IL40630A - Electrolytic production of alkali metal hydroxide with a high degree of purity - Google Patents
Electrolytic production of alkali metal hydroxide with a high degree of purityInfo
- Publication number
- IL40630A IL40630A IL40630A IL4063072A IL40630A IL 40630 A IL40630 A IL 40630A IL 40630 A IL40630 A IL 40630A IL 4063072 A IL4063072 A IL 4063072A IL 40630 A IL40630 A IL 40630A
- Authority
- IL
- Israel
- Prior art keywords
- alkali metal
- anode
- solution
- cathode
- compartment
- Prior art date
Links
- 150000008044 alkali metal hydroxides Chemical class 0.000 title claims abstract description 40
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- 239000012528 membrane Substances 0.000 claims abstract description 53
- 229910001508 alkali metal halide Inorganic materials 0.000 claims abstract description 38
- 150000008045 alkali metal halides Chemical class 0.000 claims abstract description 38
- 229910052751 metal Inorganic materials 0.000 claims abstract description 20
- 239000002184 metal Substances 0.000 claims abstract description 20
- 239000012535 impurity Substances 0.000 claims abstract description 11
- 238000005868 electrolysis reaction Methods 0.000 claims abstract description 9
- 229920001577 copolymer Polymers 0.000 claims abstract description 8
- 125000000542 sulfonic acid group Chemical group 0.000 claims abstract description 5
- 239000000243 solution Substances 0.000 claims description 53
- 238000000034 method Methods 0.000 claims description 38
- 230000008569 process Effects 0.000 claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 238000000576 coating method Methods 0.000 claims description 13
- 239000006104 solid solution Substances 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000000460 chlorine Chemical group 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 239000011248 coating agent Substances 0.000 claims description 11
- 229910044991 metal oxide Inorganic materials 0.000 claims description 10
- 150000004706 metal oxides Chemical class 0.000 claims description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 10
- -1 alkali metal chlorate Chemical class 0.000 claims description 9
- 229910052731 fluorine Inorganic materials 0.000 claims description 9
- 239000011737 fluorine Substances 0.000 claims description 9
- 239000001257 hydrogen Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000000758 substrate Substances 0.000 claims description 9
- 239000003792 electrolyte Substances 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 8
- 239000010970 precious metal Substances 0.000 claims description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052719 titanium Inorganic materials 0.000 claims description 6
- 239000010936 titanium Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000002091 cationic group Chemical group 0.000 claims description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- 239000011780 sodium chloride Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910001507 metal halide Inorganic materials 0.000 claims description 2
- 150000005309 metal halides Chemical class 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910000566 Platinum-iridium alloy Inorganic materials 0.000 claims 2
- HWLDNSXPUQTBOD-UHFFFAOYSA-N platinum-iridium alloy Chemical class [Ir].[Pt] HWLDNSXPUQTBOD-UHFFFAOYSA-N 0.000 claims 2
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 229910000831 Steel Inorganic materials 0.000 claims 1
- 239000011133 lead Substances 0.000 claims 1
- 239000011347 resin Substances 0.000 claims 1
- 229920005989 resin Polymers 0.000 claims 1
- 239000010935 stainless steel Substances 0.000 claims 1
- 229910001220 stainless steel Inorganic materials 0.000 claims 1
- 239000010959 steel Substances 0.000 claims 1
