZHACJKMWSA-N (e)-n-(3-methoxyphenyl)-3-phenylprop-2-enamide Chemical compound COC1=CC=CC(NC(=O)\C=C\C=2C=CC=CC=2)=C1 GVTLFGJNTIRUEG-ZHACJKMWSA-N 0.000 description 5
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910052979 sodium sulfide Inorganic materials 0.000 description 5
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- OARPELXYFXJBKN-FBLFFUNLSA-N 2-[[(6r)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)C1=CC=CC=C1C(O)=O OARPELXYFXJBKN-FBLFFUNLSA-N 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 4
- 238000010306 acid treatment Methods 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000000010 aprotic solvent Substances 0.000 description 4
- 239000002024 ethyl acetate extract Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- SKVHPNQACYIQDC-FFFFSGIJSA-N tert-butyl (6r)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(=O)OC(C)(C)C)N2C(=O)C(N)[C@@H]12 SKVHPNQACYIQDC-FFFFSGIJSA-N 0.000 description 4
- WOCSSWQYYJTNNU-LNUXAPHWSA-N (6r)-7-[(2-carboxybenzoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(O)=O)NC(=O)C1=CC=CC=C1C(O)=O WOCSSWQYYJTNNU-LNUXAPHWSA-N 0.000 description 3
- NWWYYVMKSWEMHE-JOPIAHFSSA-N 2-[[(6r)-2-methoxycarbonyl-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@H]2SCC(C)=C(N2C1=O)C(=O)OC)NC(=O)C1=CC=CC=C1C(O)=O NWWYYVMKSWEMHE-JOPIAHFSSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- DKJQWGJMTJUJGE-RWANSRKNSA-N CC(OCC(C(NC(C=C)=O)S[C@@H]1C2)=C(C(O)=O)N1C2=O)=O Chemical compound CC(OCC(C(NC(C=C)=O)S[C@@H]1C2)=C(C(O)=O)N1C2=O)=O DKJQWGJMTJUJGE-RWANSRKNSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 3
- 125000005544 phthalimido group Chemical group 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- GFIPSRABLXULCS-LEQGEALCSA-N (4-methoxyphenyl)methyl (6r)-7-(1,3-dioxoisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=C(C)CS[C@H]2N1C(=O)C2N1C(=O)C2=CC=CC=C2C1=O GFIPSRABLXULCS-LEQGEALCSA-N 0.000 description 2
- ABTUPEBOWRKQLD-SBXXRYSUSA-N (4-nitrophenyl)methyl (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@H]1N2C(C1N)=O)CC(C)=C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 ABTUPEBOWRKQLD-SBXXRYSUSA-N 0.000 description 2
- NVIAYEIXYQCDAN-HWZXHQHMSA-N (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 NVIAYEIXYQCDAN-HWZXHQHMSA-N 0.000 description 2
- JRTIMPRAIHZEPU-LRHAYUFXSA-N 2-[[(6r)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(=O)OC(C)(C)C)NC(=O)C1=CC=CC=C1C(O)=O JRTIMPRAIHZEPU-LRHAYUFXSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- AJYXPNIENRLELY-UHFFFAOYSA-N 2-thiophen-2-ylacetyl chloride Chemical compound ClC(=O)CC1=CC=CS1 AJYXPNIENRLELY-UHFFFAOYSA-N 0.000 description 2
- YUVVSNUXOJFGKG-UHFFFAOYSA-N 3-methylbenzene-1,2-dicarbohydrazide Chemical compound CC1=CC=CC(C(=O)NN)=C1C(=O)NN YUVVSNUXOJFGKG-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 229910052976 metal sulfide Inorganic materials 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- PBRCJCQXPAJPEL-PVQCJRHBSA-N methyl (6r)-7-(1,3-dioxoisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1[C@H]2SCC(C)=C(C(=O)OC)N2C1=O PBRCJCQXPAJPEL-PVQCJRHBSA-N 0.000 description 2
