IL41616A0 - 2,4-bis-(trifluoromethyl)-6-nitrophenol derivatives,their preparation and their use as herbicides - Google Patents
2,4-bis-(trifluoromethyl)-6-nitrophenol derivatives,their preparation and their use as herbicidesInfo
- Publication number
- IL41616A0 IL41616A0 IL41616A IL4161673A IL41616A0 IL 41616 A0 IL41616 A0 IL 41616A0 IL 41616 A IL41616 A IL 41616A IL 4161673 A IL4161673 A IL 4161673A IL 41616 A0 IL41616 A0 IL 41616A0
- Authority
- IL
- Israel
- Prior art keywords
- herbicides
- trifluoromethyl
- bis
- preparation
- nitrophenol derivatives
- Prior art date
Links
- VRQKCPBODHTCFI-UHFFFAOYSA-N 2-nitro-4,6-bis(trifluoromethyl)phenol Chemical class OC1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1C(F)(F)F VRQKCPBODHTCFI-UHFFFAOYSA-N 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/26—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups and being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
- C07C205/46—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group the carbon skeleton containing carbon atoms of quinone rings
- C07C205/47—Anthraquinones containing nitro groups
- C07C205/48—Anthraquinones containing nitro groups the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/64—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms
- C07C309/65—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms of a saturated carbon skeleton
- C07C309/66—Methanesulfonates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2209528A DE2209528A1 (de) | 1972-02-29 | 1972-02-29 | 2,4-bis-(trifluormethyl)-6-nitrophenol-derivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL41616A0 true IL41616A0 (en) | 1973-04-30 |
Family
ID=5837428
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL41616A IL41616A0 (en) | 1972-02-29 | 1973-02-26 | 2,4-bis-(trifluoromethyl)-6-nitrophenol derivatives,their preparation and their use as herbicides |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3894074A (it) |
| JP (2) | JPS4898026A (it) |
| BE (1) | BE795943A (it) |
| BR (1) | BR7301408D0 (it) |
| DE (1) | DE2209528A1 (it) |
| FR (1) | FR2174154A1 (it) |
| GB (1) | GB1378994A (it) |
| IL (1) | IL41616A0 (it) |
| IT (1) | IT979544B (it) |
| NL (1) | NL7302653A (it) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4416687A (en) * | 1982-02-01 | 1983-11-22 | Monsanto Company | 3,5-Bis (trifluoromethyl)phenoxy carboxylic acids and derivatives thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2933383A (en) * | 1956-11-23 | 1960-04-19 | Union Carbide Corp | Method of combating weeds using nu-substituted carbamates of 2, 4, 5-trichloro, 6-nitro phenol |
| US3453099A (en) * | 1966-07-07 | 1969-07-01 | Pennsalt Chemicals Corp | Treating plants with phytotoxic,fluorosulfonated substituted phenols |
-
0
- BE BE795943D patent/BE795943A/xx unknown
-
1972
- 1972-02-29 DE DE2209528A patent/DE2209528A1/de active Pending
-
1973
- 1973-02-23 US US335400A patent/US3894074A/en not_active Expired - Lifetime
- 1973-02-26 IL IL41616A patent/IL41616A0/xx unknown
- 1973-02-26 NL NL7302653A patent/NL7302653A/xx unknown
- 1973-02-26 BR BR731408A patent/BR7301408D0/pt unknown
- 1973-02-27 IT IT20937/73A patent/IT979544B/it active
- 1973-02-28 GB GB972573A patent/GB1378994A/en not_active Expired
- 1973-02-28 JP JP48023377A patent/JPS4898026A/ja active Pending
- 1973-02-28 JP JP48023376A patent/JPS4897829A/ja active Pending
- 1973-02-28 FR FR7307098A patent/FR2174154A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2174154A1 (it) | 1973-10-12 |
| JPS4897829A (it) | 1973-12-13 |
| DE2209528A1 (de) | 1973-09-06 |
| NL7302653A (it) | 1973-08-31 |
| BE795943A (fr) | 1973-08-27 |
| US3894074A (en) | 1975-07-08 |
| BR7301408D0 (pt) | 1974-07-11 |
| JPS4898026A (it) | 1973-12-13 |
| GB1378994A (en) | 1975-01-02 |
| IT979544B (it) | 1974-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL44710A0 (en) | Azolyl-amidines,their preparation and their use as herbicides | |
| IL41546A0 (en) | 1-aminouracil compounds,their production and their use as herbicides | |
| IL39391A0 (en) | Imidazolidinone-(2)derivatives,their preparation and their use as herbicides | |
| IL43536A0 (en) | Tetrahydro-1,3,5-triazine-2,6-diones,their production and their use as herbicides | |
| IL40395A0 (en) | 2,5-dioxo-imidazolidine derivatives,their production and their use as selective herbicides | |
| IL41472A0 (en) | New pyrazoline derivatives,their preparation and their use as pesticides | |
| IL41468A0 (en) | 1-aminosulphonyl-2-aminobenzimidazoles,their preparation and their use as fungicides | |
| ZA738419B (en) | New derivatives of 2-aminoindane,the preparation and use thereof | |
| IL42103A0 (en) | Novel s-triazinedione derivatives,their preparation and their use as herbicides | |
| IL43864A0 (en) | N-propargylacetanilides,their preparation and their use as herbicides | |
| KE2740A (en) | 2,3-dihydrobenzofuranyl-7-n-methyl-carbamates, their preparation and their use as insecticides | |
| IL40124A (en) | Substituted halogeno-acetanilides,their preparation and use as herbicides | |
| IL39039A0 (en) | Substituted chlorocarbonylureas,their preparation and their use as herbicides | |
| IL41616A0 (en) | 2,4-bis-(trifluoromethyl)-6-nitrophenol derivatives,their preparation and their use as herbicides | |
| IL43376A0 (en) | Novel alanine derivatives,their preparation and their use as selective herbicides | |
| IL36104A0 (en) | 2,4-bis-(trifluoromethyl)-6-nitroaniline derivatives,their preparation and their use as herbicides | |
| IL44666A0 (en) | Dichlorothiazolylureas,their preparation and their use as herbicides | |
| IL36875A (en) | 3,4-bistrifluoromethyl-phenylurea derivatives,their manufacture and their use as selective herbicides | |
| IL44000A0 (en) | 1-alkylideneaminouracils,their preparation and their use as herbicides | |
| IL45421A0 (en) | Thiadiazolylureas,their preparation and their use as herbicides | |
| IE37196B1 (en) | 1,2-dialkyl-3,5 - diphenylpyrazolium salts and their use as herbicides | |
| IL36103A (en) | Substituted 6-nitroaniline derivatives,their preparation,and their use as herbicides | |
| IL42095A0 (en) | Novel 1,3,5-triazinediones,their preparation and their use as herbicides | |
| IL43604A0 (en) | Alpha-pyrone derivatives,their preparations and their use as herbicides | |
| ZA737360B (en) | New derivatives of 1,4-benzodioxan,the preparation and the use thereof |