- 239000004408 titanium dioxide Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 abstract description 5
- 230000015556 catabolic process Effects 0.000 abstract description 3
- 238000006731 degradation reaction Methods 0.000 abstract description 3
- 239000003010 cation ion exchange membrane Substances 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- 239000012267 brine Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 239000003518 caustics Substances 0.000 description 14
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 12
- 229910052753 mercury Inorganic materials 0.000 description 12
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 7
- 238000007792 addition Methods 0.000 description 7
- 238000013508 migration Methods 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 238000010521 absorption reaction Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- 235000011164 potassium chloride Nutrition 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000008151 electrolyte solution Substances 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 229910001415 sodium ion Inorganic materials 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 241001547866 Anoda Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000008098 Oxalis acetosella Nutrition 0.000 description 1
- 240000007930 Oxalis acetosella Species 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229910000751 Rn alloy Inorganic materials 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 238000005234 chemical deposition Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- FJIUUBZGIYMKFS-UHFFFAOYSA-N dioxoruthenium oxygen(2-) titanium(4+) Chemical compound [Ru](=O)=O.[O-2].[O-2].[Ti+4] FJIUUBZGIYMKFS-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J5/00—Manufacture of articles or shaped materials containing macromolecular substances
- C08J5/20—Manufacture of shaped structures of ion-exchange resins
- C08J5/22—Films, membranes or diaphragms
- C08J5/2206—Films, membranes or diaphragms based on organic and/or inorganic macromolecular compounds
- C08J5/2218—Synthetic macromolecular compounds
- C08J5/2231—Synthetic macromolecular compounds based on macromolecular compounds obtained by reactions involving unsaturated carbon-to-carbon bonds
- C08J5/2237—Synthetic macromolecular compounds based on macromolecular compounds obtained by reactions involving unsaturated carbon-to-carbon bonds containing fluorine
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
- C25B1/46—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis in diaphragm cells
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/17—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof
- C25B9/19—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof with diaphragms
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J2327/00—Characterised by the use of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Derivatives of such polymers
- C08J2327/02—Characterised by the use of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Derivatives of such polymers not modified by chemical after-treatment
- C08J2327/12—Characterised by the use of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Derivatives of such polymers not modified by chemical after-treatment containing fluorine atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Metallurgy (AREA)
- Electrochemistry (AREA)
- Inorganic Chemistry (AREA)
- Manufacturing & Machinery (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL55151A IL55151A (en) | 1972-10-20 | 1978-07-17 | Production of alkali metal carbonates in a membrane cell |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/191,424 US4025405A (en) | 1971-10-21 | 1971-10-21 | Electrolytic production of high purity alkali metal hydroxide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL40630A0 IL40630A0 (en) | 1972-12-29 |