- QCDHBNKKHSYNCC-XCGJVMPOSA-N methyl (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound COC(=O)C1=C(C)CS[C@@H]2C(N)C(=O)N12 QCDHBNKKHSYNCC-XCGJVMPOSA-N 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- YSZIOXAEADAJLX-UHFFFAOYSA-N phthalazine-1,4-dione Chemical compound C1=CC=C2C(=O)N=NC(=O)C2=C1 YSZIOXAEADAJLX-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- GPGDURASYGCGER-OTOKDRCRSA-N tert-butyl (6r)-3-(acetyloxymethyl)-7-(1,3-dioxoisoindol-2-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C1=O)[C@@H]2N1C(C(=O)OC(C)(C)C)=C(COC(=O)C)CS2 GPGDURASYGCGER-OTOKDRCRSA-N 0.000 description 2
- QBBWQYNQWSSEHG-XPKAQORNSA-N tert-butyl (6r)-7-(1,3-dioxoisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C1=O)[C@@H]2N1C(C(=O)OC(C)(C)C)=C(C)CS2 QBBWQYNQWSSEHG-XPKAQORNSA-N 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- LNVKHOIUIPPOFH-ISTVAULSSA-N (2s,5r,6r)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)N1[C@H]1[C@H]2SC(C)(C)[C@H](C(O)=O)N2C1=O LNVKHOIUIPPOFH-ISTVAULSSA-N 0.000 description 1
- FWMULLONXKFDBL-WPZCJLIBSA-N (4-methoxyphenyl)methyl (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=C(C)CS[C@H]2N1C(=O)C2N FWMULLONXKFDBL-WPZCJLIBSA-N 0.000 description 1
- XWNBYCLNUZWIKB-AVKWCDSFSA-N (4-nitrophenyl)methyl (6r)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)CC1=CC=CC=C1 XWNBYCLNUZWIKB-AVKWCDSFSA-N 0.000 description 1
- WHWKGDOLOQBTMA-LMNIDFBRSA-N (4-nitrophenyl)methyl (6r)-7-(1,3-dioxoisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@H]1N2C(C1N1C(C3=CC=CC=C3C1=O)=O)=O)CC(C)=C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 WHWKGDOLOQBTMA-LMNIDFBRSA-N 0.000 description 1
- MTCOXAUSJFUXSC-KJHLLKJSSA-N (5r)-6-(1,3-dioxoisoindol-2-yl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1[C@H]2SCC(C(=O)O)N2C1=O MTCOXAUSJFUXSC-KJHLLKJSSA-N 0.000 description 1
- HSHGZXNAXBPPDL-IOJJLOCKSA-N (6r)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 HSHGZXNAXBPPDL-IOJJLOCKSA-N 0.000 description 1
- MITCEQPIPVPSBQ-JOPIAHFSSA-N (6r)-7-[(2-carboxybenzoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)COC)C(O)=O)NC(=O)C1=CC=CC=C1C(O)=O MITCEQPIPVPSBQ-JOPIAHFSSA-N 0.000 description 1
- SVYKJZUXLOQPIT-JOPIAHFSSA-N (6r)-7-[(2-carboxybenzoyl)amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)CSC)C(O)=O)NC(=O)C1=CC=CC=C1C(O)=O SVYKJZUXLOQPIT-JOPIAHFSSA-N 0.000 description 1
- HXFBGHGRWRUHEC-QIMFLAQGSA-N (6r)-7-[(2-carboxybenzoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid Chemical compound C1([C@H]2SC=C(C(N2C1=O)C(O)=O)C)NC(=O)C1=CC=CC=C1C(O)=O HXFBGHGRWRUHEC-QIMFLAQGSA-N 0.000 description 1
- LOVQDTPQUKGWPG-XCGJVMPOSA-N (6r)-7-amino-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(CSC)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 LOVQDTPQUKGWPG-XCGJVMPOSA-N 0.000 description 1
- BDSDFCVDQUGOFB-XNCJUZBTSA-N (6s,7s)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC)=C(C(O)=O)N2C(=O)[C@H](N)[C@H]12 BDSDFCVDQUGOFB-XNCJUZBTSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- GIGRWGTZFONRKA-UHFFFAOYSA-N 1-(bromomethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CBr)C=C1 GIGRWGTZFONRKA-UHFFFAOYSA-N 0.000 description 1
- YUCNSMNTSOFPNJ-UHFFFAOYSA-N 2,2,2-trichloroethyl n-(2-chloro-2-oxo-1-phenylethyl)carbamate Chemical compound ClC(Cl)(Cl)COC(=O)NC(C(=O)Cl)C1=CC=CC=C1 YUCNSMNTSOFPNJ-UHFFFAOYSA-N 0.000 description 1