| IL40630A true IL40630A (en) | 1976-01-30 |
Family
ID=22705454
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL40630A IL40630A (en) | 1971-10-21 | 1972-10-20 | Electrolytic production of alkali metal hydroxide with a high degree of purity |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4025405A (cs) |
| JP (1) | JPS4861397A (cs) |
| AR (1) | AR196207A1 (cs) |
| AT (1) | AT319277B (cs) |
| AU (1) | AU6427974A (cs) |
| BE (1) | BE790369A (cs) |
| BR (1) | BR7207368D0 (cs) |
| CA (1) | CA1036975A (cs) |
| DE (1) | DE2251660B2 (cs) |
| FI (1) | FI56704B (cs) |
| FR (1) | FR2156858B1 (cs) |
| GB (1) | GB1402920A (cs) |
| IL (1) | IL40630A (cs) |
| IT (1) | IT966439B (cs) |
| LU (1) | LU66331A1 (cs) |
| NL (1) | NL161202B (cs) |
| ZA (1) | ZA727499B (cs) |
Families Citing this family (97)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4192725A (en) * | 1971-10-21 | 1980-03-11 | Diamond Shamrock Corporation | Electrolytic production of high purity alkali metal hydroxide |
| US3976549A (en) * | 1973-02-26 | 1976-08-24 | Hooker Chemicals & Plastics Corporation | Electrolysis method |
| DE2437395C3 (de) * | 1973-10-15 | 1979-02-08 | E.I. Du Pont De Nemours And Co., Wilmington, Del. (V.St.A.) | Folie aus fluorhaltigen Polymeren mit Sulfonylgruppen enthaltenden Seitenketten |
| JPS551351B2 (cs) * | 1974-03-07 | 1980-01-12 | ||
| GB1487284A (en) * | 1974-03-09 | 1977-09-28 | Asahi Chemical Ind | Electrolysis |
| JPS5111098A (en) * | 1974-07-19 | 1976-01-28 | Asahi Glass Co Ltd | Suisankakariumuno seizohoho |
| JPS5154082A (ja) * | 1974-11-08 | 1976-05-12 | Asahi Glass Co Ltd | Yoionkokanmaku |
| IT1061477B (it) * | 1975-07-09 | 1983-02-28 | Asahi Chemical Ind | Membrana scambiatrice di cationi sua preparazione e suo impiego |
| JPS529700A (en) * | 1975-07-15 | 1977-01-25 | Asahi Chem Ind Co Ltd | Manufacturing method of high purity caustic soda solution |
| JPS5231331A (en) * | 1975-09-03 | 1977-03-09 | Seiko Instr & Electronics | Separator for alkaline battery |
| JPS5833312B2 (ja) * | 1975-10-28 | 1983-07-19 | 旭化成株式会社 | カセイアルカリスイヨウエキノノウシユクホウ |
| JPS5926671B2 (ja) * | 1975-11-19 | 1984-06-29 | 呉羽化学工業株式会社 | イオンコウカンマクデンカイホウホウ |
| JPS5284194A (en) * | 1975-12-30 | 1977-07-13 | Asahi Glass Co Ltd | Electrolysis of alkali chloride |
| JPS534796A (en) * | 1976-07-05 | 1978-01-17 | Asahi Chem Ind Co Ltd | Electrolysis of pressurized alkali halide |
| CA1117895A (en) * | 1976-12-17 | 1982-02-09 | Basf Wyandotte Corporation | Method of reducing chlorate formation in a chlor-alkali electrolytic cell |
| USRE30864E (en) * | 1977-06-27 | 1982-02-09 | Olin Corporation | Process for electrolysis in a membrane cell employing pressure actuated uniform spacing |
| US4129493A (en) * | 1977-06-30 | 1978-12-12 | Diamond Shamrock Corporation | Swimming pool chlorinator system |
| US4124458A (en) * | 1977-07-11 | 1978-11-07 | Innova, Inc. | Mass-transfer membrane and processes using same |
| JPS5337198A (en) * | 1977-07-15 | 1978-04-06 | Asahi Chem Ind Co Ltd | Electrolytic method of sodium chloride |
| GB2007260B (en) * | 1977-09-22 | 1982-02-24 | Kanegafuchi Chemical Ind | Method of electrolysis of alkai metal chloride |
| US4142950A (en) * | 1977-11-10 | 1979-03-06 | Basf Wyandotte Corporation | Apparatus and process for electrolysis using a cation-permselective membrane and turbulence inducing means |
| US4224121A (en) * | 1978-07-06 | 1980-09-23 | General Electric Company | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane |
| US4191618A (en) * | 1977-12-23 | 1980-03-04 | General Electric Company | Production of halogens in an electrolysis cell with catalytic electrodes bonded to an ion transporting membrane and an oxygen depolarized cathode |