- SINBGNJPYWNUQI-UHFFFAOYSA-N 2,2,2-trifluoro-1-imidazol-1-ylethanone Chemical compound FC(F)(F)C(=O)N1C=CN=C1 SINBGNJPYWNUQI-UHFFFAOYSA-N 0.000 description 1
- CTFCFOLJGJZOCJ-FFFFSGIJSA-N 2,2-dimethylpropanoyloxymethyl (6r)-7-amino-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(CSC)=C(C(=O)OCOC(=O)C(C)(C)C)N2C(=O)C(N)[C@@H]12 CTFCFOLJGJZOCJ-FFFFSGIJSA-N 0.000 description 1
- BMFZGIWAOGKIEM-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetyl bromide Chemical compound BrC(=O)CC1=CC=CN1 BMFZGIWAOGKIEM-UHFFFAOYSA-N 0.000 description 1
- FSKBLGNXIHTICU-UHFFFAOYSA-N 2-(1h-pyrrol-3-yl)acetyl chloride Chemical compound ClC(=O)CC=1C=CNC=1 FSKBLGNXIHTICU-UHFFFAOYSA-N 0.000 description 1
- HKGBEEUOCYYADA-UHFFFAOYSA-N 2-(3-bromophenyl)acetyl bromide Chemical compound BrC(=O)CC1=CC=CC(Br)=C1 HKGBEEUOCYYADA-UHFFFAOYSA-N 0.000 description 1
- KPINZNVDHXIYAR-UHFFFAOYSA-N 2-(3-chlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=CC(Cl)=C1 KPINZNVDHXIYAR-UHFFFAOYSA-N 0.000 description 1
- UZUYKYNVSJTWEH-UHFFFAOYSA-N 2-(3-methoxyphenyl)acetyl chloride Chemical compound COC1=CC=CC(CC(Cl)=O)=C1 UZUYKYNVSJTWEH-UHFFFAOYSA-N 0.000 description 1
- UMQUIRYNOVNYPA-UHFFFAOYSA-N 2-(4-chlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(Cl)C=C1 UMQUIRYNOVNYPA-UHFFFAOYSA-N 0.000 description 1
- XQRSIXZHLWBQOK-UHFFFAOYSA-N 2-(4-cyanophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(C#N)C=C1 XQRSIXZHLWBQOK-UHFFFAOYSA-N 0.000 description 1
- SIOJFYRPBYGHOO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetyl chloride Chemical compound FC1=CC=C(CC(Cl)=O)C=C1 SIOJFYRPBYGHOO-UHFFFAOYSA-N 0.000 description 1
- BFCZKXYIMLCSMJ-UHFFFAOYSA-N 2-(4-hydroxyphenyl)acetyl chloride Chemical compound OC1=CC=C(CC(Cl)=O)C=C1 BFCZKXYIMLCSMJ-UHFFFAOYSA-N 0.000 description 1
- FMPZAAJFLNAMAC-UHFFFAOYSA-N 2-(4-iodophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(I)C=C1 FMPZAAJFLNAMAC-UHFFFAOYSA-N 0.000 description 1
- YOSSZEQCUXKUFP-UHFFFAOYSA-N 2-(4-methylphenyl)acetyl bromide Chemical compound CC1=CC=C(CC(Br)=O)C=C1 YOSSZEQCUXKUFP-UHFFFAOYSA-N 0.000 description 1
- DKEPOCFDMIRIMM-UHFFFAOYSA-N 2-(furan-2-yl)acetyl iodide Chemical compound IC(=O)CC1=CC=CO1 DKEPOCFDMIRIMM-UHFFFAOYSA-N 0.000 description 1
- KZDHMONYYLJPFO-UHFFFAOYSA-N 2-(furan-3-yl)acetyl chloride Chemical compound ClC(=O)CC=1C=COC=1 KZDHMONYYLJPFO-UHFFFAOYSA-N 0.000 description 1
- FNAHXXDNUWRXPS-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]acetyl bromide Chemical compound FC(F)(F)C1=CC=CC(CC(Br)=O)=C1 FNAHXXDNUWRXPS-UHFFFAOYSA-N 0.000 description 1
- FMTGEJIAFCTLAL-LMNIDFBRSA-N 2-[[(6r)-2-[(4-methoxyphenyl)methoxycarbonyl]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=C(C)CS[C@H]2N1C(=O)C2NC(=O)C1=CC=CC=C1C(O)=O FMTGEJIAFCTLAL-LMNIDFBRSA-N 0.000 description 1
- WMJWODXPNZWFHS-XCWJXAQQSA-N 2-[[(6r)-3-(acetyloxymethyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(=O)OC(C)(C)C)NC(=O)C1=CC=CC=C1C(O)=O WMJWODXPNZWFHS-XCWJXAQQSA-N 0.000 description 1
- XBCMFAGQEUAWLM-LEQGEALCSA-N 2-[[(6r)-3-(acetyloxymethyl)-2-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)C1=CC=CC=C1C(O)=O XBCMFAGQEUAWLM-LEQGEALCSA-N 0.000 description 1
- KCCLIDQJVHIKNF-LMNIDFBRSA-N 2-[[(6r)-3-(methoxymethyl)-2-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)COC)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)C1=CC=CC=C1C(O)=O KCCLIDQJVHIKNF-LMNIDFBRSA-N 0.000 description 1
- BZLGOYCKJRCWAQ-LMNIDFBRSA-N 2-[[(6r)-3-(methylsulfanylmethyl)-8-oxo-2-phenylmethoxycarbonyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)CSC)C(=O)OCC=1C=CC=CC=1)NC(=O)C1=CC=CC=C1C(O)=O BZLGOYCKJRCWAQ-LMNIDFBRSA-N 0.000 description 1
- GEKWKOBVZVRQQY-WIXQSORDSA-N 2-[[(6r)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@H]2SC=C(C(N2C1=O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)C)NC(=O)C1=CC=CC=C1C(O)=O GEKWKOBVZVRQQY-WIXQSORDSA-N 0.000 description 1
- UFAZDHSMZWMFRY-LMNIDFBRSA-N 2-[[(6r)-3-methyl-8-oxo-2-phenacyloxycarbonyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(=O)OCC(=O)C=1C=CC=CC=1)NC(=O)C1=CC=CC=C1C(O)=O UFAZDHSMZWMFRY-LMNIDFBRSA-N 0.000 description 1
- PUAXKJDMDIAPPO-UHFFFAOYSA-N 2-azidoacetyl bromide Chemical compound BrC(=O)CN=[N+]=[N-] PUAXKJDMDIAPPO-UHFFFAOYSA-N 0.000 description 1
- GEQZTCMVWVDEDF-UHFFFAOYSA-N 2-cyanoacetyl chloride Chemical compound ClC(=O)CC#N GEQZTCMVWVDEDF-UHFFFAOYSA-N 0.000 description 1
- DTUHGWFWMWDFOC-UHFFFAOYSA-N 2-iodo-3,4-dimethoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(I)=C1OC DTUHGWFWMWDFOC-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- PKUPAJQAJXVUEK-UHFFFAOYSA-N 2-phenoxyacetyl chloride Chemical compound ClC(=O)COC1=CC=CC=C1 PKUPAJQAJXVUEK-UHFFFAOYSA-N 0.000 description 1
- RVFDMBCQFHLFOE-UHFFFAOYSA-N 2-phenyl-2-(tritylamino)acetyl chloride Chemical compound C=1C=CC=CC=1C(C(=O)Cl)NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 RVFDMBCQFHLFOE-UHFFFAOYSA-N 0.000 description 1
- UJXIOVIFPTXDHU-UHFFFAOYSA-N 2-phenylethanethioyl chloride Chemical compound ClC(=S)CC1=CC=CC=C1 UJXIOVIFPTXDHU-UHFFFAOYSA-N 0.000 description 1
- LCRDDCDZEOSUTR-UHFFFAOYSA-N 2-thiophen-3-ylacetyl bromide Chemical compound BrC(=O)CC=1C=CSC=1 LCRDDCDZEOSUTR-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- MMJMKSISAXUKLF-UHFFFAOYSA-N 3-bromooctanoyl chloride Chemical compound CCCCCC(Br)CC(Cl)=O MMJMKSISAXUKLF-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CXFIWPAUNODACX-KQQUZDAGSA-N 4-[(1e,3e)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1\C=C\C=C\C1=CC=C(N(C)C)C=C1 CXFIWPAUNODACX-KQQUZDAGSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101100294115 Caenorhabditis elegans nhr-4 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 108010013381 Porins Proteins 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- RNIPBGMVTAUWNH-UHFFFAOYSA-N [F].[I] Chemical group [F].[I] RNIPBGMVTAUWNH-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- LRBPZXYPPIQQTA-QHDYGNBISA-N acetyloxymethyl (6r)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC)=C(C(=O)OCOC(C)=O)N2C(=O)C(N)[C@@H]12 LRBPZXYPPIQQTA-QHDYGNBISA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- OQNQWSYPXOWUHL-LMNIDFBRSA-N benzhydryl (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1C(C)=NN=C1SCC1=C(C(=O)OC(C=2C=CC=CC=2)C=2C=CC=CC=2)N2C(=O)C(N)[C@H]2SC1 OQNQWSYPXOWUHL-LMNIDFBRSA-N 0.000 description 1
- 125000003460 beta-lactamyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- VRHAQNTWKSVEEC-UHFFFAOYSA-N ethyl 1,3-dioxoisoindole-2-carboxylate Chemical compound C1=CC=C2C(=O)N(C(=O)OCC)C(=O)C2=C1 VRHAQNTWKSVEEC-UHFFFAOYSA-N 0.000 description 1