| US4219394A (en) * | 1978-03-22 | 1980-08-26 | Diamond Shamrock Corporation | Membrane assembly for electrolytic cells |
| US4230543A (en) * | 1978-04-07 | 1980-10-28 | Showa Denko K.K. | Cathode for electrolysis of aqueous solution of alkali metal halide |
| US4196068A (en) * | 1978-06-26 | 1980-04-01 | Scoville Frank J | Chlorine gas producing apparatus |
| US4242193A (en) * | 1978-11-06 | 1980-12-30 | Innova, Inc. | Layered membrane and processes utilizing same |
| JPS5946316B2 (ja) * | 1978-12-28 | 1984-11-12 | 鐘淵化学工業株式会社 | 電解法 |
| US4248680A (en) * | 1979-01-24 | 1981-02-03 | Ppg Industries, Inc. | Electrolytic process and apparatus |
| US4212714A (en) * | 1979-05-14 | 1980-07-15 | General Electric Company | Electrolysis of alkali metal halides in a three compartment cell with self-pressurized buffer compartment |
| US4273628A (en) * | 1979-05-29 | 1981-06-16 | Diamond Shamrock Corp. | Production of chromic acid using two-compartment and three-compartment cells |
| US4384937A (en) * | 1979-05-29 | 1983-05-24 | Diamond Shamrock Corporation | Production of chromic acid in a three-compartment cell |
| US4272338A (en) * | 1979-06-06 | 1981-06-09 | Olin Corporation | Process for the treatment of anolyte brine |
| US4230544A (en) * | 1979-08-31 | 1980-10-28 | Ionics Inc. | Method and apparatus for controlling anode pH in membrane chlor-alkali cells |
| US4337211A (en) * | 1980-06-11 | 1982-06-29 | The Dow Chemical Company | Fluorocarbon ethers having substituted halogen site(s) and process to prepare |
| US4358412A (en) * | 1980-06-11 | 1982-11-09 | The Dow Chemical Company | Preparation of vinyl ethers |
| US4337137A (en) * | 1980-06-11 | 1982-06-29 | The Dow Chemical Company | Composite ion exchange membranes |
| US4470889A (en) * | 1980-06-11 | 1984-09-11 | The Dow Chemical Company | Electrolytic cell having an improved ion exchange membrane and process for operating |
| US4515989A (en) * | 1980-06-11 | 1985-05-07 | The Dow Chemical Company | Preparation decarboxylation and polymerization of novel acid flourides and resulting monomers |
| US4804727A (en) * | 1980-06-11 | 1989-02-14 | The Dow Chemical Company | Process to produce novel fluorocarbon vinyl ethers and resulting polymers |
| US4330654A (en) * | 1980-06-11 | 1982-05-18 | The Dow Chemical Company | Novel polymers having acid functionality |
| US4337126A (en) * | 1980-10-27 | 1982-06-29 | Diamond Shamrock Corporation | Electrolysis of carbonates to produce hydroxides |
| US4410404A (en) * | 1981-06-26 | 1983-10-18 | Diamond Shamrock Corporation | Membrane cell at increased caustic concentration |
| US4394226A (en) * | 1981-07-28 | 1983-07-19 | Thiokol Corporation | Electrolytic method for producing quaternary ammonium hydroxides |
| US4871703A (en) * | 1983-05-31 | 1989-10-03 | The Dow Chemical Company | Process for preparation of an electrocatalyst |
| US4650551A (en) * | 1985-05-31 | 1987-03-17 | The Dow Chemical Company | Supported ion exchange membrane films |
| US4650711A (en) * | 1985-05-31 | 1987-03-17 | The Dow Chemical Company | Method for sizing polytetrafluoroethylene fabrics |
| US4784900A (en) * | 1985-05-31 | 1988-11-15 | University Of Bath | Method for sizing polytretrafluoroethylene fabrics |
| US4784882A (en) * | 1985-05-31 | 1988-11-15 | The Dow Chemical Company | Method for forming composite polymer films |
| US5110385A (en) * | 1985-05-31 | 1992-05-05 | The Dow Chemical Company | Method for forming polymer composite films using a removable substrate |
| US5114515A (en) * | 1985-05-31 | 1992-05-19 | The Dow Chemical Company | Method for forming polymer composite films using removable substrates |
| US4610762A (en) * | 1985-05-31 | 1986-09-09 | The Dow Chemical Company | Method for forming polymer films having bubble release surfaces |