- 238000003810 ethyl acetate extraction Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical group C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- NIPYIXMXODGEES-UHFFFAOYSA-N hexanoyl bromide Chemical compound CCCCCC(Br)=O NIPYIXMXODGEES-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- GLNWILHOFOBOFD-UHFFFAOYSA-N lithium sulfide Chemical compound [Li+].[Li+].[S-2] GLNWILHOFOBOFD-UHFFFAOYSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- JKVSTVFFEMRSSY-JLHJGDBNSA-N methyl (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=C(C)CS[C@@H]2C(N)C(=O)N12 JKVSTVFFEMRSSY-JLHJGDBNSA-N 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- 102000007739 porin activity proteins Human genes 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical group [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000011027 product recovery Methods 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- QQKDTTWZXHEGAQ-UHFFFAOYSA-N propyl carbonochloridate Chemical compound CCCOC(Cl)=O QQKDTTWZXHEGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- JNMXRZLTEMBYQV-KPMSDPLLSA-N tert-butyl (6r)-3-(acetyloxymethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(=O)OC(C)(C)C)NC(=O)CC1=CC=CS1 JNMXRZLTEMBYQV-KPMSDPLLSA-N 0.000 description 1
- NNAIJPHLCFGSIW-OMNKOJBGSA-N tert-butyl (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(C)=C(C(=O)OC(C)(C)C)N2C(=O)C(N)[C@@H]12 NNAIJPHLCFGSIW-OMNKOJBGSA-N 0.000 description 1
- UJJDEOLXODWCGK-UHFFFAOYSA-N tert-butyl carbonochloridate Chemical compound CC(C)(C)OC(Cl)=O UJJDEOLXODWCGK-UHFFFAOYSA-N 0.000 description 1
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/371,095 US4005074A (en) | 1973-06-18 | 1973-06-18 | Process for cleaving an imido side chain from penicillins and cephalosporins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL44792A0 IL44792A0 (en) | 1974-07-31 |
| IL44792A true IL44792A (en) | 1977-10-31 |
Family
ID=23462454
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL44792A IL44792A (en) | 1973-06-18 | 1974-05-09 | Penicillin and cephalosporin cleavage process and compounds useful therein |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4005074A (esLanguage) |
| JP (2) | JPS5926630B2 (esLanguage) |
| BE (1) | BE816409A (esLanguage) |
| CA (1) | CA1018154A (esLanguage) |
| CH (1) | CH601305A5 (esLanguage) |
| DE (1) | DE2429184A1 (esLanguage) |
| ES (2) | ES427390A1 (esLanguage) |
| FR (2) | FR2233327B1 (esLanguage) |
| GB (1) | GB1474545A (esLanguage) |
| IE (1) | IE39254B1 (esLanguage) |
| IL (1) | IL44792A (esLanguage) |
| NL (1) | NL7408166A (esLanguage) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53155996U (esLanguage) * | 1977-05-13 | 1978-12-07 | ||
| JPS5687664U (esLanguage) * | 1979-12-10 | 1981-07-14 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3487074A (en) * | 1966-01-14 | 1969-12-30 | Bristol Myers Co | Derivatives of 6-amino-3-penamylcarboxylic acid and 7-amino-2,2-dimethyl-cephalosporanic acid |
| US3843682A (en) * | 1972-05-15 | 1974-10-22 | Lilly Co Eli | 2-chlorosulfinyl-3-imido-azetedin-4-ones |
-
1973
- 1973-06-18 US US05/371,095 patent/US4005074A/en not_active Expired - Lifetime
-
1974
- 1974-05-07 IE IE964/74A patent/IE39254B1/xx unknown
- 1974-05-09 IL IL44792A patent/IL44792A/en unknown
- 1974-05-15 CA CA199,955A patent/CA1018154A/en not_active Expired
- 1974-06-12 GB GB2683974A patent/GB1474545A/en not_active Expired
- 1974-06-17 BE BE1006025A patent/BE816409A/xx unknown
- 1974-06-18 DE DE2429184A patent/DE2429184A1/de not_active Withdrawn
- 1974-06-18 ES ES427390A patent/ES427390A1/es not_active Expired
- 1974-06-18 NL NL7408166A patent/NL7408166A/xx not_active Application Discontinuation
- 1974-06-18 FR FR7421141A patent/FR2233327B1/fr not_active Expired
- 1974-06-18 JP JP49070087A patent/JPS5926630B2/ja not_active Expired
- 1974-06-18 CH CH832574A patent/CH601305A5/xx not_active IP Right Cessation
- 1974-06-18 ES ES427389A patent/ES427389A1/es not_active Expired
- 1974-10-30 FR FR7436320A patent/FR2238705B1/fr not_active Expired
-
1982
- 1982-02-23 JP JP57028720A patent/JPS57197281A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IL44792A0 (en) | 1974-07-31 |
| CH601305A5 (esLanguage) | 1978-07-14 |
| ES427389A1 (es) | 1976-07-16 |
| DE2429184A1 (de) | 1975-01-02 |
| FR2233327B1 (esLanguage) | 1977-10-07 |
| GB1474545A (en) | 1977-05-25 |
| CA1018154A (en) | 1977-09-27 |
| FR2238705A1 (esLanguage) | 1975-02-21 |
| NL7408166A (esLanguage) | 1974-12-20 |
| ES427390A1 (es) | 1976-07-16 |
| FR2233327A1 (esLanguage) | 1975-01-10 |
| US4005074A (en) | 1977-01-25 |
| BE816409A (fr) | 1974-12-17 |
| JPS6135198B2 (esLanguage) | 1986-08-12 |
| USB371095I5 (esLanguage) | 1976-03-23 |
| JPS5036489A (esLanguage) | 1975-04-05 |
| JPS57197281A (en) | 1982-12-03 |
| IE39254B1 (en) | 1978-08-30 |
| JPS5926630B2 (ja) | 1984-06-29 |
| FR2238705B1 (esLanguage) | 1979-02-23 |
| IE39254L (en) | 1974-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3994885A (en) | Process for etherifying β-lactam antibiotics | |
| US4065620A (en) | 3-(Substituted) vinyl cephalosporins | |
| JPS6145627B2 (esLanguage) | ||
| US4369312A (en) | Method of producing oxo-containing azetidinone compounds | |
| US4316024A (en) | Dioxo piperazine compounds | |
| US5359058A (en) | Cephem derivatives | |
| CA1074782A (en) | Amino-substituted cephalosporins | |
| JPS61249989A (ja) | 7−アミノ−3−プロペニルセフアロスポラン酸及びそのエステル | |
| JPS6133833B2 (esLanguage) | ||
| US3647786A (en) | Preparation of cephalosporin sulfoxides | |
| US3905966A (en) | Cephalosporin cleavage process | |
| US4044000A (en) | Substituted β-lactam antibiotics | |
| IL44792A (en) | Penicillin and cephalosporin cleavage process and compounds useful therein | |
| US3968109A (en) | Production of 2-(thio substituted)cephalosporin sulfoxides and 2-(thio substituted)cephalosporins | |
| US4247461A (en) | Esterification process using methoxymethyl-P-toluenesulfonate | |
| AU619201B2 (en) | Process for the preparation of 3-exomethylene cepham derivatives | |
| US4012380A (en) | 7-Acylamino-3-acyl-2(or 3)cephems | |
| US4103086A (en) | 8-Oxo-4-thia-1-azabicyclo (4.2.0)-oct-2-ene derivatives | |
| US3994888A (en) | Cephalosporin cleavage process | |
| US3586667A (en) | Penicillin esterification process | |
| US4016155A (en) | Process for preparing cephalosporin derivatives | |
| US4001239A (en) | Cephalosporin cleavage process | |
| GB1582960A (en) | Chemical synthesis of -lactam derivatives | |
| JPH02117680A (ja) | 3―クロロセファロスポリン骨格を有する化合物 | |
| US4091214A (en) | De-esterification process for cephalosporins |