| US4666580A (en) * | 1985-12-16 | 1987-05-19 | The Dow Chemical Company | Structural frame for an electrochemical cell |
| US4668372A (en) * | 1985-12-16 | 1987-05-26 | The Dow Chemical Company | Method for making an electrolytic unit from a plastic material |
| US4668371A (en) * | 1985-12-16 | 1987-05-26 | The Dow Chemical Company | Structural frame for an electrochemical cell |
| US4670123A (en) * | 1985-12-16 | 1987-06-02 | The Dow Chemical Company | Structural frame for an electrochemical cell |
| US4666579A (en) * | 1985-12-16 | 1987-05-19 | The Dow Chemical Company | Structural frame for a solid polymer electrolyte electrochemical cell |
| US4698243A (en) * | 1986-06-20 | 1987-10-06 | The Dow Chemical Company | Method for sizing and hydrolyzing polytetrafluoroethylene fabrics, fibers, yarns, or threads |
| US4778723A (en) * | 1986-06-20 | 1988-10-18 | The Dow Chemical Company | Method for sizing polytetrafluoroethylene fibers, yarn, or threads |
| US4731263A (en) * | 1986-09-26 | 1988-03-15 | The Dow Chemical Company | Method for the preparation of ionomer films |
| US4889577A (en) * | 1986-12-19 | 1989-12-26 | The Dow Chemical Company | Method for making an improved supported membrane/electrode structure combination wherein catalytically active particles are coated onto the membrane |
| US5039389A (en) * | 1986-12-19 | 1991-08-13 | The Dow Chemical Company | Membrane/electrode combination having interconnected roadways of catalytically active particles |
| US4738741A (en) * | 1986-12-19 | 1988-04-19 | The Dow Chemical Company | Method for forming an improved membrane/electrode combination having interconnected roadways of catalytically active particles |
| US4752370A (en) * | 1986-12-19 | 1988-06-21 | The Dow Chemical Company | Supported membrane/electrode structure combination wherein catalytically active particles are coated onto the membrane |
| US4940525A (en) * | 1987-05-08 | 1990-07-10 | The Dow Chemical Company | Low equivalent weight sulfonic fluoropolymers |
| US4900408A (en) * | 1988-02-01 | 1990-02-13 | E. I. Du Pont De Nemours & Co. | Membrane electrolytic process for producing concentrated caustic |
| IT1230714B (it) * | 1989-02-10 | 1991-10-29 | Solvay | Procedimento di fabbricazione di un solfuro di un metallo alcalino. |
| US5013414A (en) * | 1989-04-19 | 1991-05-07 | The Dow Chemical Company | Electrode structure for an electrolytic cell and electrolytic process used therein |
| IT1251419B (it) * | 1991-10-23 | 1995-05-09 | Solvay | Cella di elettrolisi per la produzione di un gas |
| BE1005716A3 (fr) * | 1992-03-09 | 1993-12-28 | Solvay | Procede de fabricatiion d'hydroxyde de sodium. |
| US5433861A (en) * | 1993-09-17 | 1995-07-18 | The Dow Chemical Company | Permanent deformation and use of sulfonated halopolymer articles |
| US5716504A (en) * | 1995-07-10 | 1998-02-10 | Asahi Glass Company Ltd. | Cation exchange membrane for electrolysis and process for producing potassium hydroxide of high purity |
| US6123853A (en) * | 1999-10-14 | 2000-09-26 | Pioneer (East) Inc. | Method for treating waste water used in alkali metal hydroxide manufacturing processes |
| US6123826A (en) * | 1999-10-14 | 2000-09-26 | Pioneer (East) Inc. | Method for removal of nickel and iron from alkali metal hydroxide streams without requiring the use of sodium borohydride |
| US6080299A (en) * | 1999-10-14 | 2000-06-27 | Pioneer (East) Inc. | Method for removal of nickel and iron from alkali metal hydroxide manufacturing process requiring the use of sodium borohydride |
| US6200455B1 (en) | 1999-10-14 | 2001-03-13 | Pioneer (East) Inc. | Method for reducing the plating of nickel on vessels, piping and cells in an alkali metal hydroxide manufacturing process |
| US6375825B1 (en) | 1999-10-28 | 2002-04-23 | Chemical Products Corporation | Process for the production of alkaline earth hydroxide |
| US20040035696A1 (en) * | 2002-08-21 | 2004-02-26 | Reinhard Fred P. | Apparatus and method for membrane electrolysis for process chemical recycling |
| DE10347703A1 (de) * | 2003-10-14 | 2005-05-12 | Bayer Materialscience Ag | Konstruktionseinheit für bipolare Elektrolyseure |
| EP1609887A1 (en) * | 2004-06-22 | 2005-12-28 | CHLORINE ENGINEERS CORP., Ltd. | Ion exchange membrane electrolytic process |
| ITRM20050666A1 (it) * | 2005-12-30 | 2007-06-30 | E C A S S R L | Blocco di reattori elettrolitici a membrana con quattro camere. |
| DE102006023261A1 (de) * | 2006-05-18 | 2007-11-22 | Bayer Materialscience Ag | Verfahren zur Herstellung von Chlor aus Chlorwasserstoff und Sauerstoff |
| DE102006041465A1 (de) * | 2006-09-02 | 2008-03-06 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diarylcarbonat |
| DE102007058701A1 (de) | 2007-12-06 | 2009-06-10 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diarylcarbonat |
| DE102008011473A1 (de) | 2008-02-27 | 2009-09-03 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polycarbonat |
| DE102009017862A1 (de) | 2009-04-17 | 2010-10-21 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diarylcarbonat |
| DE102009023940A1 (de) * | 2009-06-04 | 2010-12-09 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polycarbonat |
| US8499722B2 (en) | 2010-05-28 | 2013-08-06 | Hno Greenfuels, Inc. | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| US9476357B2 (en) | 2010-03-15 | 2016-10-25 | HNO Green Fuels, Inc. | Method and apparatus for increasing combustion efficiency and reducing particulate matter emissions in jet engines |
| US9399946B2 (en) | 2010-05-28 | 2016-07-26 | Donald W. Owens | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| US9453457B2 (en) | 2010-03-15 | 2016-09-27 | HNO Green Fuels, Inc. | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| US8449735B2 (en) | 2010-03-15 | 2013-05-28 | Hno Greenfuels, Inc. | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| US9574492B2 (en) | 2010-03-15 | 2017-02-21 | HNO Green Fuels, Inc. | Portable hydrogen supplemental system and method for lowering particulate matter and other emissions in diesel engines at idle |
| US8757107B2 (en) | 2010-05-28 | 2014-06-24 | Hno Greenfuels, Inc. | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| US8449736B2 (en) | 2010-05-28 | 2013-05-28 | Hno Greenfuels, Inc. | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| EP2751418A1 (en) * | 2011-09-02 | 2014-07-09 | Donald Wade Owens | Hydrogen supplemental system for on-demand hydrogen generation for internal combustion engines |
| EP4083106B1 (de) | 2021-04-30 | 2024-04-10 | Covestro Deutschland AG | Verfahren zur herstellung von polycarbonat mit verbesserter nachhaltigkeit |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2967807A (en) * | 1952-01-23 | 1961-01-10 | Hooker Chemical Corp | Electrolytic decomposition of sodium chloride |
| US3282875A (en) * | 1964-07-22 | 1966-11-01 | Du Pont | Fluorocarbon vinyl ether polymers |
| GB1184321A (en) | 1968-05-15 | 1970-03-11 | Du Pont | Electrochemical Cells |
| US3562008A (en) * | 1968-10-14 | 1971-02-09 | Ppg Industries Inc | Method for producing a ruthenium coated titanium electrode |
| US3694281A (en) * | 1969-04-28 | 1972-09-26 | Pullman Inc | Process for forming a diaphragm for use in an electrolytic cell |
| US3663414A (en) * | 1969-06-27 | 1972-05-16 | Ppg Industries Inc | Electrode coating |
| FR2021289A5 (en) * | 1969-08-29 | 1970-07-17 | Bitterfeld Chemie | Electrolysis cell for aqueous salt solns |
| US3657104A (en) * | 1970-11-05 | 1972-04-18 | Ionics | Bifunctional cation exchange membranes and their use in electrolyticcells |
| US3684543A (en) * | 1970-11-19 | 1972-08-15 | Patricia J Barbato | Recoating of electrodes |
-
0
- BE BE790369D patent/BE790369A/xx not_active IP Right Cessation
-
1971
- 1971-10-21 US US05/191,424 patent/US4025405A/en not_active Expired - Lifetime
-
1972
- 1972-10-20 CA CA154,357A patent/CA1036975A/en not_active Expired
- 1972-10-20 GB GB4843972A patent/GB1402920A/en not_active Expired
- 1972-10-20 IT IT53510/72A patent/IT966439B/it active
- 1972-10-20 BR BR7368/72A patent/BR7207368D0/pt unknown
- 1972-10-20 FI FI2919/72A patent/FI56704B/fi active
- 1972-10-20 DE DE19722251660 patent/DE2251660B2/de not_active Ceased
- 1972-10-20 FR FR7237206A patent/FR2156858B1/fr not_active Expired
- 1972-10-20 ZA ZA727499A patent/ZA727499B/xx unknown
- 1972-10-20 LU LU66331A patent/LU66331A1/xx unknown
- 1972-10-20 AR AR244735A patent/AR196207A1/es active
- 1972-10-20 NL NL7214265.A patent/NL161202B/xx not_active Application Discontinuation
- 1972-10-20 IL IL40630A patent/IL40630A/en unknown
- 1972-10-20 AT AT897772A patent/AT319277B/de active
- 1972-10-21 JP JP47105755A patent/JPS4861397A/ja active Pending
-
1974
- 1974-01-08 AU AU64279/74A patent/AU6427974A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ZA727499B (en) | 1973-12-19 |
| FR2156858A1 (cs) | 1973-06-01 |
| AT319277B (de) | 1974-12-10 |
| JPS4861397A (cs) | 1973-08-28 |
| GB1402920A (en) | 1975-08-13 |
| CA1036975A (en) | 1978-08-22 |
| FR2156858B1 (cs) | 1976-05-21 |
| BR7207368D0 (pt) | 1973-10-09 |
| DE2251660A1 (de) | 1973-04-26 |
| FI56704B (fi) | 1979-11-30 |
| LU66331A1 (cs) | 1973-10-30 |
| US4025405A (en) | 1977-05-24 |
| AU6427974A (en) | 1975-07-10 |
| DE2251660B2 (de) | 1976-09-02 |
| NL7214265A (cs) | 1973-04-25 |
| AR196207A1 (es) | 1973-12-10 |
| NL161202B (nl) | 1979-08-15 |
| IT966439B (it) | 1974-02-11 |
| BE790369A (fr) | 1973-04-20 |
| IL40630A0 (en) | 1972-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4025405A (en) | Electrolytic production of high purity alkali metal hydroxide | |
| US4192725A (en) | Electrolytic production of high purity alkali metal hydroxide | |
| US4224121A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US3976549A (en) | Electrolysis method | |
| US4100050A (en) | Coating metal anodes to decrease consumption rates | |
| US5084149A (en) | Electrolytic process for producing chlorine dioxide | |
| US5437771A (en) | Electrolytic cell and processes for producing alkali hydroxide and hydrogen peroxide | |
| US3899403A (en) | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes | |
| US4197179A (en) | Electrolyte series flow in electrolytic chlor-alkali cells | |
| US4221644A (en) | Air-depolarized chlor-alkali cell operation methods | |
| EP0591350A1 (en) | Apparatus and process for electrochemically decomposing salt solutions to form the relevant base and acid. | |
| US4297194A (en) | Electrolytic production of high purity alkali metal hydroxide | |
| US4248680A (en) | Electrolytic process and apparatus | |
| US4364815A (en) | Solid polymer electrolyte chlor-alkali process and electrolytic cell | |
| CA1073845A (en) | Electrolytic method for the manufacture of chlorates | |
| US4956061A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US4772364A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US3948737A (en) | Process for electrolysis of brine | |
| US4752369A (en) | Electrochemical cell with improved energy efficiency | |
| US4269675A (en) | Electrolyte series flow in electrolytic chlor-alkali cells | |
| US4448662A (en) | Solid polymer electrolyte chlor-alkali electrolytic cell | |
| US4528077A (en) | Membrane electrolytic cell for minimizing hypochlorite and chlorate formation | |
| US4127457A (en) | Method of reducing chlorate formation in a chlor-alkali electrolytic cell | |
| US4061550A (en) | Process for electrolysis | |
| EP0004191B1 (en) | Chloralkali electrolytic cell and method for operating same |